diff --git a/.devcontainer/Dockerfile b/.devcontainer/Dockerfile new file mode 100644 index 0000000..ff261ba --- /dev/null +++ b/.devcontainer/Dockerfile @@ -0,0 +1,9 @@ +ARG VARIANT="3.9" +FROM mcr.microsoft.com/vscode/devcontainers/python:0-${VARIANT} + +USER vscode + +RUN curl -sSf https://rye.astral.sh/get | RYE_VERSION="0.44.0" RYE_INSTALL_OPTION="--yes" bash +ENV PATH=/home/vscode/.rye/shims:$PATH + +RUN echo "[[ -d .venv ]] && source .venv/bin/activate || export PATH=\$PATH" >> /home/vscode/.bashrc diff --git a/.devcontainer/devcontainer.json b/.devcontainer/devcontainer.json new file mode 100644 index 0000000..c17fdc1 --- /dev/null +++ b/.devcontainer/devcontainer.json @@ -0,0 +1,43 @@ +// For format details, see https://aka.ms/devcontainer.json. For config options, see the +// README at: https://github.com/devcontainers/templates/tree/main/src/debian +{ + "name": "Debian", + "build": { + "dockerfile": "Dockerfile", + "context": ".." + }, + + "postStartCommand": "rye sync --all-features", + + "customizations": { + "vscode": { + "extensions": [ + "ms-python.python" + ], + "settings": { + "terminal.integrated.shell.linux": "/bin/bash", + "python.pythonPath": ".venv/bin/python", + "python.defaultInterpreterPath": ".venv/bin/python", + "python.typeChecking": "basic", + "terminal.integrated.env.linux": { + "PATH": "/home/vscode/.rye/shims:${env:PATH}" + } + } + } + }, + "features": { + "ghcr.io/devcontainers/features/node:1": {} + } + + // Features to add to the dev container. More info: https://containers.dev/features. + // "features": {}, + + // Use 'forwardPorts' to make a list of ports inside the container available locally. + // "forwardPorts": [], + + // Configure tool-specific properties. + // "customizations": {}, + + // Uncomment to connect as root instead. More info: https://aka.ms/dev-containers-non-root. + // "remoteUser": "root" +} diff --git a/.dockerignore b/.dockerignore deleted file mode 100755 index 6be1e24..0000000 --- a/.dockerignore +++ /dev/null @@ -1,38 +0,0 @@ -# Git -.git -.gitignore -.github - -# Docker -.dockerignore - -# IDE -.idea -.vscode - -# Byte-compiled / optimized / DLL files -__pycache__/ -**/__pycache__/ -*.pyc -*.pyo -*.pyd -.Python -*.py[cod] -*$py.class -.pytest_cache/ -..mypy_cache/ - -# poetry -.venv - -# C extensions -*.so - -# Virtual environment -.venv -venv - -.DS_Store -.AppleDouble -.LSOverride -._* diff --git a/.editorconfig b/.editorconfig deleted file mode 100755 index 7f578f1..0000000 --- a/.editorconfig +++ /dev/null @@ -1,24 +0,0 @@ -# Check http://editorconfig.org for more information -# This is the main config file for this project: -root = true - -[*] -charset = utf-8 -end_of_line = lf -insert_final_newline = true -indent_style = space -indent_size = 2 -trim_trailing_whitespace = true - -[*.{py, pyi}] -indent_style = space -indent_size = 4 - -[Makefile] -indent_style = tab - -[*.md] -trim_trailing_whitespace = false - -[*.{diff,patch}] -trim_trailing_whitespace = false diff --git a/.github/.stale.yml b/.github/.stale.yml deleted file mode 100755 index dc90e5a..0000000 --- a/.github/.stale.yml +++ /dev/null @@ -1,17 +0,0 @@ -# Number of days of inactivity before an issue becomes stale -daysUntilStale: 60 -# Number of days of inactivity before a stale issue is closed -daysUntilClose: 7 -# Issues with these labels will never be considered stale -exemptLabels: - - pinned - - security -# Label to use when marking an issue as stale -staleLabel: wontfix -# Comment to post when marking an issue as stale. Set to `false` to disable -markComment: > - This issue has been automatically marked as stale because it has not had - recent activity. It will be closed if no further activity occurs. Thank you - for your contributions. -# Comment to post when closing a stale issue. Set to `false` to disable -closeComment: false diff --git a/.github/ISSUE_TEMPLATE/api_bug_report.md b/.github/ISSUE_TEMPLATE/api_bug_report.md deleted file mode 100755 index d61e283..0000000 --- a/.github/ISSUE_TEMPLATE/api_bug_report.md +++ /dev/null @@ -1,29 +0,0 @@ ---- -name: πŸ”§ API Error report -about: If the api isn't working πŸ”§ -title: '' -labels: bug -assignees: ---- - -## πŸ”§ API Error Report - - - -## πŸ”¬ How To Reproduce (url used) - -What url dit you use: (remove your api key before posting it here) - - - -### Screenshots - - - -## πŸ“ˆ Expected behavior - - - -## πŸ“Ž Additional context - - diff --git a/.github/ISSUE_TEMPLATE/bug_report.md b/.github/ISSUE_TEMPLATE/bug_report.md deleted file mode 100755 index bdd7677..0000000 --- a/.github/ISSUE_TEMPLATE/bug_report.md +++ /dev/null @@ -1,42 +0,0 @@ ---- -name: πŸ› Bug report -about: If something isn't working πŸ”§ -title: '' -labels: bug -assignees: ---- - -## πŸ› Bug Report - - - -## πŸ”¬ How To Reproduce - -Steps to reproduce the behavior: - -1. ... - -### Code sample - - - -### Environment - -* OS: [e.g. Linux / Windows / macOS] -* Python version, get it with: - -```bash -python --version -``` - -### Screenshots - - - -## πŸ“ˆ Expected behavior - - - -## πŸ“Ž Additional context - - diff --git a/.github/ISSUE_TEMPLATE/config.yml b/.github/ISSUE_TEMPLATE/config.yml deleted file mode 100755 index 8f2da54..0000000 --- a/.github/ISSUE_TEMPLATE/config.yml +++ /dev/null @@ -1,3 +0,0 @@ -# Configuration: https://help.github.com/en/github/building-a-strong-community/configuring-issue-templates-for-your-repository - -blank_issues_enabled: false diff --git a/.github/ISSUE_TEMPLATE/feature_request.md b/.github/ISSUE_TEMPLATE/feature_request.md deleted file mode 100755 index c387120..0000000 --- a/.github/ISSUE_TEMPLATE/feature_request.md +++ /dev/null @@ -1,23 +0,0 @@ ---- -name: πŸš€ Feature request -about: Suggest an idea for this project πŸ– -title: '' -labels: enhancement -assignees: ---- - -## πŸš€ Feature Request - - - -## πŸ”ˆ Motivation - - - -## πŸ›° Alternatives - - - -## πŸ“Ž Additional context - - diff --git a/.github/ISSUE_TEMPLATE/question.md b/.github/ISSUE_TEMPLATE/question.md deleted file mode 100755 index 82373ce..0000000 --- a/.github/ISSUE_TEMPLATE/question.md +++ /dev/null @@ -1,25 +0,0 @@ ---- -name: ❓ Question -about: Ask a question about this project πŸŽ“ -title: '' -labels: question -assignees: ---- - -## Checklist - - - -- [ ] I've searched the project's [`issues`](https://github.com/silkepilon/youdotcom/issues?q=is%3Aissue). - -## ❓ Question - - - -How can I [...]? - -Is it possible to [...]? - -## πŸ“Ž Additional context - - diff --git a/.github/PULL_REQUEST_TEMPLATE.md b/.github/PULL_REQUEST_TEMPLATE.md deleted file mode 100755 index 064f982..0000000 --- a/.github/PULL_REQUEST_TEMPLATE.md +++ /dev/null @@ -1,28 +0,0 @@ -## Description - - - -## Related Issue - - - -## Type of Change - - - -- [ ] πŸ“š Examples / docs / tutorials / dependencies update -- [ ] πŸ”§ Bug fix (non-breaking change which fixes an issue) -- [ ] πŸ₯‚ Improvement (non-breaking change which improves an existing feature) -- [ ] πŸš€ New feature (non-breaking change which adds functionality) -- [ ] πŸ’₯ Breaking change (fix or feature that would cause existing functionality to change) -- [ ] πŸ” Security fix - -## Checklist - - - -- [ ] I've read the [`CODE_OF_CONDUCT.md`](https://github.com/silkepilon/youdotcom/blob/master/CODE_OF_CONDUCT.md) document. -- [ ] I've read the [`CONTRIBUTING.md`](https://github.com/silkepilon/youdotcom/blob/master/CONTRIBUTING.md) guide. -- [ ] I've updated the code style using `make codestyle`. -- [ ] I've written tests for all new methods and classes that I created. -- [ ] I've written the docstring in Google format for all the methods and classes that I used. diff --git a/.github/dependabot.yml b/.github/dependabot.yml deleted file mode 100755 index f6c346e..0000000 --- a/.github/dependabot.yml +++ /dev/null @@ -1,35 +0,0 @@ -# Configuration: https://dependabot.com/docs/config-file/ -# Docs: https://docs.github.com/en/github/administering-a-repository/keeping-your-dependencies-updated-automatically - -version: 2 - -updates: - - package-ecosystem: "pip" - directory: "/" - schedule: - interval: "daily" - allow: - - dependency-type: "all" - commit-message: - prefix: ":arrow_up:" - open-pull-requests-limit: 50 - - - package-ecosystem: "github-actions" - directory: "/" - schedule: - interval: "daily" - allow: - - dependency-type: "all" - commit-message: - prefix: ":arrow_up:" - open-pull-requests-limit: 50 - - - package-ecosystem: "docker" - directory: "/docker" - schedule: - interval: "weekly" - allow: - - dependency-type: "all" - commit-message: - prefix: ":arrow_up:" - open-pull-requests-limit: 50 diff --git a/.github/release-drafter.yml b/.github/release-drafter.yml deleted file mode 100755 index 0ce0984..0000000 --- a/.github/release-drafter.yml +++ /dev/null @@ -1,28 +0,0 @@ -# Release drafter configuration https://github.com/release-drafter/release-drafter#configuration -# Emojis were chosen to match the https://gitmoji.carloscuesta.me/ - -name-template: "v$NEXT_PATCH_VERSION" -tag-template: "v$NEXT_PATCH_VERSION" - -categories: - - title: ":rocket: Features" - labels: [enhancement, feature] - - title: ":wrench: Fixes & Refactoring" - labels: [bug, refactoring, bugfix, fix] - - title: ":package: Build System & CI/CD" - labels: [build, ci, testing] - - title: ":boom: Breaking Changes" - labels: [breaking] - - title: ":pencil: Documentation" - labels: [documentation] - - title: ":arrow_up: Dependencies updates" - labels: [dependencies] - -template: | - ## What’s Changed - - $CHANGES - - ## :busts_in_silhouette: List of contributors - - $CONTRIBUTORS diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml new file mode 100644 index 0000000..641a1a3 --- /dev/null +++ b/.github/workflows/ci.yml @@ -0,0 +1,96 @@ +name: CI +on: + push: + branches-ignore: + - 'generated' + - 'codegen/**' + - 'integrated/**' + - 'stl-preview-head/**' + - 'stl-preview-base/**' + pull_request: + branches-ignore: + - 'stl-preview-head/**' + - 'stl-preview-base/**' + +jobs: + lint: + timeout-minutes: 10 + name: lint + runs-on: ${{ github.repository == 'stainless-sdks/ydc-search-api-python' && 'depot-ubuntu-24.04' || 'ubuntu-latest' }} + if: github.event_name == 'push' || github.event.pull_request.head.repo.fork + steps: + - uses: actions/checkout@v4 + + - name: Install Rye + run: | + curl -sSf https://rye.astral.sh/get | bash + echo "$HOME/.rye/shims" >> $GITHUB_PATH + env: + RYE_VERSION: '0.44.0' + RYE_INSTALL_OPTION: '--yes' + + - name: Install dependencies + run: rye sync --all-features + + - name: Run lints + run: ./scripts/lint + + build: + if: github.repository == 'stainless-sdks/ydc-search-api-python' && (github.event_name == 'push' || github.event.pull_request.head.repo.fork) + timeout-minutes: 10 + name: build + permissions: + contents: read + id-token: write + runs-on: depot-ubuntu-24.04 + steps: + - uses: actions/checkout@v4 + + - name: Install Rye + run: | + curl -sSf https://rye.astral.sh/get | bash + echo "$HOME/.rye/shims" >> $GITHUB_PATH + env: + RYE_VERSION: '0.44.0' + RYE_INSTALL_OPTION: '--yes' + + - name: Install dependencies + run: rye sync --all-features + + - name: Run build + run: rye build + + - name: Get GitHub OIDC Token + id: github-oidc + uses: actions/github-script@v6 + with: + script: core.setOutput('github_token', await core.getIDToken()); + + - name: Upload tarball + env: + URL: https://pkg.stainless.com/s + AUTH: ${{ steps.github-oidc.outputs.github_token }} + SHA: ${{ github.sha }} + run: ./scripts/utils/upload-artifact.sh + + test: + timeout-minutes: 10 + name: test + runs-on: ${{ github.repository == 'stainless-sdks/ydc-search-api-python' && 'depot-ubuntu-24.04' || 'ubuntu-latest' }} + if: github.event_name == 'push' || github.event.pull_request.head.repo.fork + steps: + - uses: actions/checkout@v4 + + - name: Install Rye + run: | + curl -sSf https://rye.astral.sh/get | bash + echo "$HOME/.rye/shims" >> $GITHUB_PATH + env: + RYE_VERSION: '0.44.0' + RYE_INSTALL_OPTION: '--yes' + + - name: Bootstrap + run: ./scripts/bootstrap + + - name: Run tests + run: ./scripts/test diff --git a/.github/workflows/codacy.yml b/.github/workflows/codacy.yml deleted file mode 100644 index f450d32..0000000 --- a/.github/workflows/codacy.yml +++ /dev/null @@ -1,61 +0,0 @@ -# This workflow uses actions that are not certified by GitHub. -# They are provided by a third-party and are governed by -# separate terms of service, privacy policy, and support -# documentation. - -# This workflow checks out code, performs a Codacy security scan -# and integrates the results with the -# GitHub Advanced Security code scanning feature. For more information on -# the Codacy security scan action usage and parameters, see -# https://github.com/codacy/codacy-analysis-cli-action. -# For more information on Codacy Analysis CLI in general, see -# https://github.com/codacy/codacy-analysis-cli. - -name: Codacy Security Scan - -on: - push: - branches: [ "main" ] - pull_request: - # The branches below must be a subset of the branches above - branches: [ "main" ] - schedule: - - cron: '27 12 * * 5' - -permissions: - contents: read - -jobs: - codacy-security-scan: - permissions: - contents: read # for actions/checkout to fetch code - security-events: write # for github/codeql-action/upload-sarif to upload SARIF results - actions: read # only required for a private repository by github/codeql-action/upload-sarif to get the Action run status - name: Codacy Security Scan - runs-on: ubuntu-latest - steps: - # Checkout the repository to the GitHub Actions runner - - name: Checkout code - uses: actions/checkout@v3 - - # Execute Codacy Analysis CLI and generate a SARIF output with the security issues identified during the analysis - - name: Run Codacy Analysis CLI - uses: codacy/codacy-analysis-cli-action@5cc54a75f9ad88159bb54046196d920e40e367a5 - with: - # Check https://github.com/codacy/codacy-analysis-cli#project-token to get your project token from your Codacy repository - # You can also omit the token and run the tools that support default configurations - project-token: ${{ secrets.CODACY_PROJECT_TOKEN }} - verbose: true - output: results.sarif - format: sarif - # Adjust severity of non-security issues - gh-code-scanning-compat: true - # Force 0 exit code to allow SARIF file generation - # This will handover control about PR rejection to the GitHub side - max-allowed-issues: 2147483647 - - # Upload the SARIF file generated in the previous step - - name: Upload SARIF results file - uses: github/codeql-action/upload-sarif@v2 - with: - sarif_file: results.sarif diff --git a/.github/workflows/greetings.yml b/.github/workflows/greetings.yml deleted file mode 100755 index 77c70eb..0000000 --- a/.github/workflows/greetings.yml +++ /dev/null @@ -1,26 +0,0 @@ -name: Greetings - -on: [pull_request, issues] - -jobs: - greeting: - runs-on: ubuntu-latest - steps: - - uses: actions/first-interaction@v1 - with: - repo-token: ${{ secrets.GITHUB_TOKEN }} - pr-message: 'Hello @${{ github.actor }}, thank you for submitting a PR! We will respond as soon as possible.' - issue-message: | - Hello @${{ github.actor }}, thank you for your interest in youdotcom/betterapi. - - If this is a bug/issue with the api (betterapi.net) note that this is still in beta. - - Please note that repository is made and maintained by a single developer, @SilkePilon. - - - Thank you for submitting a issue! @SilkePilon will respond as soon as possible. - - - - - diff --git a/.github/workflows/publish-pypi.yml b/.github/workflows/publish-pypi.yml new file mode 100644 index 0000000..ca7a014 --- /dev/null +++ b/.github/workflows/publish-pypi.yml @@ -0,0 +1,31 @@ +# This workflow is triggered when a GitHub release is created. +# It can also be run manually to re-publish to PyPI in case it failed for some reason. +# You can run this workflow by navigating to https://www.github.com/You-OpenSource/You-Python/actions/workflows/publish-pypi.yml +name: Publish PyPI +on: + workflow_dispatch: + + release: + types: [published] + +jobs: + publish: + name: publish + runs-on: ubuntu-latest + + steps: + - uses: actions/checkout@v4 + + - name: Install Rye + run: | + curl -sSf https://rye.astral.sh/get | bash + echo "$HOME/.rye/shims" >> $GITHUB_PATH + env: + RYE_VERSION: '0.44.0' + RYE_INSTALL_OPTION: '--yes' + + - name: Publish to PyPI + run: | + bash ./bin/publish-pypi + env: + PYPI_TOKEN: ${{ secrets.YDC_SEARCH_API_PYPI_TOKEN || secrets.PYPI_TOKEN }} diff --git a/.github/workflows/release-doctor.yml b/.github/workflows/release-doctor.yml new file mode 100644 index 0000000..734ad7b --- /dev/null +++ b/.github/workflows/release-doctor.yml @@ -0,0 +1,21 @@ +name: Release Doctor +on: + pull_request: + branches: + - main + workflow_dispatch: + +jobs: + release_doctor: + name: release doctor + runs-on: ubuntu-latest + if: github.repository == 'You-OpenSource/You-Python' && (github.event_name == 'push' || github.event_name == 'workflow_dispatch' || startsWith(github.head_ref, 'release-please') || github.head_ref == 'next') + + steps: + - uses: actions/checkout@v4 + + - name: Check release environment + run: | + bash ./bin/check-release-environment + env: + PYPI_TOKEN: ${{ secrets.YDC_SEARCH_API_PYPI_TOKEN || secrets.PYPI_TOKEN }} diff --git a/.github/workflows/release-drafter.yml b/.github/workflows/release-drafter.yml deleted file mode 100644 index 58efdb9..0000000 --- a/.github/workflows/release-drafter.yml +++ /dev/null @@ -1,16 +0,0 @@ -name: Release Drafter - -on: - push: - # branches to consider in the event; optional, defaults to all - branches: - - master - -jobs: - update_release_draft: - runs-on: ubuntu-latest - steps: - # Drafts your next Release notes as Pull Requests are merged into "master" - - uses: release-drafter/release-drafter@v5.23.0 - env: - GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }} diff --git a/.github/workflows/static.yml b/.github/workflows/static.yml deleted file mode 100755 index c790867..0000000 --- a/.github/workflows/static.yml +++ /dev/null @@ -1,42 +0,0 @@ -# Simple workflow for deploying static content to GitHub Pages -name: Deploy static content to Pages - -on: - # Runs on pushes targeting the default branch - push: - branches: ["main"] - - # Allows you to run this workflow manually from the Actions tab - workflow_dispatch: - -# Sets permissions of the GITHUB_TOKEN to allow deployment to GitHub Pages -permissions: - contents: read - pages: write - id-token: write - -# Allow one concurrent deployment -concurrency: - group: "pages" - cancel-in-progress: true - -jobs: - # Single deploy job since we're just deploying - deploy: - environment: - name: github-pages - url: ${{ steps.deployment.outputs.page_url }} - runs-on: ubuntu-latest - steps: - - name: Checkout - uses: actions/checkout@v3 - - name: Setup Pages - uses: actions/configure-pages@v3 - - name: Upload artifact - uses: actions/upload-pages-artifact@v1 - with: - # Upload entire repository - path: '.' - - name: Deploy to GitHub Pages - id: deployment - uses: actions/deploy-pages@v1 diff --git a/.gitignore b/.gitignore old mode 100755 new mode 100644 index 53c1b0d..8779740 --- a/.gitignore +++ b/.gitignore @@ -1,621 +1,16 @@ +.prism.log +.vscode +_dev -# Created by https://www.gitignore.io/api/osx,python,pycharm,windows,visualstudio,visualstudiocode -# Edit at https://www.gitignore.io/?templates=osx,python,pycharm,windows,visualstudio,visualstudiocode +__pycache__ +.mypy_cache -### OSX ### -# General -.DS_Store -.AppleDouble -.LSOverride +dist -# Icon must end with two \r -Icon - -# Thumbnails -._* - -# Files that might appear in the root of a volume -.DocumentRevisions-V100 -.fseventsd -.Spotlight-V100 -.TemporaryItems -.Trashes -.VolumeIcon.icns -.com.apple.timemachine.donotpresent - -# Directories potentially created on remote AFP share -.AppleDB -.AppleDesktop -Network Trash Folder -Temporary Items -.apdisk - -### PyCharm ### -# Covers JetBrains IDEs: IntelliJ, RubyMine, PhpStorm, AppCode, PyCharm, CLion, Android Studio and WebStorm -# Reference: https://intellij-support.jetbrains.com/hc/en-us/articles/206544839 - -# User-specific stuff -.idea/**/workspace.xml -.idea/**/tasks.xml -.idea/**/usage.statistics.xml -.idea/**/dictionaries -.idea/**/shelf - -# Generated files -.idea/**/contentModel.xml - -# Sensitive or high-churn files -.idea/**/dataSources/ -.idea/**/dataSources.ids -.idea/**/dataSources.local.xml -.idea/**/sqlDataSources.xml -.idea/**/dynamic.xml -.idea/**/uiDesigner.xml -.idea/**/dbnavigator.xml - -# Gradle -.idea/**/gradle.xml -.idea/**/libraries - -# Gradle and Maven with auto-import -# When using Gradle or Maven with auto-import, you should exclude module files, -# since they will be recreated, and may cause churn. Uncomment if using -# auto-import. -# .idea/modules.xml -# .idea/*.iml -# .idea/modules -# *.iml -# *.ipr - -# CMake -cmake-build-*/ - -# Mongo Explorer plugin -.idea/**/mongoSettings.xml - -# File-based project format -*.iws - -# IntelliJ -out/ - -# mpeltonen/sbt-idea plugin -.idea_modules/ - -# JIRA plugin -atlassian-ide-plugin.xml - -# Cursive Clojure plugin -.idea/replstate.xml - -# Crashlytics plugin (for Android Studio and IntelliJ) -com_crashlytics_export_strings.xml -crashlytics.properties -crashlytics-build.properties -fabric.properties - -# Editor-based Rest Client -.idea/httpRequests - -# Android studio 3.1+ serialized cache file -.idea/caches/build_file_checksums.ser - -### PyCharm Patch ### -# Comment Reason: https://github.com/joeblau/gitignore.io/issues/186#issuecomment-215987721 - -# *.iml -# modules.xml -# .idea/misc.xml -# *.ipr - -# Sonarlint plugin -.idea/**/sonarlint/ - -# SonarQube Plugin -.idea/**/sonarIssues.xml - -# Markdown Navigator plugin -.idea/**/markdown-navigator.xml -.idea/**/markdown-navigator/ - -### Python ### -# Byte-compiled / optimized / DLL files -__pycache__/ -*.py[cod] -*$py.class - -# C extensions -*.so - -# Distribution / packaging -.Python -build/ -develop-eggs/ -dist/ -downloads/ -eggs/ -.eggs/ -lib/ -lib64/ -parts/ -sdist/ -var/ -wheels/ -pip-wheel-metadata/ -share/python-wheels/ -*.egg-info/ -.installed.cfg -*.egg -MANIFEST - -# PyInstaller -# Usually these files are written by a python script from a template -# before PyInstaller builds the exe, so as to inject date/other infos into it. -*.manifest -*.spec - -# Installer logs -pip-log.txt -pip-delete-this-directory.txt - -# Unit test / coverage reports -htmlcov/ -.tox/ -.nox/ -.coverage -.coverage.* -.cache -nosetests.xml -coverage.xml -*.cover -.hypothesis/ -.pytest_cache/ - -# Translations -*.mo -*.pot - -# Scrapy stuff: -.scrapy - -# Sphinx documentation -docs/_build/ - -# PyBuilder -target/ - -# pyenv -.python-version - -# poetry .venv +.idea -# pipenv -# According to pypa/pipenv#598, it is recommended to include Pipfile.lock in version control. -# However, in case of collaboration, if having platform-specific dependencies or dependencies -# having no cross-platform support, pipenv may install dependencies that don't work, or not -# install all needed dependencies. -#Pipfile.lock - -# celery beat schedule file -celerybeat-schedule - -# SageMath parsed files -*.sage.py - -# Spyder project settings -.spyderproject -.spyproject - -# Rope project settings -.ropeproject - -# Mr Developer -.mr.developer.cfg -.project -.pydevproject - -# mkdocs documentation -/site - -# mypy -.mypy_cache/ -.dmypy.json -dmypy.json - -# Pyre type checker -.pyre/ - -# Plugins -.secrets.baseline - -### VisualStudioCode ### -.vscode/* -!.vscode/tasks.json -!.vscode/launch.json -!.vscode/extensions.json - -### VisualStudioCode Patch ### -# Ignore all local history of files -.history - -### Windows ### -# Windows thumbnail cache files -Thumbs.db -Thumbs.db:encryptable -ehthumbs.db -ehthumbs_vista.db - -# Dump file -*.stackdump - -# Folder config file -[Dd]esktop.ini - -# Recycle Bin used on file shares -$RECYCLE.BIN/ - -# Windows Installer files -*.cab -*.msi -*.msix -*.msm -*.msp - -# Windows shortcuts -*.lnk - -### VisualStudio ### -## Ignore Visual Studio temporary files, build results, and -## files generated by popular Visual Studio add-ons. -## -## Get latest from https://github.com/github/gitignore/blob/master/VisualStudio.gitignore - -# User-specific files -*.rsuser -*.suo -*.user -*.userosscache -*.sln.docstates - -# User-specific files (MonoDevelop/Xamarin Studio) -*.userprefs - -# Mono auto generated files -mono_crash.* - -# Build results -[Dd]ebug/ -[Dd]ebugPublic/ -[Rr]elease/ -[Rr]eleases/ -x64/ -x86/ -[Aa][Rr][Mm]/ -[Aa][Rr][Mm]64/ -bld/ -[Bb]in/ -[Oo]bj/ -[Ll]og/ - -# Visual Studio 2015/2017 cache/options directory -.vs/ -# Uncomment if you have tasks that create the project's static files in wwwroot -#wwwroot/ - -# Visual Studio 2017 auto generated files -Generated\ Files/ - -# MSTest test Results -[Tt]est[Rr]esult*/ -[Bb]uild[Ll]og.* - -# NUnit -*.VisualState.xml -TestResult.xml -nunit-*.xml - -# Build Results of an ATL Project -[Dd]ebugPS/ -[Rr]eleasePS/ -dlldata.c - -# Benchmark Results -BenchmarkDotNet.Artifacts/ - -# .NET Core -project.lock.json -project.fragment.lock.json -artifacts/ - -# StyleCop -StyleCopReport.xml - -# Files built by Visual Studio -*_i.c -*_p.c -*_h.h -*.ilk -*.obj -*.iobj -*.pch -*.pdb -*.ipdb -*.pgc -*.pgd -*.rsp -*.sbr -*.tlb -*.tli -*.tlh -*.tmp -*.tmp_proj -*_wpftmp.csproj -*.log -*.vspscc -*.vssscc -.builds -*.pidb -*.svclog -*.scc - -# Chutzpah Test files -_Chutzpah* - -# Visual C++ cache files -ipch/ -*.aps -*.ncb -*.opendb -*.opensdf -*.sdf -*.cachefile -*.VC.db -*.VC.VC.opendb - -# Visual Studio profiler -*.psess -*.vsp -*.vspx -*.sap - -# Visual Studio Trace Files -*.e2e - -# TFS 2012 Local Workspace -$tf/ - -# Guidance Automation Toolkit -*.gpState - -# ReSharper is a .NET coding add-in -_ReSharper*/ -*.[Rr]e[Ss]harper -*.DotSettings.user - -# JustCode is a .NET coding add-in -.JustCode - -# TeamCity is a build add-in -_TeamCity* - -# DotCover is a Code Coverage Tool -*.dotCover - -# AxoCover is a Code Coverage Tool -.axoCover/* -!.axoCover/settings.json - -# Visual Studio code coverage results -*.coverage -*.coveragexml - -# NCrunch -_NCrunch_* -.*crunch*.local.xml -nCrunchTemp_* - -# MightyMoose -*.mm.* -AutoTest.Net/ - -# Web workbench (sass) -.sass-cache/ - -# Installshield output folder -[Ee]xpress/ - -# DocProject is a documentation generator add-in -DocProject/buildhelp/ -DocProject/Help/*.HxT -DocProject/Help/*.HxC -DocProject/Help/*.hhc -DocProject/Help/*.hhk -DocProject/Help/*.hhp -DocProject/Help/Html2 -DocProject/Help/html - -# Click-Once directory -publish/ - -# Publish Web Output -*.[Pp]ublish.xml -*.azurePubxml -# Note: Comment the next line if you want to checkin your web deploy settings, -# but database connection strings (with potential passwords) will be unencrypted -*.pubxml -*.publishproj - -# Microsoft Azure Web App publish settings. Comment the next line if you want to -# checkin your Azure Web App publish settings, but sensitive information contained -# in these scripts will be unencrypted -PublishScripts/ - -# NuGet Packages -*.nupkg -# NuGet Symbol Packages -*.snupkg -# The packages folder can be ignored because of Package Restore -**/[Pp]ackages/* -# except build/, which is used as an MSBuild target. -!**/[Pp]ackages/build/ -# Uncomment if necessary however generally it will be regenerated when needed -#!**/[Pp]ackages/repositories.config -# NuGet v3's project.json files produces more ignorable files -*.nuget.props -*.nuget.targets - -# Microsoft Azure Build Output -csx/ -*.build.csdef - -# Microsoft Azure Emulator -ecf/ -rcf/ - -# Windows Store app package directories and files -AppPackages/ -BundleArtifacts/ -Package.StoreAssociation.xml -_pkginfo.txt -*.appx -*.appxbundle -*.appxupload - -# Visual Studio cache files -# files ending in .cache can be ignored -*.[Cc]ache -# but keep track of directories ending in .cache -!?*.[Cc]ache/ - -# Others -ClientBin/ -~$* -*~ -*.dbmdl -*.dbproj.schemaview -*.jfm -*.pfx -*.publishsettings -orleans.codegen.cs - -# Including strong name files can present a security risk -# (https://github.com/github/gitignore/pull/2483#issue-259490424) -#*.snk - -# Since there are multiple workflows, uncomment next line to ignore bower_components -# (https://github.com/github/gitignore/pull/1529#issuecomment-104372622) -#bower_components/ - -# RIA/Silverlight projects -Generated_Code/ - -# Backup & report files from converting an old project file -# to a newer Visual Studio version. Backup files are not needed, -# because we have git ;-) -_UpgradeReport_Files/ -Backup*/ -UpgradeLog*.XML -UpgradeLog*.htm -ServiceFabricBackup/ -*.rptproj.bak - -# SQL Server files -*.mdf -*.ldf -*.ndf - -# Business Intelligence projects -*.rdl.data -*.bim.layout -*.bim_*.settings -*.rptproj.rsuser -*- [Bb]ackup.rdl -*- [Bb]ackup ([0-9]).rdl -*- [Bb]ackup ([0-9][0-9]).rdl - -# Microsoft Fakes -FakesAssemblies/ - -# GhostDoc plugin setting file -*.GhostDoc.xml - -# Node.js Tools for Visual Studio -.ntvs_analysis.dat -node_modules/ - -# Visual Studio 6 build log -*.plg - -# Visual Studio 6 workspace options file -*.opt - -# Visual Studio 6 auto-generated workspace file (contains which files were open etc.) -*.vbw - -# Visual Studio LightSwitch build output -**/*.HTMLClient/GeneratedArtifacts -**/*.DesktopClient/GeneratedArtifacts -**/*.DesktopClient/ModelManifest.xml -**/*.Server/GeneratedArtifacts -**/*.Server/ModelManifest.xml -_Pvt_Extensions - -# Paket dependency manager -.paket/paket.exe -paket-files/ - -# FAKE - F# Make -.fake/ - -# CodeRush personal settings -.cr/personal - -# Python Tools for Visual Studio (PTVS) -*.pyc - -# Cake - Uncomment if you are using it -# tools/** -# !tools/packages.config - -# Tabs Studio -*.tss - -# Telerik's JustMock configuration file -*.jmconfig - -# BizTalk build output -*.btp.cs -*.btm.cs -*.odx.cs -*.xsd.cs - -# OpenCover UI analysis results -OpenCover/ - -# Azure Stream Analytics local run output -ASALocalRun/ - -# MSBuild Binary and Structured Log -*.binlog - -# NVidia Nsight GPU debugger configuration file -*.nvuser - -# MFractors (Xamarin productivity tool) working folder -.mfractor/ - -# Local History for Visual Studio -.localhistory/ - -# BeatPulse healthcheck temp database -healthchecksdb - -# Backup folder for Package Reference Convert tool in Visual Studio 2017 -MigrationBackup/ - -# End of https://www.gitignore.io/api/osx,python,pycharm,windows,visualstudio,visualstudiocode - -poetry-convert.py -Makefile -Makefile +.env +.envrc +codegen.log +Brewfile.lock.json diff --git a/.pre-commit-config.yaml b/.pre-commit-config.yaml deleted file mode 100755 index 4583df9..0000000 --- a/.pre-commit-config.yaml +++ /dev/null @@ -1,33 +0,0 @@ -default_language_version: - python: python3.10 - -default_stages: [commit, push] - -repos: - - repo: https://github.com/pre-commit/pre-commit-hooks - rev: v2.5.0 - hooks: - - id: check-yaml - - id: end-of-file-fixer - exclude: LICENSE - - - repo: local - hooks: - - id: pyupgrade - name: pyupgrade - entry: poetry run pyupgrade --py39-plus - types: [python] - language: system - - - repo: local - hooks: - - id: isort - name: isort - entry: poetry run isort --settings-path pyproject.toml - types: [python] - language: system - - - repo: https://github.com/psf/black - rev: 22.3.0 - hooks: - - id: black diff --git a/.python-version b/.python-version new file mode 100644 index 0000000..43077b2 --- /dev/null +++ b/.python-version @@ -0,0 +1 @@ +3.9.18 diff --git a/.release-please-manifest.json b/.release-please-manifest.json new file mode 100644 index 0000000..4191c88 --- /dev/null +++ b/.release-please-manifest.json @@ -0,0 +1,3 @@ +{ + ".": "3.0.0" +} \ No newline at end of file diff --git a/.stats.yml b/.stats.yml new file mode 100644 index 0000000..7fb7266 --- /dev/null +++ b/.stats.yml @@ -0,0 +1,4 @@ +configured_endpoints: 2 +openapi_spec_url: https://storage.googleapis.com/stainless-sdk-openapi-specs/you-com%2Fydc-search-api-04f2345110c3136d65a032316e9a5fb987d70d08b1b65f970d5f13860638b106.yml +openapi_spec_hash: f07d2ad7cbe69d51209ae44cea47d1d5 +config_hash: f197aa261ecbb9eaafb0871a9a3e1ce6 diff --git a/Brewfile b/Brewfile new file mode 100644 index 0000000..492ca37 --- /dev/null +++ b/Brewfile @@ -0,0 +1,2 @@ +brew "rye" + diff --git a/CHANGELOG.md b/CHANGELOG.md new file mode 100644 index 0000000..4ee9dec --- /dev/null +++ b/CHANGELOG.md @@ -0,0 +1,45 @@ +# Changelog + +## 3.0.0 (2025-07-02) + +Full Changelog: [v2.0.23...v3.0.0](https://github.com/You-OpenSource/You-Python/compare/v2.0.23...v3.0.0) + +### Features + +* **client:** add follow_redirects request option ([4d47f85](https://github.com/You-OpenSource/You-Python/commit/4d47f85104c202e1bad03dd30281050229422b06)) +* **client:** add support for aiohttp ([738eb2c](https://github.com/You-OpenSource/You-Python/commit/738eb2cbbe3b23d9edba12bdf30b6676846a78c4)) + + +### Bug Fixes + +* **ci:** correct conditional ([1518838](https://github.com/You-OpenSource/You-Python/commit/15188387b92789a7661461c4ad35d46de320585d)) +* **ci:** release-doctor β€” report correct token name ([2b98307](https://github.com/You-OpenSource/You-Python/commit/2b9830704adddde1ac0c9c80187b8ac32a274604)) +* **client:** correctly parse binary response | stream ([f4810f4](https://github.com/You-OpenSource/You-Python/commit/f4810f4a8e67fc9615de27e4b7475be792de39d6)) +* **package:** support direct resource imports ([edf7871](https://github.com/You-OpenSource/You-Python/commit/edf7871f8c6ca8c5baca3c0c7fb15ede1cf3a9c2)) +* **tests:** fix: tests which call HTTP endpoints directly with the example parameters ([38b773a](https://github.com/You-OpenSource/You-Python/commit/38b773a19fec344ffe8ab04cb4449f7ed23778c5)) + + +### Chores + +* **ci:** change upload type ([50c1dc3](https://github.com/You-OpenSource/You-Python/commit/50c1dc338477ec1fe7fadb20fbfc438cd3bb832a)) +* **ci:** enable for pull requests ([863412b](https://github.com/You-OpenSource/You-Python/commit/863412bfe9721714709c1109ab9bf3d608b3e81c)) +* **ci:** fix installation instructions ([9b2771b](https://github.com/You-OpenSource/You-Python/commit/9b2771b802a0dc854c4ff8099e8798207bff9cba)) +* **ci:** only run for pushes and fork pull requests ([2b4c478](https://github.com/You-OpenSource/You-Python/commit/2b4c478dbed04dc9a688ab2c93f621c469af4ba9)) +* **ci:** upload sdks to package manager ([5953bf4](https://github.com/You-OpenSource/You-Python/commit/5953bf406ad005f2fa3fd461e3a58deaefd1b4d5)) +* **docs:** grammar improvements ([836d4ea](https://github.com/You-OpenSource/You-Python/commit/836d4ea5ae3515d5dc2c8e102467898f93352cc3)) +* **docs:** remove reference to rye shell ([187ecc9](https://github.com/You-OpenSource/You-Python/commit/187ecc9d46568cbb61f2b69787def39b99a2358e)) +* **internal:** avoid errors for isinstance checks on proxies ([0c64f6a](https://github.com/You-OpenSource/You-Python/commit/0c64f6a96edfb86e6376bdd138cea718dd5a2973)) +* **internal:** codegen related update ([92331b9](https://github.com/You-OpenSource/You-Python/commit/92331b90677275ea5ceff33ef0c0abf9c50a26cc)) +* **internal:** update conftest.py ([6e97402](https://github.com/You-OpenSource/You-Python/commit/6e97402b06e5e02525a69f3790afbd858e8a66e4)) +* **readme:** update badges ([6339cd8](https://github.com/You-OpenSource/You-Python/commit/6339cd82af07b54a79c1fac3c2a44fa94a1151c5)) +* sync repo ([dc912e6](https://github.com/You-OpenSource/You-Python/commit/dc912e683c739f424a119bbeaba858d65778909d)) +* **tests:** add tests for httpx client instantiation & proxies ([8aabce1](https://github.com/You-OpenSource/You-Python/commit/8aabce14a7bd4f86937702b665b9f379eb64aae8)) +* **tests:** run tests in parallel ([0b3bd99](https://github.com/You-OpenSource/You-Python/commit/0b3bd99aedb66a79b23fbdb0975e5be673891ea9)) +* **tests:** skip some failing tests on the latest python versions ([7fc905e](https://github.com/You-OpenSource/You-Python/commit/7fc905e0047a3dc1faf83000c9010d95af283cd3)) +* update SDK settings ([323499b](https://github.com/You-OpenSource/You-Python/commit/323499ba910ff1f183d1df60c06576c77e532e82)) +* update SDK settings ([bd65b0f](https://github.com/You-OpenSource/You-Python/commit/bd65b0fb9d38b89ace7fbeb78da6ca90c9f490a9)) + + +### Documentation + +* **client:** fix httpx.Timeout documentation reference ([e7d0d02](https://github.com/You-OpenSource/You-Python/commit/e7d0d027dafec38d34df6847cced50d283de7214)) diff --git a/CODE_OF_CONDUCT.md b/CODE_OF_CONDUCT.md deleted file mode 100755 index a6362a4..0000000 --- a/CODE_OF_CONDUCT.md +++ /dev/null @@ -1,76 +0,0 @@ -# Contributor Covenant Code of Conduct - -## Our Pledge - -In the interest of fostering an open and welcoming environment, we as -contributors and maintainers pledge to making participation in our project and -our community a harassment-free experience for everyone, regardless of age, body -size, disability, ethnicity, sex characteristics, gender identity and expression, -level of experience, education, socio-economic status, nationality, personal -appearance, race, religion, or sexual identity and orientation. - -## Our Standards - -Examples of behavior that contributes to creating a positive environment -include: - -* Using welcoming and inclusive language -* Being respectful of differing viewpoints and experiences -* Gracefully accepting constructive criticism -* Focusing on what is best for the community -* Showing empathy towards other community members - -Examples of unacceptable behavior by participants include: - -* The use of sexualized language or imagery and unwelcome sexual attention or - advances -* Trolling, insulting/derogatory comments, and personal or political attacks -* Public or private harassment -* Publishing others' private information, such as a physical or electronic - address, without explicit permission -* Other conduct which could reasonably be considered inappropriate in a - professional setting - -## Our Responsibilities - -Project maintainers are responsible for clarifying the standards of acceptable -behavior and are expected to take appropriate and fair corrective action in -response to any instances of unacceptable behavior. - -Project maintainers have the right and responsibility to remove, edit, or -reject comments, commits, code, wiki edits, issues, and other contributions -that are not aligned to this Code of Conduct, or to ban temporarily or -permanently any contributor for other behaviors that they deem inappropriate, -threatening, offensive, or harmful. - -## Scope - -This Code of Conduct applies both within project spaces and in public spaces -when an individual is representing the project or its community. Examples of -representing a project or community include using an official project e-mail -address, posting via an official social media account, or acting as an appointed -representative at an online or offline event. Representation of a project may be -further defined and clarified by project maintainers. - -## Enforcement - -Instances of abusive, harassing, or otherwise unacceptable behavior may be -reported by contacting the project team at silkepilon2009@gmail.com. All -complaints will be reviewed and investigated and will result in a response that -is deemed necessary and appropriate to the circumstances. The project team is -obligated to maintain confidentiality with regard to the reporter of an incident. -Further details of specific enforcement policies may be posted separately. - -Project maintainers who do not follow or enforce the Code of Conduct in good -faith may face temporary or permanent repercussions as determined by other -members of the project's leadership. - -## Attribution - -This Code of Conduct is adapted from the [Contributor Covenant][homepage], version 1.4, -available at https://www.contributor-covenant.org/version/1/4/code-of-conduct.html - -[homepage]: https://www.contributor-covenant.org - -For answers to common questions about this code of conduct, see -https://www.contributor-covenant.org/faq diff --git a/CONTRIBUTING.md b/CONTRIBUTING.md old mode 100755 new mode 100644 index 16e880e..2292a56 --- a/CONTRIBUTING.md +++ b/CONTRIBUTING.md @@ -1,47 +1,128 @@ -# How to contribute +## Setting up the environment -## Dependencies +### With Rye -We use `poetry` to manage the [dependencies](https://github.com/python-poetry/poetry). -If you dont have `poetry`, you should install with `make poetry-download`. +We use [Rye](https://rye.astral.sh/) to manage dependencies because it will automatically provision a Python environment with the expected Python version. To set it up, run: -To install dependencies and prepare [`pre-commit`](https://pre-commit.com/) hooks you would need to run `install` command: +```sh +$ ./scripts/bootstrap +``` + +Or [install Rye manually](https://rye.astral.sh/guide/installation/) and run: + +```sh +$ rye sync --all-features +``` + +You can then run scripts using `rye run python script.py` or by activating the virtual environment: + +```sh +# Activate the virtual environment - https://docs.python.org/3/library/venv.html#how-venvs-work +$ source .venv/bin/activate + +# now you can omit the `rye run` prefix +$ python script.py +``` + +### Without Rye + +Alternatively if you don't want to install `Rye`, you can stick with the standard `pip` setup by ensuring you have the Python version specified in `.python-version`, create a virtual environment however you desire and then install dependencies using this command: -```bash -make install -make pre-commit-install +```sh +$ pip install -r requirements-dev.lock ``` -To activate your `virtualenv` run `poetry shell`. +## Modifying/Adding code -## Codestyle +Most of the SDK is generated code. Modifications to code will be persisted between generations, but may +result in merge conflicts between manual patches and changes from the generator. The generator will never +modify the contents of the `src/ydc_search_api/lib/` and `examples/` directories. -After installation you may execute code formatting. +## Adding and running examples -```bash -make codestyle +All files in the `examples/` directory are not modified by the generator and can be freely edited or added to. + +```py +# add an example to examples/.py + +#!/usr/bin/env -S rye run python +… +``` + +```sh +$ chmod +x examples/.py +# run the example against your api +$ ./examples/.py +``` + +## Using the repository from source + +If you’d like to use the repository from source, you can either install from git or link to a cloned repository: + +To install via git: + +```sh +$ pip install git+ssh://git@github.com/You-OpenSource/You-Python.git ``` -### Checks +Alternatively, you can build from source and install the wheel file: + +Building this package will create two files in the `dist/` directory, a `.tar.gz` containing the source files and a `.whl` that can be used to install the package efficiently. -Many checks are configured for this project. Command `make check-codestyle` will check black, isort and darglint. -The `make check-safety` command will look at the security of your code. +To create a distributable version of the library, all you have to do is run this command: + +```sh +$ rye build +# or +$ python -m build +``` + +Then to install: + +```sh +$ pip install ./path-to-wheel-file.whl +``` + +## Running tests + +Most tests require you to [set up a mock server](https://github.com/stoplightio/prism) against the OpenAPI spec to run the tests. + +```sh +# you will need npm installed +$ npx prism mock path/to/your/openapi.yml +``` + +```sh +$ ./scripts/test +``` + +## Linting and formatting + +This repository uses [ruff](https://github.com/astral-sh/ruff) and +[black](https://github.com/psf/black) to format the code in the repository. + +To lint: + +```sh +$ ./scripts/lint +``` + +To format and fix all ruff issues automatically: + +```sh +$ ./scripts/format +``` -Comand `make lint` applies all checks. +## Publishing and releases -### Before submitting +Changes made to this repository via the automated release PR pipeline should publish to PyPI automatically. If +the changes aren't made through the automated pipeline, you may want to make releases manually. -Before submitting your code please do the following steps: +### Publish with a GitHub workflow -1. Add any changes you want -1. Add tests for the new changes -1. Edit documentation if you have changed something significant -1. Run `make codestyle` to format your changes. -1. Run `make lint` to ensure that types, security and docstrings are okay. +You can release to package managers by using [the `Publish PyPI` GitHub action](https://www.github.com/You-OpenSource/You-Python/actions/workflows/publish-pypi.yml). This requires a setup organization or repository secret to be set up. -## Other help +### Publish manually -You can contribute by spreading a word about this library. -It would also be a huge contribution to write -a short article on how you are using this project. -You can also share your best practices with us. +If you need to manually release a package, you can run the `bin/publish-pypi` script with a `PYPI_TOKEN` set on +the environment. diff --git a/LICENSE b/LICENSE old mode 100755 new mode 100644 index 0d85078..c29940e --- a/LICENSE +++ b/LICENSE @@ -1,20 +1,201 @@ -The MIT License (MIT) -Copyright (c) 2022 youdotcom - -Permission is hereby granted, free of charge, to any person obtaining a copy -of this software and associated documentation files (the "Software"), to deal -in the Software without restriction, including without limitation the rights -to use, copy, modify, merge, publish, distribute, sublicense, and/or sell -copies of the Software, and to permit persons to whom the Software is -furnished to do so, subject to the following conditions: - -The above copyright notice and this permission notice shall be included in all -copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, -EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. -IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, -DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR -OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE -OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright 2025 Ydc Search API + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/Makefile b/Makefile deleted file mode 100755 index bd92626..0000000 --- a/Makefile +++ /dev/null @@ -1,127 +0,0 @@ -#* Variables -SHELL := /usr/bin/env bash -PYTHON := python -PYTHONPATH := `pwd` - -#* Docker variables -IMAGE := youdotcom -VERSION := latest - -#* Poetry -.PHONY: poetry-download -poetry-download: - curl -sSL https://raw.githubusercontent.com/python-poetry/poetry/master/install-poetry.py | $(PYTHON) - - -.PHONY: poetry-remove -poetry-remove: - curl -sSL https://raw.githubusercontent.com/python-poetry/poetry/master/install-poetry.py | $(PYTHON) - --uninstall - -#* Installation -.PHONY: install -install: - poetry lock -n && poetry export --without-hashes > requirements.txt - poetry install -n - -poetry run mypy --install-types --non-interactive ./ - -.PHONY: update -update: - poetry lock --no-update - -.PHONY: publish -publish: - poetry version patch - poetry publish --build - python3 update.py - python3 release.py -.PHONY: readme -readme: - python3 update.py - -.PHONY: pre-commit-install -pre-commit-install: - poetry run pre-commit install - -#* Formatters -.PHONY: codestyle -codestyle: - poetry run pyupgrade --exit-zero-even-if-changed --py39-plus **/*.py - poetry run isort --settings-path pyproject.toml ./ - poetry run black --config pyproject.toml ./ - -.PHONY: formatting -formatting: codestyle - -#* Linting -.PHONY: test -test: - PYTHONPATH=$(PYTHONPATH) poetry run pytest -c pyproject.toml --cov-report=html --cov=youdotcom tests/ - poetry run coverage-badge -o assets/images/coverage.svg -f - -.PHONY: check-codestyle -check-codestyle: - poetry run isort --diff --check-only --settings-path pyproject.toml ./ - poetry run black --diff --check --config pyproject.toml ./ - poetry run darglint --verbosity 2 youdotcom tests - -.PHONY: mypy -mypy: - poetry run mypy --config-file pyproject.toml ./ - -.PHONY: check-safety -check-safety: - poetry check - poetry run safety check --full-report - poetry run bandit -ll --recursive youdotcom tests - -.PHONY: lint -lint: test check-codestyle mypy check-safety - -.PHONY: update-dev-deps -update-dev-deps: - poetry add -D bandit@latest darglint@latest "isort[colors]@latest" mypy@latest pre-commit@latest pydocstyle@latest pylint@latest pytest@latest pyupgrade@latest safety@latest coverage@latest coverage-badge@latest pytest-html@latest pytest-cov@latest - poetry add -D --allow-prereleases black@latest - -#* Docker -# Example: make docker-build VERSION=latest -# Example: make docker-build IMAGE=some_name VERSION=0.1.0 -.PHONY: docker-build -docker-build: - @echo Building docker $(IMAGE):$(VERSION) ... - docker build \ - -t $(IMAGE):$(VERSION) . \ - -f ./docker/Dockerfile --no-cache - -# Example: make docker-remove VERSION=latest -# Example: make docker-remove IMAGE=some_name VERSION=0.1.0 -.PHONY: docker-remove -docker-remove: - @echo Removing docker $(IMAGE):$(VERSION) ... - docker rmi -f $(IMAGE):$(VERSION) - -#* Cleaning -.PHONY: pycache-remove -pycache-remove: - find . | grep -E "(__pycache__|\.pyc|\.pyo$$)" | xargs rm -rf - -.PHONY: dsstore-remove -dsstore-remove: - find . | grep -E ".DS_Store" | xargs rm -rf - -.PHONY: mypycache-remove -mypycache-remove: - find . | grep -E ".mypy_cache" | xargs rm -rf - -.PHONY: ipynbcheckpoints-remove -ipynbcheckpoints-remove: - find . | grep -E ".ipynb_checkpoints" | xargs rm -rf - -.PHONY: pytestcache-remove -pytestcache-remove: - find . | grep -E ".pytest_cache" | xargs rm -rf - -.PHONY: build-remove -build-remove: - rm -rf build/ - -.PHONY: cleanup -cleanup: pycache-remove dsstore-remove mypycache-remove ipynbcheckpoints-remove pytestcache-remove diff --git a/README.md b/README.md old mode 100755 new mode 100644 index 1c8f612..11ee900 --- a/README.md +++ b/README.md @@ -1,413 +1,379 @@ +# Ydc Search API Python API library -

-
- YouDotCom -
-
- YouDotCom for python v2.0.23 (New updates planned!) -
-

+[![PyPI version]()](https://pypi.org/project/youdotcom/) -

An python library for you.com and all of its apps.

+The Ydc Search API Python library provides convenient access to the Ydc Search API REST API from any Python 3.8+ +application. The library includes type definitions for all request params and response fields, +and offers both synchronous and asynchronous clients powered by [httpx](https://github.com/encode/httpx). -
+It is generated with [Stainless](https://www.stainless.com/). - [![Python Version](https://img.shields.io/pypi/pyversions/youdotcom.svg)](https://pypi.org/project/youdotcom/) - [![Dependencies Status](https://img.shields.io/badge/dependencies-up%20to%20date-brightgreen.svg)](https://github.com/silkepilon/youdotcom/pulls?utf8=%E2%9C%93&q=is%3Apr%20author%3Aapp%2Fdependabot) +## Documentation - [![Code style: black](https://img.shields.io/badge/code%20style-black-000000.svg)](https://github.com/psf/black) - [![Security: bandit](https://img.shields.io/badge/security-bandit-green.svg)](https://github.com/PyCQA/bandit) - [![Pre-commit](https://img.shields.io/badge/pre--commit-enabled-brightgreen?logo=pre-commit&logoColor=white)](https://github.com/silkepilon/youdotcom/blob/master/.pre-commit-config.yaml) - [![Semantic Versions](https://img.shields.io/badge/%20%20%F0%9F%93%A6%F0%9F%9A%80-semantic--versions-e10079.svg)](https://github.com/silkepilon/youdotcom/releases) - [![License](https://img.shields.io/github/license/silkepilon/youdotcom)](https://github.com/silkepilon/youdotcom/blob/master/LICENSE) - ![Coverage Report](assets/images/coverage.svg) - -
+The REST API documentation can be found on [documentation.you.com](https://documentation.you.com). The full API of this library can be found in [api.md](api.md). -

- About β€’ - Key Features β€’ - How To Use β€’ - Install β€’ - Credits β€’ - License -

+## Installation - +```sh +# install from PyPI +pip install youdotcom +``` -## About -Welcome to the YouDotCom Python Library! +## Usage -This library allows users to easily access and utilize all of the functionality of the You.com platform through a simple and intuitive Python interface. With the library, users can access a variety of You.com apps and services, including but not limited to: +The full API of this library can be found in [api.md](api.md). -* Search -* YouChat -* YouCode -* YouWrite +```python +import os +from ydc_search_api import YdcSearchAPI -To get started with the YouDotCom Python Library, simply install the package using pip and import it into your Python script. From there, you can use the provided functions and classes to easily interact with the You.com platform. +client = YdcSearchAPI( + api_key=os.environ.get("YDC_SEARCH_API_API_KEY"), # This is the default and can be omitted +) -We hope you enjoy using the YouDotCom Python Library and all of the features it has to offer! -> by Chat GPT +response = client.search.query( + query="REPLACE_ME", +) +print(response.hits) +``` +While you can provide an `api_key` keyword argument, +we recommend using [python-dotenv](https://pypi.org/project/python-dotenv/) +to add `YDC_SEARCH_API_API_KEY="My API Key"` to your `.env` file +so that your API Key is not stored in source control. -## Key Features -* Bypass CloudFlare -* Interact with YouChat -* Find code examples -* Server ready - - Supports non-gui operating systems. -* Cross platform - - Windows, macOS and Linux ready. +## Async usage +Simply import `AsyncYdcSearchAPI` instead of `YdcSearchAPI` and use `await` with each API call: -## How to install +```python +import os +import asyncio +from ydc_search_api import AsyncYdcSearchAPI -To install the YouDotCom Python Library, use the following command: +client = AsyncYdcSearchAPI( + api_key=os.environ.get("YDC_SEARCH_API_API_KEY"), # This is the default and can be omitted +) -``` -pip install youdotcom -``` -This will install the latest version of the youdotcom package. Always make sure to be up-to-date so you don't miss any features, use: -``` -pip install youdotcom --upgrade -``` +async def main() -> None: + response = await client.search.query( + query="REPLACE_ME", + ) + print(response.hits) -Once the installation is complete, you can use the youdotcom package in your Python scripts by importing it: -```python -import youdotcom +asyncio.run(main()) ``` +Functionality between the synchronous and asynchronous clients is otherwise identical. -## How To Use +### With aiohttp -To help users get started with the YouDotCom Python Library, we have provided a selection of code examples that demonstrate common use cases for the library. These examples can be found below and cover a range of functionality. +By default, the async client uses `httpx` for HTTP requests. However, for improved concurrency performance you may also use `aiohttp` as the HTTP backend. -To use the code examples, simply copy and paste the relevant code into your Python script and customize it to fit your specific needs. You can also use the examples as a starting point for your own code, using them as a guide to understand how the library functions can be used to build your own applications and integrations with the You.com platform. +You can enable this by installing `aiohttp`: -We hope that these code examples will make it easier for users to get up and running with the YouDotCom Python Library and start building with the You.com platform. -> :warning: **Warning!** -> Do not spam or harm the you.com servers in any way! - - -
-YouChat example -
-

-
- YouChat -
-

- - -> **Note** -> YouChat is currently disabled because you.com does not yet support the trafic. +```sh +# install from PyPI +pip install youdotcom[aiohttp] +``` +Then you can enable it by instantiating the client with `http_client=DefaultAioHttpClient()`: ```python -from youdotcom import Chat # import all the classes +import os +import asyncio +from ydc_search_api import DefaultAioHttpClient +from ydc_search_api import AsyncYdcSearchAPI -chat = Chat.send_message(message="how is your day?", api_key="YOUR API KEY HERE") # send a message to YouChat. passing the message and your api key. -# you can get an api key form the site: https://api.betterapi.net/ (with is also made by me) +async def main() -> None: + async with AsyncYdcSearchAPI( + api_key=os.environ.get("YDC_SEARCH_API_API_KEY"), # This is the default and can be omitted + http_client=DefaultAioHttpClient(), + ) as client: + response = await client.search.query( + query="REPLACE_ME", + ) + print(response.hits) -print(chat) # returns the message and some other data -``` +asyncio.run(main()) +``` -#### Context -> **Note** -> at the moment there is no context support YET. becuase of new api. - - -> **Note** -> Your context will not always be used in the response message is is not a code bug but a YouChat thing. Note its still in beta - -YouDotCom's YouChat feature is a powerful tool that allows for context to be utilized in your conversations. By passing a list or a file in the JSON format, you can provide the chatbot with additional information to better understand and respond to your questions. +## Using types -To use the context option, you can change the way you send your message by changing the `Chat.send_message` method. This method allows you to pass in a driver, a message, and a context_form_file or a context parameter. +Nested request parameters are [TypedDicts](https://docs.python.org/3/library/typing.html#typing.TypedDict). Responses are [Pydantic models](https://docs.pydantic.dev) which also provide helper methods for things like: -For example, if you want to use a file, you can pass the file name as the `context_form_file` parameter, like this: - -```python -Chat.send_message(driver=driver, message="YOUR QUESTION HERE", context_form_file="FILE_NAME.json") -``` - -Make sure to change the `FILE_NAME` to the name of the file you are using and include a question in the `message` parameter. +- Serializing back into JSON, `model.to_json()` +- Converting to a dictionary, `model.to_dict()` -Alternatively, you can also use the context directly without a file by passing in a list as the `context` parameter. Like this: - -```python -Chat.send_message(driver=driver, message="YOUR QUESTION HERE", context=['context #1', '#2', 'etc...']) -``` +Typed requests and responses provide autocomplete and documentation within your editor. If you would like to see type errors in VS Code to help catch bugs earlier, set `python.analysis.typeCheckingMode` to `basic`. -By providing context to your conversations, you can expect more accurate and personalized responses from YouChat, which can help to improve your overall experience. +## Handling errors -The following is an example of a JSON file that can be used as the `context_form_file` parameter in the `Chat.send_message` method: +When the library is unable to connect to the API (for example, due to network connection problems or a timeout), a subclass of `ydc_search_api.APIConnectionError` is raised. -```json -{ - "context": [ - "my name is test", - "i love coding", - "my hobby's are making pictures in nature" - ] -} -``` +When the API returns a non-success status code (that is, 4xx or 5xx +response), a subclass of `ydc_search_api.APIStatusError` is raised, containing `status_code` and `response` properties. -In this example, the `context` field contains an array of strings that provide additional information about the user. The strings can include any relevant information that could help the chatbot understand the context of the conversation. +All errors inherit from `ydc_search_api.APIError`. - -
+```python +import ydc_search_api +from ydc_search_api import YdcSearchAPI + +client = YdcSearchAPI() + +try: + client.search.query( + query="REPLACE_ME", + ) +except ydc_search_api.APIConnectionError as e: + print("The server could not be reached") + print(e.__cause__) # an underlying Exception, likely raised within httpx. +except ydc_search_api.RateLimitError as e: + print("A 429 status code was received; we should back off a bit.") +except ydc_search_api.APIStatusError as e: + print("Another non-200-range status code was received") + print(e.status_code) + print(e.response) +``` -
-YouCode example -
+Error codes are as follows: -

-
- YouCode -
-

+| Status Code | Error Type | +| ----------- | -------------------------- | +| 400 | `BadRequestError` | +| 401 | `AuthenticationError` | +| 403 | `PermissionDeniedError` | +| 404 | `NotFoundError` | +| 422 | `UnprocessableEntityError` | +| 429 | `RateLimitError` | +| >=500 | `InternalServerError` | +| N/A | `APIConnectionError` | +### Retries +Certain errors are automatically retried 2 times by default, with a short exponential backoff. +Connection errors (for example, due to a network connectivity problem), 408 Request Timeout, 409 Conflict, +429 Rate Limit, and >=500 Internal errors are all retried by default. -#### Find code +You can use the `max_retries` option to configure or disable retry settings: - ```python -from youdotcom import Webdriver, Code # import all the classes +from ydc_search_api import YdcSearchAPI + +# Configure the default for all requests: +client = YdcSearchAPI( + # default is 2 + max_retries=0, +) + +# Or, configure per-request: +client.with_options(max_retries=5).search.query( + query="REPLACE_ME", +) +``` -driver = Webdriver().driver # setting up the webdriver. use `webdriver_path=` if the pre-installed one does not work. +### Timeouts -code = Code.find_code(driver, search="how to make an python loop?") # get all the code displayed on screen. passing the driver and search string. +By default requests time out after 1 minute. You can configure this with a `timeout` option, +which accepts a float or an [`httpx.Timeout`](https://www.python-httpx.org/advanced/timeouts/#fine-tuning-the-configuration) object: -for string in code['response']: # loop through all the code - print(string) # print 1 at an time. - -print(code['time']) # print the time taken to complete you search. +```python +from ydc_search_api import YdcSearchAPI + +# Configure the default for all requests: +client = YdcSearchAPI( + # 20 seconds (default is 1 minute) + timeout=20.0, +) + +# More granular control: +client = YdcSearchAPI( + timeout=httpx.Timeout(60.0, read=5.0, write=10.0, connect=2.0), +) + +# Override per-request: +client.with_options(timeout=5.0).search.query( + query="REPLACE_ME", +) ``` - -This code imports the Code and Webdriver classes from the youdotcom library. The Code class is used to search for code snippets, while the Webdriver class is used to set up a webdriver. -First, the Webdriver class is instantiated with Webdriver(). The driver attribute of the resulting object is then stored in the driver variable. The driver attribute returns a webdriver object that can be used to automate web browsing tasks. +On timeout, an `APITimeoutError` is thrown. -Next, the find_code method of the Code class is called with driver and a search string as arguments. This method searches for code snippets related to the specified search string using the webdriver. The result of the method call is stored in the code variable. +Note that requests that time out are [retried twice by default](#retries). -The code variable is a dictionary containing a list of code snippets in the response field and the time taken to complete the search in the time field. The code then loops through the response list and prints each code snippet to the console one at a time. Finally, the time taken to complete the search is printed to the console. - ---- - -#### Generate code - -> **Note** -> Code complete has an daily limit of 20 requests. +## Advanced -```python -from youdotcom import Code # import the write class +### Logging -text = Code.gen_code("python loop") # make an api call +We use the standard library [`logging`](https://docs.python.org/3/library/logging.html) module. -print(text['response']) # print the AI made code +You can enable logging by setting the environment variable `YDC_SEARCH_API_LOG` to `info`. -print(text['time']) # print total time taken to complete your request +```shell +$ export YDC_SEARCH_API_LOG=info ``` - -This code imports the Code class from the youdotcom module. It then calls the gen_code method of the Code class, passing in the string "python loop" as an argument. The gen_code method makes an API call and returns a dictionary with two keys: response and time. The code then prints the value associated with the response key, which is the AI-generated code. It also prints the value associated with the time key, which is the total time taken to complete the request. - -
- -
-Search example -
- -```python -from youdotcom import Search # import the Search class -search_results = Search.search_for("how to make an python loop?") # search! No need to use the Webdriver class. +Or to `debug` for more verbose logging. + +### How to tell whether `None` means `null` or missing -print(search_results['results']) # print all the search results +In an API response, a field may be explicitly `null`, or missing entirely; in either case, its value is `None` in this library. You can differentiate the two cases with `.model_fields_set`: -print(search_results['time']) # print the total time taken (les then 3 seconds on average) +```py +if response.my_field is None: + if 'my_field' not in response.model_fields_set: + print('Got json like {}, without a "my_field" key present at all.') + else: + print('Got json like {"my_field": null}.') ``` - -This code imports the Search class from the youdotcom module. It then calls the search_for method of the Search class, passing in the string "how to make an python loop?" as an argument. The search_for method returns a dictionary with two keys: results and time. The code then prints the value associated with the results key, which is a list of search results. It also prints the value associated with the time key, which is the total time taken to perform the search. - -
- -
-YouWrite example -
- - -

-
- YouCode -
-

- -> **Note** -> YouWrite has an daily limit of 10 requests. - -```python -from youdotcom import Write # import the write class -text = Write.write("how to write well?") # make an api call +### Accessing raw response data (e.g. headers) -print(text['response']) # print the AI made text +The "raw" Response object can be accessed by prefixing `.with_raw_response.` to any HTTP method call, e.g., -print(text['time']) # print total time taken to complete your request -``` - -This code imports the Write class from the youdotcom module. It then calls the write method of the Write class, passing in the string "how to write well?" as an argument. The write method makes an API call and returns a dictionary with two keys: response and time. The code then prints the value associated with the response key, which is a text generated by an AI. It also prints the value associated with the time key, which is the total time taken to complete the request. - -
+```py +from ydc_search_api import YdcSearchAPI -> **Note** -> YouDotCom is in Alpha and there will be bugs! +client = YdcSearchAPI() +response = client.search.with_raw_response.query( + query="REPLACE_ME", +) +print(response.headers.get('X-My-Header')) +search = response.parse() # get the object that `search.query()` would have returned +print(search.hits) +``` -## Interactive shell -The YouDotCom python library offers a wide range of functionality to its users, and one of the ways in which users can access and utilize this functionality is through an interactive terminal shell. With the interactive shell, users are able to execute commands and manipulate the library in real-time, allowing for a more flexible and dynamic experience. +These methods return an [`APIResponse`](https://github.com/You-OpenSource/You-Python/tree/main/src/ydc_search_api/_response.py) object. -to use the interactive shell, use the following command in your terminal: +The async client returns an [`AsyncAPIResponse`](https://github.com/You-OpenSource/You-Python/tree/main/src/ydc_search_api/_response.py) with the same structure, the only difference being `await`able methods for reading the response content. -``` -youdotcom -``` +#### `.with_streaming_response` -you will get something like this: +The above interface eagerly reads the full response body when you make the request, which may not always be what you want. -```bash -Welcome to YouShell an interactive shell for all YouDotCom commands -Enter 'help' for a list of available commands. -Type 'exit' to stop. +To stream the response body, use `.with_streaming_response` instead, which requires a context manager and only reads the response body once you call `.read()`, `.text()`, `.json()`, `.iter_bytes()`, `.iter_text()`, `.iter_lines()` or `.parse()`. In the async client, these are async methods. +```python +with client.search.with_streaming_response.query( + query="REPLACE_ME", +) as response: + print(response.headers.get("X-My-Header")) -YouShell > + for line in response.iter_lines(): + print(line) ``` -> **Note** -> You may sometimes get the following error message: -> ``` -> Detected a Cloudflare version 2 Captcha challenge, This feature is not available in the opensource (free) version. -> ``` +The context manager is required so that the response will reliably be closed. +### Making custom/undocumented requests +This library is typed for convenient access to the documented API. +If you need to access undocumented endpoints, params, or response properties, the library can still be used. +#### Undocumented endpoints -## API +To make requests to undocumented endpoints, you can make requests using `client.get`, `client.post`, and other +http verbs. Options on the client will be respected (such as retries) when making this request. -> **Note** -> The request limit is 15 per minute. +```py +import httpx -Welcome to the YouDotCom Python library! Our library now features an easy-to-use public API that allows you to interact with YouChat. With this API, you can easily integrate YouChat into your own projects and applications, providing a convenient and user-friendly way for you to access and utilize the capabilities of the chat bot. +response = client.post( + "/foo", + cast_to=httpx.Response, + body={"my_param": True}, +) -To get started, you will first need to get an API key on our [website](https://betterapi.net/). This key will be required to authenticate each API request. +print(response.headers.get("x-foo")) +``` -base url: `api.betterapi.net` +#### Undocumented request params -To send a message to YouChat and receive a JSON response, you can make an HTTP GET request to the endpoint `/youdotcom/chat`, including the message to be sent as a query parameter. The key is `message` and the value should be the message text encoded in URL format. For example, to send the message `hello there`, the endpoint would be `https://api.betterapi.net/youdotcom/chat?message=hello%20there&key=YOUR_API_KEY`. The JSON response will include the message sent by YouChat, time, v2Captcha, and type of the request. +If you want to explicitly send an extra param, you can do so with the `extra_query`, `extra_body`, and `extra_headers` request +options. -You also need to set your API key, you can do this by providing it as an parameter like this `/youdotcom/chat?message=hello%20there&key=YOUR_API_KEY` +#### Undocumented response properties +To access undocumented response properties, you can access the extra fields like `response.unknown_prop`. You +can also get all the extra fields on the Pydantic model as a dict with +[`response.model_extra`](https://docs.pydantic.dev/latest/api/base_model/#pydantic.BaseModel.model_extra). -auto updating docs can be found at: https://betterapi.net/redoc +### Configuring the HTTP client -Make sure to include the API key in the url of each request to authenticate it. +You can directly override the [httpx client](https://www.python-httpx.org/api/#client) to customize it for your use case, including: -We are constantly improving and updating the YouDotCom library and API, so make sure to check back for new features and updates. If you have any questions or need assistance, feel free to reach out in the Discusions tab. I'm always happy to help. +- Support for [proxies](https://www.python-httpx.org/advanced/proxies/) +- Custom [transports](https://www.python-httpx.org/advanced/transports/) +- Additional [advanced](https://www.python-httpx.org/advanced/clients/) functionality -## Discord bot ```python -from typing import Optional - -import discord -from discord import app_commands - - -MY_GUILD = discord.Object(id=0) # replace with your guild id - - -class MyClient(discord.Client): - def __init__(self, *, intents: discord.Intents): - super().__init__(intents=intents) - # A CommandTree is a special type that holds all the application command - # state required to make it work. This is a separate class because it - # allows all the extra state to be opt-in. - # Whenever you want to work with application commands, your tree is used - # to store and work with them. - # Note: When using commands.Bot instead of discord.Client, the bot will - # maintain its own tree instead. - self.tree = app_commands.CommandTree(self) - - # In this basic example, we just synchronize the app commands to one guild. - # Instead of specifying a guild to every command, we copy over our global commands instead. - # By doing so, we don't have to wait up to an hour until they are shown to the end-user. - async def setup_hook(self): - # This copies the global commands over to your guild. - self.tree.copy_global_to(guild=MY_GUILD) - await self.tree.sync(guild=MY_GUILD) - - -intents = discord.Intents.default() -client = MyClient(intents=intents) -betterapi_token = "YOUR API KEY HERE" - -@client.event -async def on_ready(): - print(f'Logged in as {client.user} (ID: {client.user.id})') - print('------') - - -@client.tree.command() -@app_commands.describe(message='The message to YouChat') -async def joined(interaction: discord.Interaction, message:str = "hi there"): - """Send a message to YouChat""" - await interaction.response.defer() - data = requests.get(f"https://api.betterapi.net/youdotcom/chat?message={message}&key={betterapi_token}").json() - try: - msg = data['message'] - except: - msg = "got an error!" - await interaction.followup.send(f"{msg}") - -client.run('token') +import httpx +from ydc_search_api import YdcSearchAPI, DefaultHttpxClient + +client = YdcSearchAPI( + # Or use the `YDC_SEARCH_API_BASE_URL` env var + base_url="http://my.test.server.example.com:8083", + http_client=DefaultHttpxClient( + proxy="http://my.test.proxy.example.com", + transport=httpx.HTTPTransport(local_address="0.0.0.0"), + ), +) ``` +You can also customize the client on a per-request basis by using `with_options()`: -## YouDotCom roadmap -* [x] add youchat -* [x] add youcode -* [ ] switch to using you.com/api -* [ ] make code faster -* [ ] add code translate -* [ ] add all of you.com apps +```python +client.with_options(http_client=DefaultHttpxClient(...)) +``` +### Managing HTTP resources +By default the library closes underlying HTTP connections whenever the client is [garbage collected](https://docs.python.org/3/reference/datamodel.html#object.__del__). You can manually close the client using the `.close()` method if desired, or with a context manager that closes when exiting. +```py +from ydc_search_api import YdcSearchAPI -## YouDotCom projects! -- [telegram bot](https://github.com/samezarus/you_telegram_bot) +with YdcSearchAPI() as client: + # make requests here + ... +# HTTP client is now closed +``` + +## Versioning + +This package generally follows [SemVer](https://semver.org/spec/v2.0.0.html) conventions, though certain backwards-incompatible changes may be released as minor versions: +1. Changes that only affect static types, without breaking runtime behavior. +2. Changes to library internals which are technically public but not intended or documented for external use. _(Please open a GitHub issue to let us know if you are relying on such internals.)_ +3. Changes that we do not expect to impact the vast majority of users in practice. -## Discord -In addition to the YouDotCom Python Library, we also have an active [Discord server](https://discord.gg/SD7wZMFSvV) where you can chat with developers and get help with using the library. Our Discord community is a great place to ask questions, share your projects, and get feedback from other developers. +We take backwards-compatibility seriously and work hard to ensure you can rely on a smooth upgrade experience. +We are keen for your feedback; please open an [issue](https://www.github.com/You-OpenSource/You-Python/issues) with questions, bugs, or suggestions. -## Credits +### Determining the installed version -This software uses the following open source packages: +If you've upgraded to the latest version but aren't seeing any new features you were expecting then your python environment is likely still using an older version. -- [undetected-chromedriver](https://github.com/ultrafunkamsterdam/undetected-chromedriver) +You can determine the version that is being used at runtime with: + +```py +import ydc_search_api +print(ydc_search_api.__version__) +``` +## Requirements -## License +Python 3.8 or higher. -MIT +## Contributing ---- +See [the contributing documentation](./CONTRIBUTING.md). diff --git a/RELEASE.md b/RELEASE.md deleted file mode 100755 index 2599c57..0000000 --- a/RELEASE.md +++ /dev/null @@ -1,18 +0,0 @@ - -

-
- Markdownify -
-
- YouDotCom for python v1.0.23 -
-

- -

A python library for you.com and all of its apps.

- - - - - -## Release notes -fully replaced youdotcom's chat with the betterapi (also made by me) for faster responsesits now way faster (les that 8 sec) diff --git a/SECURITY.md b/SECURITY.md old mode 100755 new mode 100644 index ec760bc..209667d --- a/SECURITY.md +++ b/SECURITY.md @@ -1,27 +1,27 @@ -# Security +# Security Policy -## πŸ” Reporting Security Issues +## Reporting Security Issues -> Do not open issues that might have security implications! -> It is critical that security related issues are reported privately so we have time to address them before they become public knowledge. +This SDK is generated by [Stainless Software Inc](http://stainless.com). Stainless takes security seriously, and encourages you to report any security vulnerability promptly so that appropriate action can be taken. -Vulnerabilities can be reported by emailing core members: +To report a security issue, please contact the Stainless team at security@stainless.com. -- youdotcom [silkepilon2009@gmail.com](mailto:silkepilon2009@gmail.com) +## Responsible Disclosure -Please include the requested information listed below (as much as you can provide) to help us better understand the nature and scope of the possible issue: +We appreciate the efforts of security researchers and individuals who help us maintain the security of +SDKs we generate. If you believe you have found a security vulnerability, please adhere to responsible +disclosure practices by allowing us a reasonable amount of time to investigate and address the issue +before making any information public. -- Type of issue (e.g. buffer overflow, SQL injection, cross-site scripting, etc.) -- Full paths of source file(s) related to the manifestation of the issue -- The location of the affected source code (tag/branch/commit or direct URL) -- Any special configuration required to reproduce the issue -- Environment (e.g. Linux / Windows / macOS) -- Step-by-step instructions to reproduce the issue -- Proof-of-concept or exploit code (if possible) -- Impact of the issue, including how an attacker might exploit the issue +## Reporting Non-SDK Related Security Issues -This information will help us triage your report more quickly. +If you encounter security issues that are not directly related to SDKs but pertain to the services +or products provided by Ydc Search API, please follow the respective company's security reporting guidelines. -## Preferred Languages +### Ydc Search API Terms and Policies -We prefer all communications to be in English. +Please contact api@you.com for any questions or concerns regarding the security of our services. + +--- + +Thank you for helping us keep the SDKs and systems they interact with secure. diff --git a/add.py b/add.py deleted file mode 100755 index 46a23a6..0000000 --- a/add.py +++ /dev/null @@ -1,48 +0,0 @@ -#!python3 -""" -Convert a requirements.txt file to a Poetry project. -Just place in the root of your working directory and run! -""" - -sourceFile = "./requirements.txt" - -import os -import re - -if not os.path.exists(sourceFile): - # Install Pigar and run it to generate your initial requirements - # https://github.com/damnever/pigar - os.system("pip install pigar") - os.system(f"pigar -o ~= -p {sourceFile}") - -# We don't need to keep track of this file -with open(".gitignore", "a") as fh: - fh.write("\npoetry-convert.py\n") - -# Initialize Poetry if it doesn't yet have a pyproject.toml file -if not os.path.exists("./pyproject.toml"): - os.system("poetry init") - -with open(sourceFile) as fh: - requirements = fh.read() - -noComments = re.sub("^#.*$", "", requirements, 0, re.IGNORECASE | re.MULTILINE) -bareRequirements = re.sub("\n+", "\n", noComments, 0, re.IGNORECASE | re.MULTILINE).strip() - -pipPoetryMap = {">": "^", "=": ""} - -reqList = [] -for line in bareRequirements.splitlines(): - package, match, version = re.sub(r"^(.*?)\s*([~>=<])=\s*v?([0-9\.\*]+)", r"\1,\2,\3", line, 0, re.IGNORECASE | re.MULTILINE).split(",") - try: - poetryMatch = pipPoetryMap[match] - except KeyError: - poetryMatch = match - poetryLine = f"{package}:{poetryMatch}{version}" - reqList.append(poetryLine) - -print("Found Poetry-compatible dependencies:") -print(reqList) - -for req in reqList: - os.system(f"poetry add {req}") diff --git a/api.md b/api.md new file mode 100644 index 0000000..e85fe89 --- /dev/null +++ b/api.md @@ -0,0 +1,23 @@ +# Search + +Types: + +```python +from ydc_search_api.types import SearchQueryResponse +``` + +Methods: + +- client.search.query(\*\*params) -> SearchQueryResponse + +# News + +Types: + +```python +from ydc_search_api.types import NewsListResponse +``` + +Methods: + +- client.news.list(\*\*params) -> NewsListResponse diff --git a/assets/images/1.png b/assets/images/1.png deleted file mode 100755 index 8166ff8..0000000 Binary files a/assets/images/1.png and /dev/null differ diff --git a/assets/images/2.png b/assets/images/2.png deleted file mode 100755 index fb8b7ee..0000000 Binary files a/assets/images/2.png and /dev/null differ diff --git a/assets/images/3.png b/assets/images/3.png deleted file mode 100755 index 115a757..0000000 Binary files a/assets/images/3.png and /dev/null differ diff --git a/assets/images/YouChat.png b/assets/images/YouChat.png deleted file mode 100755 index 568c73b..0000000 Binary files a/assets/images/YouChat.png and /dev/null differ diff --git a/assets/images/YouCode.png b/assets/images/YouCode.png deleted file mode 100755 index f2941ae..0000000 Binary files a/assets/images/YouCode.png and /dev/null differ diff --git a/assets/images/YouDotCom.jpg b/assets/images/YouDotCom.jpg deleted file mode 100755 index 7c67b26..0000000 Binary files a/assets/images/YouDotCom.jpg and /dev/null differ diff --git a/assets/images/coverage.svg b/assets/images/coverage.svg deleted file mode 100755 index 0644a48..0000000 --- a/assets/images/coverage.svg +++ /dev/null @@ -1,21 +0,0 @@ - - - - - - - - - - - - - - - - coverage - coverage - 26% - 26% - - diff --git a/bin/check-release-environment b/bin/check-release-environment new file mode 100644 index 0000000..b845b0f --- /dev/null +++ b/bin/check-release-environment @@ -0,0 +1,21 @@ +#!/usr/bin/env bash + +errors=() + +if [ -z "${PYPI_TOKEN}" ]; then + errors+=("The PYPI_TOKEN secret has not been set. Please set it in either this repository's secrets or your organization secrets.") +fi + +lenErrors=${#errors[@]} + +if [[ lenErrors -gt 0 ]]; then + echo -e "Found the following errors in the release environment:\n" + + for error in "${errors[@]}"; do + echo -e "- $error\n" + done + + exit 1 +fi + +echo "The environment is ready to push releases!" diff --git a/bin/publish-pypi b/bin/publish-pypi new file mode 100644 index 0000000..826054e --- /dev/null +++ b/bin/publish-pypi @@ -0,0 +1,6 @@ +#!/usr/bin/env bash + +set -eux +mkdir -p dist +rye build --clean +rye publish --yes --token=$PYPI_TOKEN diff --git a/cookiecutter-config-file.yml b/cookiecutter-config-file.yml deleted file mode 100755 index 8db604d..0000000 --- a/cookiecutter-config-file.yml +++ /dev/null @@ -1,12 +0,0 @@ -# This file contains values from Cookiecutter - -default_context: - project_name: "youdotcom" - project_description: "official api wrapper for you.com and all of its apps" - organization: "youdotcom" - license: "MIT" - minimal_python_version: 3.8 - github_name: "silkepilon" - email: "silkepilon2009@gmail.com" - version: "0.1.2" - line_length: "200" diff --git a/docker/Dockerfile b/docker/Dockerfile deleted file mode 100755 index 2858b21..0000000 --- a/docker/Dockerfile +++ /dev/null @@ -1,25 +0,0 @@ -FROM python:3.11-slim-buster - -ENV LANG=C.UTF-8 \ - LC_ALL=C.UTF-8 \ - PATH="${PATH}:/root/.poetry/bin" - -RUN apt-get update && \ - apt-get install -y --no-install-recommends \ - curl \ - && rm -rf /var/lib/apt/lists/* - -COPY pyproject.toml ./ - -# Install Poetry -RUN curl -sSL https://raw.githubusercontent.com/python-poetry/poetry/master/install-poetry.py | POETRY_HOME=/opt/poetry python && \ - cd /usr/local/bin && \ - ln -s /opt/poetry/bin/poetry && \ - poetry config virtualenvs.create false - -# Allow installing dev dependencies to run tests -ARG INSTALL_DEV=false -RUN bash -c "if [ $INSTALL_DEV == 'true' ] ; then poetry install --no-root ; else poetry install --no-root --no-dev ; fi" - -CMD mkdir -p /workspace -WORKDIR /workspace diff --git a/docker/README.md b/docker/README.md deleted file mode 100755 index 819f9f7..0000000 --- a/docker/README.md +++ /dev/null @@ -1,47 +0,0 @@ -# Docker for youdotcom - -## Installation - -To create Docker you need to run: - -```bash -make docker-build -``` - -which is equivalent to: - -```bash -make docker-build VERSION=latest -``` - -You may provide name and version for the image. -Default name is `IMAGE := youdotcom`. -Default version is `VERSION := latest`. - -```bash -make docker-build IMAGE=some_name VERSION=0.1.0 -``` - -## Usage - -```bash -docker run -it --rm \ - -v $(pwd):/workspace \ - youdotcom bash -``` - -## How to clean up - -To uninstall docker image run `make docker-remove` with `VERSION`: - -```bash -make docker-remove VERSION=0.1.0 -``` - -you may also choose the image name - -```bash -make docker-remove IMAGE=some_name VERSION=latest -``` - -If you want to clean all, including `build` and `pycache` run `make cleanup` diff --git a/examples/.keep b/examples/.keep new file mode 100644 index 0000000..d8c73e9 --- /dev/null +++ b/examples/.keep @@ -0,0 +1,4 @@ +File generated from our OpenAPI spec by Stainless. + +This directory can be used to store example files demonstrating usage of this SDK. +It is ignored by Stainless code generation and its content (other than this keep file) won't be touched. \ No newline at end of file diff --git a/examples/youchat.py b/examples/youchat.py deleted file mode 100755 index 2066dcd..0000000 --- a/examples/youchat.py +++ /dev/null @@ -1,12 +0,0 @@ -from youdotcom.init import Init # import the Init class -from youdotcom.youchat import Chat # import YouChat - -driver = Init().driver # setting up the webdriver. use `webdriver_path=` if the pre-installed one does not work. - - -chat = Chat.send_message(driver=driver, message="what is the time?") # send a message to YouChat. passing the driver and messages - -driver.close() # close the webdriver - - -print(chat) # {'message': 'The current time is Saturday, December 31, 2022 09:47:30 UTC.', 'time': '25'} diff --git a/mypy.ini b/mypy.ini new file mode 100644 index 0000000..24ff066 --- /dev/null +++ b/mypy.ini @@ -0,0 +1,50 @@ +[mypy] +pretty = True +show_error_codes = True + +# Exclude _files.py because mypy isn't smart enough to apply +# the correct type narrowing and as this is an internal module +# it's fine to just use Pyright. +# +# We also exclude our `tests` as mypy doesn't always infer +# types correctly and Pyright will still catch any type errors. +exclude = ^(src/ydc_search_api/_files\.py|_dev/.*\.py|tests/.*)$ + +strict_equality = True +implicit_reexport = True +check_untyped_defs = True +no_implicit_optional = True + +warn_return_any = True +warn_unreachable = True +warn_unused_configs = True + +# Turn these options off as it could cause conflicts +# with the Pyright options. +warn_unused_ignores = False +warn_redundant_casts = False + +disallow_any_generics = True +disallow_untyped_defs = True +disallow_untyped_calls = True +disallow_subclassing_any = True +disallow_incomplete_defs = True +disallow_untyped_decorators = True +cache_fine_grained = True + +# By default, mypy reports an error if you assign a value to the result +# of a function call that doesn't return anything. We do this in our test +# cases: +# ``` +# result = ... +# assert result is None +# ``` +# Changing this codegen to make mypy happy would increase complexity +# and would not be worth it. +disable_error_code = func-returns-value,overload-cannot-match + +# https://github.com/python/mypy/issues/12162 +[mypy.overrides] +module = "black.files.*" +ignore_errors = true +ignore_missing_imports = true diff --git a/noxfile.py b/noxfile.py new file mode 100644 index 0000000..53bca7f --- /dev/null +++ b/noxfile.py @@ -0,0 +1,9 @@ +import nox + + +@nox.session(reuse_venv=True, name="test-pydantic-v1") +def test_pydantic_v1(session: nox.Session) -> None: + session.install("-r", "requirements-dev.lock") + session.install("pydantic<2") + + session.run("pytest", "--showlocals", "--ignore=tests/functional", *session.posargs) diff --git a/poetry.lock b/poetry.lock deleted file mode 100644 index 07d8f6e..0000000 --- a/poetry.lock +++ /dev/null @@ -1,2263 +0,0 @@ -# This file is automatically @generated by Poetry 1.5.1 and should not be changed by hand. - -[[package]] -name = "aioredis" -version = "2.0.1" -description = "asyncio (PEP 3156) Redis support" -optional = false -python-versions = ">=3.6" -files = [ - {file = "aioredis-2.0.1-py3-none-any.whl", hash = "sha256:9ac0d0b3b485d293b8ca1987e6de8658d7dafcca1cddfcd1d506cae8cdebfdd6"}, - {file = "aioredis-2.0.1.tar.gz", hash = "sha256:eaa51aaf993f2d71f54b70527c440437ba65340588afeb786cd87c55c89cd98e"}, -] - -[package.dependencies] -async-timeout = "*" -typing-extensions = "*" - -[package.extras] -hiredis = ["hiredis (>=1.0)"] - -[[package]] -name = "anyio" -version = "3.6.2" -description = "High level compatibility layer for multiple asynchronous event loop implementations" -optional = false -python-versions = ">=3.6.2" -files = [ - {file = "anyio-3.6.2-py3-none-any.whl", hash = "sha256:fbbe32bd270d2a2ef3ed1c5d45041250284e31fc0a4df4a5a6071842051a51e3"}, - {file = "anyio-3.6.2.tar.gz", hash = "sha256:25ea0d673ae30af41a0c442f81cf3b38c7e79fdc7b60335a4c14e05eb0947421"}, -] - -[package.dependencies] -idna = ">=2.8" -sniffio = ">=1.1" - -[package.extras] -doc = ["packaging", "sphinx-autodoc-typehints (>=1.2.0)", "sphinx-rtd-theme"] -test = ["contextlib2", "coverage[toml] (>=4.5)", "hypothesis (>=4.0)", "mock (>=4)", "pytest (>=7.0)", "pytest-mock (>=3.6.1)", "trustme", "uvloop (<0.15)", "uvloop (>=0.15)"] -trio = ["trio (>=0.16,<0.22)"] - -[[package]] -name = "ascii-magic" -version = "1.6" -description = "Converts pictures into ASCII art" -optional = false -python-versions = ">=3.5" -files = [ - {file = "ascii_magic-1.6-py3-none-any.whl", hash = "sha256:937447d8677b7428856729c298c0264afd62fc2b8e7ff90c82000492cdc5f8d4"}, - {file = "ascii_magic-1.6.tar.gz", hash = "sha256:7da5518f7368e73f11e2151a0c060804aa149e267b369b7ee7653fbd7b046a51"}, -] - -[package.dependencies] -colorama = "*" -Pillow = "*" - -[[package]] -name = "astroid" -version = "2.14.2" -description = "An abstract syntax tree for Python with inference support." -optional = false -python-versions = ">=3.7.2" -files = [ - {file = "astroid-2.14.2-py3-none-any.whl", hash = "sha256:0e0e3709d64fbffd3037e4ff403580550f14471fd3eaae9fa11cc9a5c7901153"}, - {file = "astroid-2.14.2.tar.gz", hash = "sha256:a3cf9f02c53dd259144a7e8f3ccd75d67c9a8c716ef183e0c1f291bc5d7bb3cf"}, -] - -[package.dependencies] -lazy-object-proxy = ">=1.4.0" -typing-extensions = {version = ">=4.0.0", markers = "python_version < \"3.11\""} -wrapt = [ - {version = ">=1.11,<2", markers = "python_version < \"3.11\""}, - {version = ">=1.14,<2", markers = "python_version >= \"3.11\""}, -] - -[[package]] -name = "async-generator" -version = "1.10" -description = "Async generators and context managers for Python 3.5+" -optional = false -python-versions = ">=3.5" -files = [ - {file = "async_generator-1.10-py3-none-any.whl", hash = "sha256:01c7bf666359b4967d2cda0000cc2e4af16a0ae098cbffcb8472fb9e8ad6585b"}, - {file = "async_generator-1.10.tar.gz", hash = "sha256:6ebb3d106c12920aaae42ccb6f787ef5eefdcdd166ea3d628fa8476abe712144"}, -] - -[[package]] -name = "async-timeout" -version = "4.0.2" -description = "Timeout context manager for asyncio programs" -optional = false -python-versions = ">=3.6" -files = [ - {file = "async-timeout-4.0.2.tar.gz", hash = "sha256:2163e1640ddb52b7a8c80d0a67a08587e5d245cc9c553a74a847056bc2976b15"}, - {file = "async_timeout-4.0.2-py3-none-any.whl", hash = "sha256:8ca1e4fcf50d07413d66d1a5e416e42cfdf5851c981d679a09851a6853383b3c"}, -] - -[[package]] -name = "attrs" -version = "22.2.0" -description = "Classes Without Boilerplate" -optional = false -python-versions = ">=3.6" -files = [ - {file = "attrs-22.2.0-py3-none-any.whl", hash = "sha256:29e95c7f6778868dbd49170f98f8818f78f3dc5e0e37c0b1f474e3561b240836"}, - {file = "attrs-22.2.0.tar.gz", hash = "sha256:c9227bfc2f01993c03f68db37d1d15c9690188323c067c641f1a35ca58185f99"}, -] - -[package.extras] -cov = ["attrs[tests]", "coverage-enable-subprocess", "coverage[toml] (>=5.3)"] -dev = ["attrs[docs,tests]"] -docs = ["furo", "myst-parser", "sphinx", "sphinx-notfound-page", "sphinxcontrib-towncrier", "towncrier", "zope.interface"] -tests = ["attrs[tests-no-zope]", "zope.interface"] -tests-no-zope = ["cloudpickle", "cloudpickle", "hypothesis", "hypothesis", "mypy (>=0.971,<0.990)", "mypy (>=0.971,<0.990)", "pympler", "pympler", "pytest (>=4.3.0)", "pytest (>=4.3.0)", "pytest-mypy-plugins", "pytest-mypy-plugins", "pytest-xdist[psutil]", "pytest-xdist[psutil]"] - -[[package]] -name = "bandit" -version = "1.7.4" -description = "Security oriented static analyser for python code." -optional = false -python-versions = ">=3.7" -files = [ - {file = "bandit-1.7.4-py3-none-any.whl", hash = "sha256:412d3f259dab4077d0e7f0c11f50f650cc7d10db905d98f6520a95a18049658a"}, - {file = "bandit-1.7.4.tar.gz", hash = "sha256:2d63a8c573417bae338962d4b9b06fbc6080f74ecd955a092849e1e65c717bd2"}, -] - -[package.dependencies] -colorama = {version = ">=0.3.9", markers = "platform_system == \"Windows\""} -GitPython = ">=1.0.1" -PyYAML = ">=5.3.1" -stevedore = ">=1.20.0" - -[package.extras] -test = ["beautifulsoup4 (>=4.8.0)", "coverage (>=4.5.4)", "fixtures (>=3.0.0)", "flake8 (>=4.0.0)", "pylint (==1.9.4)", "stestr (>=2.5.0)", "testscenarios (>=0.5.0)", "testtools (>=2.3.0)", "toml"] -toml = ["toml"] -yaml = ["PyYAML"] - -[[package]] -name = "beautifulsoup4" -version = "4.11.2" -description = "Screen-scraping library" -optional = false -python-versions = ">=3.6.0" -files = [ - {file = "beautifulsoup4-4.11.2-py3-none-any.whl", hash = "sha256:0e79446b10b3ecb499c1556f7e228a53e64a2bfcebd455f370d8927cb5b59e39"}, - {file = "beautifulsoup4-4.11.2.tar.gz", hash = "sha256:bc4bdda6717de5a2987436fb8d72f45dc90dd856bdfd512a1314ce90349a0106"}, -] - -[package.dependencies] -soupsieve = ">1.2" - -[package.extras] -html5lib = ["html5lib"] -lxml = ["lxml"] - -[[package]] -name = "black" -version = "22.12.0" -description = "The uncompromising code formatter." -optional = false -python-versions = ">=3.7" -files = [ - {file = "black-22.12.0-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:9eedd20838bd5d75b80c9f5487dbcb06836a43833a37846cf1d8c1cc01cef59d"}, - {file = "black-22.12.0-cp310-cp310-win_amd64.whl", hash = "sha256:159a46a4947f73387b4d83e87ea006dbb2337eab6c879620a3ba52699b1f4351"}, - {file = "black-22.12.0-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:d30b212bffeb1e252b31dd269dfae69dd17e06d92b87ad26e23890f3efea366f"}, - {file = "black-22.12.0-cp311-cp311-win_amd64.whl", hash = "sha256:7412e75863aa5c5411886804678b7d083c7c28421210180d67dfd8cf1221e1f4"}, - {file = "black-22.12.0-cp37-cp37m-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c116eed0efb9ff870ded8b62fe9f28dd61ef6e9ddd28d83d7d264a38417dcee2"}, - {file = "black-22.12.0-cp37-cp37m-win_amd64.whl", hash = "sha256:1f58cbe16dfe8c12b7434e50ff889fa479072096d79f0a7f25e4ab8e94cd8350"}, - {file = "black-22.12.0-cp38-cp38-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:77d86c9f3db9b1bf6761244bc0b3572a546f5fe37917a044e02f3166d5aafa7d"}, - {file = "black-22.12.0-cp38-cp38-win_amd64.whl", hash = "sha256:82d9fe8fee3401e02e79767016b4907820a7dc28d70d137eb397b92ef3cc5bfc"}, - {file = "black-22.12.0-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:101c69b23df9b44247bd88e1d7e90154336ac4992502d4197bdac35dd7ee3320"}, - {file = "black-22.12.0-cp39-cp39-win_amd64.whl", hash = "sha256:559c7a1ba9a006226f09e4916060982fd27334ae1998e7a38b3f33a37f7a2148"}, - {file = "black-22.12.0-py3-none-any.whl", hash = "sha256:436cc9167dd28040ad90d3b404aec22cedf24a6e4d7de221bec2730ec0c97bcf"}, - {file = "black-22.12.0.tar.gz", hash = "sha256:229351e5a18ca30f447bf724d007f890f97e13af070bb6ad4c0a441cd7596a2f"}, -] - -[package.dependencies] -click = ">=8.0.0" -mypy-extensions = ">=0.4.3" -pathspec = ">=0.9.0" -platformdirs = ">=2" -tomli = {version = ">=1.1.0", markers = "python_full_version < \"3.11.0a7\""} -typing-extensions = {version = ">=3.10.0.0", markers = "python_version < \"3.10\""} - -[package.extras] -colorama = ["colorama (>=0.4.3)"] -d = ["aiohttp (>=3.7.4)"] -jupyter = ["ipython (>=7.8.0)", "tokenize-rt (>=3.2.0)"] -uvloop = ["uvloop (>=0.15.2)"] - -[[package]] -name = "certifi" -version = "2022.12.7" -description = "Python package for providing Mozilla's CA Bundle." -optional = false -python-versions = ">=3.6" -files = [ - {file = "certifi-2022.12.7-py3-none-any.whl", hash = "sha256:4ad3232f5e926d6718ec31cfc1fcadfde020920e278684144551c91769c7bc18"}, - {file = "certifi-2022.12.7.tar.gz", hash = "sha256:35824b4c3a97115964b408844d64aa14db1cc518f6562e8d7261699d1350a9e3"}, -] - -[[package]] -name = "cffi" -version = "1.15.1" -description = "Foreign Function Interface for Python calling C code." -optional = false -python-versions = "*" -files = [ - {file = "cffi-1.15.1-cp27-cp27m-macosx_10_9_x86_64.whl", hash = "sha256:a66d3508133af6e8548451b25058d5812812ec3798c886bf38ed24a98216fab2"}, - {file = "cffi-1.15.1-cp27-cp27m-manylinux1_i686.whl", hash = "sha256:470c103ae716238bbe698d67ad020e1db9d9dba34fa5a899b5e21577e6d52ed2"}, - {file = "cffi-1.15.1-cp27-cp27m-manylinux1_x86_64.whl", hash = "sha256:9ad5db27f9cabae298d151c85cf2bad1d359a1b9c686a275df03385758e2f914"}, - {file = "cffi-1.15.1-cp27-cp27m-win32.whl", hash = "sha256:b3bbeb01c2b273cca1e1e0c5df57f12dce9a4dd331b4fa1635b8bec26350bde3"}, - {file = "cffi-1.15.1-cp27-cp27m-win_amd64.whl", hash = "sha256:e00b098126fd45523dd056d2efba6c5a63b71ffe9f2bbe1a4fe1716e1d0c331e"}, - {file = "cffi-1.15.1-cp27-cp27mu-manylinux1_i686.whl", hash = "sha256:d61f4695e6c866a23a21acab0509af1cdfd2c013cf256bbf5b6b5e2695827162"}, - {file = "cffi-1.15.1-cp27-cp27mu-manylinux1_x86_64.whl", hash = "sha256:ed9cb427ba5504c1dc15ede7d516b84757c3e3d7868ccc85121d9310d27eed0b"}, - {file = "cffi-1.15.1-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:39d39875251ca8f612b6f33e6b1195af86d1b3e60086068be9cc053aa4376e21"}, - {file = "cffi-1.15.1-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:285d29981935eb726a4399badae8f0ffdff4f5050eaa6d0cfc3f64b857b77185"}, - {file = "cffi-1.15.1-cp310-cp310-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:3eb6971dcff08619f8d91607cfc726518b6fa2a9eba42856be181c6d0d9515fd"}, - {file = "cffi-1.15.1-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:21157295583fe8943475029ed5abdcf71eb3911894724e360acff1d61c1d54bc"}, - {file = "cffi-1.15.1-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:5635bd9cb9731e6d4a1132a498dd34f764034a8ce60cef4f5319c0541159392f"}, - {file = "cffi-1.15.1-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:2012c72d854c2d03e45d06ae57f40d78e5770d252f195b93f581acf3ba44496e"}, - {file = "cffi-1.15.1-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:dd86c085fae2efd48ac91dd7ccffcfc0571387fe1193d33b6394db7ef31fe2a4"}, - {file = "cffi-1.15.1-cp310-cp310-musllinux_1_1_i686.whl", hash = "sha256:fa6693661a4c91757f4412306191b6dc88c1703f780c8234035eac011922bc01"}, - {file = "cffi-1.15.1-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:59c0b02d0a6c384d453fece7566d1c7e6b7bae4fc5874ef2ef46d56776d61c9e"}, - {file = "cffi-1.15.1-cp310-cp310-win32.whl", hash = "sha256:cba9d6b9a7d64d4bd46167096fc9d2f835e25d7e4c121fb2ddfc6528fb0413b2"}, - {file = "cffi-1.15.1-cp310-cp310-win_amd64.whl", hash = "sha256:ce4bcc037df4fc5e3d184794f27bdaab018943698f4ca31630bc7f84a7b69c6d"}, - {file = "cffi-1.15.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:3d08afd128ddaa624a48cf2b859afef385b720bb4b43df214f85616922e6a5ac"}, - {file = "cffi-1.15.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:3799aecf2e17cf585d977b780ce79ff0dc9b78d799fc694221ce814c2c19db83"}, - {file = "cffi-1.15.1-cp311-cp311-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:a591fe9e525846e4d154205572a029f653ada1a78b93697f3b5a8f1f2bc055b9"}, - {file = "cffi-1.15.1-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:3548db281cd7d2561c9ad9984681c95f7b0e38881201e157833a2342c30d5e8c"}, - {file = "cffi-1.15.1-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:91fc98adde3d7881af9b59ed0294046f3806221863722ba7d8d120c575314325"}, - {file = "cffi-1.15.1-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:94411f22c3985acaec6f83c6df553f2dbe17b698cc7f8ae751ff2237d96b9e3c"}, - {file = "cffi-1.15.1-cp311-cp311-musllinux_1_1_i686.whl", hash = "sha256:03425bdae262c76aad70202debd780501fabeaca237cdfddc008987c0e0f59ef"}, - {file = "cffi-1.15.1-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:cc4d65aeeaa04136a12677d3dd0b1c0c94dc43abac5860ab33cceb42b801c1e8"}, - {file = "cffi-1.15.1-cp311-cp311-win32.whl", hash = "sha256:a0f100c8912c114ff53e1202d0078b425bee3649ae34d7b070e9697f93c5d52d"}, - {file = "cffi-1.15.1-cp311-cp311-win_amd64.whl", hash = "sha256:04ed324bda3cda42b9b695d51bb7d54b680b9719cfab04227cdd1e04e5de3104"}, - {file = "cffi-1.15.1-cp36-cp36m-macosx_10_9_x86_64.whl", hash = "sha256:50a74364d85fd319352182ef59c5c790484a336f6db772c1a9231f1c3ed0cbd7"}, - {file = "cffi-1.15.1-cp36-cp36m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:e263d77ee3dd201c3a142934a086a4450861778baaeeb45db4591ef65550b0a6"}, - {file = "cffi-1.15.1-cp36-cp36m-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:cec7d9412a9102bdc577382c3929b337320c4c4c4849f2c5cdd14d7368c5562d"}, - {file = "cffi-1.15.1-cp36-cp36m-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:4289fc34b2f5316fbb762d75362931e351941fa95fa18789191b33fc4cf9504a"}, - {file = "cffi-1.15.1-cp36-cp36m-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:173379135477dc8cac4bc58f45db08ab45d228b3363adb7af79436135d028405"}, - {file = "cffi-1.15.1-cp36-cp36m-manylinux_2_5_x86_64.manylinux1_x86_64.whl", hash = "sha256:6975a3fac6bc83c4a65c9f9fcab9e47019a11d3d2cf7f3c0d03431bf145a941e"}, - {file = "cffi-1.15.1-cp36-cp36m-win32.whl", hash = "sha256:2470043b93ff09bf8fb1d46d1cb756ce6132c54826661a32d4e4d132e1977adf"}, - {file = "cffi-1.15.1-cp36-cp36m-win_amd64.whl", hash = "sha256:30d78fbc8ebf9c92c9b7823ee18eb92f2e6ef79b45ac84db507f52fbe3ec4497"}, - {file = "cffi-1.15.1-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:198caafb44239b60e252492445da556afafc7d1e3ab7a1fb3f0584ef6d742375"}, - {file = "cffi-1.15.1-cp37-cp37m-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:5ef34d190326c3b1f822a5b7a45f6c4535e2f47ed06fec77d3d799c450b2651e"}, - {file = "cffi-1.15.1-cp37-cp37m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:8102eaf27e1e448db915d08afa8b41d6c7ca7a04b7d73af6514df10a3e74bd82"}, - {file = "cffi-1.15.1-cp37-cp37m-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:5df2768244d19ab7f60546d0c7c63ce1581f7af8b5de3eb3004b9b6fc8a9f84b"}, - {file = "cffi-1.15.1-cp37-cp37m-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:a8c4917bd7ad33e8eb21e9a5bbba979b49d9a97acb3a803092cbc1133e20343c"}, - {file = "cffi-1.15.1-cp37-cp37m-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0e2642fe3142e4cc4af0799748233ad6da94c62a8bec3a6648bf8ee68b1c7426"}, - {file = "cffi-1.15.1-cp37-cp37m-win32.whl", hash = "sha256:e229a521186c75c8ad9490854fd8bbdd9a0c9aa3a524326b55be83b54d4e0ad9"}, - {file = "cffi-1.15.1-cp37-cp37m-win_amd64.whl", hash = "sha256:a0b71b1b8fbf2b96e41c4d990244165e2c9be83d54962a9a1d118fd8657d2045"}, - {file = "cffi-1.15.1-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:320dab6e7cb2eacdf0e658569d2575c4dad258c0fcc794f46215e1e39f90f2c3"}, - {file = "cffi-1.15.1-cp38-cp38-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:1e74c6b51a9ed6589199c787bf5f9875612ca4a8a0785fb2d4a84429badaf22a"}, - {file = "cffi-1.15.1-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:a5c84c68147988265e60416b57fc83425a78058853509c1b0629c180094904a5"}, - {file = "cffi-1.15.1-cp38-cp38-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:3b926aa83d1edb5aa5b427b4053dc420ec295a08e40911296b9eb1b6170f6cca"}, - {file = "cffi-1.15.1-cp38-cp38-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:87c450779d0914f2861b8526e035c5e6da0a3199d8f1add1a665e1cbc6fc6d02"}, - {file = "cffi-1.15.1-cp38-cp38-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:4f2c9f67e9821cad2e5f480bc8d83b8742896f1242dba247911072d4fa94c192"}, - {file = "cffi-1.15.1-cp38-cp38-win32.whl", hash = "sha256:8b7ee99e510d7b66cdb6c593f21c043c248537a32e0bedf02e01e9553a172314"}, - {file = "cffi-1.15.1-cp38-cp38-win_amd64.whl", hash = "sha256:00a9ed42e88df81ffae7a8ab6d9356b371399b91dbdf0c3cb1e84c03a13aceb5"}, - {file = "cffi-1.15.1-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:54a2db7b78338edd780e7ef7f9f6c442500fb0d41a5a4ea24fff1c929d5af585"}, - {file = "cffi-1.15.1-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:fcd131dd944808b5bdb38e6f5b53013c5aa4f334c5cad0c72742f6eba4b73db0"}, - {file = "cffi-1.15.1-cp39-cp39-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:7473e861101c9e72452f9bf8acb984947aa1661a7704553a9f6e4baa5ba64415"}, - {file = "cffi-1.15.1-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:6c9a799e985904922a4d207a94eae35c78ebae90e128f0c4e521ce339396be9d"}, - {file = "cffi-1.15.1-cp39-cp39-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:3bcde07039e586f91b45c88f8583ea7cf7a0770df3a1649627bf598332cb6984"}, - {file = "cffi-1.15.1-cp39-cp39-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:33ab79603146aace82c2427da5ca6e58f2b3f2fb5da893ceac0c42218a40be35"}, - {file = "cffi-1.15.1-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:5d598b938678ebf3c67377cdd45e09d431369c3b1a5b331058c338e201f12b27"}, - {file = "cffi-1.15.1-cp39-cp39-musllinux_1_1_i686.whl", hash = "sha256:db0fbb9c62743ce59a9ff687eb5f4afbe77e5e8403d6697f7446e5f609976f76"}, - {file = "cffi-1.15.1-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:98d85c6a2bef81588d9227dde12db8a7f47f639f4a17c9ae08e773aa9c697bf3"}, - {file = "cffi-1.15.1-cp39-cp39-win32.whl", hash = "sha256:40f4774f5a9d4f5e344f31a32b5096977b5d48560c5592e2f3d2c4374bd543ee"}, - {file = "cffi-1.15.1-cp39-cp39-win_amd64.whl", hash = "sha256:70df4e3b545a17496c9b3f41f5115e69a4f2e77e94e1d2a8e1070bc0c38c8a3c"}, - {file = "cffi-1.15.1.tar.gz", hash = "sha256:d400bfb9a37b1351253cb402671cea7e89bdecc294e8016a707f6d1d8ac934f9"}, -] - -[package.dependencies] -pycparser = "*" - -[[package]] -name = "cfgv" -version = "3.3.1" -description = "Validate configuration and produce human readable error messages." -optional = false -python-versions = ">=3.6.1" -files = [ - {file = "cfgv-3.3.1-py2.py3-none-any.whl", hash = "sha256:c6a0883f3917a037485059700b9e75da2464e6c27051014ad85ba6aaa5884426"}, - {file = "cfgv-3.3.1.tar.gz", hash = "sha256:f5a830efb9ce7a445376bb66ec94c638a9787422f96264c98edc6bdeed8ab736"}, -] - -[[package]] -name = "charset-normalizer" -version = "3.0.1" -description = "The Real First Universal Charset Detector. Open, modern and actively maintained alternative to Chardet." -optional = false -python-versions = "*" -files = [ - {file = "charset-normalizer-3.0.1.tar.gz", hash = "sha256:ebea339af930f8ca5d7a699b921106c6e29c617fe9606fa7baa043c1cdae326f"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:88600c72ef7587fe1708fd242b385b6ed4b8904976d5da0893e31df8b3480cb6"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:c75ffc45f25324e68ab238cb4b5c0a38cd1c3d7f1fb1f72b5541de469e2247db"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:db72b07027db150f468fbada4d85b3b2729a3db39178abf5c543b784c1254539"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:62595ab75873d50d57323a91dd03e6966eb79c41fa834b7a1661ed043b2d404d"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:ff6f3db31555657f3163b15a6b7c6938d08df7adbfc9dd13d9d19edad678f1e8"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:772b87914ff1152b92a197ef4ea40efe27a378606c39446ded52c8f80f79702e"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:70990b9c51340e4044cfc394a81f614f3f90d41397104d226f21e66de668730d"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:292d5e8ba896bbfd6334b096e34bffb56161c81408d6d036a7dfa6929cff8783"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:2edb64ee7bf1ed524a1da60cdcd2e1f6e2b4f66ef7c077680739f1641f62f555"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-musllinux_1_1_i686.whl", hash = "sha256:31a9ddf4718d10ae04d9b18801bd776693487cbb57d74cc3458a7673f6f34639"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-musllinux_1_1_ppc64le.whl", hash = "sha256:44ba614de5361b3e5278e1241fda3dc1838deed864b50a10d7ce92983797fa76"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-musllinux_1_1_s390x.whl", hash = "sha256:12db3b2c533c23ab812c2b25934f60383361f8a376ae272665f8e48b88e8e1c6"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:c512accbd6ff0270939b9ac214b84fb5ada5f0409c44298361b2f5e13f9aed9e"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-win32.whl", hash = "sha256:502218f52498a36d6bf5ea77081844017bf7982cdbe521ad85e64cabee1b608b"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-win_amd64.whl", hash = "sha256:601f36512f9e28f029d9481bdaf8e89e5148ac5d89cffd3b05cd533eeb423b59"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:0298eafff88c99982a4cf66ba2efa1128e4ddaca0b05eec4c456bbc7db691d8d"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:a8d0fc946c784ff7f7c3742310cc8a57c5c6dc31631269876a88b809dbeff3d3"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:87701167f2a5c930b403e9756fab1d31d4d4da52856143b609e30a1ce7160f3c"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:14e76c0f23218b8f46c4d87018ca2e441535aed3632ca134b10239dfb6dadd6b"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:0c0a590235ccd933d9892c627dec5bc7511ce6ad6c1011fdf5b11363022746c1"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:8c7fe7afa480e3e82eed58e0ca89f751cd14d767638e2550c77a92a9e749c317"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:79909e27e8e4fcc9db4addea88aa63f6423ebb171db091fb4373e3312cb6d603"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:8ac7b6a045b814cf0c47f3623d21ebd88b3e8cf216a14790b455ea7ff0135d18"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:72966d1b297c741541ca8cf1223ff262a6febe52481af742036a0b296e35fa5a"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-musllinux_1_1_i686.whl", hash = "sha256:f9d0c5c045a3ca9bedfc35dca8526798eb91a07aa7a2c0fee134c6c6f321cbd7"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-musllinux_1_1_ppc64le.whl", hash = "sha256:5995f0164fa7df59db4746112fec3f49c461dd6b31b841873443bdb077c13cfc"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-musllinux_1_1_s390x.whl", hash = "sha256:4a8fcf28c05c1f6d7e177a9a46a1c52798bfe2ad80681d275b10dcf317deaf0b"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:761e8904c07ad053d285670f36dd94e1b6ab7f16ce62b9805c475b7aa1cffde6"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-win32.whl", hash = "sha256:71140351489970dfe5e60fc621ada3e0f41104a5eddaca47a7acb3c1b851d6d3"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-win_amd64.whl", hash = "sha256:9ab77acb98eba3fd2a85cd160851816bfce6871d944d885febf012713f06659c"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-macosx_10_9_x86_64.whl", hash = "sha256:84c3990934bae40ea69a82034912ffe5a62c60bbf6ec5bc9691419641d7d5c9a"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:74292fc76c905c0ef095fe11e188a32ebd03bc38f3f3e9bcb85e4e6db177b7ea"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:c95a03c79bbe30eec3ec2b7f076074f4281526724c8685a42872974ef4d36b72"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:f4c39b0e3eac288fedc2b43055cfc2ca7a60362d0e5e87a637beac5d801ef478"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:df2c707231459e8a4028eabcd3cfc827befd635b3ef72eada84ab13b52e1574d"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:93ad6d87ac18e2a90b0fe89df7c65263b9a99a0eb98f0a3d2e079f12a0735837"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-musllinux_1_1_aarch64.whl", hash = "sha256:59e5686dd847347e55dffcc191a96622f016bc0ad89105e24c14e0d6305acbc6"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-musllinux_1_1_i686.whl", hash = "sha256:cd6056167405314a4dc3c173943f11249fa0f1b204f8b51ed4bde1a9cd1834dc"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-musllinux_1_1_ppc64le.whl", hash = "sha256:083c8d17153ecb403e5e1eb76a7ef4babfc2c48d58899c98fcaa04833e7a2f9a"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-musllinux_1_1_s390x.whl", hash = "sha256:f5057856d21e7586765171eac8b9fc3f7d44ef39425f85dbcccb13b3ebea806c"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-musllinux_1_1_x86_64.whl", hash = "sha256:7eb33a30d75562222b64f569c642ff3dc6689e09adda43a082208397f016c39a"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-win32.whl", hash = "sha256:95dea361dd73757c6f1c0a1480ac499952c16ac83f7f5f4f84f0658a01b8ef41"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-win_amd64.whl", hash = "sha256:eaa379fcd227ca235d04152ca6704c7cb55564116f8bc52545ff357628e10602"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:3e45867f1f2ab0711d60c6c71746ac53537f1684baa699f4f668d4c6f6ce8e14"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:cadaeaba78750d58d3cc6ac4d1fd867da6fc73c88156b7a3212a3cd4819d679d"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:911d8a40b2bef5b8bbae2e36a0b103f142ac53557ab421dc16ac4aafee6f53dc"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:503e65837c71b875ecdd733877d852adbc465bd82c768a067badd953bf1bc5a3"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:a60332922359f920193b1d4826953c507a877b523b2395ad7bc716ddd386d866"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:16a8663d6e281208d78806dbe14ee9903715361cf81f6d4309944e4d1e59ac5b"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-musllinux_1_1_aarch64.whl", hash = "sha256:a16418ecf1329f71df119e8a65f3aa68004a3f9383821edcb20f0702934d8087"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-musllinux_1_1_i686.whl", hash = "sha256:9d9153257a3f70d5f69edf2325357251ed20f772b12e593f3b3377b5f78e7ef8"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-musllinux_1_1_ppc64le.whl", hash = "sha256:02a51034802cbf38db3f89c66fb5d2ec57e6fe7ef2f4a44d070a593c3688667b"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-musllinux_1_1_s390x.whl", hash = "sha256:2e396d70bc4ef5325b72b593a72c8979999aa52fb8bcf03f701c1b03e1166918"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-musllinux_1_1_x86_64.whl", hash = "sha256:11b53acf2411c3b09e6af37e4b9005cba376c872503c8f28218c7243582df45d"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-win32.whl", hash = "sha256:0bf2dae5291758b6f84cf923bfaa285632816007db0330002fa1de38bfcb7154"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-win_amd64.whl", hash = "sha256:2c03cc56021a4bd59be889c2b9257dae13bf55041a3372d3295416f86b295fb5"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-macosx_10_9_universal2.whl", hash = "sha256:024e606be3ed92216e2b6952ed859d86b4cfa52cd5bc5f050e7dc28f9b43ec42"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:4b0d02d7102dd0f997580b51edc4cebcf2ab6397a7edf89f1c73b586c614272c"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-macosx_11_0_arm64.whl", hash = "sha256:358a7c4cb8ba9b46c453b1dd8d9e431452d5249072e4f56cfda3149f6ab1405e"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:81d6741ab457d14fdedc215516665050f3822d3e56508921cc7239f8c8e66a58"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:8b8af03d2e37866d023ad0ddea594edefc31e827fee64f8de5611a1dbc373174"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:9cf4e8ad252f7c38dd1f676b46514f92dc0ebeb0db5552f5f403509705e24753"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:e696f0dd336161fca9adbb846875d40752e6eba585843c768935ba5c9960722b"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:c22d3fe05ce11d3671297dc8973267daa0f938b93ec716e12e0f6dee81591dc1"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-musllinux_1_1_aarch64.whl", hash = "sha256:109487860ef6a328f3eec66f2bf78b0b72400280d8f8ea05f69c51644ba6521a"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-musllinux_1_1_i686.whl", hash = "sha256:37f8febc8ec50c14f3ec9637505f28e58d4f66752207ea177c1d67df25da5aed"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-musllinux_1_1_ppc64le.whl", hash = "sha256:f97e83fa6c25693c7a35de154681fcc257c1c41b38beb0304b9c4d2d9e164479"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-musllinux_1_1_s390x.whl", hash = "sha256:a152f5f33d64a6be73f1d30c9cc82dfc73cec6477ec268e7c6e4c7d23c2d2291"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-musllinux_1_1_x86_64.whl", hash = "sha256:39049da0ffb96c8cbb65cbf5c5f3ca3168990adf3551bd1dee10c48fce8ae820"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-win32.whl", hash = "sha256:4457ea6774b5611f4bed5eaa5df55f70abde42364d498c5134b7ef4c6958e20e"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-win_amd64.whl", hash = "sha256:e62164b50f84e20601c1ff8eb55620d2ad25fb81b59e3cd776a1902527a788af"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:8eade758719add78ec36dc13201483f8e9b5d940329285edcd5f70c0a9edbd7f"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:8499ca8f4502af841f68135133d8258f7b32a53a1d594aa98cc52013fff55678"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:3fc1c4a2ffd64890aebdb3f97e1278b0cc72579a08ca4de8cd2c04799a3a22be"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:00d3ffdaafe92a5dc603cb9bd5111aaa36dfa187c8285c543be562e61b755f6b"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:c2ac1b08635a8cd4e0cbeaf6f5e922085908d48eb05d44c5ae9eabab148512ca"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:f6f45710b4459401609ebebdbcfb34515da4fc2aa886f95107f556ac69a9147e"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:3ae1de54a77dc0d6d5fcf623290af4266412a7c4be0b1ff7444394f03f5c54e3"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:3b590df687e3c5ee0deef9fc8c547d81986d9a1b56073d82de008744452d6541"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-musllinux_1_1_aarch64.whl", hash = "sha256:ab5de034a886f616a5668aa5d098af2b5385ed70142090e2a31bcbd0af0fdb3d"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-musllinux_1_1_i686.whl", hash = "sha256:9cb3032517f1627cc012dbc80a8ec976ae76d93ea2b5feaa9d2a5b8882597579"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-musllinux_1_1_ppc64le.whl", hash = "sha256:608862a7bf6957f2333fc54ab4399e405baad0163dc9f8d99cb236816db169d4"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-musllinux_1_1_s390x.whl", hash = "sha256:0f438ae3532723fb6ead77e7c604be7c8374094ef4ee2c5e03a3a17f1fca256c"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:356541bf4381fa35856dafa6a965916e54bed415ad8a24ee6de6e37deccf2786"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-win32.whl", hash = "sha256:39cf9ed17fe3b1bc81f33c9ceb6ce67683ee7526e65fde1447c772afc54a1bb8"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-win_amd64.whl", hash = "sha256:0a11e971ed097d24c534c037d298ad32c6ce81a45736d31e0ff0ad37ab437d59"}, - {file = "charset_normalizer-3.0.1-py3-none-any.whl", hash = "sha256:7e189e2e1d3ed2f4aebabd2d5b0f931e883676e51c7624826e0a4e5fe8a0bf24"}, -] - -[[package]] -name = "chromedriver-autoinstaller" -version = "0.4.0" -description = "Automatically install chromedriver that supports the currently installed version of chrome." -optional = false -python-versions = ">=3.6" -files = [ - {file = "chromedriver-autoinstaller-0.4.0.tar.gz", hash = "sha256:57f15f40d2e356c4cb84870cb7f882283a8280118bedacbf19301dd692f672b5"}, - {file = "chromedriver_autoinstaller-0.4.0-py3-none-any.whl", hash = "sha256:1534d39903d22379ff13435d695703ae9b14ddb336d43556fd7735854ada6d2b"}, -] - -[[package]] -name = "click" -version = "8.1.4" -description = "Composable command line interface toolkit" -optional = false -python-versions = ">=3.7" -files = [ - {file = "click-8.1.4-py3-none-any.whl", hash = "sha256:2739815aaa5d2c986a88f1e9230c55e17f0caad3d958a5e13ad0797c166db9e3"}, - {file = "click-8.1.4.tar.gz", hash = "sha256:b97d0c74955da062a7d4ef92fadb583806a585b2ea81958a81bd72726cbb8e37"}, -] - -[package.dependencies] -colorama = {version = "*", markers = "platform_system == \"Windows\""} - -[[package]] -name = "click-shell" -version = "2.1" -description = "An extension to click that easily turns your click app into a shell utility" -optional = false -python-versions = "*" -files = [ - {file = "click-shell-2.1.tar.gz", hash = "sha256:ce0c91faae284c41a39bec966f928791ad4a45763755445f1fe2041fd091aa37"}, - {file = "click_shell-2.1-py2.py3-none-any.whl", hash = "sha256:2d971a2e50eb7ad387cf0ce79ba4b844e66e0580784e2efe2df58b50a2f047f0"}, -] - -[package.dependencies] -click = ">=6.0" - -[package.extras] -readline = ["gnureadline"] -windows = ["pyreadline"] - -[[package]] -name = "cloudscraper" -version = "1.2.69" -description = "A Python module to bypass Cloudflare's anti-bot page." -optional = false -python-versions = "*" -files = [ - {file = "cloudscraper-1.2.69-py2.py3-none-any.whl", hash = "sha256:ad1e70be61fa071bc9a1409c2f419687b49a1780405ad8a226df59b52fb135db"}, - {file = "cloudscraper-1.2.69.tar.gz", hash = "sha256:1ff4befeeae63a67076c0264515162935981dd5d51552f052dc266bf64997345"}, -] - -[package.dependencies] -pyparsing = ">=2.4.7" -requests = ">=2.9.2" -requests-toolbelt = ">=0.9.1" - -[[package]] -name = "colorama" -version = "0.4.6" -description = "Cross-platform colored terminal text." -optional = false -python-versions = "!=3.0.*,!=3.1.*,!=3.2.*,!=3.3.*,!=3.4.*,!=3.5.*,!=3.6.*,>=2.7" -files = [ - {file = "colorama-0.4.6-py2.py3-none-any.whl", hash = "sha256:4f1d9991f5acc0ca119f9d443620b77f9d6b33703e51011c16baf57afb285fc6"}, - {file = "colorama-0.4.6.tar.gz", hash = "sha256:08695f5cb7ed6e0531a20572697297273c47b8cae5a63ffc6d6ed5c201be6e44"}, -] - -[[package]] -name = "coverage" -version = "7.2.3" -description = "Code coverage measurement for Python" -optional = false -python-versions = ">=3.7" -files = [ - {file = "coverage-7.2.3-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:e58c0d41d336569d63d1b113bd573db8363bc4146f39444125b7f8060e4e04f5"}, - {file = "coverage-7.2.3-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:344e714bd0fe921fc72d97404ebbdbf9127bac0ca1ff66d7b79efc143cf7c0c4"}, - {file = "coverage-7.2.3-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:974bc90d6f6c1e59ceb1516ab00cf1cdfbb2e555795d49fa9571d611f449bcb2"}, - {file = "coverage-7.2.3-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:0743b0035d4b0e32bc1df5de70fba3059662ace5b9a2a86a9f894cfe66569013"}, - {file = "coverage-7.2.3-cp310-cp310-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:5d0391fb4cfc171ce40437f67eb050a340fdbd0f9f49d6353a387f1b7f9dd4fa"}, - {file = "coverage-7.2.3-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:4a42e1eff0ca9a7cb7dc9ecda41dfc7cbc17cb1d02117214be0561bd1134772b"}, - {file = "coverage-7.2.3-cp310-cp310-musllinux_1_1_i686.whl", hash = "sha256:be19931a8dcbe6ab464f3339966856996b12a00f9fe53f346ab3be872d03e257"}, - {file = "coverage-7.2.3-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:72fcae5bcac3333a4cf3b8f34eec99cea1187acd55af723bcbd559adfdcb5535"}, - {file = "coverage-7.2.3-cp310-cp310-win32.whl", hash = "sha256:aeae2aa38395b18106e552833f2a50c27ea0000122bde421c31d11ed7e6f9c91"}, - {file = "coverage-7.2.3-cp310-cp310-win_amd64.whl", hash = "sha256:83957d349838a636e768251c7e9979e899a569794b44c3728eaebd11d848e58e"}, - {file = "coverage-7.2.3-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:dfd393094cd82ceb9b40df4c77976015a314b267d498268a076e940fe7be6b79"}, - {file = "coverage-7.2.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:182eb9ac3f2b4874a1f41b78b87db20b66da6b9cdc32737fbbf4fea0c35b23fc"}, - {file = "coverage-7.2.3-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:1bb1e77a9a311346294621be905ea8a2c30d3ad371fc15bb72e98bfcfae532df"}, - {file = "coverage-7.2.3-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:ca0f34363e2634deffd390a0fef1aa99168ae9ed2af01af4a1f5865e362f8623"}, - {file = "coverage-7.2.3-cp311-cp311-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:55416d7385774285b6e2a5feca0af9652f7f444a4fa3d29d8ab052fafef9d00d"}, - {file = "coverage-7.2.3-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:06ddd9c0249a0546997fdda5a30fbcb40f23926df0a874a60a8a185bc3a87d93"}, - {file = "coverage-7.2.3-cp311-cp311-musllinux_1_1_i686.whl", hash = "sha256:fff5aaa6becf2c6a1699ae6a39e2e6fb0672c2d42eca8eb0cafa91cf2e9bd312"}, - {file = "coverage-7.2.3-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:ea53151d87c52e98133eb8ac78f1206498c015849662ca8dc246255265d9c3c4"}, - {file = "coverage-7.2.3-cp311-cp311-win32.whl", hash = "sha256:8f6c930fd70d91ddee53194e93029e3ef2aabe26725aa3c2753df057e296b925"}, - {file = "coverage-7.2.3-cp311-cp311-win_amd64.whl", hash = "sha256:fa546d66639d69aa967bf08156eb8c9d0cd6f6de84be9e8c9819f52ad499c910"}, - {file = "coverage-7.2.3-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:b2317d5ed777bf5a033e83d4f1389fd4ef045763141d8f10eb09a7035cee774c"}, - {file = "coverage-7.2.3-cp37-cp37m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:be9824c1c874b73b96288c6d3de793bf7f3a597770205068c6163ea1f326e8b9"}, - {file = "coverage-7.2.3-cp37-cp37m-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:2c3b2803e730dc2797a017335827e9da6da0e84c745ce0f552e66400abdfb9a1"}, - {file = "coverage-7.2.3-cp37-cp37m-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8f69770f5ca1994cb32c38965e95f57504d3aea96b6c024624fdd5bb1aa494a1"}, - {file = "coverage-7.2.3-cp37-cp37m-musllinux_1_1_aarch64.whl", hash = "sha256:1127b16220f7bfb3f1049ed4a62d26d81970a723544e8252db0efde853268e21"}, - {file = "coverage-7.2.3-cp37-cp37m-musllinux_1_1_i686.whl", hash = "sha256:aa784405f0c640940595fa0f14064d8e84aff0b0f762fa18393e2760a2cf5841"}, - {file = "coverage-7.2.3-cp37-cp37m-musllinux_1_1_x86_64.whl", hash = "sha256:3146b8e16fa60427e03884301bf8209221f5761ac754ee6b267642a2fd354c48"}, - {file = "coverage-7.2.3-cp37-cp37m-win32.whl", hash = "sha256:1fd78b911aea9cec3b7e1e2622c8018d51c0d2bbcf8faaf53c2497eb114911c1"}, - {file = "coverage-7.2.3-cp37-cp37m-win_amd64.whl", hash = "sha256:0f3736a5d34e091b0a611964c6262fd68ca4363df56185902528f0b75dbb9c1f"}, - {file = "coverage-7.2.3-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:981b4df72c93e3bc04478153df516d385317628bd9c10be699c93c26ddcca8ab"}, - {file = "coverage-7.2.3-cp38-cp38-macosx_11_0_arm64.whl", hash = "sha256:c0045f8f23a5fb30b2eb3b8a83664d8dc4fb58faddf8155d7109166adb9f2040"}, - {file = "coverage-7.2.3-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:f760073fcf8f3d6933178d67754f4f2d4e924e321f4bb0dcef0424ca0215eba1"}, - {file = "coverage-7.2.3-cp38-cp38-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:c86bd45d1659b1ae3d0ba1909326b03598affbc9ed71520e0ff8c31a993ad911"}, - {file = "coverage-7.2.3-cp38-cp38-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:172db976ae6327ed4728e2507daf8a4de73c7cc89796483e0a9198fd2e47b462"}, - {file = "coverage-7.2.3-cp38-cp38-musllinux_1_1_aarch64.whl", hash = "sha256:d2a3a6146fe9319926e1d477842ca2a63fe99af5ae690b1f5c11e6af074a6b5c"}, - {file = "coverage-7.2.3-cp38-cp38-musllinux_1_1_i686.whl", hash = "sha256:f649dd53833b495c3ebd04d6eec58479454a1784987af8afb77540d6c1767abd"}, - {file = "coverage-7.2.3-cp38-cp38-musllinux_1_1_x86_64.whl", hash = "sha256:7c4ed4e9f3b123aa403ab424430b426a1992e6f4c8fd3cb56ea520446e04d152"}, - {file = "coverage-7.2.3-cp38-cp38-win32.whl", hash = "sha256:eb0edc3ce9760d2f21637766c3aa04822030e7451981ce569a1b3456b7053f22"}, - {file = "coverage-7.2.3-cp38-cp38-win_amd64.whl", hash = "sha256:63cdeaac4ae85a179a8d6bc09b77b564c096250d759eed343a89d91bce8b6367"}, - {file = "coverage-7.2.3-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:20d1a2a76bb4eb00e4d36b9699f9b7aba93271c9c29220ad4c6a9581a0320235"}, - {file = "coverage-7.2.3-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:4ea748802cc0de4de92ef8244dd84ffd793bd2e7be784cd8394d557a3c751e21"}, - {file = "coverage-7.2.3-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:21b154aba06df42e4b96fc915512ab39595105f6c483991287021ed95776d934"}, - {file = "coverage-7.2.3-cp39-cp39-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:fd214917cabdd6f673a29d708574e9fbdb892cb77eb426d0eae3490d95ca7859"}, - {file = "coverage-7.2.3-cp39-cp39-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:2c2e58e45fe53fab81f85474e5d4d226eeab0f27b45aa062856c89389da2f0d9"}, - {file = "coverage-7.2.3-cp39-cp39-musllinux_1_1_aarch64.whl", hash = "sha256:87ecc7c9a1a9f912e306997ffee020297ccb5ea388421fe62a2a02747e4d5539"}, - {file = "coverage-7.2.3-cp39-cp39-musllinux_1_1_i686.whl", hash = "sha256:387065e420aed3c71b61af7e82c7b6bc1c592f7e3c7a66e9f78dd178699da4fe"}, - {file = "coverage-7.2.3-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:ea3f5bc91d7d457da7d48c7a732beaf79d0c8131df3ab278e6bba6297e23c6c4"}, - {file = "coverage-7.2.3-cp39-cp39-win32.whl", hash = "sha256:ae7863a1d8db6a014b6f2ff9c1582ab1aad55a6d25bac19710a8df68921b6e30"}, - {file = "coverage-7.2.3-cp39-cp39-win_amd64.whl", hash = "sha256:3f04becd4fcda03c0160d0da9c8f0c246bc78f2f7af0feea1ec0930e7c93fa4a"}, - {file = "coverage-7.2.3-pp37.pp38.pp39-none-any.whl", hash = "sha256:965ee3e782c7892befc25575fa171b521d33798132692df428a09efacaffe8d0"}, - {file = "coverage-7.2.3.tar.gz", hash = "sha256:d298c2815fa4891edd9abe5ad6e6cb4207104c7dd9fd13aea3fdebf6f9b91259"}, -] - -[package.dependencies] -tomli = {version = "*", optional = true, markers = "python_full_version <= \"3.11.0a6\" and extra == \"toml\""} - -[package.extras] -toml = ["tomli"] - -[[package]] -name = "coverage-badge" -version = "1.1.0" -description = "Generate coverage badges for Coverage.py." -optional = false -python-versions = "*" -files = [ - {file = "coverage-badge-1.1.0.tar.gz", hash = "sha256:c824a106503e981c02821e7d32f008fb3984b2338aa8c3800ec9357e33345b78"}, - {file = "coverage_badge-1.1.0-py2.py3-none-any.whl", hash = "sha256:e365d56e5202e923d1b237f82defd628a02d1d645a147f867ac85c58c81d7997"}, -] - -[package.dependencies] -coverage = "*" - -[[package]] -name = "darglint" -version = "1.8.1" -description = "A utility for ensuring Google-style docstrings stay up to date with the source code." -optional = false -python-versions = ">=3.6,<4.0" -files = [ - {file = "darglint-1.8.1-py3-none-any.whl", hash = "sha256:5ae11c259c17b0701618a20c3da343a3eb98b3bc4b5a83d31cdd94f5ebdced8d"}, - {file = "darglint-1.8.1.tar.gz", hash = "sha256:080d5106df149b199822e7ee7deb9c012b49891538f14a11be681044f0bb20da"}, -] - -[[package]] -name = "deprecated" -version = "1.2.13" -description = "Python @deprecated decorator to deprecate old python classes, functions or methods." -optional = false -python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*" -files = [ - {file = "Deprecated-1.2.13-py2.py3-none-any.whl", hash = "sha256:64756e3e14c8c5eea9795d93c524551432a0be75629f8f29e67ab8caf076c76d"}, - {file = "Deprecated-1.2.13.tar.gz", hash = "sha256:43ac5335da90c31c24ba028af536a91d41d53f9e6901ddb021bcc572ce44e38d"}, -] - -[package.dependencies] -wrapt = ">=1.10,<2" - -[package.extras] -dev = ["PyTest", "PyTest (<5)", "PyTest-Cov", "PyTest-Cov (<2.6)", "bump2version (<1)", "configparser (<5)", "importlib-metadata (<3)", "importlib-resources (<4)", "sphinx (<2)", "sphinxcontrib-websupport (<2)", "tox", "zipp (<2)"] - -[[package]] -name = "dill" -version = "0.3.6" -description = "serialize all of python" -optional = false -python-versions = ">=3.7" -files = [ - {file = "dill-0.3.6-py3-none-any.whl", hash = "sha256:a07ffd2351b8c678dfc4a856a3005f8067aea51d6ba6c700796a4d9e280f39f0"}, - {file = "dill-0.3.6.tar.gz", hash = "sha256:e5db55f3687856d8fbdab002ed78544e1c4559a130302693d839dfe8f93f2373"}, -] - -[package.extras] -graph = ["objgraph (>=1.7.2)"] - -[[package]] -name = "distlib" -version = "0.3.6" -description = "Distribution utilities" -optional = false -python-versions = "*" -files = [ - {file = "distlib-0.3.6-py2.py3-none-any.whl", hash = "sha256:f35c4b692542ca110de7ef0bea44d73981caeb34ca0b9b6b2e6d7790dda8f80e"}, - {file = "distlib-0.3.6.tar.gz", hash = "sha256:14bad2d9b04d3a36127ac97f30b12a19268f211063d8f8ee4f47108896e11b46"}, -] - -[[package]] -name = "dparse" -version = "0.6.2" -description = "A parser for Python dependency files" -optional = false -python-versions = ">=3.5" -files = [ - {file = "dparse-0.6.2-py3-none-any.whl", hash = "sha256:8097076f1dd26c377f30d4745e6ec18fef42f3bf493933b842ac5bafad8c345f"}, - {file = "dparse-0.6.2.tar.gz", hash = "sha256:d45255bda21f998bc7ddf2afd5e62505ba6134756ba2d42a84c56b0826614dfe"}, -] - -[package.dependencies] -packaging = "*" -toml = "*" - -[package.extras] -conda = ["pyyaml"] -pipenv = ["pipenv"] - -[[package]] -name = "exceptiongroup" -version = "1.1.0" -description = "Backport of PEP 654 (exception groups)" -optional = false -python-versions = ">=3.7" -files = [ - {file = "exceptiongroup-1.1.0-py3-none-any.whl", hash = "sha256:327cbda3da756e2de031a3107b81ab7b3770a602c4d16ca618298c526f4bec1e"}, - {file = "exceptiongroup-1.1.0.tar.gz", hash = "sha256:bcb67d800a4497e1b404c2dd44fca47d3b7a5e5433dbab67f96c1a685cdfdf23"}, -] - -[package.extras] -test = ["pytest (>=6)"] - -[[package]] -name = "fastapi" -version = "0.92.0" -description = "FastAPI framework, high performance, easy to learn, fast to code, ready for production" -optional = false -python-versions = ">=3.7" -files = [ - {file = "fastapi-0.92.0-py3-none-any.whl", hash = "sha256:ae7b97c778e2f2ec3fb3cb4fb14162129411d99907fb71920f6d69a524340ebf"}, - {file = "fastapi-0.92.0.tar.gz", hash = "sha256:023a0f5bd2c8b2609014d3bba1e14a1d7df96c6abea0a73070621c9862b9a4de"}, -] - -[package.dependencies] -pydantic = ">=1.6.2,<1.7 || >1.7,<1.7.1 || >1.7.1,<1.7.2 || >1.7.2,<1.7.3 || >1.7.3,<1.8 || >1.8,<1.8.1 || >1.8.1,<2.0.0" -starlette = ">=0.25.0,<0.26.0" - -[package.extras] -all = ["email-validator (>=1.1.1)", "httpx (>=0.23.0)", "itsdangerous (>=1.1.0)", "jinja2 (>=2.11.2)", "orjson (>=3.2.1)", "python-multipart (>=0.0.5)", "pyyaml (>=5.3.1)", "ujson (>=4.0.1,!=4.0.2,!=4.1.0,!=4.2.0,!=4.3.0,!=5.0.0,!=5.1.0)", "uvicorn[standard] (>=0.12.0)"] -dev = ["pre-commit (>=2.17.0,<3.0.0)", "ruff (==0.0.138)", "uvicorn[standard] (>=0.12.0,<0.21.0)"] -doc = ["mdx-include (>=1.4.1,<2.0.0)", "mkdocs (>=1.1.2,<2.0.0)", "mkdocs-markdownextradata-plugin (>=0.1.7,<0.3.0)", "mkdocs-material (>=8.1.4,<9.0.0)", "pyyaml (>=5.3.1,<7.0.0)", "typer[all] (>=0.6.1,<0.8.0)"] -test = ["anyio[trio] (>=3.2.1,<4.0.0)", "black (==22.10.0)", "coverage[toml] (>=6.5.0,<8.0)", "databases[sqlite] (>=0.3.2,<0.7.0)", "email-validator (>=1.1.1,<2.0.0)", "flask (>=1.1.2,<3.0.0)", "httpx (>=0.23.0,<0.24.0)", "isort (>=5.0.6,<6.0.0)", "mypy (==0.982)", "orjson (>=3.2.1,<4.0.0)", "passlib[bcrypt] (>=1.7.2,<2.0.0)", "peewee (>=3.13.3,<4.0.0)", "pytest (>=7.1.3,<8.0.0)", "python-jose[cryptography] (>=3.3.0,<4.0.0)", "python-multipart (>=0.0.5,<0.0.6)", "pyyaml (>=5.3.1,<7.0.0)", "ruff (==0.0.138)", "sqlalchemy (>=1.3.18,<1.4.43)", "types-orjson (==3.6.2)", "types-ujson (==5.6.0.0)", "ujson (>=4.0.1,!=4.0.2,!=4.1.0,!=4.2.0,!=4.3.0,!=5.0.0,!=5.1.0,<6.0.0)"] - -[[package]] -name = "fastapi-queue" -version = "0.1.1" -description = "A task queue based on redis that can serve as a peak shaver and protect your app." -optional = false -python-versions = ">=3.7" -files = [ - {file = "fastapi-queue-0.1.1.tar.gz", hash = "sha256:6a9ff8250adb0dcff2b507b2b78bac2197ed2af2b9aa50f690ef05910ed67a3d"}, - {file = "fastapi_queue-0.1.1-py3-none-any.whl", hash = "sha256:ea9d7599cee3a1901aa2a0b51382cb9875d9cedb07f91d7b863cb2ca8a0c2be0"}, -] - -[package.dependencies] -aioredis = "*" -fastapi = {version = "*", extras = ["standard"]} -loguru = "*" -msgpack = ">=1.0.0" -ThreadPoolExecutorPlus = "*" -uvicorn = "*" - -[[package]] -name = "filelock" -version = "3.11.0" -description = "A platform independent file lock." -optional = false -python-versions = ">=3.7" -files = [ - {file = "filelock-3.11.0-py3-none-any.whl", hash = "sha256:f08a52314748335c6460fc8fe40cd5638b85001225db78c2aa01c8c0db83b318"}, - {file = "filelock-3.11.0.tar.gz", hash = "sha256:3618c0da67adcc0506b015fd11ef7faf1b493f0b40d87728e19986b536890c37"}, -] - -[package.extras] -docs = ["furo (>=2023.3.27)", "sphinx (>=6.1.3)", "sphinx-autodoc-typehints (>=1.22,!=1.23.4)"] -testing = ["covdefaults (>=2.3)", "coverage (>=7.2.2)", "diff-cover (>=7.5)", "pytest (>=7.2.2)", "pytest-cov (>=4)", "pytest-mock (>=3.10)", "pytest-timeout (>=2.1)"] - -[[package]] -name = "gitdb" -version = "4.0.10" -description = "Git Object Database" -optional = false -python-versions = ">=3.7" -files = [ - {file = "gitdb-4.0.10-py3-none-any.whl", hash = "sha256:c286cf298426064079ed96a9e4a9d39e7f3e9bf15ba60701e95f5492f28415c7"}, - {file = "gitdb-4.0.10.tar.gz", hash = "sha256:6eb990b69df4e15bad899ea868dc46572c3f75339735663b81de79b06f17eb9a"}, -] - -[package.dependencies] -smmap = ">=3.0.1,<6" - -[[package]] -name = "gitpython" -version = "3.1.31" -description = "GitPython is a Python library used to interact with Git repositories" -optional = false -python-versions = ">=3.7" -files = [ - {file = "GitPython-3.1.31-py3-none-any.whl", hash = "sha256:f04893614f6aa713a60cbbe1e6a97403ef633103cdd0ef5eb6efe0deb98dbe8d"}, - {file = "GitPython-3.1.31.tar.gz", hash = "sha256:8ce3bcf69adfdf7c7d503e78fd3b1c492af782d58893b650adb2ac8912ddd573"}, -] - -[package.dependencies] -gitdb = ">=4.0.1,<5" - -[[package]] -name = "gtts" -version = "2.3.1" -description = "gTTS (Google Text-to-Speech), a Python library and CLI tool to interface with Google Translate text-to-speech API" -optional = false -python-versions = ">=3.7" -files = [ - {file = "gTTS-2.3.1-py3-none-any.whl", hash = "sha256:7123ba91d415340f3264266adc195ff69f89b07f97ddafcfe48c9dad66f005c8"}, - {file = "gTTS-2.3.1.tar.gz", hash = "sha256:fad26bccf0408aa8373ca8323f10731dc5b0c59eb5a0617591efe47ff30d4fcb"}, -] - -[package.dependencies] -click = ">=7.1,<8.2" -requests = ">=2.27,<3" - -[package.extras] -docs = ["sphinx", "sphinx-autobuild", "sphinx-click", "sphinx-mdinclude", "sphinx-rtd-theme"] -tests = ["pytest (>=7.1.3,<7.2.0)", "pytest-cov", "testfixtures"] - -[[package]] -name = "h11" -version = "0.14.0" -description = "A pure-Python, bring-your-own-I/O implementation of HTTP/1.1" -optional = false -python-versions = ">=3.7" -files = [ - {file = "h11-0.14.0-py3-none-any.whl", hash = "sha256:e3fe4ac4b851c468cc8363d500db52c2ead036020723024a109d37346efaa761"}, - {file = "h11-0.14.0.tar.gz", hash = "sha256:8f19fbbe99e72420ff35c00b27a34cb9937e902a8b810e2c88300c6f0a3b699d"}, -] - -[[package]] -name = "identify" -version = "2.5.18" -description = "File identification library for Python" -optional = false -python-versions = ">=3.7" -files = [ - {file = "identify-2.5.18-py2.py3-none-any.whl", hash = "sha256:93aac7ecf2f6abf879b8f29a8002d3c6de7086b8c28d88e1ad15045a15ab63f9"}, - {file = "identify-2.5.18.tar.gz", hash = "sha256:89e144fa560cc4cffb6ef2ab5e9fb18ed9f9b3cb054384bab4b95c12f6c309fe"}, -] - -[package.extras] -license = ["ukkonen"] - -[[package]] -name = "idna" -version = "3.4" -description = "Internationalized Domain Names in Applications (IDNA)" -optional = false -python-versions = ">=3.5" -files = [ - {file = "idna-3.4-py3-none-any.whl", hash = "sha256:90b77e79eaa3eba6de819a0c442c0b4ceefc341a7a2ab77d7562bf49f425c5c2"}, - {file = "idna-3.4.tar.gz", hash = "sha256:814f528e8dead7d329833b91c5faa87d60bf71824cd12a7530b5526063d02cb4"}, -] - -[[package]] -name = "iniconfig" -version = "2.0.0" -description = "brain-dead simple config-ini parsing" -optional = false -python-versions = ">=3.7" -files = [ - {file = "iniconfig-2.0.0-py3-none-any.whl", hash = "sha256:b6a85871a79d2e3b22d2d1b94ac2824226a63c6b741c88f7ae975f18b6778374"}, - {file = "iniconfig-2.0.0.tar.gz", hash = "sha256:2d91e135bf72d31a410b17c16da610a82cb55f6b0477d1a902134b24a455b8b3"}, -] - -[[package]] -name = "isort" -version = "5.12.0" -description = "A Python utility / library to sort Python imports." -optional = false -python-versions = ">=3.8.0" -files = [ - {file = "isort-5.12.0-py3-none-any.whl", hash = "sha256:f84c2818376e66cf843d497486ea8fed8700b340f308f076c6fb1229dff318b6"}, - {file = "isort-5.12.0.tar.gz", hash = "sha256:8bef7dde241278824a6d83f44a544709b065191b95b6e50894bdc722fcba0504"}, -] - -[package.dependencies] -colorama = {version = ">=0.4.3", optional = true, markers = "extra == \"colors\""} - -[package.extras] -colors = ["colorama (>=0.4.3)"] -pipfile-deprecated-finder = ["pip-shims (>=0.5.2)", "pipreqs", "requirementslib"] -plugins = ["setuptools"] -requirements-deprecated-finder = ["pip-api", "pipreqs"] - -[[package]] -name = "lazy-object-proxy" -version = "1.9.0" -description = "A fast and thorough lazy object proxy." -optional = false -python-versions = ">=3.7" -files = [ - {file = "lazy-object-proxy-1.9.0.tar.gz", hash = "sha256:659fb5809fa4629b8a1ac5106f669cfc7bef26fbb389dda53b3e010d1ac4ebae"}, - {file = "lazy_object_proxy-1.9.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:b40387277b0ed2d0602b8293b94d7257e17d1479e257b4de114ea11a8cb7f2d7"}, - {file = "lazy_object_proxy-1.9.0-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:e8c6cfb338b133fbdbc5cfaa10fe3c6aeea827db80c978dbd13bc9dd8526b7d4"}, - {file = "lazy_object_proxy-1.9.0-cp310-cp310-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:721532711daa7db0d8b779b0bb0318fa87af1c10d7fe5e52ef30f8eff254d0cd"}, - {file = "lazy_object_proxy-1.9.0-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:66a3de4a3ec06cd8af3f61b8e1ec67614fbb7c995d02fa224813cb7afefee701"}, - {file = "lazy_object_proxy-1.9.0-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:1aa3de4088c89a1b69f8ec0dcc169aa725b0ff017899ac568fe44ddc1396df46"}, - {file = "lazy_object_proxy-1.9.0-cp310-cp310-win32.whl", hash = "sha256:f0705c376533ed2a9e5e97aacdbfe04cecd71e0aa84c7c0595d02ef93b6e4455"}, - {file = "lazy_object_proxy-1.9.0-cp310-cp310-win_amd64.whl", hash = "sha256:ea806fd4c37bf7e7ad82537b0757999264d5f70c45468447bb2b91afdbe73a6e"}, - {file = "lazy_object_proxy-1.9.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:946d27deaff6cf8452ed0dba83ba38839a87f4f7a9732e8f9fd4107b21e6ff07"}, - {file = "lazy_object_proxy-1.9.0-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:79a31b086e7e68b24b99b23d57723ef7e2c6d81ed21007b6281ebcd1688acb0a"}, - {file = "lazy_object_proxy-1.9.0-cp311-cp311-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:f699ac1c768270c9e384e4cbd268d6e67aebcfae6cd623b4d7c3bfde5a35db59"}, - {file = "lazy_object_proxy-1.9.0-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:bfb38f9ffb53b942f2b5954e0f610f1e721ccebe9cce9025a38c8ccf4a5183a4"}, - {file = "lazy_object_proxy-1.9.0-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:189bbd5d41ae7a498397287c408617fe5c48633e7755287b21d741f7db2706a9"}, - {file = "lazy_object_proxy-1.9.0-cp311-cp311-win32.whl", hash = "sha256:81fc4d08b062b535d95c9ea70dbe8a335c45c04029878e62d744bdced5141586"}, - {file = "lazy_object_proxy-1.9.0-cp311-cp311-win_amd64.whl", hash = "sha256:f2457189d8257dd41ae9b434ba33298aec198e30adf2dcdaaa3a28b9994f6adb"}, - {file = "lazy_object_proxy-1.9.0-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:d9e25ef10a39e8afe59a5c348a4dbf29b4868ab76269f81ce1674494e2565a6e"}, - {file = "lazy_object_proxy-1.9.0-cp37-cp37m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:cbf9b082426036e19c6924a9ce90c740a9861e2bdc27a4834fd0a910742ac1e8"}, - {file = "lazy_object_proxy-1.9.0-cp37-cp37m-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:9f5fa4a61ce2438267163891961cfd5e32ec97a2c444e5b842d574251ade27d2"}, - {file = "lazy_object_proxy-1.9.0-cp37-cp37m-musllinux_1_1_aarch64.whl", hash = "sha256:8fa02eaab317b1e9e03f69aab1f91e120e7899b392c4fc19807a8278a07a97e8"}, - {file = "lazy_object_proxy-1.9.0-cp37-cp37m-musllinux_1_1_x86_64.whl", hash = "sha256:e7c21c95cae3c05c14aafffe2865bbd5e377cfc1348c4f7751d9dc9a48ca4bda"}, - {file = "lazy_object_proxy-1.9.0-cp37-cp37m-win32.whl", hash = "sha256:f12ad7126ae0c98d601a7ee504c1122bcef553d1d5e0c3bfa77b16b3968d2734"}, - {file = "lazy_object_proxy-1.9.0-cp37-cp37m-win_amd64.whl", hash = "sha256:edd20c5a55acb67c7ed471fa2b5fb66cb17f61430b7a6b9c3b4a1e40293b1671"}, - {file = "lazy_object_proxy-1.9.0-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:2d0daa332786cf3bb49e10dc6a17a52f6a8f9601b4cf5c295a4f85854d61de63"}, - {file = "lazy_object_proxy-1.9.0-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:9cd077f3d04a58e83d04b20e334f678c2b0ff9879b9375ed107d5d07ff160171"}, - {file = "lazy_object_proxy-1.9.0-cp38-cp38-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:660c94ea760b3ce47d1855a30984c78327500493d396eac4dfd8bd82041b22be"}, - {file = "lazy_object_proxy-1.9.0-cp38-cp38-musllinux_1_1_aarch64.whl", hash = "sha256:212774e4dfa851e74d393a2370871e174d7ff0ebc980907723bb67d25c8a7c30"}, - {file = "lazy_object_proxy-1.9.0-cp38-cp38-musllinux_1_1_x86_64.whl", hash = "sha256:f0117049dd1d5635bbff65444496c90e0baa48ea405125c088e93d9cf4525b11"}, - {file = "lazy_object_proxy-1.9.0-cp38-cp38-win32.whl", hash = "sha256:0a891e4e41b54fd5b8313b96399f8b0e173bbbfc03c7631f01efbe29bb0bcf82"}, - {file = "lazy_object_proxy-1.9.0-cp38-cp38-win_amd64.whl", hash = "sha256:9990d8e71b9f6488e91ad25f322898c136b008d87bf852ff65391b004da5e17b"}, - {file = "lazy_object_proxy-1.9.0-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:9e7551208b2aded9c1447453ee366f1c4070602b3d932ace044715d89666899b"}, - {file = "lazy_object_proxy-1.9.0-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:5f83ac4d83ef0ab017683d715ed356e30dd48a93746309c8f3517e1287523ef4"}, - {file = "lazy_object_proxy-1.9.0-cp39-cp39-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:7322c3d6f1766d4ef1e51a465f47955f1e8123caee67dd641e67d539a534d006"}, - {file = "lazy_object_proxy-1.9.0-cp39-cp39-musllinux_1_1_aarch64.whl", hash = "sha256:18b78ec83edbbeb69efdc0e9c1cb41a3b1b1ed11ddd8ded602464c3fc6020494"}, - {file = "lazy_object_proxy-1.9.0-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:09763491ce220c0299688940f8dc2c5d05fd1f45af1e42e636b2e8b2303e4382"}, - {file = "lazy_object_proxy-1.9.0-cp39-cp39-win32.whl", hash = "sha256:9090d8e53235aa280fc9239a86ae3ea8ac58eff66a705fa6aa2ec4968b95c821"}, - {file = "lazy_object_proxy-1.9.0-cp39-cp39-win_amd64.whl", hash = "sha256:db1c1722726f47e10e0b5fdbf15ac3b8adb58c091d12b3ab713965795036985f"}, -] - -[[package]] -name = "limits" -version = "2.8.0" -description = "Rate limiting utilities" -optional = false -python-versions = ">=3.7" -files = [ - {file = "limits-2.8.0-py3-none-any.whl", hash = "sha256:ee19e9a98dd392d52dd62cfc28d93710eb29a22cf9834c21c16ee19367c4d596"}, - {file = "limits-2.8.0.tar.gz", hash = "sha256:b47e01c48b3b677c7230cb51775ebe7c30a574e9711dc68499dab810ed883bb9"}, -] - -[package.dependencies] -deprecated = ">=1.2" -packaging = ">=21,<23" -setuptools = "*" -typing-extensions = "*" - -[package.extras] -all = ["coredis (>=3.4.0,<5)", "emcache (>=0.6.1)", "motor (>=2.5,<4)", "pymemcache (>3,<5.0.0)", "pymongo (>3,<5)", "redis (>3,<5.0.0)", "redis (>=4.2.0)"] -async-memcached = ["emcache (>=0.6.1)"] -async-mongodb = ["motor (>=2.5,<4)"] -async-redis = ["coredis (>=3.4.0,<5)"] -memcached = ["pymemcache (>3,<5.0.0)"] -mongodb = ["pymongo (>3,<5)"] -redis = ["redis (>3,<5.0.0)"] -rediscluster = ["redis (>=4.2.0)"] - -[[package]] -name = "loguru" -version = "0.6.0" -description = "Python logging made (stupidly) simple" -optional = false -python-versions = ">=3.5" -files = [ - {file = "loguru-0.6.0-py3-none-any.whl", hash = "sha256:4e2414d534a2ab57573365b3e6d0234dfb1d84b68b7f3b948e6fb743860a77c3"}, - {file = "loguru-0.6.0.tar.gz", hash = "sha256:066bd06758d0a513e9836fd9c6b5a75bfb3fd36841f4b996bc60b547a309d41c"}, -] - -[package.dependencies] -colorama = {version = ">=0.3.4", markers = "sys_platform == \"win32\""} -win32-setctime = {version = ">=1.0.0", markers = "sys_platform == \"win32\""} - -[package.extras] -dev = ["Sphinx (>=4.1.1)", "black (>=19.10b0)", "colorama (>=0.3.4)", "docutils (==0.16)", "flake8 (>=3.7.7)", "isort (>=5.1.1)", "pytest (>=4.6.2)", "pytest-cov (>=2.7.1)", "sphinx-autobuild (>=0.7.1)", "sphinx-rtd-theme (>=0.4.3)", "tox (>=3.9.0)"] - -[[package]] -name = "markdown-it-py" -version = "2.2.0" -description = "Python port of markdown-it. Markdown parsing, done right!" -optional = false -python-versions = ">=3.7" -files = [ - {file = "markdown-it-py-2.2.0.tar.gz", hash = "sha256:7c9a5e412688bc771c67432cbfebcdd686c93ce6484913dccf06cb5a0bea35a1"}, - {file = "markdown_it_py-2.2.0-py3-none-any.whl", hash = "sha256:5a35f8d1870171d9acc47b99612dc146129b631baf04970128b568f190d0cc30"}, -] - -[package.dependencies] -mdurl = ">=0.1,<1.0" - -[package.extras] -benchmarking = ["psutil", "pytest", "pytest-benchmark"] -code-style = ["pre-commit (>=3.0,<4.0)"] -compare = ["commonmark (>=0.9,<1.0)", "markdown (>=3.4,<4.0)", "mistletoe (>=1.0,<2.0)", "mistune (>=2.0,<3.0)", "panflute (>=2.3,<3.0)"] -linkify = ["linkify-it-py (>=1,<3)"] -plugins = ["mdit-py-plugins"] -profiling = ["gprof2dot"] -rtd = ["attrs", "myst-parser", "pyyaml", "sphinx", "sphinx-copybutton", "sphinx-design", "sphinx_book_theme"] -testing = ["coverage", "pytest", "pytest-cov", "pytest-regressions"] - -[[package]] -name = "markdownify" -version = "0.11.6" -description = "Convert HTML to markdown." -optional = false -python-versions = "*" -files = [ - {file = "markdownify-0.11.6-py3-none-any.whl", hash = "sha256:ba35fe289d5e9073bcd7d2cad629278fe25f1a93741fcdc0bfb4f009076d8324"}, - {file = "markdownify-0.11.6.tar.gz", hash = "sha256:009b240e0c9f4c8eaf1d085625dcd4011e12f0f8cec55dedf9ea6f7655e49bfe"}, -] - -[package.dependencies] -beautifulsoup4 = ">=4.9,<5" -six = ">=1.15,<2" - -[[package]] -name = "mccabe" -version = "0.7.0" -description = "McCabe checker, plugin for flake8" -optional = false -python-versions = ">=3.6" -files = [ - {file = "mccabe-0.7.0-py2.py3-none-any.whl", hash = "sha256:6c2d30ab6be0e4a46919781807b4f0d834ebdd6c6e3dca0bda5a15f863427b6e"}, - {file = "mccabe-0.7.0.tar.gz", hash = "sha256:348e0240c33b60bbdf4e523192ef919f28cb2c3d7d5c7794f74009290f236325"}, -] - -[[package]] -name = "mdurl" -version = "0.1.2" -description = "Markdown URL utilities" -optional = false -python-versions = ">=3.7" -files = [ - {file = "mdurl-0.1.2-py3-none-any.whl", hash = "sha256:84008a41e51615a49fc9966191ff91509e3c40b939176e643fd50a5c2196b8f8"}, - {file = "mdurl-0.1.2.tar.gz", hash = "sha256:bb413d29f5eea38f31dd4754dd7377d4465116fb207585f97bf925588687c1ba"}, -] - -[[package]] -name = "msgpack" -version = "1.0.4" -description = "MessagePack serializer" -optional = false -python-versions = "*" -files = [ - {file = "msgpack-1.0.4-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:4ab251d229d10498e9a2f3b1e68ef64cb393394ec477e3370c457f9430ce9250"}, - {file = "msgpack-1.0.4-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:112b0f93202d7c0fef0b7810d465fde23c746a2d482e1e2de2aafd2ce1492c88"}, - {file = "msgpack-1.0.4-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:002b5c72b6cd9b4bafd790f364b8480e859b4712e91f43014fe01e4f957b8467"}, - {file = "msgpack-1.0.4-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:35bc0faa494b0f1d851fd29129b2575b2e26d41d177caacd4206d81502d4c6a6"}, - {file = "msgpack-1.0.4-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:4733359808c56d5d7756628736061c432ded018e7a1dff2d35a02439043321aa"}, - {file = "msgpack-1.0.4-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:eb514ad14edf07a1dbe63761fd30f89ae79b42625731e1ccf5e1f1092950eaa6"}, - {file = "msgpack-1.0.4-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:c23080fdeec4716aede32b4e0ef7e213c7b1093eede9ee010949f2a418ced6ba"}, - {file = "msgpack-1.0.4-cp310-cp310-musllinux_1_1_i686.whl", hash = "sha256:49565b0e3d7896d9ea71d9095df15b7f75a035c49be733051c34762ca95bbf7e"}, - {file = "msgpack-1.0.4-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:aca0f1644d6b5a73eb3e74d4d64d5d8c6c3d577e753a04c9e9c87d07692c58db"}, - {file = "msgpack-1.0.4-cp310-cp310-win32.whl", hash = "sha256:0dfe3947db5fb9ce52aaea6ca28112a170db9eae75adf9339a1aec434dc954ef"}, - {file = "msgpack-1.0.4-cp310-cp310-win_amd64.whl", hash = "sha256:4dea20515f660aa6b7e964433b1808d098dcfcabbebeaaad240d11f909298075"}, - {file = "msgpack-1.0.4-cp36-cp36m-macosx_10_9_x86_64.whl", hash = "sha256:e83f80a7fec1a62cf4e6c9a660e39c7f878f603737a0cdac8c13131d11d97f52"}, - {file = "msgpack-1.0.4-cp36-cp36m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:3c11a48cf5e59026ad7cb0dc29e29a01b5a66a3e333dc11c04f7e991fc5510a9"}, - {file = "msgpack-1.0.4-cp36-cp36m-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:1276e8f34e139aeff1c77a3cefb295598b504ac5314d32c8c3d54d24fadb94c9"}, - {file = "msgpack-1.0.4-cp36-cp36m-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:6c9566f2c39ccced0a38d37c26cc3570983b97833c365a6044edef3574a00c08"}, - {file = "msgpack-1.0.4-cp36-cp36m-musllinux_1_1_aarch64.whl", hash = "sha256:fcb8a47f43acc113e24e910399376f7277cf8508b27e5b88499f053de6b115a8"}, - {file = "msgpack-1.0.4-cp36-cp36m-musllinux_1_1_i686.whl", hash = "sha256:76ee788122de3a68a02ed6f3a16bbcd97bc7c2e39bd4d94be2f1821e7c4a64e6"}, - {file = "msgpack-1.0.4-cp36-cp36m-musllinux_1_1_x86_64.whl", hash = "sha256:0a68d3ac0104e2d3510de90a1091720157c319ceeb90d74f7b5295a6bee51bae"}, - {file = "msgpack-1.0.4-cp36-cp36m-win32.whl", hash = "sha256:85f279d88d8e833ec015650fd15ae5eddce0791e1e8a59165318f371158efec6"}, - {file = "msgpack-1.0.4-cp36-cp36m-win_amd64.whl", hash = "sha256:c1683841cd4fa45ac427c18854c3ec3cd9b681694caf5bff04edb9387602d661"}, - {file = "msgpack-1.0.4-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:a75dfb03f8b06f4ab093dafe3ddcc2d633259e6c3f74bb1b01996f5d8aa5868c"}, - {file = "msgpack-1.0.4-cp37-cp37m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:9667bdfdf523c40d2511f0e98a6c9d3603be6b371ae9a238b7ef2dc4e7a427b0"}, - {file = "msgpack-1.0.4-cp37-cp37m-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:11184bc7e56fd74c00ead4f9cc9a3091d62ecb96e97653add7a879a14b003227"}, - {file = "msgpack-1.0.4-cp37-cp37m-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:ac5bd7901487c4a1dd51a8c58f2632b15d838d07ceedaa5e4c080f7190925bff"}, - {file = "msgpack-1.0.4-cp37-cp37m-musllinux_1_1_aarch64.whl", hash = "sha256:1e91d641d2bfe91ba4c52039adc5bccf27c335356055825c7f88742c8bb900dd"}, - {file = "msgpack-1.0.4-cp37-cp37m-musllinux_1_1_i686.whl", hash = "sha256:2a2df1b55a78eb5f5b7d2a4bb221cd8363913830145fad05374a80bf0877cb1e"}, - {file = "msgpack-1.0.4-cp37-cp37m-musllinux_1_1_x86_64.whl", hash = "sha256:545e3cf0cf74f3e48b470f68ed19551ae6f9722814ea969305794645da091236"}, - {file = "msgpack-1.0.4-cp37-cp37m-win32.whl", hash = "sha256:2cc5ca2712ac0003bcb625c96368fd08a0f86bbc1a5578802512d87bc592fe44"}, - {file = "msgpack-1.0.4-cp37-cp37m-win_amd64.whl", hash = "sha256:eba96145051ccec0ec86611fe9cf693ce55f2a3ce89c06ed307de0e085730ec1"}, - {file = "msgpack-1.0.4-cp38-cp38-macosx_10_9_universal2.whl", hash = "sha256:7760f85956c415578c17edb39eed99f9181a48375b0d4a94076d84148cf67b2d"}, - {file = "msgpack-1.0.4-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:449e57cc1ff18d3b444eb554e44613cffcccb32805d16726a5494038c3b93dab"}, - {file = "msgpack-1.0.4-cp38-cp38-macosx_11_0_arm64.whl", hash = "sha256:d603de2b8d2ea3f3bcb2efe286849aa7a81531abc52d8454da12f46235092bcb"}, - {file = "msgpack-1.0.4-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:48f5d88c99f64c456413d74a975bd605a9b0526293218a3b77220a2c15458ba9"}, - {file = "msgpack-1.0.4-cp38-cp38-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:6916c78f33602ecf0509cc40379271ba0f9ab572b066bd4bdafd7434dee4bc6e"}, - {file = "msgpack-1.0.4-cp38-cp38-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:81fc7ba725464651190b196f3cd848e8553d4d510114a954681fd0b9c479d7e1"}, - {file = "msgpack-1.0.4-cp38-cp38-musllinux_1_1_aarch64.whl", hash = "sha256:d5b5b962221fa2c5d3a7f8133f9abffc114fe218eb4365e40f17732ade576c8e"}, - {file = "msgpack-1.0.4-cp38-cp38-musllinux_1_1_i686.whl", hash = "sha256:77ccd2af37f3db0ea59fb280fa2165bf1b096510ba9fe0cc2bf8fa92a22fdb43"}, - {file = "msgpack-1.0.4-cp38-cp38-musllinux_1_1_x86_64.whl", hash = "sha256:b17be2478b622939e39b816e0aa8242611cc8d3583d1cd8ec31b249f04623243"}, - {file = "msgpack-1.0.4-cp38-cp38-win32.whl", hash = "sha256:2bb8cdf50dd623392fa75525cce44a65a12a00c98e1e37bf0fb08ddce2ff60d2"}, - {file = "msgpack-1.0.4-cp38-cp38-win_amd64.whl", hash = "sha256:26b8feaca40a90cbe031b03d82b2898bf560027160d3eae1423f4a67654ec5d6"}, - {file = "msgpack-1.0.4-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:462497af5fd4e0edbb1559c352ad84f6c577ffbbb708566a0abaaa84acd9f3ae"}, - {file = "msgpack-1.0.4-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:2999623886c5c02deefe156e8f869c3b0aaeba14bfc50aa2486a0415178fce55"}, - {file = "msgpack-1.0.4-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:f0029245c51fd9473dc1aede1160b0a29f4a912e6b1dd353fa6d317085b219da"}, - {file = "msgpack-1.0.4-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:ed6f7b854a823ea44cf94919ba3f727e230da29feb4a99711433f25800cf747f"}, - {file = "msgpack-1.0.4-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0df96d6eaf45ceca04b3f3b4b111b86b33785683d682c655063ef8057d61fd92"}, - {file = "msgpack-1.0.4-cp39-cp39-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:6a4192b1ab40f8dca3f2877b70e63799d95c62c068c84dc028b40a6cb03ccd0f"}, - {file = "msgpack-1.0.4-cp39-cp39-musllinux_1_1_aarch64.whl", hash = "sha256:0e3590f9fb9f7fbc36df366267870e77269c03172d086fa76bb4eba8b2b46624"}, - {file = "msgpack-1.0.4-cp39-cp39-musllinux_1_1_i686.whl", hash = "sha256:1576bd97527a93c44fa856770197dec00d223b0b9f36ef03f65bac60197cedf8"}, - {file = "msgpack-1.0.4-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:63e29d6e8c9ca22b21846234913c3466b7e4ee6e422f205a2988083de3b08cae"}, - {file = "msgpack-1.0.4-cp39-cp39-win32.whl", hash = "sha256:fb62ea4b62bfcb0b380d5680f9a4b3f9a2d166d9394e9bbd9666c0ee09a3645c"}, - {file = "msgpack-1.0.4-cp39-cp39-win_amd64.whl", hash = "sha256:4d5834a2a48965a349da1c5a79760d94a1a0172fbb5ab6b5b33cbf8447e109ce"}, - {file = "msgpack-1.0.4.tar.gz", hash = "sha256:f5d869c18f030202eb412f08b28d2afeea553d6613aee89e200d7aca7ef01f5f"}, -] - -[[package]] -name = "mypy" -version = "1.0.1" -description = "Optional static typing for Python" -optional = false -python-versions = ">=3.7" -files = [ - {file = "mypy-1.0.1-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:71a808334d3f41ef011faa5a5cd8153606df5fc0b56de5b2e89566c8093a0c9a"}, - {file = "mypy-1.0.1-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:920169f0184215eef19294fa86ea49ffd4635dedfdea2b57e45cb4ee85d5ccaf"}, - {file = "mypy-1.0.1-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:27a0f74a298769d9fdc8498fcb4f2beb86f0564bcdb1a37b58cbbe78e55cf8c0"}, - {file = "mypy-1.0.1-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:65b122a993d9c81ea0bfde7689b3365318a88bde952e4dfa1b3a8b4ac05d168b"}, - {file = "mypy-1.0.1-cp310-cp310-win_amd64.whl", hash = "sha256:5deb252fd42a77add936b463033a59b8e48eb2eaec2976d76b6878d031933fe4"}, - {file = "mypy-1.0.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:2013226d17f20468f34feddd6aae4635a55f79626549099354ce641bc7d40262"}, - {file = "mypy-1.0.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:48525aec92b47baed9b3380371ab8ab6e63a5aab317347dfe9e55e02aaad22e8"}, - {file = "mypy-1.0.1-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c96b8a0c019fe29040d520d9257d8c8f122a7343a8307bf8d6d4a43f5c5bfcc8"}, - {file = "mypy-1.0.1-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:448de661536d270ce04f2d7dddaa49b2fdba6e3bd8a83212164d4174ff43aa65"}, - {file = "mypy-1.0.1-cp311-cp311-win_amd64.whl", hash = "sha256:d42a98e76070a365a1d1c220fcac8aa4ada12ae0db679cb4d910fabefc88b994"}, - {file = "mypy-1.0.1-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:e64f48c6176e243ad015e995de05af7f22bbe370dbb5b32bd6988438ec873919"}, - {file = "mypy-1.0.1-cp37-cp37m-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:5fdd63e4f50e3538617887e9aee91855368d9fc1dea30da743837b0df7373bc4"}, - {file = "mypy-1.0.1-cp37-cp37m-musllinux_1_1_x86_64.whl", hash = "sha256:dbeb24514c4acbc78d205f85dd0e800f34062efcc1f4a4857c57e4b4b8712bff"}, - {file = "mypy-1.0.1-cp37-cp37m-win_amd64.whl", hash = "sha256:a2948c40a7dd46c1c33765718936669dc1f628f134013b02ff5ac6c7ef6942bf"}, - {file = "mypy-1.0.1-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:5bc8d6bd3b274dd3846597855d96d38d947aedba18776aa998a8d46fabdaed76"}, - {file = "mypy-1.0.1-cp38-cp38-macosx_11_0_arm64.whl", hash = "sha256:17455cda53eeee0a4adb6371a21dd3dbf465897de82843751cf822605d152c8c"}, - {file = "mypy-1.0.1-cp38-cp38-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:e831662208055b006eef68392a768ff83596035ffd6d846786578ba1714ba8f6"}, - {file = "mypy-1.0.1-cp38-cp38-musllinux_1_1_x86_64.whl", hash = "sha256:e60d0b09f62ae97a94605c3f73fd952395286cf3e3b9e7b97f60b01ddfbbda88"}, - {file = "mypy-1.0.1-cp38-cp38-win_amd64.whl", hash = "sha256:0af4f0e20706aadf4e6f8f8dc5ab739089146b83fd53cb4a7e0e850ef3de0bb6"}, - {file = "mypy-1.0.1-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:24189f23dc66f83b839bd1cce2dfc356020dfc9a8bae03978477b15be61b062e"}, - {file = "mypy-1.0.1-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:93a85495fb13dc484251b4c1fd7a5ac370cd0d812bbfc3b39c1bafefe95275d5"}, - {file = "mypy-1.0.1-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:5f546ac34093c6ce33f6278f7c88f0f147a4849386d3bf3ae193702f4fe31407"}, - {file = "mypy-1.0.1-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:c6c2ccb7af7154673c591189c3687b013122c5a891bb5651eca3db8e6c6c55bd"}, - {file = "mypy-1.0.1-cp39-cp39-win_amd64.whl", hash = "sha256:15b5a824b58c7c822c51bc66308e759243c32631896743f030daf449fe3677f3"}, - {file = "mypy-1.0.1-py3-none-any.whl", hash = "sha256:eda5c8b9949ed411ff752b9a01adda31afe7eae1e53e946dbdf9db23865e66c4"}, - {file = "mypy-1.0.1.tar.gz", hash = "sha256:28cea5a6392bb43d266782983b5a4216c25544cd7d80be681a155ddcdafd152d"}, -] - -[package.dependencies] -mypy-extensions = ">=0.4.3" -tomli = {version = ">=1.1.0", markers = "python_version < \"3.11\""} -typing-extensions = ">=3.10" - -[package.extras] -dmypy = ["psutil (>=4.0)"] -install-types = ["pip"] -python2 = ["typed-ast (>=1.4.0,<2)"] -reports = ["lxml"] - -[[package]] -name = "mypy-extensions" -version = "1.0.0" -description = "Type system extensions for programs checked with the mypy type checker." -optional = false -python-versions = ">=3.5" -files = [ - {file = "mypy_extensions-1.0.0-py3-none-any.whl", hash = "sha256:4392f6c0eb8a5668a69e23d168ffa70f0be9ccfd32b5cc2d26a34ae5b844552d"}, - {file = "mypy_extensions-1.0.0.tar.gz", hash = "sha256:75dbf8955dc00442a438fc4d0666508a9a97b6bd41aa2f0ffe9d2f2725af0782"}, -] - -[[package]] -name = "nodeenv" -version = "1.7.0" -description = "Node.js virtual environment builder" -optional = false -python-versions = ">=2.7,!=3.0.*,!=3.1.*,!=3.2.*,!=3.3.*,!=3.4.*,!=3.5.*,!=3.6.*" -files = [ - {file = "nodeenv-1.7.0-py2.py3-none-any.whl", hash = "sha256:27083a7b96a25f2f5e1d8cb4b6317ee8aeda3bdd121394e5ac54e498028a042e"}, - {file = "nodeenv-1.7.0.tar.gz", hash = "sha256:e0e7f7dfb85fc5394c6fe1e8fa98131a2473e04311a45afb6508f7cf1836fa2b"}, -] - -[package.dependencies] -setuptools = "*" - -[[package]] -name = "outcome" -version = "1.2.0" -description = "Capture the outcome of Python function calls." -optional = false -python-versions = ">=3.7" -files = [ - {file = "outcome-1.2.0-py2.py3-none-any.whl", hash = "sha256:c4ab89a56575d6d38a05aa16daeaa333109c1f96167aba8901ab18b6b5e0f7f5"}, - {file = "outcome-1.2.0.tar.gz", hash = "sha256:6f82bd3de45da303cf1f771ecafa1633750a358436a8bb60e06a1ceb745d2672"}, -] - -[package.dependencies] -attrs = ">=19.2.0" - -[[package]] -name = "packaging" -version = "21.3" -description = "Core utilities for Python packages" -optional = false -python-versions = ">=3.6" -files = [ - {file = "packaging-21.3-py3-none-any.whl", hash = "sha256:ef103e05f519cdc783ae24ea4e2e0f508a9c99b2d4969652eed6a2e1ea5bd522"}, - {file = "packaging-21.3.tar.gz", hash = "sha256:dd47c42927d89ab911e606518907cc2d3a1f38bbd026385970643f9c5b8ecfeb"}, -] - -[package.dependencies] -pyparsing = ">=2.0.2,<3.0.5 || >3.0.5" - -[[package]] -name = "pathspec" -version = "0.11.0" -description = "Utility library for gitignore style pattern matching of file paths." -optional = false -python-versions = ">=3.7" -files = [ - {file = "pathspec-0.11.0-py3-none-any.whl", hash = "sha256:3a66eb970cbac598f9e5ccb5b2cf58930cd8e3ed86d393d541eaf2d8b1705229"}, - {file = "pathspec-0.11.0.tar.gz", hash = "sha256:64d338d4e0914e91c1792321e6907b5a593f1ab1851de7fc269557a21b30ebbc"}, -] - -[[package]] -name = "pbr" -version = "5.11.1" -description = "Python Build Reasonableness" -optional = false -python-versions = ">=2.6" -files = [ - {file = "pbr-5.11.1-py2.py3-none-any.whl", hash = "sha256:567f09558bae2b3ab53cb3c1e2e33e726ff3338e7bae3db5dc954b3a44eef12b"}, - {file = "pbr-5.11.1.tar.gz", hash = "sha256:aefc51675b0b533d56bb5fd1c8c6c0522fe31896679882e1c4c63d5e4a0fccb3"}, -] - -[[package]] -name = "pillow" -version = "9.4.0" -description = "Python Imaging Library (Fork)" -optional = false -python-versions = ">=3.7" -files = [ - {file = "Pillow-9.4.0-1-cp310-cp310-macosx_10_10_x86_64.whl", hash = "sha256:1b4b4e9dda4f4e4c4e6896f93e84a8f0bcca3b059de9ddf67dac3c334b1195e1"}, - {file = "Pillow-9.4.0-1-cp311-cp311-macosx_10_10_x86_64.whl", hash = "sha256:fb5c1ad6bad98c57482236a21bf985ab0ef42bd51f7ad4e4538e89a997624e12"}, - {file = "Pillow-9.4.0-1-cp37-cp37m-macosx_10_10_x86_64.whl", hash = "sha256:f0caf4a5dcf610d96c3bd32932bfac8aee61c96e60481c2a0ea58da435e25acd"}, - {file = "Pillow-9.4.0-1-cp38-cp38-macosx_10_10_x86_64.whl", hash = "sha256:3f4cc516e0b264c8d4ccd6b6cbc69a07c6d582d8337df79be1e15a5056b258c9"}, - {file = "Pillow-9.4.0-1-cp39-cp39-macosx_10_10_x86_64.whl", hash = "sha256:b8c2f6eb0df979ee99433d8b3f6d193d9590f735cf12274c108bd954e30ca858"}, - {file = "Pillow-9.4.0-1-pp38-pypy38_pp73-macosx_10_10_x86_64.whl", hash = "sha256:b70756ec9417c34e097f987b4d8c510975216ad26ba6e57ccb53bc758f490dab"}, - {file = "Pillow-9.4.0-1-pp39-pypy39_pp73-macosx_10_10_x86_64.whl", hash = "sha256:43521ce2c4b865d385e78579a082b6ad1166ebed2b1a2293c3be1d68dd7ca3b9"}, - {file = "Pillow-9.4.0-2-cp310-cp310-macosx_10_10_x86_64.whl", hash = "sha256:9d9a62576b68cd90f7075876f4e8444487db5eeea0e4df3ba298ee38a8d067b0"}, - {file = "Pillow-9.4.0-2-cp311-cp311-macosx_10_10_x86_64.whl", hash = "sha256:87708d78a14d56a990fbf4f9cb350b7d89ee8988705e58e39bdf4d82c149210f"}, - {file = "Pillow-9.4.0-2-cp37-cp37m-macosx_10_10_x86_64.whl", hash = "sha256:8a2b5874d17e72dfb80d917213abd55d7e1ed2479f38f001f264f7ce7bae757c"}, - {file = "Pillow-9.4.0-2-cp38-cp38-macosx_10_10_x86_64.whl", hash = "sha256:83125753a60cfc8c412de5896d10a0a405e0bd88d0470ad82e0869ddf0cb3848"}, - {file = "Pillow-9.4.0-2-cp39-cp39-macosx_10_10_x86_64.whl", hash = "sha256:9e5f94742033898bfe84c93c831a6f552bb629448d4072dd312306bab3bd96f1"}, - {file = "Pillow-9.4.0-2-pp38-pypy38_pp73-macosx_10_10_x86_64.whl", hash = "sha256:013016af6b3a12a2f40b704677f8b51f72cb007dac785a9933d5c86a72a7fe33"}, - {file = "Pillow-9.4.0-2-pp39-pypy39_pp73-macosx_10_10_x86_64.whl", hash = "sha256:99d92d148dd03fd19d16175b6d355cc1b01faf80dae93c6c3eb4163709edc0a9"}, - {file = "Pillow-9.4.0-cp310-cp310-macosx_10_10_x86_64.whl", hash = "sha256:2968c58feca624bb6c8502f9564dd187d0e1389964898f5e9e1fbc8533169157"}, - {file = "Pillow-9.4.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:c5c1362c14aee73f50143d74389b2c158707b4abce2cb055b7ad37ce60738d47"}, - {file = "Pillow-9.4.0-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:bd752c5ff1b4a870b7661234694f24b1d2b9076b8bf337321a814c612665f343"}, - {file = "Pillow-9.4.0-cp310-cp310-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:9a3049a10261d7f2b6514d35bbb7a4dfc3ece4c4de14ef5876c4b7a23a0e566d"}, - {file = "Pillow-9.4.0-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:16a8df99701f9095bea8a6c4b3197da105df6f74e6176c5b410bc2df2fd29a57"}, - {file = "Pillow-9.4.0-cp310-cp310-manylinux_2_28_aarch64.whl", hash = "sha256:94cdff45173b1919350601f82d61365e792895e3c3a3443cf99819e6fbf717a5"}, - {file = "Pillow-9.4.0-cp310-cp310-manylinux_2_28_x86_64.whl", hash = "sha256:ed3e4b4e1e6de75fdc16d3259098de7c6571b1a6cc863b1a49e7d3d53e036070"}, - {file = "Pillow-9.4.0-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:d5b2f8a31bd43e0f18172d8ac82347c8f37ef3e0b414431157718aa234991b28"}, - {file = "Pillow-9.4.0-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:09b89ddc95c248ee788328528e6a2996e09eaccddeeb82a5356e92645733be35"}, - {file = "Pillow-9.4.0-cp310-cp310-win32.whl", hash = "sha256:f09598b416ba39a8f489c124447b007fe865f786a89dbfa48bb5cf395693132a"}, - {file = "Pillow-9.4.0-cp310-cp310-win_amd64.whl", hash = "sha256:f6e78171be3fb7941f9910ea15b4b14ec27725865a73c15277bc39f5ca4f8391"}, - {file = "Pillow-9.4.0-cp311-cp311-macosx_10_10_x86_64.whl", hash = "sha256:3fa1284762aacca6dc97474ee9c16f83990b8eeb6697f2ba17140d54b453e133"}, - {file = "Pillow-9.4.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:eaef5d2de3c7e9b21f1e762f289d17b726c2239a42b11e25446abf82b26ac132"}, - {file = "Pillow-9.4.0-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:a4dfdae195335abb4e89cc9762b2edc524f3c6e80d647a9a81bf81e17e3fb6f0"}, - {file = "Pillow-9.4.0-cp311-cp311-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:6abfb51a82e919e3933eb137e17c4ae9c0475a25508ea88993bb59faf82f3b35"}, - {file = "Pillow-9.4.0-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:451f10ef963918e65b8869e17d67db5e2f4ab40e716ee6ce7129b0cde2876eab"}, - {file = "Pillow-9.4.0-cp311-cp311-manylinux_2_28_aarch64.whl", hash = "sha256:6663977496d616b618b6cfa43ec86e479ee62b942e1da76a2c3daa1c75933ef4"}, - {file = "Pillow-9.4.0-cp311-cp311-manylinux_2_28_x86_64.whl", hash = "sha256:60e7da3a3ad1812c128750fc1bc14a7ceeb8d29f77e0a2356a8fb2aa8925287d"}, - {file = "Pillow-9.4.0-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:19005a8e58b7c1796bc0167862b1f54a64d3b44ee5d48152b06bb861458bc0f8"}, - {file = "Pillow-9.4.0-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:f715c32e774a60a337b2bb8ad9839b4abf75b267a0f18806f6f4f5f1688c4b5a"}, - {file = "Pillow-9.4.0-cp311-cp311-win32.whl", hash = "sha256:b222090c455d6d1a64e6b7bb5f4035c4dff479e22455c9eaa1bdd4c75b52c80c"}, - {file = "Pillow-9.4.0-cp311-cp311-win_amd64.whl", hash = "sha256:ba6612b6548220ff5e9df85261bddc811a057b0b465a1226b39bfb8550616aee"}, - {file = "Pillow-9.4.0-cp37-cp37m-macosx_10_10_x86_64.whl", hash = "sha256:5f532a2ad4d174eb73494e7397988e22bf427f91acc8e6ebf5bb10597b49c493"}, - {file = "Pillow-9.4.0-cp37-cp37m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:5dd5a9c3091a0f414a963d427f920368e2b6a4c2f7527fdd82cde8ef0bc7a327"}, - {file = "Pillow-9.4.0-cp37-cp37m-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:ef21af928e807f10bf4141cad4746eee692a0dd3ff56cfb25fce076ec3cc8abe"}, - {file = "Pillow-9.4.0-cp37-cp37m-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:847b114580c5cc9ebaf216dd8c8dbc6b00a3b7ab0131e173d7120e6deade1f57"}, - {file = "Pillow-9.4.0-cp37-cp37m-manylinux_2_28_aarch64.whl", hash = "sha256:653d7fb2df65efefbcbf81ef5fe5e5be931f1ee4332c2893ca638c9b11a409c4"}, - {file = "Pillow-9.4.0-cp37-cp37m-manylinux_2_28_x86_64.whl", hash = "sha256:46f39cab8bbf4a384ba7cb0bc8bae7b7062b6a11cfac1ca4bc144dea90d4a9f5"}, - {file = "Pillow-9.4.0-cp37-cp37m-win32.whl", hash = "sha256:7ac7594397698f77bce84382929747130765f66406dc2cd8b4ab4da68ade4c6e"}, - {file = "Pillow-9.4.0-cp37-cp37m-win_amd64.whl", hash = "sha256:46c259e87199041583658457372a183636ae8cd56dbf3f0755e0f376a7f9d0e6"}, - {file = "Pillow-9.4.0-cp38-cp38-macosx_10_10_x86_64.whl", hash = "sha256:0e51f608da093e5d9038c592b5b575cadc12fd748af1479b5e858045fff955a9"}, - {file = "Pillow-9.4.0-cp38-cp38-macosx_11_0_arm64.whl", hash = "sha256:765cb54c0b8724a7c12c55146ae4647e0274a839fb6de7bcba841e04298e1011"}, - {file = "Pillow-9.4.0-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:519e14e2c49fcf7616d6d2cfc5c70adae95682ae20f0395e9280db85e8d6c4df"}, - {file = "Pillow-9.4.0-cp38-cp38-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:d197df5489004db87d90b918033edbeee0bd6df3848a204bca3ff0a903bef837"}, - {file = "Pillow-9.4.0-cp38-cp38-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0845adc64fe9886db00f5ab68c4a8cd933ab749a87747555cec1c95acea64b0b"}, - {file = "Pillow-9.4.0-cp38-cp38-manylinux_2_28_aarch64.whl", hash = "sha256:e1339790c083c5a4de48f688b4841f18df839eb3c9584a770cbd818b33e26d5d"}, - {file = "Pillow-9.4.0-cp38-cp38-manylinux_2_28_x86_64.whl", hash = "sha256:a96e6e23f2b79433390273eaf8cc94fec9c6370842e577ab10dabdcc7ea0a66b"}, - {file = "Pillow-9.4.0-cp38-cp38-musllinux_1_1_aarch64.whl", hash = "sha256:7cfc287da09f9d2a7ec146ee4d72d6ea1342e770d975e49a8621bf54eaa8f30f"}, - {file = "Pillow-9.4.0-cp38-cp38-musllinux_1_1_x86_64.whl", hash = "sha256:d7081c084ceb58278dd3cf81f836bc818978c0ccc770cbbb202125ddabec6628"}, - {file = "Pillow-9.4.0-cp38-cp38-win32.whl", hash = "sha256:df41112ccce5d47770a0c13651479fbcd8793f34232a2dd9faeccb75eb5d0d0d"}, - {file = "Pillow-9.4.0-cp38-cp38-win_amd64.whl", hash = "sha256:7a21222644ab69ddd9967cfe6f2bb420b460dae4289c9d40ff9a4896e7c35c9a"}, - {file = "Pillow-9.4.0-cp39-cp39-macosx_10_10_x86_64.whl", hash = "sha256:0f3269304c1a7ce82f1759c12ce731ef9b6e95b6df829dccd9fe42912cc48569"}, - {file = "Pillow-9.4.0-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:cb362e3b0976dc994857391b776ddaa8c13c28a16f80ac6522c23d5257156bed"}, - {file = "Pillow-9.4.0-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:a2e0f87144fcbbe54297cae708c5e7f9da21a4646523456b00cc956bd4c65815"}, - {file = "Pillow-9.4.0-cp39-cp39-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:28676836c7796805914b76b1837a40f76827ee0d5398f72f7dcc634bae7c6264"}, - {file = "Pillow-9.4.0-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0884ba7b515163a1a05440a138adeb722b8a6ae2c2b33aea93ea3118dd3a899e"}, - {file = "Pillow-9.4.0-cp39-cp39-manylinux_2_28_aarch64.whl", hash = "sha256:53dcb50fbdc3fb2c55431a9b30caeb2f7027fcd2aeb501459464f0214200a503"}, - {file = "Pillow-9.4.0-cp39-cp39-manylinux_2_28_x86_64.whl", hash = "sha256:e8c5cf126889a4de385c02a2c3d3aba4b00f70234bfddae82a5eaa3ee6d5e3e6"}, - {file = "Pillow-9.4.0-cp39-cp39-musllinux_1_1_aarch64.whl", hash = "sha256:6c6b1389ed66cdd174d040105123a5a1bc91d0aa7059c7261d20e583b6d8cbd2"}, - {file = "Pillow-9.4.0-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:0dd4c681b82214b36273c18ca7ee87065a50e013112eea7d78c7a1b89a739153"}, - {file = "Pillow-9.4.0-cp39-cp39-win32.whl", hash = "sha256:6d9dfb9959a3b0039ee06c1a1a90dc23bac3b430842dcb97908ddde05870601c"}, - {file = "Pillow-9.4.0-cp39-cp39-win_amd64.whl", hash = "sha256:54614444887e0d3043557d9dbc697dbb16cfb5a35d672b7a0fcc1ed0cf1c600b"}, - {file = "Pillow-9.4.0-pp38-pypy38_pp73-macosx_10_10_x86_64.whl", hash = "sha256:b9b752ab91e78234941e44abdecc07f1f0d8f51fb62941d32995b8161f68cfe5"}, - {file = "Pillow-9.4.0-pp38-pypy38_pp73-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:d3b56206244dc8711f7e8b7d6cad4663917cd5b2d950799425076681e8766286"}, - {file = "Pillow-9.4.0-pp38-pypy38_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:aabdab8ec1e7ca7f1434d042bf8b1e92056245fb179790dc97ed040361f16bfd"}, - {file = "Pillow-9.4.0-pp38-pypy38_pp73-manylinux_2_28_x86_64.whl", hash = "sha256:db74f5562c09953b2c5f8ec4b7dfd3f5421f31811e97d1dbc0a7c93d6e3a24df"}, - {file = "Pillow-9.4.0-pp38-pypy38_pp73-win_amd64.whl", hash = "sha256:e9d7747847c53a16a729b6ee5e737cf170f7a16611c143d95aa60a109a59c336"}, - {file = "Pillow-9.4.0-pp39-pypy39_pp73-macosx_10_10_x86_64.whl", hash = "sha256:b52ff4f4e002f828ea6483faf4c4e8deea8d743cf801b74910243c58acc6eda3"}, - {file = "Pillow-9.4.0-pp39-pypy39_pp73-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:575d8912dca808edd9acd6f7795199332696d3469665ef26163cd090fa1f8bfa"}, - {file = "Pillow-9.4.0-pp39-pypy39_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c3c4ed2ff6760e98d262e0cc9c9a7f7b8a9f61aa4d47c58835cdaf7b0b8811bb"}, - {file = "Pillow-9.4.0-pp39-pypy39_pp73-manylinux_2_28_x86_64.whl", hash = "sha256:e621b0246192d3b9cb1dc62c78cfa4c6f6d2ddc0ec207d43c0dedecb914f152a"}, - {file = "Pillow-9.4.0-pp39-pypy39_pp73-win_amd64.whl", hash = "sha256:8f127e7b028900421cad64f51f75c051b628db17fb00e099eb148761eed598c9"}, - {file = "Pillow-9.4.0.tar.gz", hash = "sha256:a1c2d7780448eb93fbcc3789bf3916aa5720d942e37945f4056680317f1cd23e"}, -] - -[package.extras] -docs = ["furo", "olefile", "sphinx (>=2.4)", "sphinx-copybutton", "sphinx-inline-tabs", "sphinx-issues (>=3.0.1)", "sphinx-removed-in", "sphinxext-opengraph"] -tests = ["check-manifest", "coverage", "defusedxml", "markdown2", "olefile", "packaging", "pyroma", "pytest", "pytest-cov", "pytest-timeout"] - -[[package]] -name = "platformdirs" -version = "3.8.1" -description = "A small Python package for determining appropriate platform-specific dirs, e.g. a \"user data dir\"." -optional = false -python-versions = ">=3.7" -files = [ - {file = "platformdirs-3.8.1-py3-none-any.whl", hash = "sha256:cec7b889196b9144d088e4c57d9ceef7374f6c39694ad1577a0aab50d27ea28c"}, - {file = "platformdirs-3.8.1.tar.gz", hash = "sha256:f87ca4fcff7d2b0f81c6a748a77973d7af0f4d526f98f308477c3c436c74d528"}, -] - -[package.extras] -docs = ["furo (>=2023.5.20)", "proselint (>=0.13)", "sphinx (>=7.0.1)", "sphinx-autodoc-typehints (>=1.23,!=1.23.4)"] -test = ["appdirs (==1.4.4)", "covdefaults (>=2.3)", "pytest (>=7.3.1)", "pytest-cov (>=4.1)", "pytest-mock (>=3.10)"] - -[[package]] -name = "pluggy" -version = "1.0.0" -description = "plugin and hook calling mechanisms for python" -optional = false -python-versions = ">=3.6" -files = [ - {file = "pluggy-1.0.0-py2.py3-none-any.whl", hash = "sha256:74134bbf457f031a36d68416e1509f34bd5ccc019f0bcc952c7b909d06b37bd3"}, - {file = "pluggy-1.0.0.tar.gz", hash = "sha256:4224373bacce55f955a878bf9cfa763c1e360858e330072059e10bad68531159"}, -] - -[package.extras] -dev = ["pre-commit", "tox"] -testing = ["pytest", "pytest-benchmark"] - -[[package]] -name = "pre-commit" -version = "3.1.1" -description = "A framework for managing and maintaining multi-language pre-commit hooks." -optional = false -python-versions = ">=3.8" -files = [ - {file = "pre_commit-3.1.1-py2.py3-none-any.whl", hash = "sha256:b80254e60668e1dd1f5c03a1c9e0413941d61f568a57d745add265945f65bfe8"}, - {file = "pre_commit-3.1.1.tar.gz", hash = "sha256:d63e6537f9252d99f65755ae5b79c989b462d511ebbc481b561db6a297e1e865"}, -] - -[package.dependencies] -cfgv = ">=2.0.0" -identify = ">=1.0.0" -nodeenv = ">=0.11.1" -pyyaml = ">=5.1" -virtualenv = ">=20.10.0" - -[[package]] -name = "py" -version = "1.11.0" -description = "library with cross-python path, ini-parsing, io, code, log facilities" -optional = false -python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*, !=3.4.*" -files = [ - {file = "py-1.11.0-py2.py3-none-any.whl", hash = "sha256:607c53218732647dff4acdfcd50cb62615cedf612e72d1724fb1a0cc6405b378"}, - {file = "py-1.11.0.tar.gz", hash = "sha256:51c75c4126074b472f746a24399ad32f6053d1b34b68d2fa41e558e6f4a98719"}, -] - -[[package]] -name = "pycparser" -version = "2.21" -description = "C parser in Python" -optional = false -python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*" -files = [ - {file = "pycparser-2.21-py2.py3-none-any.whl", hash = "sha256:8ee45429555515e1f6b185e78100aea234072576aa43ab53aefcae078162fca9"}, - {file = "pycparser-2.21.tar.gz", hash = "sha256:e644fdec12f7872f86c58ff790da456218b10f863970249516d60a5eaca77206"}, -] - -[[package]] -name = "pydantic" -version = "1.10.11" -description = "Data validation and settings management using python type hints" -optional = false -python-versions = ">=3.7" -files = [ - {file = "pydantic-1.10.11-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:ff44c5e89315b15ff1f7fdaf9853770b810936d6b01a7bcecaa227d2f8fe444f"}, - {file = "pydantic-1.10.11-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:a6c098d4ab5e2d5b3984d3cb2527e2d6099d3de85630c8934efcfdc348a9760e"}, - {file = "pydantic-1.10.11-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:16928fdc9cb273c6af00d9d5045434c39afba5f42325fb990add2c241402d151"}, - {file = "pydantic-1.10.11-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:0588788a9a85f3e5e9ebca14211a496409cb3deca5b6971ff37c556d581854e7"}, - {file = "pydantic-1.10.11-cp310-cp310-musllinux_1_1_i686.whl", hash = "sha256:e9baf78b31da2dc3d3f346ef18e58ec5f12f5aaa17ac517e2ffd026a92a87588"}, - {file = "pydantic-1.10.11-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:373c0840f5c2b5b1ccadd9286782852b901055998136287828731868027a724f"}, - {file = "pydantic-1.10.11-cp310-cp310-win_amd64.whl", hash = "sha256:c3339a46bbe6013ef7bdd2844679bfe500347ac5742cd4019a88312aa58a9847"}, - {file = "pydantic-1.10.11-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:08a6c32e1c3809fbc49debb96bf833164f3438b3696abf0fbeceb417d123e6eb"}, - {file = "pydantic-1.10.11-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:a451ccab49971af043ec4e0d207cbc8cbe53dbf148ef9f19599024076fe9c25b"}, - {file = "pydantic-1.10.11-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:5b02d24f7b2b365fed586ed73582c20f353a4c50e4be9ba2c57ab96f8091ddae"}, - {file = "pydantic-1.10.11-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:3f34739a89260dfa420aa3cbd069fbcc794b25bbe5c0a214f8fb29e363484b66"}, - {file = "pydantic-1.10.11-cp311-cp311-musllinux_1_1_i686.whl", hash = "sha256:e297897eb4bebde985f72a46a7552a7556a3dd11e7f76acda0c1093e3dbcf216"}, - {file = "pydantic-1.10.11-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:d185819a7a059550ecb85d5134e7d40f2565f3dd94cfd870132c5f91a89cf58c"}, - {file = "pydantic-1.10.11-cp311-cp311-win_amd64.whl", hash = "sha256:4400015f15c9b464c9db2d5d951b6a780102cfa5870f2c036d37c23b56f7fc1b"}, - {file = "pydantic-1.10.11-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:2417de68290434461a266271fc57274a138510dca19982336639484c73a07af6"}, - {file = "pydantic-1.10.11-cp37-cp37m-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:331c031ba1554b974c98679bd0780d89670d6fd6f53f5d70b10bdc9addee1713"}, - {file = "pydantic-1.10.11-cp37-cp37m-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:8268a735a14c308923e8958363e3a3404f6834bb98c11f5ab43251a4e410170c"}, - {file = "pydantic-1.10.11-cp37-cp37m-musllinux_1_1_i686.whl", hash = "sha256:44e51ba599c3ef227e168424e220cd3e544288c57829520dc90ea9cb190c3248"}, - {file = "pydantic-1.10.11-cp37-cp37m-musllinux_1_1_x86_64.whl", hash = "sha256:d7781f1d13b19700b7949c5a639c764a077cbbdd4322ed505b449d3ca8edcb36"}, - {file = "pydantic-1.10.11-cp37-cp37m-win_amd64.whl", hash = "sha256:7522a7666157aa22b812ce14c827574ddccc94f361237ca6ea8bb0d5c38f1629"}, - {file = "pydantic-1.10.11-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:bc64eab9b19cd794a380179ac0e6752335e9555d214cfcb755820333c0784cb3"}, - {file = "pydantic-1.10.11-cp38-cp38-macosx_11_0_arm64.whl", hash = "sha256:8dc77064471780262b6a68fe67e013298d130414d5aaf9b562c33987dbd2cf4f"}, - {file = "pydantic-1.10.11-cp38-cp38-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:fe429898f2c9dd209bd0632a606bddc06f8bce081bbd03d1c775a45886e2c1cb"}, - {file = "pydantic-1.10.11-cp38-cp38-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:192c608ad002a748e4a0bed2ddbcd98f9b56df50a7c24d9a931a8c5dd053bd3d"}, - {file = "pydantic-1.10.11-cp38-cp38-musllinux_1_1_i686.whl", hash = "sha256:ef55392ec4bb5721f4ded1096241e4b7151ba6d50a50a80a2526c854f42e6a2f"}, - {file = "pydantic-1.10.11-cp38-cp38-musllinux_1_1_x86_64.whl", hash = "sha256:41e0bb6efe86281623abbeeb0be64eab740c865388ee934cd3e6a358784aca6e"}, - {file = "pydantic-1.10.11-cp38-cp38-win_amd64.whl", hash = "sha256:265a60da42f9f27e0b1014eab8acd3e53bd0bad5c5b4884e98a55f8f596b2c19"}, - {file = "pydantic-1.10.11-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:469adf96c8e2c2bbfa655fc7735a2a82f4c543d9fee97bd113a7fb509bf5e622"}, - {file = "pydantic-1.10.11-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:e6cbfbd010b14c8a905a7b10f9fe090068d1744d46f9e0c021db28daeb8b6de1"}, - {file = "pydantic-1.10.11-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:abade85268cc92dff86d6effcd917893130f0ff516f3d637f50dadc22ae93999"}, - {file = "pydantic-1.10.11-cp39-cp39-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:e9738b0f2e6c70f44ee0de53f2089d6002b10c33264abee07bdb5c7f03038303"}, - {file = "pydantic-1.10.11-cp39-cp39-musllinux_1_1_i686.whl", hash = "sha256:787cf23e5a0cde753f2eabac1b2e73ae3844eb873fd1f5bdbff3048d8dbb7604"}, - {file = "pydantic-1.10.11-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:174899023337b9fc685ac8adaa7b047050616136ccd30e9070627c1aaab53a13"}, - {file = "pydantic-1.10.11-cp39-cp39-win_amd64.whl", hash = "sha256:1954f8778489a04b245a1e7b8b22a9d3ea8ef49337285693cf6959e4b757535e"}, - {file = "pydantic-1.10.11-py3-none-any.whl", hash = "sha256:008c5e266c8aada206d0627a011504e14268a62091450210eda7c07fabe6963e"}, - {file = "pydantic-1.10.11.tar.gz", hash = "sha256:f66d479cf7eb331372c470614be6511eae96f1f120344c25f3f9bb59fb1b5528"}, -] - -[package.dependencies] -typing-extensions = ">=4.2.0" - -[package.extras] -dotenv = ["python-dotenv (>=0.10.4)"] -email = ["email-validator (>=1.0.3)"] - -[[package]] -name = "pydocstyle" -version = "6.3.0" -description = "Python docstring style checker" -optional = false -python-versions = ">=3.6" -files = [ - {file = "pydocstyle-6.3.0-py3-none-any.whl", hash = "sha256:118762d452a49d6b05e194ef344a55822987a462831ade91ec5c06fd2169d019"}, - {file = "pydocstyle-6.3.0.tar.gz", hash = "sha256:7ce43f0c0ac87b07494eb9c0b462c0b73e6ff276807f204d6b53edc72b7e44e1"}, -] - -[package.dependencies] -snowballstemmer = ">=2.2.0" - -[package.extras] -toml = ["tomli (>=1.2.3)"] - -[[package]] -name = "pygments" -version = "2.14.0" -description = "Pygments is a syntax highlighting package written in Python." -optional = false -python-versions = ">=3.6" -files = [ - {file = "Pygments-2.14.0-py3-none-any.whl", hash = "sha256:fa7bd7bd2771287c0de303af8bfdfc731f51bd2c6a47ab69d117138893b82717"}, - {file = "Pygments-2.14.0.tar.gz", hash = "sha256:b3ed06a9e8ac9a9aae5a6f5dbe78a8a58655d17b43b93c078f094ddc476ae297"}, -] - -[package.extras] -plugins = ["importlib-metadata"] - -[[package]] -name = "pylint" -version = "2.16.3" -description = "python code static checker" -optional = false -python-versions = ">=3.7.2" -files = [ - {file = "pylint-2.16.3-py3-none-any.whl", hash = "sha256:3e803be66e3a34c76b0aa1a3cf4714b538335e79bd69718d34fcf36d8fff2a2b"}, - {file = "pylint-2.16.3.tar.gz", hash = "sha256:0decdf8dfe30298cd9f8d82e9a1542da464db47da60e03641631086671a03621"}, -] - -[package.dependencies] -astroid = ">=2.14.2,<=2.16.0-dev0" -colorama = {version = ">=0.4.5", markers = "sys_platform == \"win32\""} -dill = [ - {version = ">=0.2", markers = "python_version < \"3.11\""}, - {version = ">=0.3.6", markers = "python_version >= \"3.11\""}, -] -isort = ">=4.2.5,<6" -mccabe = ">=0.6,<0.8" -platformdirs = ">=2.2.0" -tomli = {version = ">=1.1.0", markers = "python_version < \"3.11\""} -tomlkit = ">=0.10.1" -typing-extensions = {version = ">=3.10.0", markers = "python_version < \"3.10\""} - -[package.extras] -spelling = ["pyenchant (>=3.2,<4.0)"] -testutils = ["gitpython (>3)"] - -[[package]] -name = "pyparsing" -version = "3.0.9" -description = "pyparsing module - Classes and methods to define and execute parsing grammars" -optional = false -python-versions = ">=3.6.8" -files = [ - {file = "pyparsing-3.0.9-py3-none-any.whl", hash = "sha256:5026bae9a10eeaefb61dab2f09052b9f4307d44aee4eda64b309723d8d206bbc"}, - {file = "pyparsing-3.0.9.tar.gz", hash = "sha256:2b020ecf7d21b687f219b71ecad3631f644a47f01403fa1d1036b0c6416d70fb"}, -] - -[package.extras] -diagrams = ["jinja2", "railroad-diagrams"] - -[[package]] -name = "pysocks" -version = "1.7.1" -description = "A Python SOCKS client module. See https://github.com/Anorov/PySocks for more information." -optional = false -python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*" -files = [ - {file = "PySocks-1.7.1-py27-none-any.whl", hash = "sha256:08e69f092cc6dbe92a0fdd16eeb9b9ffbc13cadfe5ca4c7bd92ffb078b293299"}, - {file = "PySocks-1.7.1-py3-none-any.whl", hash = "sha256:2725bd0a9925919b9b51739eea5f9e2bae91e83288108a9ad338b2e3a4435ee5"}, - {file = "PySocks-1.7.1.tar.gz", hash = "sha256:3f8804571ebe159c380ac6de37643bb4685970655d3bba243530d6558b799aa0"}, -] - -[[package]] -name = "pytest" -version = "7.2.2" -description = "pytest: simple powerful testing with Python" -optional = false -python-versions = ">=3.7" -files = [ - {file = "pytest-7.2.2-py3-none-any.whl", hash = "sha256:130328f552dcfac0b1cec75c12e3f005619dc5f874f0a06e8ff7263f0ee6225e"}, - {file = "pytest-7.2.2.tar.gz", hash = "sha256:c99ab0c73aceb050f68929bc93af19ab6db0558791c6a0715723abe9d0ade9d4"}, -] - -[package.dependencies] -attrs = ">=19.2.0" -colorama = {version = "*", markers = "sys_platform == \"win32\""} -exceptiongroup = {version = ">=1.0.0rc8", markers = "python_version < \"3.11\""} -iniconfig = "*" -packaging = "*" -pluggy = ">=0.12,<2.0" -tomli = {version = ">=1.0.0", markers = "python_version < \"3.11\""} - -[package.extras] -testing = ["argcomplete", "hypothesis (>=3.56)", "mock", "nose", "pygments (>=2.7.2)", "requests", "xmlschema"] - -[[package]] -name = "pytest-cov" -version = "4.0.0" -description = "Pytest plugin for measuring coverage." -optional = false -python-versions = ">=3.6" -files = [ - {file = "pytest-cov-4.0.0.tar.gz", hash = "sha256:996b79efde6433cdbd0088872dbc5fb3ed7fe1578b68cdbba634f14bb8dd0470"}, - {file = "pytest_cov-4.0.0-py3-none-any.whl", hash = "sha256:2feb1b751d66a8bd934e5edfa2e961d11309dc37b73b0eabe73b5945fee20f6b"}, -] - -[package.dependencies] -coverage = {version = ">=5.2.1", extras = ["toml"]} -pytest = ">=4.6" - -[package.extras] -testing = ["fields", "hunter", "process-tests", "pytest-xdist", "six", "virtualenv"] - -[[package]] -name = "pytest-html" -version = "3.2.0" -description = "pytest plugin for generating HTML reports" -optional = false -python-versions = ">=3.6" -files = [ - {file = "pytest-html-3.2.0.tar.gz", hash = "sha256:c4e2f4bb0bffc437f51ad2174a8a3e71df81bbc2f6894604e604af18fbe687c3"}, - {file = "pytest_html-3.2.0-py3-none-any.whl", hash = "sha256:868c08564a68d8b2c26866f1e33178419bb35b1e127c33784a28622eb827f3f3"}, -] - -[package.dependencies] -py = ">=1.8.2" -pytest = ">=5.0,<6.0.0 || >6.0.0" -pytest-metadata = "*" - -[[package]] -name = "pytest-metadata" -version = "2.0.4" -description = "pytest plugin for test session metadata" -optional = false -python-versions = ">=3.7,<4.0" -files = [ - {file = "pytest_metadata-2.0.4-py3-none-any.whl", hash = "sha256:acb739f89fabb3d798c099e9e0c035003062367a441910aaaf2281bc1972ee14"}, - {file = "pytest_metadata-2.0.4.tar.gz", hash = "sha256:fcc653f65fe3035b478820b5284fbf0f52803622ee3f60a2faed7a7d3ba1f41e"}, -] - -[package.dependencies] -pytest = ">=3.0.0,<8.0.0" - -[[package]] -name = "pyupgrade" -version = "3.3.1" -description = "A tool to automatically upgrade syntax for newer versions." -optional = false -python-versions = ">=3.7" -files = [ - {file = "pyupgrade-3.3.1-py2.py3-none-any.whl", hash = "sha256:3b93641963df022d605c78aeae4b5956a5296ea24701eafaef9c487527b77e60"}, - {file = "pyupgrade-3.3.1.tar.gz", hash = "sha256:f88bce38b0ba92c2a9a5063c8629e456e8d919b67d2d42c7ecab82ff196f9813"}, -] - -[package.dependencies] -tokenize-rt = ">=3.2.0" - -[[package]] -name = "pyvirtualdisplay" -version = "3.0" -description = "python wrapper for Xvfb, Xephyr and Xvnc" -optional = false -python-versions = "*" -files = [ - {file = "PyVirtualDisplay-3.0-py3-none-any.whl", hash = "sha256:40d4b8dfe4b8de8552e28eb367647f311f88a130bf837fe910e7f180d5477f0e"}, - {file = "PyVirtualDisplay-3.0.tar.gz", hash = "sha256:09755bc3ceb6eb725fb07eca5425f43f2358d3bf08e00d2a9b792a1aedd16159"}, -] - -[[package]] -name = "pyyaml" -version = "6.0" -description = "YAML parser and emitter for Python" -optional = false -python-versions = ">=3.6" -files = [ - {file = "PyYAML-6.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:d4db7c7aef085872ef65a8fd7d6d09a14ae91f691dec3e87ee5ee0539d516f53"}, - {file = "PyYAML-6.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:9df7ed3b3d2e0ecfe09e14741b857df43adb5a3ddadc919a2d94fbdf78fea53c"}, - {file = "PyYAML-6.0-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:77f396e6ef4c73fdc33a9157446466f1cff553d979bd00ecb64385760c6babdc"}, - {file = "PyYAML-6.0-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:a80a78046a72361de73f8f395f1f1e49f956c6be882eed58505a15f3e430962b"}, - {file = "PyYAML-6.0-cp310-cp310-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_12_x86_64.manylinux2010_x86_64.whl", hash = "sha256:f84fbc98b019fef2ee9a1cb3ce93e3187a6df0b2538a651bfb890254ba9f90b5"}, - {file = "PyYAML-6.0-cp310-cp310-win32.whl", hash = "sha256:2cd5df3de48857ed0544b34e2d40e9fac445930039f3cfe4bcc592a1f836d513"}, - {file = "PyYAML-6.0-cp310-cp310-win_amd64.whl", hash = "sha256:daf496c58a8c52083df09b80c860005194014c3698698d1a57cbcfa182142a3a"}, - {file = "PyYAML-6.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:d4b0ba9512519522b118090257be113b9468d804b19d63c71dbcf4a48fa32358"}, - {file = "PyYAML-6.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:81957921f441d50af23654aa6c5e5eaf9b06aba7f0a19c18a538dc7ef291c5a1"}, - {file = "PyYAML-6.0-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:afa17f5bc4d1b10afd4466fd3a44dc0e245382deca5b3c353d8b757f9e3ecb8d"}, - {file = "PyYAML-6.0-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:dbad0e9d368bb989f4515da330b88a057617d16b6a8245084f1b05400f24609f"}, - {file = "PyYAML-6.0-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:432557aa2c09802be39460360ddffd48156e30721f5e8d917f01d31694216782"}, - {file = "PyYAML-6.0-cp311-cp311-win32.whl", hash = "sha256:bfaef573a63ba8923503d27530362590ff4f576c626d86a9fed95822a8255fd7"}, - {file = "PyYAML-6.0-cp311-cp311-win_amd64.whl", hash = "sha256:01b45c0191e6d66c470b6cf1b9531a771a83c1c4208272ead47a3ae4f2f603bf"}, - {file = "PyYAML-6.0-cp36-cp36m-macosx_10_9_x86_64.whl", hash = "sha256:897b80890765f037df3403d22bab41627ca8811ae55e9a722fd0392850ec4d86"}, - {file = "PyYAML-6.0-cp36-cp36m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:50602afada6d6cbfad699b0c7bb50d5ccffa7e46a3d738092afddc1f9758427f"}, - {file = "PyYAML-6.0-cp36-cp36m-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:48c346915c114f5fdb3ead70312bd042a953a8ce5c7106d5bfb1a5254e47da92"}, - {file = "PyYAML-6.0-cp36-cp36m-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_12_x86_64.manylinux2010_x86_64.whl", hash = "sha256:98c4d36e99714e55cfbaaee6dd5badbc9a1ec339ebfc3b1f52e293aee6bb71a4"}, - {file = "PyYAML-6.0-cp36-cp36m-win32.whl", hash = "sha256:0283c35a6a9fbf047493e3a0ce8d79ef5030852c51e9d911a27badfde0605293"}, - {file = "PyYAML-6.0-cp36-cp36m-win_amd64.whl", hash = "sha256:07751360502caac1c067a8132d150cf3d61339af5691fe9e87803040dbc5db57"}, - {file = "PyYAML-6.0-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:819b3830a1543db06c4d4b865e70ded25be52a2e0631ccd2f6a47a2822f2fd7c"}, - {file = "PyYAML-6.0-cp37-cp37m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:473f9edb243cb1935ab5a084eb238d842fb8f404ed2193a915d1784b5a6b5fc0"}, - {file = "PyYAML-6.0-cp37-cp37m-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:0ce82d761c532fe4ec3f87fc45688bdd3a4c1dc5e0b4a19814b9009a29baefd4"}, - {file = "PyYAML-6.0-cp37-cp37m-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_12_x86_64.manylinux2010_x86_64.whl", hash = "sha256:231710d57adfd809ef5d34183b8ed1eeae3f76459c18fb4a0b373ad56bedcdd9"}, - {file = "PyYAML-6.0-cp37-cp37m-win32.whl", hash = "sha256:c5687b8d43cf58545ade1fe3e055f70eac7a5a1a0bf42824308d868289a95737"}, - {file = "PyYAML-6.0-cp37-cp37m-win_amd64.whl", hash = "sha256:d15a181d1ecd0d4270dc32edb46f7cb7733c7c508857278d3d378d14d606db2d"}, - {file = "PyYAML-6.0-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:0b4624f379dab24d3725ffde76559cff63d9ec94e1736b556dacdfebe5ab6d4b"}, - {file = "PyYAML-6.0-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:213c60cd50106436cc818accf5baa1aba61c0189ff610f64f4a3e8c6726218ba"}, - {file = "PyYAML-6.0-cp38-cp38-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:9fa600030013c4de8165339db93d182b9431076eb98eb40ee068700c9c813e34"}, - {file = "PyYAML-6.0-cp38-cp38-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_12_x86_64.manylinux2010_x86_64.whl", hash = "sha256:277a0ef2981ca40581a47093e9e2d13b3f1fbbeffae064c1d21bfceba2030287"}, - {file = "PyYAML-6.0-cp38-cp38-win32.whl", hash = "sha256:d4eccecf9adf6fbcc6861a38015c2a64f38b9d94838ac1810a9023a0609e1b78"}, - {file = "PyYAML-6.0-cp38-cp38-win_amd64.whl", hash = "sha256:1e4747bc279b4f613a09eb64bba2ba602d8a6664c6ce6396a4d0cd413a50ce07"}, - {file = "PyYAML-6.0-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:055d937d65826939cb044fc8c9b08889e8c743fdc6a32b33e2390f66013e449b"}, - {file = "PyYAML-6.0-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:e61ceaab6f49fb8bdfaa0f92c4b57bcfbea54c09277b1b4f7ac376bfb7a7c174"}, - {file = "PyYAML-6.0-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d67d839ede4ed1b28a4e8909735fc992a923cdb84e618544973d7dfc71540803"}, - {file = "PyYAML-6.0-cp39-cp39-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:cba8c411ef271aa037d7357a2bc8f9ee8b58b9965831d9e51baf703280dc73d3"}, - {file = "PyYAML-6.0-cp39-cp39-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_12_x86_64.manylinux2010_x86_64.whl", hash = "sha256:40527857252b61eacd1d9af500c3337ba8deb8fc298940291486c465c8b46ec0"}, - {file = "PyYAML-6.0-cp39-cp39-win32.whl", hash = "sha256:b5b9eccad747aabaaffbc6064800670f0c297e52c12754eb1d976c57e4f74dcb"}, - {file = "PyYAML-6.0-cp39-cp39-win_amd64.whl", hash = "sha256:b3d267842bf12586ba6c734f89d1f5b871df0273157918b0ccefa29deb05c21c"}, - {file = "PyYAML-6.0.tar.gz", hash = "sha256:68fb519c14306fec9720a2a5b45bc9f0c8d1b9c72adf45c37baedfcd949c35a2"}, -] - -[[package]] -name = "ratelimit" -version = "2.2.1" -description = "API rate limit decorator" -optional = false -python-versions = "*" -files = [ - {file = "ratelimit-2.2.1.tar.gz", hash = "sha256:af8a9b64b821529aca09ebaf6d8d279100d766f19e90b5059ac6a718ca6dee42"}, -] - -[[package]] -name = "requests" -version = "2.28.2" -description = "Python HTTP for Humans." -optional = false -python-versions = ">=3.7, <4" -files = [ - {file = "requests-2.28.2-py3-none-any.whl", hash = "sha256:64299f4909223da747622c030b781c0d7811e359c37124b4bd368fb8c6518baa"}, - {file = "requests-2.28.2.tar.gz", hash = "sha256:98b1b2782e3c6c4904938b84c0eb932721069dfdb9134313beff7c83c2df24bf"}, -] - -[package.dependencies] -certifi = ">=2017.4.17" -charset-normalizer = ">=2,<4" -idna = ">=2.5,<4" -urllib3 = ">=1.21.1,<1.27" - -[package.extras] -socks = ["PySocks (>=1.5.6,!=1.5.7)"] -use-chardet-on-py3 = ["chardet (>=3.0.2,<6)"] - -[[package]] -name = "requests-toolbelt" -version = "0.10.1" -description = "A utility belt for advanced users of python-requests" -optional = false -python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*" -files = [ - {file = "requests-toolbelt-0.10.1.tar.gz", hash = "sha256:62e09f7ff5ccbda92772a29f394a49c3ad6cb181d568b1337626b2abb628a63d"}, - {file = "requests_toolbelt-0.10.1-py2.py3-none-any.whl", hash = "sha256:18565aa58116d9951ac39baa288d3adb5b3ff975c4f25eee78555d89e8f247f7"}, -] - -[package.dependencies] -requests = ">=2.0.1,<3.0.0" - -[[package]] -name = "rich" -version = "13.3.2" -description = "Render rich text, tables, progress bars, syntax highlighting, markdown and more to the terminal" -optional = false -python-versions = ">=3.7.0" -files = [ - {file = "rich-13.3.2-py3-none-any.whl", hash = "sha256:a104f37270bf677148d8acb07d33be1569eeee87e2d1beb286a4e9113caf6f2f"}, - {file = "rich-13.3.2.tar.gz", hash = "sha256:91954fe80cfb7985727a467ca98a7618e5dd15178cc2da10f553b36a93859001"}, -] - -[package.dependencies] -markdown-it-py = ">=2.2.0,<3.0.0" -pygments = ">=2.13.0,<3.0.0" -typing-extensions = {version = ">=4.0.0,<5.0", markers = "python_version < \"3.9\""} - -[package.extras] -jupyter = ["ipywidgets (>=7.5.1,<9)"] - -[[package]] -name = "ruamel-yaml" -version = "0.17.21" -description = "ruamel.yaml is a YAML parser/emitter that supports roundtrip preservation of comments, seq/map flow style, and map key order" -optional = false -python-versions = ">=3" -files = [ - {file = "ruamel.yaml-0.17.21-py3-none-any.whl", hash = "sha256:742b35d3d665023981bd6d16b3d24248ce5df75fdb4e2924e93a05c1f8b61ca7"}, - {file = "ruamel.yaml-0.17.21.tar.gz", hash = "sha256:8b7ce697a2f212752a35c1ac414471dc16c424c9573be4926b56ff3f5d23b7af"}, -] - -[package.dependencies] -"ruamel.yaml.clib" = {version = ">=0.2.6", markers = "platform_python_implementation == \"CPython\" and python_version < \"3.11\""} - -[package.extras] -docs = ["ryd"] -jinja2 = ["ruamel.yaml.jinja2 (>=0.2)"] - -[[package]] -name = "ruamel-yaml-clib" -version = "0.2.7" -description = "C version of reader, parser and emitter for ruamel.yaml derived from libyaml" -optional = false -python-versions = ">=3.5" -files = [ - {file = "ruamel.yaml.clib-0.2.7-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:d5859983f26d8cd7bb5c287ef452e8aacc86501487634573d260968f753e1d71"}, - {file = "ruamel.yaml.clib-0.2.7-cp310-cp310-macosx_12_0_arm64.whl", hash = "sha256:debc87a9516b237d0466a711b18b6ebeb17ba9f391eb7f91c649c5c4ec5006c7"}, - {file = "ruamel.yaml.clib-0.2.7-cp310-cp310-manylinux2014_aarch64.whl", hash = "sha256:df5828871e6648db72d1c19b4bd24819b80a755c4541d3409f0f7acd0f335c80"}, - {file = "ruamel.yaml.clib-0.2.7-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_24_x86_64.whl", hash = "sha256:efa08d63ef03d079dcae1dfe334f6c8847ba8b645d08df286358b1f5293d24ab"}, - {file = "ruamel.yaml.clib-0.2.7-cp310-cp310-win32.whl", hash = "sha256:763d65baa3b952479c4e972669f679fe490eee058d5aa85da483ebae2009d231"}, - {file = "ruamel.yaml.clib-0.2.7-cp310-cp310-win_amd64.whl", hash = "sha256:d000f258cf42fec2b1bbf2863c61d7b8918d31ffee905da62dede869254d3b8a"}, - {file = "ruamel.yaml.clib-0.2.7-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:045e0626baf1c52e5527bd5db361bc83180faaba2ff586e763d3d5982a876a9e"}, - {file = "ruamel.yaml.clib-0.2.7-cp311-cp311-macosx_13_0_arm64.whl", hash = "sha256:1a6391a7cabb7641c32517539ca42cf84b87b667bad38b78d4d42dd23e957c81"}, - {file = "ruamel.yaml.clib-0.2.7-cp311-cp311-manylinux2014_aarch64.whl", hash = "sha256:9c7617df90c1365638916b98cdd9be833d31d337dbcd722485597b43c4a215bf"}, - {file = "ruamel.yaml.clib-0.2.7-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_24_x86_64.whl", hash = "sha256:41d0f1fa4c6830176eef5b276af04c89320ea616655d01327d5ce65e50575c94"}, - {file = "ruamel.yaml.clib-0.2.7-cp311-cp311-win32.whl", hash = "sha256:f6d3d39611ac2e4f62c3128a9eed45f19a6608670c5a2f4f07f24e8de3441d38"}, - {file = "ruamel.yaml.clib-0.2.7-cp311-cp311-win_amd64.whl", hash = "sha256:da538167284de58a52109a9b89b8f6a53ff8437dd6dc26d33b57bf6699153122"}, - {file = "ruamel.yaml.clib-0.2.7-cp36-cp36m-macosx_10_9_x86_64.whl", hash = "sha256:4b3a93bb9bc662fc1f99c5c3ea8e623d8b23ad22f861eb6fce9377ac07ad6072"}, - {file = "ruamel.yaml.clib-0.2.7-cp36-cp36m-macosx_12_0_arm64.whl", hash = "sha256:a234a20ae07e8469da311e182e70ef6b199d0fbeb6c6cc2901204dd87fb867e8"}, - {file = "ruamel.yaml.clib-0.2.7-cp36-cp36m-manylinux2014_aarch64.whl", hash = "sha256:15910ef4f3e537eea7fe45f8a5d19997479940d9196f357152a09031c5be59f3"}, - {file = "ruamel.yaml.clib-0.2.7-cp36-cp36m-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_24_x86_64.whl", hash = "sha256:370445fd795706fd291ab00c9df38a0caed0f17a6fb46b0f607668ecb16ce763"}, - {file = "ruamel.yaml.clib-0.2.7-cp36-cp36m-win32.whl", hash = "sha256:ecdf1a604009bd35c674b9225a8fa609e0282d9b896c03dd441a91e5f53b534e"}, - {file = "ruamel.yaml.clib-0.2.7-cp36-cp36m-win_amd64.whl", hash = "sha256:f34019dced51047d6f70cb9383b2ae2853b7fc4dce65129a5acd49f4f9256646"}, - {file = "ruamel.yaml.clib-0.2.7-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:2aa261c29a5545adfef9296b7e33941f46aa5bbd21164228e833412af4c9c75f"}, - {file = "ruamel.yaml.clib-0.2.7-cp37-cp37m-macosx_12_0_arm64.whl", hash = "sha256:f01da5790e95815eb5a8a138508c01c758e5f5bc0ce4286c4f7028b8dd7ac3d0"}, - {file = "ruamel.yaml.clib-0.2.7-cp37-cp37m-manylinux2014_aarch64.whl", hash = "sha256:40d030e2329ce5286d6b231b8726959ebbe0404c92f0a578c0e2482182e38282"}, - {file = "ruamel.yaml.clib-0.2.7-cp37-cp37m-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_24_x86_64.whl", hash = "sha256:c3ca1fbba4ae962521e5eb66d72998b51f0f4d0f608d3c0347a48e1af262efa7"}, - {file = "ruamel.yaml.clib-0.2.7-cp37-cp37m-win32.whl", hash = "sha256:7bdb4c06b063f6fd55e472e201317a3bb6cdeeee5d5a38512ea5c01e1acbdd93"}, - {file = "ruamel.yaml.clib-0.2.7-cp37-cp37m-win_amd64.whl", hash = "sha256:be2a7ad8fd8f7442b24323d24ba0b56c51219513cfa45b9ada3b87b76c374d4b"}, - {file = "ruamel.yaml.clib-0.2.7-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:91a789b4aa0097b78c93e3dc4b40040ba55bef518f84a40d4442f713b4094acb"}, - {file = "ruamel.yaml.clib-0.2.7-cp38-cp38-macosx_12_0_arm64.whl", hash = "sha256:99e77daab5d13a48a4054803d052ff40780278240a902b880dd37a51ba01a307"}, - {file = "ruamel.yaml.clib-0.2.7-cp38-cp38-manylinux2014_aarch64.whl", hash = "sha256:3243f48ecd450eddadc2d11b5feb08aca941b5cd98c9b1db14b2fd128be8c697"}, - {file = "ruamel.yaml.clib-0.2.7-cp38-cp38-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_24_x86_64.whl", hash = "sha256:8831a2cedcd0f0927f788c5bdf6567d9dc9cc235646a434986a852af1cb54b4b"}, - {file = "ruamel.yaml.clib-0.2.7-cp38-cp38-win32.whl", hash = "sha256:3110a99e0f94a4a3470ff67fc20d3f96c25b13d24c6980ff841e82bafe827cac"}, - {file = "ruamel.yaml.clib-0.2.7-cp38-cp38-win_amd64.whl", hash = "sha256:92460ce908546ab69770b2e576e4f99fbb4ce6ab4b245345a3869a0a0410488f"}, - {file = "ruamel.yaml.clib-0.2.7-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:5bc0667c1eb8f83a3752b71b9c4ba55ef7c7058ae57022dd9b29065186a113d9"}, - {file = "ruamel.yaml.clib-0.2.7-cp39-cp39-macosx_12_0_arm64.whl", hash = "sha256:4a4d8d417868d68b979076a9be6a38c676eca060785abaa6709c7b31593c35d1"}, - {file = "ruamel.yaml.clib-0.2.7-cp39-cp39-manylinux2014_aarch64.whl", hash = "sha256:bf9a6bc4a0221538b1a7de3ed7bca4c93c02346853f44e1cd764be0023cd3640"}, - {file = "ruamel.yaml.clib-0.2.7-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_24_x86_64.whl", hash = "sha256:a7b301ff08055d73223058b5c46c55638917f04d21577c95e00e0c4d79201a6b"}, - {file = "ruamel.yaml.clib-0.2.7-cp39-cp39-win32.whl", hash = "sha256:d5e51e2901ec2366b79f16c2299a03e74ba4531ddcfacc1416639c557aef0ad8"}, - {file = "ruamel.yaml.clib-0.2.7-cp39-cp39-win_amd64.whl", hash = "sha256:184faeaec61dbaa3cace407cffc5819f7b977e75360e8d5ca19461cd851a5fc5"}, - {file = "ruamel.yaml.clib-0.2.7.tar.gz", hash = "sha256:1f08fd5a2bea9c4180db71678e850b995d2a5f4537be0e94557668cf0f5f9497"}, -] - -[[package]] -name = "safety" -version = "2.3.5" -description = "Checks installed dependencies for known vulnerabilities and licenses." -optional = false -python-versions = "*" -files = [ - {file = "safety-2.3.5-py3-none-any.whl", hash = "sha256:2227fcac1b22b53c1615af78872b48348661691450aa25d6704a5504dbd1f7e2"}, - {file = "safety-2.3.5.tar.gz", hash = "sha256:a60c11f8952f412cbb165d70cb1f673a3b43a2ba9a93ce11f97e6a4de834aa3a"}, -] - -[package.dependencies] -Click = ">=8.0.2" -dparse = ">=0.6.2" -packaging = ">=21.0,<22.0" -requests = "*" -"ruamel.yaml" = ">=0.17.21" -setuptools = ">=19.3" - -[package.extras] -github = ["jinja2 (>=3.1.0)", "pygithub (>=1.43.3)"] -gitlab = ["python-gitlab (>=1.3.0)"] - -[[package]] -name = "selenium" -version = "4.8.2" -description = "" -optional = false -python-versions = ">=3.7" -files = [ - {file = "selenium-4.8.2-py3-none-any.whl", hash = "sha256:bd04eb41395605d9b2b65fe587f3fed21431da75512985c52772529e5e210c60"}, - {file = "selenium-4.8.2.tar.gz", hash = "sha256:c48372905bffcc3b24bd55ab4683a07ee5e1f30fe918c59558ea5ee44cedf6c3"}, -] - -[package.dependencies] -certifi = ">=2021.10.8" -trio = ">=0.17,<1.0" -trio-websocket = ">=0.9,<1.0" -urllib3 = {version = ">=1.26,<2.0", extras = ["socks"]} - -[[package]] -name = "setuptools" -version = "67.4.0" -description = "Easily download, build, install, upgrade, and uninstall Python packages" -optional = false -python-versions = ">=3.7" -files = [ - {file = "setuptools-67.4.0-py3-none-any.whl", hash = "sha256:f106dee1b506dee5102cc3f3e9e68137bbad6d47b616be7991714b0c62204251"}, - {file = "setuptools-67.4.0.tar.gz", hash = "sha256:e5fd0a713141a4a105412233c63dc4e17ba0090c8e8334594ac790ec97792330"}, -] - -[package.extras] -docs = ["furo", "jaraco.packaging (>=9)", "jaraco.tidelift (>=1.4)", "pygments-github-lexers (==0.0.5)", "rst.linker (>=1.9)", "sphinx (>=3.5)", "sphinx-favicon", "sphinx-hoverxref (<2)", "sphinx-inline-tabs", "sphinx-lint", "sphinx-notfound-page (==0.8.3)", "sphinx-reredirects", "sphinxcontrib-towncrier"] -testing = ["build[virtualenv]", "filelock (>=3.4.0)", "flake8 (<5)", "flake8-2020", "ini2toml[lite] (>=0.9)", "jaraco.envs (>=2.2)", "jaraco.path (>=3.2.0)", "pip (>=19.1)", "pip-run (>=8.8)", "pytest (>=6)", "pytest-black (>=0.3.7)", "pytest-checkdocs (>=2.4)", "pytest-cov", "pytest-enabler (>=1.3)", "pytest-flake8", "pytest-mypy (>=0.9.1)", "pytest-perf", "pytest-timeout", "pytest-xdist", "tomli-w (>=1.0.0)", "virtualenv (>=13.0.0)", "wheel"] -testing-integration = ["build[virtualenv]", "filelock (>=3.4.0)", "jaraco.envs (>=2.2)", "jaraco.path (>=3.2.0)", "pytest", "pytest-enabler", "pytest-xdist", "tomli", "virtualenv (>=13.0.0)", "wheel"] - -[[package]] -name = "shellingham" -version = "1.5.0.post1" -description = "Tool to Detect Surrounding Shell" -optional = false -python-versions = ">=3.7" -files = [ - {file = "shellingham-1.5.0.post1-py2.py3-none-any.whl", hash = "sha256:368bf8c00754fd4f55afb7bbb86e272df77e4dc76ac29dbcbb81a59e9fc15744"}, - {file = "shellingham-1.5.0.post1.tar.gz", hash = "sha256:823bc5fb5c34d60f285b624e7264f4dda254bc803a3774a147bf99c0e3004a28"}, -] - -[[package]] -name = "six" -version = "1.16.0" -description = "Python 2 and 3 compatibility utilities" -optional = false -python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*" -files = [ - {file = "six-1.16.0-py2.py3-none-any.whl", hash = "sha256:8abb2f1d86890a2dfb989f9a77cfcfd3e47c2a354b01111771326f8aa26e0254"}, - {file = "six-1.16.0.tar.gz", hash = "sha256:1e61c37477a1626458e36f7b1d82aa5c9b094fa4802892072e49de9c60c4c926"}, -] - -[[package]] -name = "slowapi" -version = "0.1.7" -description = "A rate limiting extension for Starlette and Fastapi" -optional = false -python-versions = ">=3.7,<4.0" -files = [ - {file = "slowapi-0.1.7-py3-none-any.whl", hash = "sha256:94743ba5f68359455cfa1be214c086134c03f4e7072590682671fc65c744a615"}, - {file = "slowapi-0.1.7.tar.gz", hash = "sha256:5a4a6f3e232d0465085392c1d92f6f8f6a6329ed2102a80062094fe86d7b1f36"}, -] - -[package.dependencies] -limits = ">=2.3,<3.0" - -[[package]] -name = "smmap" -version = "5.0.0" -description = "A pure Python implementation of a sliding window memory map manager" -optional = false -python-versions = ">=3.6" -files = [ - {file = "smmap-5.0.0-py3-none-any.whl", hash = "sha256:2aba19d6a040e78d8b09de5c57e96207b09ed71d8e55ce0959eeee6c8e190d94"}, - {file = "smmap-5.0.0.tar.gz", hash = "sha256:c840e62059cd3be204b0c9c9f74be2c09d5648eddd4580d9314c3ecde0b30936"}, -] - -[[package]] -name = "sniffio" -version = "1.3.0" -description = "Sniff out which async library your code is running under" -optional = false -python-versions = ">=3.7" -files = [ - {file = "sniffio-1.3.0-py3-none-any.whl", hash = "sha256:eecefdce1e5bbfb7ad2eeaabf7c1eeb404d7757c379bd1f7e5cce9d8bf425384"}, - {file = "sniffio-1.3.0.tar.gz", hash = "sha256:e60305c5e5d314f5389259b7f22aaa33d8f7dee49763119234af3755c55b9101"}, -] - -[[package]] -name = "snowballstemmer" -version = "2.2.0" -description = "This package provides 29 stemmers for 28 languages generated from Snowball algorithms." -optional = false -python-versions = "*" -files = [ - {file = "snowballstemmer-2.2.0-py2.py3-none-any.whl", hash = "sha256:c8e1716e83cc398ae16824e5572ae04e0d9fc2c6b985fb0f900f5f0c96ecba1a"}, - {file = "snowballstemmer-2.2.0.tar.gz", hash = "sha256:09b16deb8547d3412ad7b590689584cd0fe25ec8db3be37788be3810cbf19cb1"}, -] - -[[package]] -name = "sortedcontainers" -version = "2.4.0" -description = "Sorted Containers -- Sorted List, Sorted Dict, Sorted Set" -optional = false -python-versions = "*" -files = [ - {file = "sortedcontainers-2.4.0-py2.py3-none-any.whl", hash = "sha256:a163dcaede0f1c021485e957a39245190e74249897e2ae4b2aa38595db237ee0"}, - {file = "sortedcontainers-2.4.0.tar.gz", hash = "sha256:25caa5a06cc30b6b83d11423433f65d1f9d76c4c6a0c90e3379eaa43b9bfdb88"}, -] - -[[package]] -name = "soupsieve" -version = "2.4" -description = "A modern CSS selector implementation for Beautiful Soup." -optional = false -python-versions = ">=3.7" -files = [ - {file = "soupsieve-2.4-py3-none-any.whl", hash = "sha256:49e5368c2cda80ee7e84da9dbe3e110b70a4575f196efb74e51b94549d921955"}, - {file = "soupsieve-2.4.tar.gz", hash = "sha256:e28dba9ca6c7c00173e34e4ba57448f0688bb681b7c5e8bf4971daafc093d69a"}, -] - -[[package]] -name = "starlette" -version = "0.25.0" -description = "The little ASGI library that shines." -optional = false -python-versions = ">=3.7" -files = [ - {file = "starlette-0.25.0-py3-none-any.whl", hash = "sha256:774f1df1983fd594b9b6fb3ded39c2aa1979d10ac45caac0f4255cbe2acb8628"}, - {file = "starlette-0.25.0.tar.gz", hash = "sha256:854c71e73736c429c2bdb07801f2c76c9cba497e7c3cf4988fde5e95fe4cdb3c"}, -] - -[package.dependencies] -anyio = ">=3.4.0,<5" -typing-extensions = {version = ">=3.10.0", markers = "python_version < \"3.10\""} - -[package.extras] -full = ["httpx (>=0.22.0)", "itsdangerous", "jinja2", "python-multipart", "pyyaml"] - -[[package]] -name = "stevedore" -version = "5.0.0" -description = "Manage dynamic plugins for Python applications" -optional = false -python-versions = ">=3.8" -files = [ - {file = "stevedore-5.0.0-py3-none-any.whl", hash = "sha256:bd5a71ff5e5e5f5ea983880e4a1dd1bb47f8feebbb3d95b592398e2f02194771"}, - {file = "stevedore-5.0.0.tar.gz", hash = "sha256:2c428d2338976279e8eb2196f7a94910960d9f7ba2f41f3988511e95ca447021"}, -] - -[package.dependencies] -pbr = ">=2.0.0,<2.1.0 || >2.1.0" - -[[package]] -name = "threadpoolexecutorplus" -version = "0.2.2" -description = "A fully replaceable executor that makes it possible to reuse idle threads and shrink thread list when there's no heavy load. - GitHub - GoodManWEN/ThreadPoolExecutorPlus: A fully replaceable executor that makes it possible to reuse idle threads and shrink thread list when there's no heavy load." -optional = false -python-versions = ">=3.5" -files = [ - {file = "ThreadPoolExecutorPlus-0.2.2-py3-none-any.whl", hash = "sha256:bd5fada94b5563ccea24b2758c9a0629820f0a40815ad03f268794c63ff5e72f"}, - {file = "ThreadPoolExecutorPlus-0.2.2.tar.gz", hash = "sha256:aa958057f9ca72892f217c8a3af2b28d3a38d97510ece4189fe82f06ed0c7312"}, -] - -[[package]] -name = "tokenize-rt" -version = "5.0.0" -description = "A wrapper around the stdlib `tokenize` which roundtrips." -optional = false -python-versions = ">=3.7" -files = [ - {file = "tokenize_rt-5.0.0-py2.py3-none-any.whl", hash = "sha256:c67772c662c6b3dc65edf66808577968fb10badfc2042e3027196bed4daf9e5a"}, - {file = "tokenize_rt-5.0.0.tar.gz", hash = "sha256:3160bc0c3e8491312d0485171dea861fc160a240f5f5766b72a1165408d10740"}, -] - -[[package]] -name = "toml" -version = "0.10.2" -description = "Python Library for Tom's Obvious, Minimal Language" -optional = false -python-versions = ">=2.6, !=3.0.*, !=3.1.*, !=3.2.*" -files = [ - {file = "toml-0.10.2-py2.py3-none-any.whl", hash = "sha256:806143ae5bfb6a3c6e736a764057db0e6a0e05e338b5630894a5f779cabb4f9b"}, - {file = "toml-0.10.2.tar.gz", hash = "sha256:b3bda1d108d5dd99f4a20d24d9c348e91c4db7ab1b749200bded2f839ccbe68f"}, -] - -[[package]] -name = "tomli" -version = "2.0.1" -description = "A lil' TOML parser" -optional = false -python-versions = ">=3.7" -files = [ - {file = "tomli-2.0.1-py3-none-any.whl", hash = "sha256:939de3e7a6161af0c887ef91b7d41a53e7c5a1ca976325f429cb46ea9bc30ecc"}, - {file = "tomli-2.0.1.tar.gz", hash = "sha256:de526c12914f0c550d15924c62d72abc48d6fe7364aa87328337a31007fe8a4f"}, -] - -[[package]] -name = "tomlkit" -version = "0.11.6" -description = "Style preserving TOML library" -optional = false -python-versions = ">=3.6" -files = [ - {file = "tomlkit-0.11.6-py3-none-any.whl", hash = "sha256:07de26b0d8cfc18f871aec595fda24d95b08fef89d147caa861939f37230bf4b"}, - {file = "tomlkit-0.11.6.tar.gz", hash = "sha256:71b952e5721688937fb02cf9d354dbcf0785066149d2855e44531ebdd2b65d73"}, -] - -[[package]] -name = "trio" -version = "0.22.0" -description = "A friendly Python library for async concurrency and I/O" -optional = false -python-versions = ">=3.7" -files = [ - {file = "trio-0.22.0-py3-none-any.whl", hash = "sha256:f1dd0780a89bfc880c7c7994519cb53f62aacb2c25ff487001c0052bd721cdf0"}, - {file = "trio-0.22.0.tar.gz", hash = "sha256:ce68f1c5400a47b137c5a4de72c7c901bd4e7a24fbdebfe9b41de8c6c04eaacf"}, -] - -[package.dependencies] -async-generator = ">=1.9" -attrs = ">=19.2.0" -cffi = {version = ">=1.14", markers = "os_name == \"nt\" and implementation_name != \"pypy\""} -exceptiongroup = {version = ">=1.0.0rc9", markers = "python_version < \"3.11\""} -idna = "*" -outcome = "*" -sniffio = "*" -sortedcontainers = "*" - -[[package]] -name = "trio-websocket" -version = "0.9.2" -description = "WebSocket library for Trio" -optional = false -python-versions = ">=3.5" -files = [ - {file = "trio-websocket-0.9.2.tar.gz", hash = "sha256:a3d34de8fac26023eee701ed1e7bf4da9a8326b61a62934ec9e53b64970fd8fe"}, - {file = "trio_websocket-0.9.2-py3-none-any.whl", hash = "sha256:5b558f6e83cc20a37c3b61202476c5295d1addf57bd65543364e0337e37ed2bc"}, -] - -[package.dependencies] -async-generator = ">=1.10" -trio = ">=0.11" -wsproto = ">=0.14" - -[[package]] -name = "typer" -version = "0.4.2" -description = "Typer, build great CLIs. Easy to code. Based on Python type hints." -optional = false -python-versions = ">=3.6" -files = [ - {file = "typer-0.4.2-py3-none-any.whl", hash = "sha256:023bae00d1baf358a6cc7cea45851639360bb716de687b42b0a4641cd99173f1"}, - {file = "typer-0.4.2.tar.gz", hash = "sha256:b8261c6c0152dd73478b5ba96ba677e5d6948c715c310f7c91079f311f62ec03"}, -] - -[package.dependencies] -click = ">=7.1.1,<9.0.0" -colorama = {version = ">=0.4.3,<0.5.0", optional = true, markers = "extra == \"all\""} -shellingham = {version = ">=1.3.0,<2.0.0", optional = true, markers = "extra == \"all\""} - -[package.extras] -all = ["colorama (>=0.4.3,<0.5.0)", "shellingham (>=1.3.0,<2.0.0)"] -dev = ["autoflake (>=1.3.1,<2.0.0)", "flake8 (>=3.8.3,<4.0.0)", "pre-commit (>=2.17.0,<3.0.0)"] -doc = ["mdx-include (>=1.4.1,<2.0.0)", "mkdocs (>=1.1.2,<2.0.0)", "mkdocs-material (>=8.1.4,<9.0.0)"] -test = ["black (>=22.3.0,<23.0.0)", "coverage (>=5.2,<6.0)", "isort (>=5.0.6,<6.0.0)", "mypy (==0.910)", "pytest (>=4.4.0,<5.4.0)", "pytest-cov (>=2.10.0,<3.0.0)", "pytest-sugar (>=0.9.4,<0.10.0)", "pytest-xdist (>=1.32.0,<2.0.0)", "shellingham (>=1.3.0,<2.0.0)"] - -[[package]] -name = "typing-extensions" -version = "4.5.0" -description = "Backported and Experimental Type Hints for Python 3.7+" -optional = false -python-versions = ">=3.7" -files = [ - {file = "typing_extensions-4.5.0-py3-none-any.whl", hash = "sha256:fb33085c39dd998ac16d1431ebc293a8b3eedd00fd4a32de0ff79002c19511b4"}, - {file = "typing_extensions-4.5.0.tar.gz", hash = "sha256:5cb5f4a79139d699607b3ef622a1dedafa84e115ab0024e0d9c044a9479ca7cb"}, -] - -[[package]] -name = "undetected-chromedriver" -version = "3.4.6" -description = "('Selenium.webdriver.Chrome replacement with compatiblity for Brave, and other Chromium based browsers.', 'Not triggered by CloudFlare/Imperva/hCaptcha and such.', 'NOTE: results may vary due to many factors. No guarantees are given, except for ongoing efforts in understanding detection algorithms.')" -optional = false -python-versions = "*" -files = [ - {file = "undetected-chromedriver-3.4.6.tar.gz", hash = "sha256:871485624f7a2e1c15fde75ab7b8ceb30ebc06dad90cd66173ea8036c046367f"}, -] - -[package.dependencies] -requests = "*" -selenium = ">=4.0.0" -websockets = "*" - -[[package]] -name = "urllib3" -version = "1.26.14" -description = "HTTP library with thread-safe connection pooling, file post, and more." -optional = false -python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*, !=3.4.*, !=3.5.*" -files = [ - {file = "urllib3-1.26.14-py2.py3-none-any.whl", hash = "sha256:75edcdc2f7d85b137124a6c3c9fc3933cdeaa12ecb9a6a959f22797a0feca7e1"}, - {file = "urllib3-1.26.14.tar.gz", hash = "sha256:076907bf8fd355cde77728471316625a4d2f7e713c125f51953bb5b3eecf4f72"}, -] - -[package.dependencies] -PySocks = {version = ">=1.5.6,<1.5.7 || >1.5.7,<2.0", optional = true, markers = "extra == \"socks\""} - -[package.extras] -brotli = ["brotli (>=1.0.9)", "brotlicffi (>=0.8.0)", "brotlipy (>=0.6.0)"] -secure = ["certifi", "cryptography (>=1.3.4)", "idna (>=2.0.0)", "ipaddress", "pyOpenSSL (>=0.14)", "urllib3-secure-extra"] -socks = ["PySocks (>=1.5.6,!=1.5.7,<2.0)"] - -[[package]] -name = "uvicorn" -version = "0.20.0" -description = "The lightning-fast ASGI server." -optional = false -python-versions = ">=3.7" -files = [ - {file = "uvicorn-0.20.0-py3-none-any.whl", hash = "sha256:c3ed1598a5668208723f2bb49336f4509424ad198d6ab2615b7783db58d919fd"}, - {file = "uvicorn-0.20.0.tar.gz", hash = "sha256:a4e12017b940247f836bc90b72e725d7dfd0c8ed1c51eb365f5ba30d9f5127d8"}, -] - -[package.dependencies] -click = ">=7.0" -h11 = ">=0.8" - -[package.extras] -standard = ["colorama (>=0.4)", "httptools (>=0.5.0)", "python-dotenv (>=0.13)", "pyyaml (>=5.1)", "uvloop (>=0.14.0,!=0.15.0,!=0.15.1)", "watchfiles (>=0.13)", "websockets (>=10.4)"] - -[[package]] -name = "virtualenv" -version = "20.20.0" -description = "Virtual Python Environment builder" -optional = false -python-versions = ">=3.7" -files = [ - {file = "virtualenv-20.20.0-py3-none-any.whl", hash = "sha256:3c22fa5a7c7aa106ced59934d2c20a2ecb7f49b4130b8bf444178a16b880fa45"}, - {file = "virtualenv-20.20.0.tar.gz", hash = "sha256:a8a4b8ca1e28f864b7514a253f98c1d62b64e31e77325ba279248c65fb4fcef4"}, -] - -[package.dependencies] -distlib = ">=0.3.6,<1" -filelock = ">=3.4.1,<4" -platformdirs = ">=2.4,<4" - -[package.extras] -docs = ["furo (>=2022.12.7)", "proselint (>=0.13)", "sphinx (>=6.1.3)", "sphinx-argparse (>=0.4)", "sphinxcontrib-towncrier (>=0.2.1a0)", "towncrier (>=22.12)"] -test = ["covdefaults (>=2.2.2)", "coverage (>=7.1)", "coverage-enable-subprocess (>=1)", "flaky (>=3.7)", "packaging (>=23)", "pytest (>=7.2.1)", "pytest-env (>=0.8.1)", "pytest-freezegun (>=0.4.2)", "pytest-mock (>=3.10)", "pytest-randomly (>=3.12)", "pytest-timeout (>=2.1)"] - -[[package]] -name = "websockets" -version = "10.4" -description = "An implementation of the WebSocket Protocol (RFC 6455 & 7692)" -optional = false -python-versions = ">=3.7" -files = [ - {file = "websockets-10.4-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:d58804e996d7d2307173d56c297cf7bc132c52df27a3efaac5e8d43e36c21c48"}, - {file = "websockets-10.4-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:bc0b82d728fe21a0d03e65f81980abbbcb13b5387f733a1a870672c5be26edab"}, - {file = "websockets-10.4-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:ba089c499e1f4155d2a3c2a05d2878a3428cf321c848f2b5a45ce55f0d7d310c"}, - {file = "websockets-10.4-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:33d69ca7612f0ddff3316b0c7b33ca180d464ecac2d115805c044bf0a3b0d032"}, - {file = "websockets-10.4-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:62e627f6b6d4aed919a2052efc408da7a545c606268d5ab5bfab4432734b82b4"}, - {file = "websockets-10.4-cp310-cp310-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:38ea7b82bfcae927eeffc55d2ffa31665dc7fec7b8dc654506b8e5a518eb4d50"}, - {file = "websockets-10.4-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:e0cb5cc6ece6ffa75baccfd5c02cffe776f3f5c8bf486811f9d3ea3453676ce8"}, - {file = "websockets-10.4-cp310-cp310-musllinux_1_1_i686.whl", hash = "sha256:ae5e95cfb53ab1da62185e23b3130e11d64431179debac6dc3c6acf08760e9b1"}, - {file = "websockets-10.4-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:7c584f366f46ba667cfa66020344886cf47088e79c9b9d39c84ce9ea98aaa331"}, - {file = "websockets-10.4-cp310-cp310-win32.whl", hash = "sha256:b029fb2032ae4724d8ae8d4f6b363f2cc39e4c7b12454df8df7f0f563ed3e61a"}, - {file = "websockets-10.4-cp310-cp310-win_amd64.whl", hash = "sha256:8dc96f64ae43dde92530775e9cb169979f414dcf5cff670455d81a6823b42089"}, - {file = "websockets-10.4-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:47a2964021f2110116cc1125b3e6d87ab5ad16dea161949e7244ec583b905bb4"}, - {file = "websockets-10.4-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:e789376b52c295c4946403bd0efecf27ab98f05319df4583d3c48e43c7342c2f"}, - {file = "websockets-10.4-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:7d3f0b61c45c3fa9a349cf484962c559a8a1d80dae6977276df8fd1fa5e3cb8c"}, - {file = "websockets-10.4-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:f55b5905705725af31ccef50e55391621532cd64fbf0bc6f4bac935f0fccec46"}, - {file = "websockets-10.4-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:00c870522cdb69cd625b93f002961ffb0c095394f06ba8c48f17eef7c1541f96"}, - {file = "websockets-10.4-cp311-cp311-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8f38706e0b15d3c20ef6259fd4bc1700cd133b06c3c1bb108ffe3f8947be15fa"}, - {file = "websockets-10.4-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:f2c38d588887a609191d30e902df2a32711f708abfd85d318ca9b367258cfd0c"}, - {file = "websockets-10.4-cp311-cp311-musllinux_1_1_i686.whl", hash = "sha256:fe10ddc59b304cb19a1bdf5bd0a7719cbbc9fbdd57ac80ed436b709fcf889106"}, - {file = "websockets-10.4-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:90fcf8929836d4a0e964d799a58823547df5a5e9afa83081761630553be731f9"}, - {file = "websockets-10.4-cp311-cp311-win32.whl", hash = "sha256:b9968694c5f467bf67ef97ae7ad4d56d14be2751000c1207d31bf3bb8860bae8"}, - {file = "websockets-10.4-cp311-cp311-win_amd64.whl", hash = "sha256:a7a240d7a74bf8d5cb3bfe6be7f21697a28ec4b1a437607bae08ac7acf5b4882"}, - {file = "websockets-10.4-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:74de2b894b47f1d21cbd0b37a5e2b2392ad95d17ae983e64727e18eb281fe7cb"}, - {file = "websockets-10.4-cp37-cp37m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:e3a686ecb4aa0d64ae60c9c9f1a7d5d46cab9bfb5d91a2d303d00e2cd4c4c5cc"}, - {file = "websockets-10.4-cp37-cp37m-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:b0d15c968ea7a65211e084f523151dbf8ae44634de03c801b8bd070b74e85033"}, - {file = "websockets-10.4-cp37-cp37m-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:00213676a2e46b6ebf6045bc11d0f529d9120baa6f58d122b4021ad92adabd41"}, - {file = "websockets-10.4-cp37-cp37m-musllinux_1_1_aarch64.whl", hash = "sha256:e23173580d740bf8822fd0379e4bf30aa1d5a92a4f252d34e893070c081050df"}, - {file = "websockets-10.4-cp37-cp37m-musllinux_1_1_i686.whl", hash = "sha256:dd500e0a5e11969cdd3320935ca2ff1e936f2358f9c2e61f100a1660933320ea"}, - {file = "websockets-10.4-cp37-cp37m-musllinux_1_1_x86_64.whl", hash = "sha256:4239b6027e3d66a89446908ff3027d2737afc1a375f8fd3eea630a4842ec9a0c"}, - {file = "websockets-10.4-cp37-cp37m-win32.whl", hash = "sha256:8a5cc00546e0a701da4639aa0bbcb0ae2bb678c87f46da01ac2d789e1f2d2038"}, - {file = "websockets-10.4-cp37-cp37m-win_amd64.whl", hash = "sha256:a9f9a735deaf9a0cadc2d8c50d1a5bcdbae8b6e539c6e08237bc4082d7c13f28"}, - {file = "websockets-10.4-cp38-cp38-macosx_10_9_universal2.whl", hash = "sha256:5c1289596042fad2cdceb05e1ebf7aadf9995c928e0da2b7a4e99494953b1b94"}, - {file = "websockets-10.4-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:0cff816f51fb33c26d6e2b16b5c7d48eaa31dae5488ace6aae468b361f422b63"}, - {file = "websockets-10.4-cp38-cp38-macosx_11_0_arm64.whl", hash = "sha256:dd9becd5fe29773d140d68d607d66a38f60e31b86df75332703757ee645b6faf"}, - {file = "websockets-10.4-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:45ec8e75b7dbc9539cbfafa570742fe4f676eb8b0d3694b67dabe2f2ceed8aa6"}, - {file = "websockets-10.4-cp38-cp38-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:4f72e5cd0f18f262f5da20efa9e241699e0cf3a766317a17392550c9ad7b37d8"}, - {file = "websockets-10.4-cp38-cp38-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:185929b4808b36a79c65b7865783b87b6841e852ef5407a2fb0c03381092fa3b"}, - {file = "websockets-10.4-cp38-cp38-musllinux_1_1_aarch64.whl", hash = "sha256:7d27a7e34c313b3a7f91adcd05134315002aaf8540d7b4f90336beafaea6217c"}, - {file = "websockets-10.4-cp38-cp38-musllinux_1_1_i686.whl", hash = "sha256:884be66c76a444c59f801ac13f40c76f176f1bfa815ef5b8ed44321e74f1600b"}, - {file = "websockets-10.4-cp38-cp38-musllinux_1_1_x86_64.whl", hash = "sha256:931c039af54fc195fe6ad536fde4b0de04da9d5916e78e55405436348cfb0e56"}, - {file = "websockets-10.4-cp38-cp38-win32.whl", hash = "sha256:db3c336f9eda2532ec0fd8ea49fef7a8df8f6c804cdf4f39e5c5c0d4a4ad9a7a"}, - {file = "websockets-10.4-cp38-cp38-win_amd64.whl", hash = "sha256:48c08473563323f9c9debac781ecf66f94ad5a3680a38fe84dee5388cf5acaf6"}, - {file = "websockets-10.4-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:40e826de3085721dabc7cf9bfd41682dadc02286d8cf149b3ad05bff89311e4f"}, - {file = "websockets-10.4-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:56029457f219ade1f2fc12a6504ea61e14ee227a815531f9738e41203a429112"}, - {file = "websockets-10.4-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:f5fc088b7a32f244c519a048c170f14cf2251b849ef0e20cbbb0fdf0fdaf556f"}, - {file = "websockets-10.4-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:2fc8709c00704194213d45e455adc106ff9e87658297f72d544220e32029cd3d"}, - {file = "websockets-10.4-cp39-cp39-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:0154f7691e4fe6c2b2bc275b5701e8b158dae92a1ab229e2b940efe11905dff4"}, - {file = "websockets-10.4-cp39-cp39-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:4c6d2264f485f0b53adf22697ac11e261ce84805c232ed5dbe6b1bcb84b00ff0"}, - {file = "websockets-10.4-cp39-cp39-musllinux_1_1_aarch64.whl", hash = "sha256:9bc42e8402dc5e9905fb8b9649f57efcb2056693b7e88faa8fb029256ba9c68c"}, - {file = "websockets-10.4-cp39-cp39-musllinux_1_1_i686.whl", hash = "sha256:edc344de4dac1d89300a053ac973299e82d3db56330f3494905643bb68801269"}, - {file = "websockets-10.4-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:84bc2a7d075f32f6ed98652db3a680a17a4edb21ca7f80fe42e38753a58ee02b"}, - {file = "websockets-10.4-cp39-cp39-win32.whl", hash = "sha256:c94ae4faf2d09f7c81847c63843f84fe47bf6253c9d60b20f25edfd30fb12588"}, - {file = "websockets-10.4-cp39-cp39-win_amd64.whl", hash = "sha256:bbccd847aa0c3a69b5f691a84d2341a4f8a629c6922558f2a70611305f902d74"}, - {file = "websockets-10.4-pp37-pypy37_pp73-macosx_10_9_x86_64.whl", hash = "sha256:82ff5e1cae4e855147fd57a2863376ed7454134c2bf49ec604dfe71e446e2193"}, - {file = "websockets-10.4-pp37-pypy37_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d210abe51b5da0ffdbf7b43eed0cfdff8a55a1ab17abbec4301c9ff077dd0342"}, - {file = "websockets-10.4-pp37-pypy37_pp73-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:942de28af58f352a6f588bc72490ae0f4ccd6dfc2bd3de5945b882a078e4e179"}, - {file = "websockets-10.4-pp37-pypy37_pp73-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c9b27d6c1c6cd53dc93614967e9ce00ae7f864a2d9f99fe5ed86706e1ecbf485"}, - {file = "websockets-10.4-pp37-pypy37_pp73-win_amd64.whl", hash = "sha256:3d3cac3e32b2c8414f4f87c1b2ab686fa6284a980ba283617404377cd448f631"}, - {file = "websockets-10.4-pp38-pypy38_pp73-macosx_10_9_x86_64.whl", hash = "sha256:da39dd03d130162deb63da51f6e66ed73032ae62e74aaccc4236e30edccddbb0"}, - {file = "websockets-10.4-pp38-pypy38_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:389f8dbb5c489e305fb113ca1b6bdcdaa130923f77485db5b189de343a179393"}, - {file = "websockets-10.4-pp38-pypy38_pp73-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:09a1814bb15eff7069e51fed0826df0bc0702652b5cb8f87697d469d79c23576"}, - {file = "websockets-10.4-pp38-pypy38_pp73-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:ff64a1d38d156d429404aaa84b27305e957fd10c30e5880d1765c9480bea490f"}, - {file = "websockets-10.4-pp38-pypy38_pp73-win_amd64.whl", hash = "sha256:b343f521b047493dc4022dd338fc6db9d9282658862756b4f6fd0e996c1380e1"}, - {file = "websockets-10.4-pp39-pypy39_pp73-macosx_10_9_x86_64.whl", hash = "sha256:932af322458da7e4e35df32f050389e13d3d96b09d274b22a7aa1808f292fee4"}, - {file = "websockets-10.4-pp39-pypy39_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d6a4162139374a49eb18ef5b2f4da1dd95c994588f5033d64e0bbfda4b6b6fcf"}, - {file = "websockets-10.4-pp39-pypy39_pp73-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:c57e4c1349fbe0e446c9fa7b19ed2f8a4417233b6984277cce392819123142d3"}, - {file = "websockets-10.4-pp39-pypy39_pp73-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:b627c266f295de9dea86bd1112ed3d5fafb69a348af30a2422e16590a8ecba13"}, - {file = "websockets-10.4-pp39-pypy39_pp73-win_amd64.whl", hash = "sha256:05a7233089f8bd355e8cbe127c2e8ca0b4ea55467861906b80d2ebc7db4d6b72"}, - {file = "websockets-10.4.tar.gz", hash = "sha256:eef610b23933c54d5d921c92578ae5f89813438fded840c2e9809d378dc765d3"}, -] - -[[package]] -name = "win32-setctime" -version = "1.1.0" -description = "A small Python utility to set file creation time on Windows" -optional = false -python-versions = ">=3.5" -files = [ - {file = "win32_setctime-1.1.0-py3-none-any.whl", hash = "sha256:231db239e959c2fe7eb1d7dc129f11172354f98361c4fa2d6d2d7e278baa8aad"}, - {file = "win32_setctime-1.1.0.tar.gz", hash = "sha256:15cf5750465118d6929ae4de4eb46e8edae9a5634350c01ba582df868e932cb2"}, -] - -[package.extras] -dev = ["black (>=19.3b0)", "pytest (>=4.6.2)"] - -[[package]] -name = "wrapt" -version = "1.15.0" -description = "Module for decorators, wrappers and monkey patching." -optional = false -python-versions = "!=3.0.*,!=3.1.*,!=3.2.*,!=3.3.*,!=3.4.*,>=2.7" -files = [ - {file = "wrapt-1.15.0-cp27-cp27m-macosx_10_9_x86_64.whl", hash = "sha256:ca1cccf838cd28d5a0883b342474c630ac48cac5df0ee6eacc9c7290f76b11c1"}, - {file = "wrapt-1.15.0-cp27-cp27m-manylinux1_i686.whl", hash = "sha256:e826aadda3cae59295b95343db8f3d965fb31059da7de01ee8d1c40a60398b29"}, - {file = "wrapt-1.15.0-cp27-cp27m-manylinux1_x86_64.whl", hash = "sha256:5fc8e02f5984a55d2c653f5fea93531e9836abbd84342c1d1e17abc4a15084c2"}, - {file = "wrapt-1.15.0-cp27-cp27m-manylinux2010_i686.whl", hash = "sha256:96e25c8603a155559231c19c0349245eeb4ac0096fe3c1d0be5c47e075bd4f46"}, - {file = "wrapt-1.15.0-cp27-cp27m-manylinux2010_x86_64.whl", hash = "sha256:40737a081d7497efea35ab9304b829b857f21558acfc7b3272f908d33b0d9d4c"}, - {file = "wrapt-1.15.0-cp27-cp27mu-manylinux1_i686.whl", hash = "sha256:f87ec75864c37c4c6cb908d282e1969e79763e0d9becdfe9fe5473b7bb1e5f09"}, - {file = "wrapt-1.15.0-cp27-cp27mu-manylinux1_x86_64.whl", hash = "sha256:1286eb30261894e4c70d124d44b7fd07825340869945c79d05bda53a40caa079"}, - {file = "wrapt-1.15.0-cp27-cp27mu-manylinux2010_i686.whl", hash = "sha256:493d389a2b63c88ad56cdc35d0fa5752daac56ca755805b1b0c530f785767d5e"}, - {file = "wrapt-1.15.0-cp27-cp27mu-manylinux2010_x86_64.whl", hash = "sha256:58d7a75d731e8c63614222bcb21dd992b4ab01a399f1f09dd82af17bbfc2368a"}, - {file = "wrapt-1.15.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:21f6d9a0d5b3a207cdf7acf8e58d7d13d463e639f0c7e01d82cdb671e6cb7923"}, - {file = "wrapt-1.15.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:ce42618f67741d4697684e501ef02f29e758a123aa2d669e2d964ff734ee00ee"}, - {file = "wrapt-1.15.0-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:41d07d029dd4157ae27beab04d22b8e261eddfc6ecd64ff7000b10dc8b3a5727"}, - {file = "wrapt-1.15.0-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:54accd4b8bc202966bafafd16e69da9d5640ff92389d33d28555c5fd4f25ccb7"}, - {file = "wrapt-1.15.0-cp310-cp310-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:2fbfbca668dd15b744418265a9607baa970c347eefd0db6a518aaf0cfbd153c0"}, - {file = "wrapt-1.15.0-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:76e9c727a874b4856d11a32fb0b389afc61ce8aaf281ada613713ddeadd1cfec"}, - {file = "wrapt-1.15.0-cp310-cp310-musllinux_1_1_i686.whl", hash = "sha256:e20076a211cd6f9b44a6be58f7eeafa7ab5720eb796975d0c03f05b47d89eb90"}, - {file = "wrapt-1.15.0-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:a74d56552ddbde46c246b5b89199cb3fd182f9c346c784e1a93e4dc3f5ec9975"}, - {file = "wrapt-1.15.0-cp310-cp310-win32.whl", hash = "sha256:26458da5653aa5b3d8dc8b24192f574a58984c749401f98fff994d41d3f08da1"}, - {file = "wrapt-1.15.0-cp310-cp310-win_amd64.whl", hash = "sha256:75760a47c06b5974aa5e01949bf7e66d2af4d08cb8c1d6516af5e39595397f5e"}, - {file = "wrapt-1.15.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:ba1711cda2d30634a7e452fc79eabcadaffedf241ff206db2ee93dd2c89a60e7"}, - {file = "wrapt-1.15.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:56374914b132c702aa9aa9959c550004b8847148f95e1b824772d453ac204a72"}, - {file = "wrapt-1.15.0-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:a89ce3fd220ff144bd9d54da333ec0de0399b52c9ac3d2ce34b569cf1a5748fb"}, - {file = "wrapt-1.15.0-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:3bbe623731d03b186b3d6b0d6f51865bf598587c38d6f7b0be2e27414f7f214e"}, - {file = "wrapt-1.15.0-cp311-cp311-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:3abbe948c3cbde2689370a262a8d04e32ec2dd4f27103669a45c6929bcdbfe7c"}, - {file = "wrapt-1.15.0-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:b67b819628e3b748fd3c2192c15fb951f549d0f47c0449af0764d7647302fda3"}, - {file = "wrapt-1.15.0-cp311-cp311-musllinux_1_1_i686.whl", hash = "sha256:7eebcdbe3677e58dd4c0e03b4f2cfa346ed4049687d839adad68cc38bb559c92"}, - {file = "wrapt-1.15.0-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:74934ebd71950e3db69960a7da29204f89624dde411afbfb3b4858c1409b1e98"}, - {file = "wrapt-1.15.0-cp311-cp311-win32.whl", hash = "sha256:bd84395aab8e4d36263cd1b9308cd504f6cf713b7d6d3ce25ea55670baec5416"}, - {file = "wrapt-1.15.0-cp311-cp311-win_amd64.whl", hash = "sha256:a487f72a25904e2b4bbc0817ce7a8de94363bd7e79890510174da9d901c38705"}, - {file = "wrapt-1.15.0-cp35-cp35m-manylinux1_i686.whl", hash = "sha256:4ff0d20f2e670800d3ed2b220d40984162089a6e2c9646fdb09b85e6f9a8fc29"}, - {file = "wrapt-1.15.0-cp35-cp35m-manylinux1_x86_64.whl", hash = "sha256:9ed6aa0726b9b60911f4aed8ec5b8dd7bf3491476015819f56473ffaef8959bd"}, - {file = "wrapt-1.15.0-cp35-cp35m-manylinux2010_i686.whl", hash = "sha256:896689fddba4f23ef7c718279e42f8834041a21342d95e56922e1c10c0cc7afb"}, - {file = "wrapt-1.15.0-cp35-cp35m-manylinux2010_x86_64.whl", hash = "sha256:75669d77bb2c071333417617a235324a1618dba66f82a750362eccbe5b61d248"}, - {file = "wrapt-1.15.0-cp35-cp35m-win32.whl", hash = "sha256:fbec11614dba0424ca72f4e8ba3c420dba07b4a7c206c8c8e4e73f2e98f4c559"}, - {file = "wrapt-1.15.0-cp35-cp35m-win_amd64.whl", hash = "sha256:fd69666217b62fa5d7c6aa88e507493a34dec4fa20c5bd925e4bc12fce586639"}, - {file = "wrapt-1.15.0-cp36-cp36m-macosx_10_9_x86_64.whl", hash = "sha256:b0724f05c396b0a4c36a3226c31648385deb6a65d8992644c12a4963c70326ba"}, - {file = "wrapt-1.15.0-cp36-cp36m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:bbeccb1aa40ab88cd29e6c7d8585582c99548f55f9b2581dfc5ba68c59a85752"}, - {file = "wrapt-1.15.0-cp36-cp36m-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:38adf7198f8f154502883242f9fe7333ab05a5b02de7d83aa2d88ea621f13364"}, - {file = "wrapt-1.15.0-cp36-cp36m-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:578383d740457fa790fdf85e6d346fda1416a40549fe8db08e5e9bd281c6a475"}, - {file = "wrapt-1.15.0-cp36-cp36m-musllinux_1_1_aarch64.whl", hash = "sha256:a4cbb9ff5795cd66f0066bdf5947f170f5d63a9274f99bdbca02fd973adcf2a8"}, - {file = "wrapt-1.15.0-cp36-cp36m-musllinux_1_1_i686.whl", hash = "sha256:af5bd9ccb188f6a5fdda9f1f09d9f4c86cc8a539bd48a0bfdc97723970348418"}, - {file = "wrapt-1.15.0-cp36-cp36m-musllinux_1_1_x86_64.whl", hash = "sha256:b56d5519e470d3f2fe4aa7585f0632b060d532d0696c5bdfb5e8319e1d0f69a2"}, - {file = "wrapt-1.15.0-cp36-cp36m-win32.whl", hash = "sha256:77d4c1b881076c3ba173484dfa53d3582c1c8ff1f914c6461ab70c8428b796c1"}, - {file = "wrapt-1.15.0-cp36-cp36m-win_amd64.whl", hash = "sha256:077ff0d1f9d9e4ce6476c1a924a3332452c1406e59d90a2cf24aeb29eeac9420"}, - {file = "wrapt-1.15.0-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:5c5aa28df055697d7c37d2099a7bc09f559d5053c3349b1ad0c39000e611d317"}, - {file = "wrapt-1.15.0-cp37-cp37m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:3a8564f283394634a7a7054b7983e47dbf39c07712d7b177b37e03f2467a024e"}, - {file = "wrapt-1.15.0-cp37-cp37m-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:780c82a41dc493b62fc5884fb1d3a3b81106642c5c5c78d6a0d4cbe96d62ba7e"}, - {file = "wrapt-1.15.0-cp37-cp37m-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:e169e957c33576f47e21864cf3fc9ff47c223a4ebca8960079b8bd36cb014fd0"}, - {file = "wrapt-1.15.0-cp37-cp37m-musllinux_1_1_aarch64.whl", hash = "sha256:b02f21c1e2074943312d03d243ac4388319f2456576b2c6023041c4d57cd7019"}, - {file = "wrapt-1.15.0-cp37-cp37m-musllinux_1_1_i686.whl", hash = "sha256:f2e69b3ed24544b0d3dbe2c5c0ba5153ce50dcebb576fdc4696d52aa22db6034"}, - {file = "wrapt-1.15.0-cp37-cp37m-musllinux_1_1_x86_64.whl", hash = "sha256:d787272ed958a05b2c86311d3a4135d3c2aeea4fc655705f074130aa57d71653"}, - {file = "wrapt-1.15.0-cp37-cp37m-win32.whl", hash = "sha256:02fce1852f755f44f95af51f69d22e45080102e9d00258053b79367d07af39c0"}, - {file = "wrapt-1.15.0-cp37-cp37m-win_amd64.whl", hash = "sha256:abd52a09d03adf9c763d706df707c343293d5d106aea53483e0ec8d9e310ad5e"}, - {file = "wrapt-1.15.0-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:cdb4f085756c96a3af04e6eca7f08b1345e94b53af8921b25c72f096e704e145"}, - {file = "wrapt-1.15.0-cp38-cp38-macosx_11_0_arm64.whl", hash = "sha256:230ae493696a371f1dbffaad3dafbb742a4d27a0afd2b1aecebe52b740167e7f"}, - {file = "wrapt-1.15.0-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:63424c681923b9f3bfbc5e3205aafe790904053d42ddcc08542181a30a7a51bd"}, - {file = "wrapt-1.15.0-cp38-cp38-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:d6bcbfc99f55655c3d93feb7ef3800bd5bbe963a755687cbf1f490a71fb7794b"}, - {file = "wrapt-1.15.0-cp38-cp38-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c99f4309f5145b93eca6e35ac1a988f0dc0a7ccf9ccdcd78d3c0adf57224e62f"}, - {file = "wrapt-1.15.0-cp38-cp38-musllinux_1_1_aarch64.whl", hash = "sha256:b130fe77361d6771ecf5a219d8e0817d61b236b7d8b37cc045172e574ed219e6"}, - {file = "wrapt-1.15.0-cp38-cp38-musllinux_1_1_i686.whl", hash = "sha256:96177eb5645b1c6985f5c11d03fc2dbda9ad24ec0f3a46dcce91445747e15094"}, - {file = "wrapt-1.15.0-cp38-cp38-musllinux_1_1_x86_64.whl", hash = "sha256:d5fe3e099cf07d0fb5a1e23d399e5d4d1ca3e6dfcbe5c8570ccff3e9208274f7"}, - {file = "wrapt-1.15.0-cp38-cp38-win32.whl", hash = "sha256:abd8f36c99512755b8456047b7be10372fca271bf1467a1caa88db991e7c421b"}, - {file = "wrapt-1.15.0-cp38-cp38-win_amd64.whl", hash = "sha256:b06fa97478a5f478fb05e1980980a7cdf2712015493b44d0c87606c1513ed5b1"}, - {file = "wrapt-1.15.0-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:2e51de54d4fb8fb50d6ee8327f9828306a959ae394d3e01a1ba8b2f937747d86"}, - {file = "wrapt-1.15.0-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:0970ddb69bba00670e58955f8019bec4a42d1785db3faa043c33d81de2bf843c"}, - {file = "wrapt-1.15.0-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:76407ab327158c510f44ded207e2f76b657303e17cb7a572ffe2f5a8a48aa04d"}, - {file = "wrapt-1.15.0-cp39-cp39-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:cd525e0e52a5ff16653a3fc9e3dd827981917d34996600bbc34c05d048ca35cc"}, - {file = "wrapt-1.15.0-cp39-cp39-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:9d37ac69edc5614b90516807de32d08cb8e7b12260a285ee330955604ed9dd29"}, - {file = "wrapt-1.15.0-cp39-cp39-musllinux_1_1_aarch64.whl", hash = "sha256:078e2a1a86544e644a68422f881c48b84fef6d18f8c7a957ffd3f2e0a74a0d4a"}, - {file = "wrapt-1.15.0-cp39-cp39-musllinux_1_1_i686.whl", hash = "sha256:2cf56d0e237280baed46f0b5316661da892565ff58309d4d2ed7dba763d984b8"}, - {file = "wrapt-1.15.0-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:7dc0713bf81287a00516ef43137273b23ee414fe41a3c14be10dd95ed98a2df9"}, - {file = "wrapt-1.15.0-cp39-cp39-win32.whl", hash = "sha256:46ed616d5fb42f98630ed70c3529541408166c22cdfd4540b88d5f21006b0eff"}, - {file = "wrapt-1.15.0-cp39-cp39-win_amd64.whl", hash = "sha256:eef4d64c650f33347c1f9266fa5ae001440b232ad9b98f1f43dfe7a79435c0a6"}, - {file = "wrapt-1.15.0-py3-none-any.whl", hash = "sha256:64b1df0f83706b4ef4cfb4fb0e4c2669100fd7ecacfb59e091fad300d4e04640"}, - {file = "wrapt-1.15.0.tar.gz", hash = "sha256:d06730c6aed78cee4126234cf2d071e01b44b915e725a6cb439a879ec9754a3a"}, -] - -[[package]] -name = "wsproto" -version = "1.2.0" -description = "WebSockets state-machine based protocol implementation" -optional = false -python-versions = ">=3.7.0" -files = [ - {file = "wsproto-1.2.0-py3-none-any.whl", hash = "sha256:b9acddd652b585d75b20477888c56642fdade28bdfd3579aa24a4d2c037dd736"}, - {file = "wsproto-1.2.0.tar.gz", hash = "sha256:ad565f26ecb92588a3e43bc3d96164de84cd9902482b130d0ddbaa9664a85065"}, -] - -[package.dependencies] -h11 = ">=0.9.0,<1" - -[metadata] -lock-version = "2.0" -python-versions = "^3.8" -content-hash = "ba0470e3545180fa17d8cf9002d0c3571b52771c31044fd9b17cd58a66c2d8ad" diff --git a/poetry.lock.old b/poetry.lock.old deleted file mode 100755 index 7cb7af8..0000000 --- a/poetry.lock.old +++ /dev/null @@ -1,1987 +0,0 @@ -# This file is automatically @generated by Poetry and should not be changed by hand. - -[[package]] -name = "ascii-magic" -version = "1.6" -description = "Converts pictures into ASCII art" -category = "main" -optional = false -python-versions = ">=3.5" -files = [ - {file = "ascii_magic-1.6-py3-none-any.whl", hash = "sha256:937447d8677b7428856729c298c0264afd62fc2b8e7ff90c82000492cdc5f8d4"}, - {file = "ascii_magic-1.6.tar.gz", hash = "sha256:7da5518f7368e73f11e2151a0c060804aa149e267b369b7ee7653fbd7b046a51"}, -] - -[package.dependencies] -colorama = "*" -Pillow = "*" - -[[package]] -name = "astroid" -version = "2.14.1" -description = "An abstract syntax tree for Python with inference support." -category = "dev" -optional = false -python-versions = ">=3.7.2" -files = [ - {file = "astroid-2.14.1-py3-none-any.whl", hash = "sha256:23c718921acab5f08cbbbe9293967f1f8fec40c336d19cd75dc12a9ea31d2eb2"}, - {file = "astroid-2.14.1.tar.gz", hash = "sha256:bd1aa4f9915c98e8aaebcd4e71930154d4e8c9aaf05d35ac0a63d1956091ae3f"}, -] - -[package.dependencies] -lazy-object-proxy = ">=1.4.0" -typing-extensions = {version = ">=4.0.0", markers = "python_version < \"3.11\""} -wrapt = [ - {version = ">=1.11,<2", markers = "python_version < \"3.11\""}, - {version = ">=1.14,<2", markers = "python_version >= \"3.11\""}, -] - -[[package]] -name = "async-generator" -version = "1.10" -description = "Async generators and context managers for Python 3.5+" -category = "main" -optional = false -python-versions = ">=3.5" -files = [ - {file = "async_generator-1.10-py3-none-any.whl", hash = "sha256:01c7bf666359b4967d2cda0000cc2e4af16a0ae098cbffcb8472fb9e8ad6585b"}, - {file = "async_generator-1.10.tar.gz", hash = "sha256:6ebb3d106c12920aaae42ccb6f787ef5eefdcdd166ea3d628fa8476abe712144"}, -] - -[[package]] -name = "attrs" -version = "22.2.0" -description = "Classes Without Boilerplate" -category = "main" -optional = false -python-versions = ">=3.6" -files = [ - {file = "attrs-22.2.0-py3-none-any.whl", hash = "sha256:29e95c7f6778868dbd49170f98f8818f78f3dc5e0e37c0b1f474e3561b240836"}, - {file = "attrs-22.2.0.tar.gz", hash = "sha256:c9227bfc2f01993c03f68db37d1d15c9690188323c067c641f1a35ca58185f99"}, -] - -[package.extras] -cov = ["attrs[tests]", "coverage-enable-subprocess", "coverage[toml] (>=5.3)"] -dev = ["attrs[docs,tests]"] -docs = ["furo", "myst-parser", "sphinx", "sphinx-notfound-page", "sphinxcontrib-towncrier", "towncrier", "zope.interface"] -tests = ["attrs[tests-no-zope]", "zope.interface"] -tests-no-zope = ["cloudpickle", "cloudpickle", "hypothesis", "hypothesis", "mypy (>=0.971,<0.990)", "mypy (>=0.971,<0.990)", "pympler", "pympler", "pytest (>=4.3.0)", "pytest (>=4.3.0)", "pytest-mypy-plugins", "pytest-mypy-plugins", "pytest-xdist[psutil]", "pytest-xdist[psutil]"] - -[[package]] -name = "bandit" -version = "1.7.4" -description = "Security oriented static analyser for python code." -category = "dev" -optional = false -python-versions = ">=3.7" -files = [ - {file = "bandit-1.7.4-py3-none-any.whl", hash = "sha256:412d3f259dab4077d0e7f0c11f50f650cc7d10db905d98f6520a95a18049658a"}, - {file = "bandit-1.7.4.tar.gz", hash = "sha256:2d63a8c573417bae338962d4b9b06fbc6080f74ecd955a092849e1e65c717bd2"}, -] - -[package.dependencies] -colorama = {version = ">=0.3.9", markers = "platform_system == \"Windows\""} -GitPython = ">=1.0.1" -PyYAML = ">=5.3.1" -stevedore = ">=1.20.0" - -[package.extras] -test = ["beautifulsoup4 (>=4.8.0)", "coverage (>=4.5.4)", "fixtures (>=3.0.0)", "flake8 (>=4.0.0)", "pylint (==1.9.4)", "stestr (>=2.5.0)", "testscenarios (>=0.5.0)", "testtools (>=2.3.0)", "toml"] -toml = ["toml"] -yaml = ["PyYAML"] - -[[package]] -name = "beautifulsoup4" -version = "4.11.2" -description = "Screen-scraping library" -category = "main" -optional = false -python-versions = ">=3.6.0" -files = [ - {file = "beautifulsoup4-4.11.2-py3-none-any.whl", hash = "sha256:0e79446b10b3ecb499c1556f7e228a53e64a2bfcebd455f370d8927cb5b59e39"}, - {file = "beautifulsoup4-4.11.2.tar.gz", hash = "sha256:bc4bdda6717de5a2987436fb8d72f45dc90dd856bdfd512a1314ce90349a0106"}, -] - -[package.dependencies] -soupsieve = ">1.2" - -[package.extras] -html5lib = ["html5lib"] -lxml = ["lxml"] - -[[package]] -name = "black" -version = "22.12.0" -description = "The uncompromising code formatter." -category = "dev" -optional = false -python-versions = ">=3.7" -files = [ - {file = "black-22.12.0-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:9eedd20838bd5d75b80c9f5487dbcb06836a43833a37846cf1d8c1cc01cef59d"}, - {file = "black-22.12.0-cp310-cp310-win_amd64.whl", hash = "sha256:159a46a4947f73387b4d83e87ea006dbb2337eab6c879620a3ba52699b1f4351"}, - {file = "black-22.12.0-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:d30b212bffeb1e252b31dd269dfae69dd17e06d92b87ad26e23890f3efea366f"}, - {file = "black-22.12.0-cp311-cp311-win_amd64.whl", hash = "sha256:7412e75863aa5c5411886804678b7d083c7c28421210180d67dfd8cf1221e1f4"}, - {file = "black-22.12.0-cp37-cp37m-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c116eed0efb9ff870ded8b62fe9f28dd61ef6e9ddd28d83d7d264a38417dcee2"}, - {file = "black-22.12.0-cp37-cp37m-win_amd64.whl", hash = "sha256:1f58cbe16dfe8c12b7434e50ff889fa479072096d79f0a7f25e4ab8e94cd8350"}, - {file = "black-22.12.0-cp38-cp38-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:77d86c9f3db9b1bf6761244bc0b3572a546f5fe37917a044e02f3166d5aafa7d"}, - {file = "black-22.12.0-cp38-cp38-win_amd64.whl", hash = "sha256:82d9fe8fee3401e02e79767016b4907820a7dc28d70d137eb397b92ef3cc5bfc"}, - {file = "black-22.12.0-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:101c69b23df9b44247bd88e1d7e90154336ac4992502d4197bdac35dd7ee3320"}, - {file = "black-22.12.0-cp39-cp39-win_amd64.whl", hash = "sha256:559c7a1ba9a006226f09e4916060982fd27334ae1998e7a38b3f33a37f7a2148"}, - {file = "black-22.12.0-py3-none-any.whl", hash = "sha256:436cc9167dd28040ad90d3b404aec22cedf24a6e4d7de221bec2730ec0c97bcf"}, - {file = "black-22.12.0.tar.gz", hash = "sha256:229351e5a18ca30f447bf724d007f890f97e13af070bb6ad4c0a441cd7596a2f"}, -] - -[package.dependencies] -click = ">=8.0.0" -mypy-extensions = ">=0.4.3" -pathspec = ">=0.9.0" -platformdirs = ">=2" -tomli = {version = ">=1.1.0", markers = "python_full_version < \"3.11.0a7\""} -typing-extensions = {version = ">=3.10.0.0", markers = "python_version < \"3.10\""} - -[package.extras] -colorama = ["colorama (>=0.4.3)"] -d = ["aiohttp (>=3.7.4)"] -jupyter = ["ipython (>=7.8.0)", "tokenize-rt (>=3.2.0)"] -uvloop = ["uvloop (>=0.15.2)"] - -[[package]] -name = "certifi" -version = "2022.12.7" -description = "Python package for providing Mozilla's CA Bundle." -category = "main" -optional = false -python-versions = ">=3.6" -files = [ - {file = "certifi-2022.12.7-py3-none-any.whl", hash = "sha256:4ad3232f5e926d6718ec31cfc1fcadfde020920e278684144551c91769c7bc18"}, - {file = "certifi-2022.12.7.tar.gz", hash = "sha256:35824b4c3a97115964b408844d64aa14db1cc518f6562e8d7261699d1350a9e3"}, -] - -[[package]] -name = "cffi" -version = "1.15.1" -description = "Foreign Function Interface for Python calling C code." -category = "main" -optional = false -python-versions = "*" -files = [ - {file = "cffi-1.15.1-cp27-cp27m-macosx_10_9_x86_64.whl", hash = "sha256:a66d3508133af6e8548451b25058d5812812ec3798c886bf38ed24a98216fab2"}, - {file = "cffi-1.15.1-cp27-cp27m-manylinux1_i686.whl", hash = "sha256:470c103ae716238bbe698d67ad020e1db9d9dba34fa5a899b5e21577e6d52ed2"}, - {file = "cffi-1.15.1-cp27-cp27m-manylinux1_x86_64.whl", hash = "sha256:9ad5db27f9cabae298d151c85cf2bad1d359a1b9c686a275df03385758e2f914"}, - {file = "cffi-1.15.1-cp27-cp27m-win32.whl", hash = "sha256:b3bbeb01c2b273cca1e1e0c5df57f12dce9a4dd331b4fa1635b8bec26350bde3"}, - {file = "cffi-1.15.1-cp27-cp27m-win_amd64.whl", hash = "sha256:e00b098126fd45523dd056d2efba6c5a63b71ffe9f2bbe1a4fe1716e1d0c331e"}, - {file = "cffi-1.15.1-cp27-cp27mu-manylinux1_i686.whl", hash = "sha256:d61f4695e6c866a23a21acab0509af1cdfd2c013cf256bbf5b6b5e2695827162"}, - {file = "cffi-1.15.1-cp27-cp27mu-manylinux1_x86_64.whl", hash = "sha256:ed9cb427ba5504c1dc15ede7d516b84757c3e3d7868ccc85121d9310d27eed0b"}, - {file = "cffi-1.15.1-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:39d39875251ca8f612b6f33e6b1195af86d1b3e60086068be9cc053aa4376e21"}, - {file = "cffi-1.15.1-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:285d29981935eb726a4399badae8f0ffdff4f5050eaa6d0cfc3f64b857b77185"}, - {file = "cffi-1.15.1-cp310-cp310-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:3eb6971dcff08619f8d91607cfc726518b6fa2a9eba42856be181c6d0d9515fd"}, - {file = "cffi-1.15.1-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:21157295583fe8943475029ed5abdcf71eb3911894724e360acff1d61c1d54bc"}, - {file = "cffi-1.15.1-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:5635bd9cb9731e6d4a1132a498dd34f764034a8ce60cef4f5319c0541159392f"}, - {file = "cffi-1.15.1-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:2012c72d854c2d03e45d06ae57f40d78e5770d252f195b93f581acf3ba44496e"}, - {file = "cffi-1.15.1-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:dd86c085fae2efd48ac91dd7ccffcfc0571387fe1193d33b6394db7ef31fe2a4"}, - {file = "cffi-1.15.1-cp310-cp310-musllinux_1_1_i686.whl", hash = "sha256:fa6693661a4c91757f4412306191b6dc88c1703f780c8234035eac011922bc01"}, - {file = "cffi-1.15.1-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:59c0b02d0a6c384d453fece7566d1c7e6b7bae4fc5874ef2ef46d56776d61c9e"}, - {file = "cffi-1.15.1-cp310-cp310-win32.whl", hash = "sha256:cba9d6b9a7d64d4bd46167096fc9d2f835e25d7e4c121fb2ddfc6528fb0413b2"}, - {file = "cffi-1.15.1-cp310-cp310-win_amd64.whl", hash = "sha256:ce4bcc037df4fc5e3d184794f27bdaab018943698f4ca31630bc7f84a7b69c6d"}, - {file = "cffi-1.15.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:3d08afd128ddaa624a48cf2b859afef385b720bb4b43df214f85616922e6a5ac"}, - {file = "cffi-1.15.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:3799aecf2e17cf585d977b780ce79ff0dc9b78d799fc694221ce814c2c19db83"}, - {file = "cffi-1.15.1-cp311-cp311-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:a591fe9e525846e4d154205572a029f653ada1a78b93697f3b5a8f1f2bc055b9"}, - {file = "cffi-1.15.1-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:3548db281cd7d2561c9ad9984681c95f7b0e38881201e157833a2342c30d5e8c"}, - {file = "cffi-1.15.1-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:91fc98adde3d7881af9b59ed0294046f3806221863722ba7d8d120c575314325"}, - {file = "cffi-1.15.1-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:94411f22c3985acaec6f83c6df553f2dbe17b698cc7f8ae751ff2237d96b9e3c"}, - {file = "cffi-1.15.1-cp311-cp311-musllinux_1_1_i686.whl", hash = "sha256:03425bdae262c76aad70202debd780501fabeaca237cdfddc008987c0e0f59ef"}, - {file = "cffi-1.15.1-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:cc4d65aeeaa04136a12677d3dd0b1c0c94dc43abac5860ab33cceb42b801c1e8"}, - {file = "cffi-1.15.1-cp311-cp311-win32.whl", hash = "sha256:a0f100c8912c114ff53e1202d0078b425bee3649ae34d7b070e9697f93c5d52d"}, - {file = "cffi-1.15.1-cp311-cp311-win_amd64.whl", hash = "sha256:04ed324bda3cda42b9b695d51bb7d54b680b9719cfab04227cdd1e04e5de3104"}, - {file = "cffi-1.15.1-cp36-cp36m-macosx_10_9_x86_64.whl", hash = "sha256:50a74364d85fd319352182ef59c5c790484a336f6db772c1a9231f1c3ed0cbd7"}, - {file = "cffi-1.15.1-cp36-cp36m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:e263d77ee3dd201c3a142934a086a4450861778baaeeb45db4591ef65550b0a6"}, - {file = "cffi-1.15.1-cp36-cp36m-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:cec7d9412a9102bdc577382c3929b337320c4c4c4849f2c5cdd14d7368c5562d"}, - {file = "cffi-1.15.1-cp36-cp36m-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:4289fc34b2f5316fbb762d75362931e351941fa95fa18789191b33fc4cf9504a"}, - {file = "cffi-1.15.1-cp36-cp36m-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:173379135477dc8cac4bc58f45db08ab45d228b3363adb7af79436135d028405"}, - {file = "cffi-1.15.1-cp36-cp36m-manylinux_2_5_x86_64.manylinux1_x86_64.whl", hash = "sha256:6975a3fac6bc83c4a65c9f9fcab9e47019a11d3d2cf7f3c0d03431bf145a941e"}, - {file = "cffi-1.15.1-cp36-cp36m-win32.whl", hash = "sha256:2470043b93ff09bf8fb1d46d1cb756ce6132c54826661a32d4e4d132e1977adf"}, - {file = "cffi-1.15.1-cp36-cp36m-win_amd64.whl", hash = "sha256:30d78fbc8ebf9c92c9b7823ee18eb92f2e6ef79b45ac84db507f52fbe3ec4497"}, - {file = "cffi-1.15.1-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:198caafb44239b60e252492445da556afafc7d1e3ab7a1fb3f0584ef6d742375"}, - {file = "cffi-1.15.1-cp37-cp37m-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:5ef34d190326c3b1f822a5b7a45f6c4535e2f47ed06fec77d3d799c450b2651e"}, - {file = "cffi-1.15.1-cp37-cp37m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:8102eaf27e1e448db915d08afa8b41d6c7ca7a04b7d73af6514df10a3e74bd82"}, - {file = "cffi-1.15.1-cp37-cp37m-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:5df2768244d19ab7f60546d0c7c63ce1581f7af8b5de3eb3004b9b6fc8a9f84b"}, - {file = "cffi-1.15.1-cp37-cp37m-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:a8c4917bd7ad33e8eb21e9a5bbba979b49d9a97acb3a803092cbc1133e20343c"}, - {file = "cffi-1.15.1-cp37-cp37m-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0e2642fe3142e4cc4af0799748233ad6da94c62a8bec3a6648bf8ee68b1c7426"}, - {file = "cffi-1.15.1-cp37-cp37m-win32.whl", hash = "sha256:e229a521186c75c8ad9490854fd8bbdd9a0c9aa3a524326b55be83b54d4e0ad9"}, - {file = "cffi-1.15.1-cp37-cp37m-win_amd64.whl", hash = "sha256:a0b71b1b8fbf2b96e41c4d990244165e2c9be83d54962a9a1d118fd8657d2045"}, - {file = "cffi-1.15.1-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:320dab6e7cb2eacdf0e658569d2575c4dad258c0fcc794f46215e1e39f90f2c3"}, - {file = "cffi-1.15.1-cp38-cp38-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:1e74c6b51a9ed6589199c787bf5f9875612ca4a8a0785fb2d4a84429badaf22a"}, - {file = "cffi-1.15.1-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:a5c84c68147988265e60416b57fc83425a78058853509c1b0629c180094904a5"}, - {file = "cffi-1.15.1-cp38-cp38-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:3b926aa83d1edb5aa5b427b4053dc420ec295a08e40911296b9eb1b6170f6cca"}, - {file = "cffi-1.15.1-cp38-cp38-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:87c450779d0914f2861b8526e035c5e6da0a3199d8f1add1a665e1cbc6fc6d02"}, - {file = "cffi-1.15.1-cp38-cp38-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:4f2c9f67e9821cad2e5f480bc8d83b8742896f1242dba247911072d4fa94c192"}, - {file = "cffi-1.15.1-cp38-cp38-win32.whl", hash = "sha256:8b7ee99e510d7b66cdb6c593f21c043c248537a32e0bedf02e01e9553a172314"}, - {file = "cffi-1.15.1-cp38-cp38-win_amd64.whl", hash = "sha256:00a9ed42e88df81ffae7a8ab6d9356b371399b91dbdf0c3cb1e84c03a13aceb5"}, - {file = "cffi-1.15.1-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:54a2db7b78338edd780e7ef7f9f6c442500fb0d41a5a4ea24fff1c929d5af585"}, - {file = "cffi-1.15.1-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:fcd131dd944808b5bdb38e6f5b53013c5aa4f334c5cad0c72742f6eba4b73db0"}, - {file = "cffi-1.15.1-cp39-cp39-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:7473e861101c9e72452f9bf8acb984947aa1661a7704553a9f6e4baa5ba64415"}, - {file = "cffi-1.15.1-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:6c9a799e985904922a4d207a94eae35c78ebae90e128f0c4e521ce339396be9d"}, - {file = "cffi-1.15.1-cp39-cp39-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:3bcde07039e586f91b45c88f8583ea7cf7a0770df3a1649627bf598332cb6984"}, - {file = "cffi-1.15.1-cp39-cp39-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:33ab79603146aace82c2427da5ca6e58f2b3f2fb5da893ceac0c42218a40be35"}, - {file = "cffi-1.15.1-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:5d598b938678ebf3c67377cdd45e09d431369c3b1a5b331058c338e201f12b27"}, - {file = "cffi-1.15.1-cp39-cp39-musllinux_1_1_i686.whl", hash = "sha256:db0fbb9c62743ce59a9ff687eb5f4afbe77e5e8403d6697f7446e5f609976f76"}, - {file = "cffi-1.15.1-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:98d85c6a2bef81588d9227dde12db8a7f47f639f4a17c9ae08e773aa9c697bf3"}, - {file = "cffi-1.15.1-cp39-cp39-win32.whl", hash = "sha256:40f4774f5a9d4f5e344f31a32b5096977b5d48560c5592e2f3d2c4374bd543ee"}, - {file = "cffi-1.15.1-cp39-cp39-win_amd64.whl", hash = "sha256:70df4e3b545a17496c9b3f41f5115e69a4f2e77e94e1d2a8e1070bc0c38c8a3c"}, - {file = "cffi-1.15.1.tar.gz", hash = "sha256:d400bfb9a37b1351253cb402671cea7e89bdecc294e8016a707f6d1d8ac934f9"}, -] - -[package.dependencies] -pycparser = "*" - -[[package]] -name = "cfgv" -version = "3.3.1" -description = "Validate configuration and produce human readable error messages." -category = "dev" -optional = false -python-versions = ">=3.6.1" -files = [ - {file = "cfgv-3.3.1-py2.py3-none-any.whl", hash = "sha256:c6a0883f3917a037485059700b9e75da2464e6c27051014ad85ba6aaa5884426"}, - {file = "cfgv-3.3.1.tar.gz", hash = "sha256:f5a830efb9ce7a445376bb66ec94c638a9787422f96264c98edc6bdeed8ab736"}, -] - -[[package]] -name = "charset-normalizer" -version = "3.0.1" -description = "The Real First Universal Charset Detector. Open, modern and actively maintained alternative to Chardet." -category = "main" -optional = false -python-versions = "*" -files = [ - {file = "charset-normalizer-3.0.1.tar.gz", hash = "sha256:ebea339af930f8ca5d7a699b921106c6e29c617fe9606fa7baa043c1cdae326f"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:88600c72ef7587fe1708fd242b385b6ed4b8904976d5da0893e31df8b3480cb6"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:c75ffc45f25324e68ab238cb4b5c0a38cd1c3d7f1fb1f72b5541de469e2247db"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:db72b07027db150f468fbada4d85b3b2729a3db39178abf5c543b784c1254539"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:62595ab75873d50d57323a91dd03e6966eb79c41fa834b7a1661ed043b2d404d"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:ff6f3db31555657f3163b15a6b7c6938d08df7adbfc9dd13d9d19edad678f1e8"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:772b87914ff1152b92a197ef4ea40efe27a378606c39446ded52c8f80f79702e"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:70990b9c51340e4044cfc394a81f614f3f90d41397104d226f21e66de668730d"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:292d5e8ba896bbfd6334b096e34bffb56161c81408d6d036a7dfa6929cff8783"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:2edb64ee7bf1ed524a1da60cdcd2e1f6e2b4f66ef7c077680739f1641f62f555"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-musllinux_1_1_i686.whl", hash = "sha256:31a9ddf4718d10ae04d9b18801bd776693487cbb57d74cc3458a7673f6f34639"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-musllinux_1_1_ppc64le.whl", hash = "sha256:44ba614de5361b3e5278e1241fda3dc1838deed864b50a10d7ce92983797fa76"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-musllinux_1_1_s390x.whl", hash = "sha256:12db3b2c533c23ab812c2b25934f60383361f8a376ae272665f8e48b88e8e1c6"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:c512accbd6ff0270939b9ac214b84fb5ada5f0409c44298361b2f5e13f9aed9e"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-win32.whl", hash = "sha256:502218f52498a36d6bf5ea77081844017bf7982cdbe521ad85e64cabee1b608b"}, - {file = "charset_normalizer-3.0.1-cp310-cp310-win_amd64.whl", hash = "sha256:601f36512f9e28f029d9481bdaf8e89e5148ac5d89cffd3b05cd533eeb423b59"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:0298eafff88c99982a4cf66ba2efa1128e4ddaca0b05eec4c456bbc7db691d8d"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:a8d0fc946c784ff7f7c3742310cc8a57c5c6dc31631269876a88b809dbeff3d3"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:87701167f2a5c930b403e9756fab1d31d4d4da52856143b609e30a1ce7160f3c"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:14e76c0f23218b8f46c4d87018ca2e441535aed3632ca134b10239dfb6dadd6b"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:0c0a590235ccd933d9892c627dec5bc7511ce6ad6c1011fdf5b11363022746c1"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:8c7fe7afa480e3e82eed58e0ca89f751cd14d767638e2550c77a92a9e749c317"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:79909e27e8e4fcc9db4addea88aa63f6423ebb171db091fb4373e3312cb6d603"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:8ac7b6a045b814cf0c47f3623d21ebd88b3e8cf216a14790b455ea7ff0135d18"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:72966d1b297c741541ca8cf1223ff262a6febe52481af742036a0b296e35fa5a"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-musllinux_1_1_i686.whl", hash = "sha256:f9d0c5c045a3ca9bedfc35dca8526798eb91a07aa7a2c0fee134c6c6f321cbd7"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-musllinux_1_1_ppc64le.whl", hash = "sha256:5995f0164fa7df59db4746112fec3f49c461dd6b31b841873443bdb077c13cfc"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-musllinux_1_1_s390x.whl", hash = "sha256:4a8fcf28c05c1f6d7e177a9a46a1c52798bfe2ad80681d275b10dcf317deaf0b"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:761e8904c07ad053d285670f36dd94e1b6ab7f16ce62b9805c475b7aa1cffde6"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-win32.whl", hash = "sha256:71140351489970dfe5e60fc621ada3e0f41104a5eddaca47a7acb3c1b851d6d3"}, - {file = "charset_normalizer-3.0.1-cp311-cp311-win_amd64.whl", hash = "sha256:9ab77acb98eba3fd2a85cd160851816bfce6871d944d885febf012713f06659c"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-macosx_10_9_x86_64.whl", hash = "sha256:84c3990934bae40ea69a82034912ffe5a62c60bbf6ec5bc9691419641d7d5c9a"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:74292fc76c905c0ef095fe11e188a32ebd03bc38f3f3e9bcb85e4e6db177b7ea"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:c95a03c79bbe30eec3ec2b7f076074f4281526724c8685a42872974ef4d36b72"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:f4c39b0e3eac288fedc2b43055cfc2ca7a60362d0e5e87a637beac5d801ef478"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:df2c707231459e8a4028eabcd3cfc827befd635b3ef72eada84ab13b52e1574d"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:93ad6d87ac18e2a90b0fe89df7c65263b9a99a0eb98f0a3d2e079f12a0735837"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-musllinux_1_1_aarch64.whl", hash = "sha256:59e5686dd847347e55dffcc191a96622f016bc0ad89105e24c14e0d6305acbc6"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-musllinux_1_1_i686.whl", hash = "sha256:cd6056167405314a4dc3c173943f11249fa0f1b204f8b51ed4bde1a9cd1834dc"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-musllinux_1_1_ppc64le.whl", hash = "sha256:083c8d17153ecb403e5e1eb76a7ef4babfc2c48d58899c98fcaa04833e7a2f9a"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-musllinux_1_1_s390x.whl", hash = "sha256:f5057856d21e7586765171eac8b9fc3f7d44ef39425f85dbcccb13b3ebea806c"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-musllinux_1_1_x86_64.whl", hash = "sha256:7eb33a30d75562222b64f569c642ff3dc6689e09adda43a082208397f016c39a"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-win32.whl", hash = "sha256:95dea361dd73757c6f1c0a1480ac499952c16ac83f7f5f4f84f0658a01b8ef41"}, - {file = "charset_normalizer-3.0.1-cp36-cp36m-win_amd64.whl", hash = "sha256:eaa379fcd227ca235d04152ca6704c7cb55564116f8bc52545ff357628e10602"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:3e45867f1f2ab0711d60c6c71746ac53537f1684baa699f4f668d4c6f6ce8e14"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:cadaeaba78750d58d3cc6ac4d1fd867da6fc73c88156b7a3212a3cd4819d679d"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:911d8a40b2bef5b8bbae2e36a0b103f142ac53557ab421dc16ac4aafee6f53dc"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:503e65837c71b875ecdd733877d852adbc465bd82c768a067badd953bf1bc5a3"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:a60332922359f920193b1d4826953c507a877b523b2395ad7bc716ddd386d866"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:16a8663d6e281208d78806dbe14ee9903715361cf81f6d4309944e4d1e59ac5b"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-musllinux_1_1_aarch64.whl", hash = "sha256:a16418ecf1329f71df119e8a65f3aa68004a3f9383821edcb20f0702934d8087"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-musllinux_1_1_i686.whl", hash = "sha256:9d9153257a3f70d5f69edf2325357251ed20f772b12e593f3b3377b5f78e7ef8"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-musllinux_1_1_ppc64le.whl", hash = "sha256:02a51034802cbf38db3f89c66fb5d2ec57e6fe7ef2f4a44d070a593c3688667b"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-musllinux_1_1_s390x.whl", hash = "sha256:2e396d70bc4ef5325b72b593a72c8979999aa52fb8bcf03f701c1b03e1166918"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-musllinux_1_1_x86_64.whl", hash = "sha256:11b53acf2411c3b09e6af37e4b9005cba376c872503c8f28218c7243582df45d"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-win32.whl", hash = "sha256:0bf2dae5291758b6f84cf923bfaa285632816007db0330002fa1de38bfcb7154"}, - {file = "charset_normalizer-3.0.1-cp37-cp37m-win_amd64.whl", hash = "sha256:2c03cc56021a4bd59be889c2b9257dae13bf55041a3372d3295416f86b295fb5"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-macosx_10_9_universal2.whl", hash = "sha256:024e606be3ed92216e2b6952ed859d86b4cfa52cd5bc5f050e7dc28f9b43ec42"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:4b0d02d7102dd0f997580b51edc4cebcf2ab6397a7edf89f1c73b586c614272c"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-macosx_11_0_arm64.whl", hash = "sha256:358a7c4cb8ba9b46c453b1dd8d9e431452d5249072e4f56cfda3149f6ab1405e"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:81d6741ab457d14fdedc215516665050f3822d3e56508921cc7239f8c8e66a58"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:8b8af03d2e37866d023ad0ddea594edefc31e827fee64f8de5611a1dbc373174"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:9cf4e8ad252f7c38dd1f676b46514f92dc0ebeb0db5552f5f403509705e24753"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:e696f0dd336161fca9adbb846875d40752e6eba585843c768935ba5c9960722b"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:c22d3fe05ce11d3671297dc8973267daa0f938b93ec716e12e0f6dee81591dc1"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-musllinux_1_1_aarch64.whl", hash = "sha256:109487860ef6a328f3eec66f2bf78b0b72400280d8f8ea05f69c51644ba6521a"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-musllinux_1_1_i686.whl", hash = "sha256:37f8febc8ec50c14f3ec9637505f28e58d4f66752207ea177c1d67df25da5aed"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-musllinux_1_1_ppc64le.whl", hash = "sha256:f97e83fa6c25693c7a35de154681fcc257c1c41b38beb0304b9c4d2d9e164479"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-musllinux_1_1_s390x.whl", hash = "sha256:a152f5f33d64a6be73f1d30c9cc82dfc73cec6477ec268e7c6e4c7d23c2d2291"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-musllinux_1_1_x86_64.whl", hash = "sha256:39049da0ffb96c8cbb65cbf5c5f3ca3168990adf3551bd1dee10c48fce8ae820"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-win32.whl", hash = "sha256:4457ea6774b5611f4bed5eaa5df55f70abde42364d498c5134b7ef4c6958e20e"}, - {file = "charset_normalizer-3.0.1-cp38-cp38-win_amd64.whl", hash = "sha256:e62164b50f84e20601c1ff8eb55620d2ad25fb81b59e3cd776a1902527a788af"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:8eade758719add78ec36dc13201483f8e9b5d940329285edcd5f70c0a9edbd7f"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:8499ca8f4502af841f68135133d8258f7b32a53a1d594aa98cc52013fff55678"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:3fc1c4a2ffd64890aebdb3f97e1278b0cc72579a08ca4de8cd2c04799a3a22be"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:00d3ffdaafe92a5dc603cb9bd5111aaa36dfa187c8285c543be562e61b755f6b"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:c2ac1b08635a8cd4e0cbeaf6f5e922085908d48eb05d44c5ae9eabab148512ca"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:f6f45710b4459401609ebebdbcfb34515da4fc2aa886f95107f556ac69a9147e"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:3ae1de54a77dc0d6d5fcf623290af4266412a7c4be0b1ff7444394f03f5c54e3"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:3b590df687e3c5ee0deef9fc8c547d81986d9a1b56073d82de008744452d6541"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-musllinux_1_1_aarch64.whl", hash = "sha256:ab5de034a886f616a5668aa5d098af2b5385ed70142090e2a31bcbd0af0fdb3d"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-musllinux_1_1_i686.whl", hash = "sha256:9cb3032517f1627cc012dbc80a8ec976ae76d93ea2b5feaa9d2a5b8882597579"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-musllinux_1_1_ppc64le.whl", hash = "sha256:608862a7bf6957f2333fc54ab4399e405baad0163dc9f8d99cb236816db169d4"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-musllinux_1_1_s390x.whl", hash = "sha256:0f438ae3532723fb6ead77e7c604be7c8374094ef4ee2c5e03a3a17f1fca256c"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:356541bf4381fa35856dafa6a965916e54bed415ad8a24ee6de6e37deccf2786"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-win32.whl", hash = "sha256:39cf9ed17fe3b1bc81f33c9ceb6ce67683ee7526e65fde1447c772afc54a1bb8"}, - {file = "charset_normalizer-3.0.1-cp39-cp39-win_amd64.whl", hash = "sha256:0a11e971ed097d24c534c037d298ad32c6ce81a45736d31e0ff0ad37ab437d59"}, - {file = "charset_normalizer-3.0.1-py3-none-any.whl", hash = "sha256:7e189e2e1d3ed2f4aebabd2d5b0f931e883676e51c7624826e0a4e5fe8a0bf24"}, -] - -[[package]] -name = "chromedriver-autoinstaller" -version = "0.4.0" -description = "Automatically install chromedriver that supports the currently installed version of chrome." -category = "main" -optional = false -python-versions = ">=3.6" -files = [ - {file = "chromedriver-autoinstaller-0.4.0.tar.gz", hash = "sha256:57f15f40d2e356c4cb84870cb7f882283a8280118bedacbf19301dd692f672b5"}, - {file = "chromedriver_autoinstaller-0.4.0-py3-none-any.whl", hash = "sha256:1534d39903d22379ff13435d695703ae9b14ddb336d43556fd7735854ada6d2b"}, -] - -[[package]] -name = "click" -version = "8.0.4" -description = "Composable command line interface toolkit" -category = "main" -optional = false -python-versions = ">=3.6" -files = [ - {file = "click-8.0.4-py3-none-any.whl", hash = "sha256:6a7a62563bbfabfda3a38f3023a1db4a35978c0abd76f6c9605ecd6554d6d9b1"}, - {file = "click-8.0.4.tar.gz", hash = "sha256:8458d7b1287c5fb128c90e23381cf99dcde74beaf6c7ff6384ce84d6fe090adb"}, -] - -[package.dependencies] -colorama = {version = "*", markers = "platform_system == \"Windows\""} - -[[package]] -name = "click-shell" -version = "2.1" -description = "An extension to click that easily turns your click app into a shell utility" -category = "main" -optional = false -python-versions = "*" -files = [ - {file = "click-shell-2.1.tar.gz", hash = "sha256:ce0c91faae284c41a39bec966f928791ad4a45763755445f1fe2041fd091aa37"}, - {file = "click_shell-2.1-py2.py3-none-any.whl", hash = "sha256:2d971a2e50eb7ad387cf0ce79ba4b844e66e0580784e2efe2df58b50a2f047f0"}, -] - -[package.dependencies] -click = ">=6.0" - -[package.extras] -readline = ["gnureadline"] -windows = ["pyreadline"] - -[[package]] -name = "cloudscraper" -version = "1.2.68" -description = "A Python module to bypass Cloudflare's anti-bot page." -category = "main" -optional = false -python-versions = "*" -files = [ - {file = "cloudscraper-1.2.68-py2.py3-none-any.whl", hash = "sha256:401409859697edae9384a7623b450cc97ab14dd0b2c8cdcac62edc2d50b31741"}, - {file = "cloudscraper-1.2.68.tar.gz", hash = "sha256:4d02aceffa90abd4dabc75b79bafa31636309baa7c0f2ee665e2d345aadb8863"}, -] - -[package.dependencies] -pyparsing = ">=2.4.7" -requests = ">=2.9.2" -requests-toolbelt = ">=0.9.1" - -[[package]] -name = "colorama" -version = "0.4.6" -description = "Cross-platform colored terminal text." -category = "main" -optional = false -python-versions = "!=3.0.*,!=3.1.*,!=3.2.*,!=3.3.*,!=3.4.*,!=3.5.*,!=3.6.*,>=2.7" -files = [ - {file = "colorama-0.4.6-py2.py3-none-any.whl", hash = "sha256:4f1d9991f5acc0ca119f9d443620b77f9d6b33703e51011c16baf57afb285fc6"}, - {file = "colorama-0.4.6.tar.gz", hash = "sha256:08695f5cb7ed6e0531a20572697297273c47b8cae5a63ffc6d6ed5c201be6e44"}, -] - -[[package]] -name = "coverage" -version = "7.1.0" -description = "Code coverage measurement for Python" -category = "dev" -optional = false -python-versions = ">=3.7" -files = [ - {file = "coverage-7.1.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:3b946bbcd5a8231383450b195cfb58cb01cbe7f8949f5758566b881df4b33baf"}, - {file = "coverage-7.1.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:ec8e767f13be637d056f7e07e61d089e555f719b387a7070154ad80a0ff31801"}, - {file = "coverage-7.1.0-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d4a5a5879a939cb84959d86869132b00176197ca561c664fc21478c1eee60d75"}, - {file = "coverage-7.1.0-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:b643cb30821e7570c0aaf54feaf0bfb630b79059f85741843e9dc23f33aaca2c"}, - {file = "coverage-7.1.0-cp310-cp310-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:32df215215f3af2c1617a55dbdfb403b772d463d54d219985ac7cd3bf124cada"}, - {file = "coverage-7.1.0-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:33d1ae9d4079e05ac4cc1ef9e20c648f5afabf1a92adfaf2ccf509c50b85717f"}, - {file = "coverage-7.1.0-cp310-cp310-musllinux_1_1_i686.whl", hash = "sha256:29571503c37f2ef2138a306d23e7270687c0efb9cab4bd8038d609b5c2393a3a"}, - {file = "coverage-7.1.0-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:63ffd21aa133ff48c4dff7adcc46b7ec8b565491bfc371212122dd999812ea1c"}, - {file = "coverage-7.1.0-cp310-cp310-win32.whl", hash = "sha256:4b14d5e09c656de5038a3f9bfe5228f53439282abcab87317c9f7f1acb280352"}, - {file = "coverage-7.1.0-cp310-cp310-win_amd64.whl", hash = "sha256:8361be1c2c073919500b6601220a6f2f98ea0b6d2fec5014c1d9cfa23dd07038"}, - {file = "coverage-7.1.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:da9b41d4539eefd408c46725fb76ecba3a50a3367cafb7dea5f250d0653c1040"}, - {file = "coverage-7.1.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:c5b15ed7644ae4bee0ecf74fee95808dcc34ba6ace87e8dfbf5cb0dc20eab45a"}, - {file = "coverage-7.1.0-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d12d076582507ea460ea2a89a8c85cb558f83406c8a41dd641d7be9a32e1274f"}, - {file = "coverage-7.1.0-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:e2617759031dae1bf183c16cef8fcfb3de7617f394c813fa5e8e46e9b82d4222"}, - {file = "coverage-7.1.0-cp311-cp311-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c4e4881fa9e9667afcc742f0c244d9364d197490fbc91d12ac3b5de0bf2df146"}, - {file = "coverage-7.1.0-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:9d58885215094ab4a86a6aef044e42994a2bd76a446dc59b352622655ba6621b"}, - {file = "coverage-7.1.0-cp311-cp311-musllinux_1_1_i686.whl", hash = "sha256:ffeeb38ee4a80a30a6877c5c4c359e5498eec095878f1581453202bfacc8fbc2"}, - {file = "coverage-7.1.0-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:3baf5f126f30781b5e93dbefcc8271cb2491647f8283f20ac54d12161dff080e"}, - {file = "coverage-7.1.0-cp311-cp311-win32.whl", hash = "sha256:ded59300d6330be27bc6cf0b74b89ada58069ced87c48eaf9344e5e84b0072f7"}, - {file = "coverage-7.1.0-cp311-cp311-win_amd64.whl", hash = "sha256:6a43c7823cd7427b4ed763aa7fb63901ca8288591323b58c9cd6ec31ad910f3c"}, - {file = "coverage-7.1.0-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:7a726d742816cb3a8973c8c9a97539c734b3a309345236cd533c4883dda05b8d"}, - {file = "coverage-7.1.0-cp37-cp37m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:bc7c85a150501286f8b56bd8ed3aa4093f4b88fb68c0843d21ff9656f0009d6a"}, - {file = "coverage-7.1.0-cp37-cp37m-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:f5b4198d85a3755d27e64c52f8c95d6333119e49fd001ae5798dac872c95e0f8"}, - {file = "coverage-7.1.0-cp37-cp37m-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:ddb726cb861c3117a553f940372a495fe1078249ff5f8a5478c0576c7be12050"}, - {file = "coverage-7.1.0-cp37-cp37m-musllinux_1_1_aarch64.whl", hash = "sha256:51b236e764840a6df0661b67e50697aaa0e7d4124ca95e5058fa3d7cbc240b7c"}, - {file = "coverage-7.1.0-cp37-cp37m-musllinux_1_1_i686.whl", hash = "sha256:7ee5c9bb51695f80878faaa5598040dd6c9e172ddcf490382e8aedb8ec3fec8d"}, - {file = "coverage-7.1.0-cp37-cp37m-musllinux_1_1_x86_64.whl", hash = "sha256:c31b75ae466c053a98bf26843563b3b3517b8f37da4d47b1c582fdc703112bc3"}, - {file = "coverage-7.1.0-cp37-cp37m-win32.whl", hash = "sha256:3b155caf3760408d1cb903b21e6a97ad4e2bdad43cbc265e3ce0afb8e0057e73"}, - {file = "coverage-7.1.0-cp37-cp37m-win_amd64.whl", hash = "sha256:2a60d6513781e87047c3e630b33b4d1e89f39836dac6e069ffee28c4786715f5"}, - {file = "coverage-7.1.0-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:f2cba5c6db29ce991029b5e4ac51eb36774458f0a3b8d3137241b32d1bb91f06"}, - {file = "coverage-7.1.0-cp38-cp38-macosx_11_0_arm64.whl", hash = "sha256:beeb129cacea34490ffd4d6153af70509aa3cda20fdda2ea1a2be870dfec8d52"}, - {file = "coverage-7.1.0-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:0c45948f613d5d18c9ec5eaa203ce06a653334cf1bd47c783a12d0dd4fd9c851"}, - {file = "coverage-7.1.0-cp38-cp38-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:ef382417db92ba23dfb5864a3fc9be27ea4894e86620d342a116b243ade5d35d"}, - {file = "coverage-7.1.0-cp38-cp38-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:7c7c0d0827e853315c9bbd43c1162c006dd808dbbe297db7ae66cd17b07830f0"}, - {file = "coverage-7.1.0-cp38-cp38-musllinux_1_1_aarch64.whl", hash = "sha256:e5cdbb5cafcedea04924568d990e20ce7f1945a1dd54b560f879ee2d57226912"}, - {file = "coverage-7.1.0-cp38-cp38-musllinux_1_1_i686.whl", hash = "sha256:9817733f0d3ea91bea80de0f79ef971ae94f81ca52f9b66500c6a2fea8e4b4f8"}, - {file = "coverage-7.1.0-cp38-cp38-musllinux_1_1_x86_64.whl", hash = "sha256:218fe982371ac7387304153ecd51205f14e9d731b34fb0568181abaf7b443ba0"}, - {file = "coverage-7.1.0-cp38-cp38-win32.whl", hash = "sha256:04481245ef966fbd24ae9b9e537ce899ae584d521dfbe78f89cad003c38ca2ab"}, - {file = "coverage-7.1.0-cp38-cp38-win_amd64.whl", hash = "sha256:8ae125d1134bf236acba8b83e74c603d1b30e207266121e76484562bc816344c"}, - {file = "coverage-7.1.0-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:2bf1d5f2084c3932b56b962a683074a3692bce7cabd3aa023c987a2a8e7612f6"}, - {file = "coverage-7.1.0-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:98b85dd86514d889a2e3dd22ab3c18c9d0019e696478391d86708b805f4ea0fa"}, - {file = "coverage-7.1.0-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:38da2db80cc505a611938d8624801158e409928b136c8916cd2e203970dde4dc"}, - {file = "coverage-7.1.0-cp39-cp39-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:3164d31078fa9efe406e198aecd2a02d32a62fecbdef74f76dad6a46c7e48311"}, - {file = "coverage-7.1.0-cp39-cp39-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:db61a79c07331e88b9a9974815c075fbd812bc9dbc4dc44b366b5368a2936063"}, - {file = "coverage-7.1.0-cp39-cp39-musllinux_1_1_aarch64.whl", hash = "sha256:9ccb092c9ede70b2517a57382a601619d20981f56f440eae7e4d7eaafd1d1d09"}, - {file = "coverage-7.1.0-cp39-cp39-musllinux_1_1_i686.whl", hash = "sha256:33ff26d0f6cc3ca8de13d14fde1ff8efe1456b53e3f0273e63cc8b3c84a063d8"}, - {file = "coverage-7.1.0-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:d47dd659a4ee952e90dc56c97d78132573dc5c7b09d61b416a9deef4ebe01a0c"}, - {file = "coverage-7.1.0-cp39-cp39-win32.whl", hash = "sha256:d248cd4a92065a4d4543b8331660121b31c4148dd00a691bfb7a5cdc7483cfa4"}, - {file = "coverage-7.1.0-cp39-cp39-win_amd64.whl", hash = "sha256:7ed681b0f8e8bcbbffa58ba26fcf5dbc8f79e7997595bf071ed5430d8c08d6f3"}, - {file = "coverage-7.1.0-pp37.pp38.pp39-none-any.whl", hash = "sha256:755e89e32376c850f826c425ece2c35a4fc266c081490eb0a841e7c1cb0d3bda"}, - {file = "coverage-7.1.0.tar.gz", hash = "sha256:10188fe543560ec4874f974b5305cd1a8bdcfa885ee00ea3a03733464c4ca265"}, -] - -[package.dependencies] -tomli = {version = "*", optional = true, markers = "python_full_version <= \"3.11.0a6\" and extra == \"toml\""} - -[package.extras] -toml = ["tomli"] - -[[package]] -name = "coverage-badge" -version = "1.1.0" -description = "Generate coverage badges for Coverage.py." -category = "dev" -optional = false -python-versions = "*" -files = [ - {file = "coverage-badge-1.1.0.tar.gz", hash = "sha256:c824a106503e981c02821e7d32f008fb3984b2338aa8c3800ec9357e33345b78"}, - {file = "coverage_badge-1.1.0-py2.py3-none-any.whl", hash = "sha256:e365d56e5202e923d1b237f82defd628a02d1d645a147f867ac85c58c81d7997"}, -] - -[package.dependencies] -coverage = "*" - -[[package]] -name = "darglint" -version = "1.8.1" -description = "A utility for ensuring Google-style docstrings stay up to date with the source code." -category = "dev" -optional = false -python-versions = ">=3.6,<4.0" -files = [ - {file = "darglint-1.8.1-py3-none-any.whl", hash = "sha256:5ae11c259c17b0701618a20c3da343a3eb98b3bc4b5a83d31cdd94f5ebdced8d"}, - {file = "darglint-1.8.1.tar.gz", hash = "sha256:080d5106df149b199822e7ee7deb9c012b49891538f14a11be681044f0bb20da"}, -] - -[[package]] -name = "dill" -version = "0.3.6" -description = "serialize all of python" -category = "dev" -optional = false -python-versions = ">=3.7" -files = [ - {file = "dill-0.3.6-py3-none-any.whl", hash = "sha256:a07ffd2351b8c678dfc4a856a3005f8067aea51d6ba6c700796a4d9e280f39f0"}, - {file = "dill-0.3.6.tar.gz", hash = "sha256:e5db55f3687856d8fbdab002ed78544e1c4559a130302693d839dfe8f93f2373"}, -] - -[package.extras] -graph = ["objgraph (>=1.7.2)"] - -[[package]] -name = "distlib" -version = "0.3.6" -description = "Distribution utilities" -category = "dev" -optional = false -python-versions = "*" -files = [ - {file = "distlib-0.3.6-py2.py3-none-any.whl", hash = "sha256:f35c4b692542ca110de7ef0bea44d73981caeb34ca0b9b6b2e6d7790dda8f80e"}, - {file = "distlib-0.3.6.tar.gz", hash = "sha256:14bad2d9b04d3a36127ac97f30b12a19268f211063d8f8ee4f47108896e11b46"}, -] - -[[package]] -name = "dparse" -version = "0.6.2" -description = "A parser for Python dependency files" -category = "dev" -optional = false -python-versions = ">=3.5" -files = [ - {file = "dparse-0.6.2-py3-none-any.whl", hash = "sha256:8097076f1dd26c377f30d4745e6ec18fef42f3bf493933b842ac5bafad8c345f"}, - {file = "dparse-0.6.2.tar.gz", hash = "sha256:d45255bda21f998bc7ddf2afd5e62505ba6134756ba2d42a84c56b0826614dfe"}, -] - -[package.dependencies] -packaging = "*" -toml = "*" - -[package.extras] -conda = ["pyyaml"] -pipenv = ["pipenv"] - -[[package]] -name = "exceptiongroup" -version = "1.1.0" -description = "Backport of PEP 654 (exception groups)" -category = "main" -optional = false -python-versions = ">=3.7" -files = [ - {file = "exceptiongroup-1.1.0-py3-none-any.whl", hash = "sha256:327cbda3da756e2de031a3107b81ab7b3770a602c4d16ca618298c526f4bec1e"}, - {file = "exceptiongroup-1.1.0.tar.gz", hash = "sha256:bcb67d800a4497e1b404c2dd44fca47d3b7a5e5433dbab67f96c1a685cdfdf23"}, -] - -[package.extras] -test = ["pytest (>=6)"] - -[[package]] -name = "filelock" -version = "3.9.0" -description = "A platform independent file lock." -category = "dev" -optional = false -python-versions = ">=3.7" -files = [ - {file = "filelock-3.9.0-py3-none-any.whl", hash = "sha256:f58d535af89bb9ad5cd4df046f741f8553a418c01a7856bf0d173bbc9f6bd16d"}, - {file = "filelock-3.9.0.tar.gz", hash = "sha256:7b319f24340b51f55a2bf7a12ac0755a9b03e718311dac567a0f4f7fabd2f5de"}, -] - -[package.extras] -docs = ["furo (>=2022.12.7)", "sphinx (>=5.3)", "sphinx-autodoc-typehints (>=1.19.5)"] -testing = ["covdefaults (>=2.2.2)", "coverage (>=7.0.1)", "pytest (>=7.2)", "pytest-cov (>=4)", "pytest-timeout (>=2.1)"] - -[[package]] -name = "gitdb" -version = "4.0.10" -description = "Git Object Database" -category = "dev" -optional = false -python-versions = ">=3.7" -files = [ - {file = "gitdb-4.0.10-py3-none-any.whl", hash = "sha256:c286cf298426064079ed96a9e4a9d39e7f3e9bf15ba60701e95f5492f28415c7"}, - {file = "gitdb-4.0.10.tar.gz", hash = "sha256:6eb990b69df4e15bad899ea868dc46572c3f75339735663b81de79b06f17eb9a"}, -] - -[package.dependencies] -smmap = ">=3.0.1,<6" - -[[package]] -name = "gitpython" -version = "3.1.30" -description = "GitPython is a python library used to interact with Git repositories" -category = "dev" -optional = false -python-versions = ">=3.7" -files = [ - {file = "GitPython-3.1.30-py3-none-any.whl", hash = "sha256:cd455b0000615c60e286208ba540271af9fe531fa6a87cc590a7298785ab2882"}, - {file = "GitPython-3.1.30.tar.gz", hash = "sha256:769c2d83e13f5d938b7688479da374c4e3d49f71549aaf462b646db9602ea6f8"}, -] - -[package.dependencies] -gitdb = ">=4.0.1,<5" - -[[package]] -name = "h11" -version = "0.14.0" -description = "A pure-Python, bring-your-own-I/O implementation of HTTP/1.1" -category = "main" -optional = false -python-versions = ">=3.7" -files = [ - {file = "h11-0.14.0-py3-none-any.whl", hash = "sha256:e3fe4ac4b851c468cc8363d500db52c2ead036020723024a109d37346efaa761"}, - {file = "h11-0.14.0.tar.gz", hash = "sha256:8f19fbbe99e72420ff35c00b27a34cb9937e902a8b810e2c88300c6f0a3b699d"}, -] - -[[package]] -name = "identify" -version = "2.5.17" -description = "File identification library for Python" -category = "dev" -optional = false -python-versions = ">=3.7" -files = [ - {file = "identify-2.5.17-py2.py3-none-any.whl", hash = "sha256:7d526dd1283555aafcc91539acc061d8f6f59adb0a7bba462735b0a318bff7ed"}, - {file = "identify-2.5.17.tar.gz", hash = "sha256:93cc61a861052de9d4c541a7acb7e3dcc9c11b398a2144f6e52ae5285f5f4f06"}, -] - -[package.extras] -license = ["ukkonen"] - -[[package]] -name = "idna" -version = "3.4" -description = "Internationalized Domain Names in Applications (IDNA)" -category = "main" -optional = false -python-versions = ">=3.5" -files = [ - {file = "idna-3.4-py3-none-any.whl", hash = "sha256:90b77e79eaa3eba6de819a0c442c0b4ceefc341a7a2ab77d7562bf49f425c5c2"}, - {file = "idna-3.4.tar.gz", hash = "sha256:814f528e8dead7d329833b91c5faa87d60bf71824cd12a7530b5526063d02cb4"}, -] - -[[package]] -name = "iniconfig" -version = "2.0.0" -description = "brain-dead simple config-ini parsing" -category = "dev" -optional = false -python-versions = ">=3.7" -files = [ - {file = "iniconfig-2.0.0-py3-none-any.whl", hash = "sha256:b6a85871a79d2e3b22d2d1b94ac2824226a63c6b741c88f7ae975f18b6778374"}, - {file = "iniconfig-2.0.0.tar.gz", hash = "sha256:2d91e135bf72d31a410b17c16da610a82cb55f6b0477d1a902134b24a455b8b3"}, -] - -[[package]] -name = "isort" -version = "5.12.0" -description = "A Python utility / library to sort Python imports." -category = "dev" -optional = false -python-versions = ">=3.8.0" -files = [ - {file = "isort-5.12.0-py3-none-any.whl", hash = "sha256:f84c2818376e66cf843d497486ea8fed8700b340f308f076c6fb1229dff318b6"}, - {file = "isort-5.12.0.tar.gz", hash = "sha256:8bef7dde241278824a6d83f44a544709b065191b95b6e50894bdc722fcba0504"}, -] - -[package.dependencies] -colorama = {version = ">=0.4.3", optional = true, markers = "extra == \"colors\""} - -[package.extras] -colors = ["colorama (>=0.4.3)"] -pipfile-deprecated-finder = ["pip-shims (>=0.5.2)", "pipreqs", "requirementslib"] -plugins = ["setuptools"] -requirements-deprecated-finder = ["pip-api", "pipreqs"] - -[[package]] -name = "lazy-object-proxy" -version = "1.9.0" -description = "A fast and thorough lazy object proxy." -category = "dev" -optional = false -python-versions = ">=3.7" -files = [ - {file = "lazy-object-proxy-1.9.0.tar.gz", hash = "sha256:659fb5809fa4629b8a1ac5106f669cfc7bef26fbb389dda53b3e010d1ac4ebae"}, - {file = "lazy_object_proxy-1.9.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:b40387277b0ed2d0602b8293b94d7257e17d1479e257b4de114ea11a8cb7f2d7"}, - {file = "lazy_object_proxy-1.9.0-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:e8c6cfb338b133fbdbc5cfaa10fe3c6aeea827db80c978dbd13bc9dd8526b7d4"}, - {file = "lazy_object_proxy-1.9.0-cp310-cp310-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:721532711daa7db0d8b779b0bb0318fa87af1c10d7fe5e52ef30f8eff254d0cd"}, - {file = "lazy_object_proxy-1.9.0-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:66a3de4a3ec06cd8af3f61b8e1ec67614fbb7c995d02fa224813cb7afefee701"}, - {file = "lazy_object_proxy-1.9.0-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:1aa3de4088c89a1b69f8ec0dcc169aa725b0ff017899ac568fe44ddc1396df46"}, - {file = "lazy_object_proxy-1.9.0-cp310-cp310-win32.whl", hash = "sha256:f0705c376533ed2a9e5e97aacdbfe04cecd71e0aa84c7c0595d02ef93b6e4455"}, - {file = "lazy_object_proxy-1.9.0-cp310-cp310-win_amd64.whl", hash = "sha256:ea806fd4c37bf7e7ad82537b0757999264d5f70c45468447bb2b91afdbe73a6e"}, - {file = "lazy_object_proxy-1.9.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:946d27deaff6cf8452ed0dba83ba38839a87f4f7a9732e8f9fd4107b21e6ff07"}, - {file = "lazy_object_proxy-1.9.0-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:79a31b086e7e68b24b99b23d57723ef7e2c6d81ed21007b6281ebcd1688acb0a"}, - {file = "lazy_object_proxy-1.9.0-cp311-cp311-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:f699ac1c768270c9e384e4cbd268d6e67aebcfae6cd623b4d7c3bfde5a35db59"}, - {file = "lazy_object_proxy-1.9.0-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:bfb38f9ffb53b942f2b5954e0f610f1e721ccebe9cce9025a38c8ccf4a5183a4"}, - {file = "lazy_object_proxy-1.9.0-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:189bbd5d41ae7a498397287c408617fe5c48633e7755287b21d741f7db2706a9"}, - {file = "lazy_object_proxy-1.9.0-cp311-cp311-win32.whl", hash = "sha256:81fc4d08b062b535d95c9ea70dbe8a335c45c04029878e62d744bdced5141586"}, - {file = "lazy_object_proxy-1.9.0-cp311-cp311-win_amd64.whl", hash = "sha256:f2457189d8257dd41ae9b434ba33298aec198e30adf2dcdaaa3a28b9994f6adb"}, - {file = "lazy_object_proxy-1.9.0-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:d9e25ef10a39e8afe59a5c348a4dbf29b4868ab76269f81ce1674494e2565a6e"}, - {file = "lazy_object_proxy-1.9.0-cp37-cp37m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:cbf9b082426036e19c6924a9ce90c740a9861e2bdc27a4834fd0a910742ac1e8"}, - {file = "lazy_object_proxy-1.9.0-cp37-cp37m-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:9f5fa4a61ce2438267163891961cfd5e32ec97a2c444e5b842d574251ade27d2"}, - {file = "lazy_object_proxy-1.9.0-cp37-cp37m-musllinux_1_1_aarch64.whl", hash = "sha256:8fa02eaab317b1e9e03f69aab1f91e120e7899b392c4fc19807a8278a07a97e8"}, - {file = "lazy_object_proxy-1.9.0-cp37-cp37m-musllinux_1_1_x86_64.whl", hash = "sha256:e7c21c95cae3c05c14aafffe2865bbd5e377cfc1348c4f7751d9dc9a48ca4bda"}, - {file = "lazy_object_proxy-1.9.0-cp37-cp37m-win32.whl", hash = "sha256:f12ad7126ae0c98d601a7ee504c1122bcef553d1d5e0c3bfa77b16b3968d2734"}, - {file = "lazy_object_proxy-1.9.0-cp37-cp37m-win_amd64.whl", hash = "sha256:edd20c5a55acb67c7ed471fa2b5fb66cb17f61430b7a6b9c3b4a1e40293b1671"}, - {file = "lazy_object_proxy-1.9.0-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:2d0daa332786cf3bb49e10dc6a17a52f6a8f9601b4cf5c295a4f85854d61de63"}, - {file = "lazy_object_proxy-1.9.0-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:9cd077f3d04a58e83d04b20e334f678c2b0ff9879b9375ed107d5d07ff160171"}, - {file = "lazy_object_proxy-1.9.0-cp38-cp38-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:660c94ea760b3ce47d1855a30984c78327500493d396eac4dfd8bd82041b22be"}, - {file = "lazy_object_proxy-1.9.0-cp38-cp38-musllinux_1_1_aarch64.whl", hash = "sha256:212774e4dfa851e74d393a2370871e174d7ff0ebc980907723bb67d25c8a7c30"}, - {file = "lazy_object_proxy-1.9.0-cp38-cp38-musllinux_1_1_x86_64.whl", hash = "sha256:f0117049dd1d5635bbff65444496c90e0baa48ea405125c088e93d9cf4525b11"}, - {file = "lazy_object_proxy-1.9.0-cp38-cp38-win32.whl", hash = "sha256:0a891e4e41b54fd5b8313b96399f8b0e173bbbfc03c7631f01efbe29bb0bcf82"}, - {file = "lazy_object_proxy-1.9.0-cp38-cp38-win_amd64.whl", hash = "sha256:9990d8e71b9f6488e91ad25f322898c136b008d87bf852ff65391b004da5e17b"}, - {file = "lazy_object_proxy-1.9.0-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:9e7551208b2aded9c1447453ee366f1c4070602b3d932ace044715d89666899b"}, - {file = "lazy_object_proxy-1.9.0-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:5f83ac4d83ef0ab017683d715ed356e30dd48a93746309c8f3517e1287523ef4"}, - {file = "lazy_object_proxy-1.9.0-cp39-cp39-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:7322c3d6f1766d4ef1e51a465f47955f1e8123caee67dd641e67d539a534d006"}, - {file = "lazy_object_proxy-1.9.0-cp39-cp39-musllinux_1_1_aarch64.whl", hash = "sha256:18b78ec83edbbeb69efdc0e9c1cb41a3b1b1ed11ddd8ded602464c3fc6020494"}, - {file = "lazy_object_proxy-1.9.0-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:09763491ce220c0299688940f8dc2c5d05fd1f45af1e42e636b2e8b2303e4382"}, - {file = "lazy_object_proxy-1.9.0-cp39-cp39-win32.whl", hash = "sha256:9090d8e53235aa280fc9239a86ae3ea8ac58eff66a705fa6aa2ec4968b95c821"}, - {file = "lazy_object_proxy-1.9.0-cp39-cp39-win_amd64.whl", hash = "sha256:db1c1722726f47e10e0b5fdbf15ac3b8adb58c091d12b3ab713965795036985f"}, -] - -[[package]] -name = "markdown-it-py" -version = "2.1.0" -description = "Python port of markdown-it. Markdown parsing, done right!" -category = "main" -optional = false -python-versions = ">=3.7" -files = [ - {file = "markdown-it-py-2.1.0.tar.gz", hash = "sha256:cf7e59fed14b5ae17c0006eff14a2d9a00ed5f3a846148153899a0224e2c07da"}, - {file = "markdown_it_py-2.1.0-py3-none-any.whl", hash = "sha256:93de681e5c021a432c63147656fe21790bc01231e0cd2da73626f1aa3ac0fe27"}, -] - -[package.dependencies] -mdurl = ">=0.1,<1.0" - -[package.extras] -benchmarking = ["psutil", "pytest", "pytest-benchmark (>=3.2,<4.0)"] -code-style = ["pre-commit (==2.6)"] -compare = ["commonmark (>=0.9.1,<0.10.0)", "markdown (>=3.3.6,<3.4.0)", "mistletoe (>=0.8.1,<0.9.0)", "mistune (>=2.0.2,<2.1.0)", "panflute (>=2.1.3,<2.2.0)"] -linkify = ["linkify-it-py (>=1.0,<2.0)"] -plugins = ["mdit-py-plugins"] -profiling = ["gprof2dot"] -rtd = ["attrs", "myst-parser", "pyyaml", "sphinx", "sphinx-copybutton", "sphinx-design", "sphinx_book_theme"] -testing = ["coverage", "pytest", "pytest-cov", "pytest-regressions"] - -[[package]] -name = "markdownify" -version = "0.11.6" -description = "Convert HTML to markdown." -category = "main" -optional = false -python-versions = "*" -files = [ - {file = "markdownify-0.11.6-py3-none-any.whl", hash = "sha256:ba35fe289d5e9073bcd7d2cad629278fe25f1a93741fcdc0bfb4f009076d8324"}, - {file = "markdownify-0.11.6.tar.gz", hash = "sha256:009b240e0c9f4c8eaf1d085625dcd4011e12f0f8cec55dedf9ea6f7655e49bfe"}, -] - -[package.dependencies] -beautifulsoup4 = ">=4.9,<5" -six = ">=1.15,<2" - -[[package]] -name = "mccabe" -version = "0.7.0" -description = "McCabe checker, plugin for flake8" -category = "dev" -optional = false -python-versions = ">=3.6" -files = [ - {file = "mccabe-0.7.0-py2.py3-none-any.whl", hash = "sha256:6c2d30ab6be0e4a46919781807b4f0d834ebdd6c6e3dca0bda5a15f863427b6e"}, - {file = "mccabe-0.7.0.tar.gz", hash = "sha256:348e0240c33b60bbdf4e523192ef919f28cb2c3d7d5c7794f74009290f236325"}, -] - -[[package]] -name = "mdurl" -version = "0.1.2" -description = "Markdown URL utilities" -category = "main" -optional = false -python-versions = ">=3.7" -files = [ - {file = "mdurl-0.1.2-py3-none-any.whl", hash = "sha256:84008a41e51615a49fc9966191ff91509e3c40b939176e643fd50a5c2196b8f8"}, - {file = "mdurl-0.1.2.tar.gz", hash = "sha256:bb413d29f5eea38f31dd4754dd7377d4465116fb207585f97bf925588687c1ba"}, -] - -[[package]] -name = "mypy" -version = "0.991" -description = "Optional static typing for Python" -category = "dev" -optional = false -python-versions = ">=3.7" -files = [ - {file = "mypy-0.991-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:7d17e0a9707d0772f4a7b878f04b4fd11f6f5bcb9b3813975a9b13c9332153ab"}, - {file = "mypy-0.991-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:0714258640194d75677e86c786e80ccf294972cc76885d3ebbb560f11db0003d"}, - {file = "mypy-0.991-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:0c8f3be99e8a8bd403caa8c03be619544bc2c77a7093685dcf308c6b109426c6"}, - {file = "mypy-0.991-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:bc9ec663ed6c8f15f4ae9d3c04c989b744436c16d26580eaa760ae9dd5d662eb"}, - {file = "mypy-0.991-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:4307270436fd7694b41f913eb09210faff27ea4979ecbcd849e57d2da2f65305"}, - {file = "mypy-0.991-cp310-cp310-win_amd64.whl", hash = "sha256:901c2c269c616e6cb0998b33d4adbb4a6af0ac4ce5cd078afd7bc95830e62c1c"}, - {file = "mypy-0.991-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:d13674f3fb73805ba0c45eb6c0c3053d218aa1f7abead6e446d474529aafc372"}, - {file = "mypy-0.991-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:1c8cd4fb70e8584ca1ed5805cbc7c017a3d1a29fb450621089ffed3e99d1857f"}, - {file = "mypy-0.991-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:209ee89fbb0deed518605edddd234af80506aec932ad28d73c08f1400ef80a33"}, - {file = "mypy-0.991-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:37bd02ebf9d10e05b00d71302d2c2e6ca333e6c2a8584a98c00e038db8121f05"}, - {file = "mypy-0.991-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:26efb2fcc6b67e4d5a55561f39176821d2adf88f2745ddc72751b7890f3194ad"}, - {file = "mypy-0.991-cp311-cp311-win_amd64.whl", hash = "sha256:3a700330b567114b673cf8ee7388e949f843b356a73b5ab22dd7cff4742a5297"}, - {file = "mypy-0.991-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:1f7d1a520373e2272b10796c3ff721ea1a0712288cafaa95931e66aa15798813"}, - {file = "mypy-0.991-cp37-cp37m-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:641411733b127c3e0dab94c45af15fea99e4468f99ac88b39efb1ad677da5711"}, - {file = "mypy-0.991-cp37-cp37m-musllinux_1_1_x86_64.whl", hash = "sha256:3d80e36b7d7a9259b740be6d8d906221789b0d836201af4234093cae89ced0cd"}, - {file = "mypy-0.991-cp37-cp37m-win_amd64.whl", hash = "sha256:e62ebaad93be3ad1a828a11e90f0e76f15449371ffeecca4a0a0b9adc99abcef"}, - {file = "mypy-0.991-cp38-cp38-macosx_10_9_universal2.whl", hash = "sha256:b86ce2c1866a748c0f6faca5232059f881cda6dda2a893b9a8373353cfe3715a"}, - {file = "mypy-0.991-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:ac6e503823143464538efda0e8e356d871557ef60ccd38f8824a4257acc18d93"}, - {file = "mypy-0.991-cp38-cp38-macosx_11_0_arm64.whl", hash = "sha256:0cca5adf694af539aeaa6ac633a7afe9bbd760df9d31be55ab780b77ab5ae8bf"}, - {file = "mypy-0.991-cp38-cp38-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:a12c56bf73cdab116df96e4ff39610b92a348cc99a1307e1da3c3768bbb5b135"}, - {file = "mypy-0.991-cp38-cp38-musllinux_1_1_x86_64.whl", hash = "sha256:652b651d42f155033a1967739788c436491b577b6a44e4c39fb340d0ee7f0d70"}, - {file = "mypy-0.991-cp38-cp38-win_amd64.whl", hash = "sha256:4175593dc25d9da12f7de8de873a33f9b2b8bdb4e827a7cae952e5b1a342e243"}, - {file = "mypy-0.991-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:98e781cd35c0acf33eb0295e8b9c55cdbef64fcb35f6d3aa2186f289bed6e80d"}, - {file = "mypy-0.991-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:6d7464bac72a85cb3491c7e92b5b62f3dcccb8af26826257760a552a5e244aa5"}, - {file = "mypy-0.991-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:c9166b3f81a10cdf9b49f2d594b21b31adadb3d5e9db9b834866c3258b695be3"}, - {file = "mypy-0.991-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:b8472f736a5bfb159a5e36740847808f6f5b659960115ff29c7cecec1741c648"}, - {file = "mypy-0.991-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:5e80e758243b97b618cdf22004beb09e8a2de1af481382e4d84bc52152d1c476"}, - {file = "mypy-0.991-cp39-cp39-win_amd64.whl", hash = "sha256:74e259b5c19f70d35fcc1ad3d56499065c601dfe94ff67ae48b85596b9ec1461"}, - {file = "mypy-0.991-py3-none-any.whl", hash = "sha256:de32edc9b0a7e67c2775e574cb061a537660e51210fbf6006b0b36ea695ae9bb"}, - {file = "mypy-0.991.tar.gz", hash = "sha256:3c0165ba8f354a6d9881809ef29f1a9318a236a6d81c690094c5df32107bde06"}, -] - -[package.dependencies] -mypy-extensions = ">=0.4.3" -tomli = {version = ">=1.1.0", markers = "python_version < \"3.11\""} -typing-extensions = ">=3.10" - -[package.extras] -dmypy = ["psutil (>=4.0)"] -install-types = ["pip"] -python2 = ["typed-ast (>=1.4.0,<2)"] -reports = ["lxml"] - -[[package]] -name = "mypy-extensions" -version = "1.0.0" -description = "Type system extensions for programs checked with the mypy type checker." -category = "dev" -optional = false -python-versions = ">=3.5" -files = [ - {file = "mypy_extensions-1.0.0-py3-none-any.whl", hash = "sha256:4392f6c0eb8a5668a69e23d168ffa70f0be9ccfd32b5cc2d26a34ae5b844552d"}, - {file = "mypy_extensions-1.0.0.tar.gz", hash = "sha256:75dbf8955dc00442a438fc4d0666508a9a97b6bd41aa2f0ffe9d2f2725af0782"}, -] - -[[package]] -name = "nodeenv" -version = "1.7.0" -description = "Node.js virtual environment builder" -category = "dev" -optional = false -python-versions = ">=2.7,!=3.0.*,!=3.1.*,!=3.2.*,!=3.3.*,!=3.4.*,!=3.5.*,!=3.6.*" -files = [ - {file = "nodeenv-1.7.0-py2.py3-none-any.whl", hash = "sha256:27083a7b96a25f2f5e1d8cb4b6317ee8aeda3bdd121394e5ac54e498028a042e"}, - {file = "nodeenv-1.7.0.tar.gz", hash = "sha256:e0e7f7dfb85fc5394c6fe1e8fa98131a2473e04311a45afb6508f7cf1836fa2b"}, -] - -[package.dependencies] -setuptools = "*" - -[[package]] -name = "outcome" -version = "1.2.0" -description = "Capture the outcome of Python function calls." -category = "main" -optional = false -python-versions = ">=3.7" -files = [ - {file = "outcome-1.2.0-py2.py3-none-any.whl", hash = "sha256:c4ab89a56575d6d38a05aa16daeaa333109c1f96167aba8901ab18b6b5e0f7f5"}, - {file = "outcome-1.2.0.tar.gz", hash = "sha256:6f82bd3de45da303cf1f771ecafa1633750a358436a8bb60e06a1ceb745d2672"}, -] - -[package.dependencies] -attrs = ">=19.2.0" - -[[package]] -name = "packaging" -version = "21.3" -description = "Core utilities for Python packages" -category = "dev" -optional = false -python-versions = ">=3.6" -files = [ - {file = "packaging-21.3-py3-none-any.whl", hash = "sha256:ef103e05f519cdc783ae24ea4e2e0f508a9c99b2d4969652eed6a2e1ea5bd522"}, - {file = "packaging-21.3.tar.gz", hash = "sha256:dd47c42927d89ab911e606518907cc2d3a1f38bbd026385970643f9c5b8ecfeb"}, -] - -[package.dependencies] -pyparsing = ">=2.0.2,<3.0.5 || >3.0.5" - -[[package]] -name = "pathspec" -version = "0.11.0" -description = "Utility library for gitignore style pattern matching of file paths." -category = "dev" -optional = false -python-versions = ">=3.7" -files = [ - {file = "pathspec-0.11.0-py3-none-any.whl", hash = "sha256:3a66eb970cbac598f9e5ccb5b2cf58930cd8e3ed86d393d541eaf2d8b1705229"}, - {file = "pathspec-0.11.0.tar.gz", hash = "sha256:64d338d4e0914e91c1792321e6907b5a593f1ab1851de7fc269557a21b30ebbc"}, -] - -[[package]] -name = "pbr" -version = "5.11.1" -description = "Python Build Reasonableness" -category = "dev" -optional = false -python-versions = ">=2.6" -files = [ - {file = "pbr-5.11.1-py2.py3-none-any.whl", hash = "sha256:567f09558bae2b3ab53cb3c1e2e33e726ff3338e7bae3db5dc954b3a44eef12b"}, - {file = "pbr-5.11.1.tar.gz", hash = "sha256:aefc51675b0b533d56bb5fd1c8c6c0522fe31896679882e1c4c63d5e4a0fccb3"}, -] - -[[package]] -name = "pillow" -version = "9.4.0" -description = "Python Imaging Library (Fork)" -category = "main" -optional = false -python-versions = ">=3.7" -files = [ - {file = "Pillow-9.4.0-1-cp310-cp310-macosx_10_10_x86_64.whl", hash = "sha256:1b4b4e9dda4f4e4c4e6896f93e84a8f0bcca3b059de9ddf67dac3c334b1195e1"}, - {file = "Pillow-9.4.0-1-cp311-cp311-macosx_10_10_x86_64.whl", hash = "sha256:fb5c1ad6bad98c57482236a21bf985ab0ef42bd51f7ad4e4538e89a997624e12"}, - {file = "Pillow-9.4.0-1-cp37-cp37m-macosx_10_10_x86_64.whl", hash = "sha256:f0caf4a5dcf610d96c3bd32932bfac8aee61c96e60481c2a0ea58da435e25acd"}, - {file = "Pillow-9.4.0-1-cp38-cp38-macosx_10_10_x86_64.whl", hash = "sha256:3f4cc516e0b264c8d4ccd6b6cbc69a07c6d582d8337df79be1e15a5056b258c9"}, - {file = "Pillow-9.4.0-1-cp39-cp39-macosx_10_10_x86_64.whl", hash = "sha256:b8c2f6eb0df979ee99433d8b3f6d193d9590f735cf12274c108bd954e30ca858"}, - {file = "Pillow-9.4.0-1-pp38-pypy38_pp73-macosx_10_10_x86_64.whl", hash = "sha256:b70756ec9417c34e097f987b4d8c510975216ad26ba6e57ccb53bc758f490dab"}, - {file = "Pillow-9.4.0-1-pp39-pypy39_pp73-macosx_10_10_x86_64.whl", hash = "sha256:43521ce2c4b865d385e78579a082b6ad1166ebed2b1a2293c3be1d68dd7ca3b9"}, - {file = "Pillow-9.4.0-2-cp310-cp310-macosx_10_10_x86_64.whl", hash = "sha256:9d9a62576b68cd90f7075876f4e8444487db5eeea0e4df3ba298ee38a8d067b0"}, - {file = "Pillow-9.4.0-2-cp311-cp311-macosx_10_10_x86_64.whl", hash = "sha256:87708d78a14d56a990fbf4f9cb350b7d89ee8988705e58e39bdf4d82c149210f"}, - {file = "Pillow-9.4.0-2-cp37-cp37m-macosx_10_10_x86_64.whl", hash = "sha256:8a2b5874d17e72dfb80d917213abd55d7e1ed2479f38f001f264f7ce7bae757c"}, - {file = "Pillow-9.4.0-2-cp38-cp38-macosx_10_10_x86_64.whl", hash = "sha256:83125753a60cfc8c412de5896d10a0a405e0bd88d0470ad82e0869ddf0cb3848"}, - {file = "Pillow-9.4.0-2-cp39-cp39-macosx_10_10_x86_64.whl", hash = "sha256:9e5f94742033898bfe84c93c831a6f552bb629448d4072dd312306bab3bd96f1"}, - {file = "Pillow-9.4.0-2-pp38-pypy38_pp73-macosx_10_10_x86_64.whl", hash = "sha256:013016af6b3a12a2f40b704677f8b51f72cb007dac785a9933d5c86a72a7fe33"}, - {file = "Pillow-9.4.0-2-pp39-pypy39_pp73-macosx_10_10_x86_64.whl", hash = "sha256:99d92d148dd03fd19d16175b6d355cc1b01faf80dae93c6c3eb4163709edc0a9"}, - {file = "Pillow-9.4.0-cp310-cp310-macosx_10_10_x86_64.whl", hash = "sha256:2968c58feca624bb6c8502f9564dd187d0e1389964898f5e9e1fbc8533169157"}, - {file = "Pillow-9.4.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:c5c1362c14aee73f50143d74389b2c158707b4abce2cb055b7ad37ce60738d47"}, - {file = "Pillow-9.4.0-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:bd752c5ff1b4a870b7661234694f24b1d2b9076b8bf337321a814c612665f343"}, - {file = "Pillow-9.4.0-cp310-cp310-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:9a3049a10261d7f2b6514d35bbb7a4dfc3ece4c4de14ef5876c4b7a23a0e566d"}, - {file = "Pillow-9.4.0-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:16a8df99701f9095bea8a6c4b3197da105df6f74e6176c5b410bc2df2fd29a57"}, - {file = "Pillow-9.4.0-cp310-cp310-manylinux_2_28_aarch64.whl", hash = "sha256:94cdff45173b1919350601f82d61365e792895e3c3a3443cf99819e6fbf717a5"}, - {file = "Pillow-9.4.0-cp310-cp310-manylinux_2_28_x86_64.whl", hash = "sha256:ed3e4b4e1e6de75fdc16d3259098de7c6571b1a6cc863b1a49e7d3d53e036070"}, - {file = "Pillow-9.4.0-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:d5b2f8a31bd43e0f18172d8ac82347c8f37ef3e0b414431157718aa234991b28"}, - {file = "Pillow-9.4.0-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:09b89ddc95c248ee788328528e6a2996e09eaccddeeb82a5356e92645733be35"}, - {file = "Pillow-9.4.0-cp310-cp310-win32.whl", hash = "sha256:f09598b416ba39a8f489c124447b007fe865f786a89dbfa48bb5cf395693132a"}, - {file = "Pillow-9.4.0-cp310-cp310-win_amd64.whl", hash = "sha256:f6e78171be3fb7941f9910ea15b4b14ec27725865a73c15277bc39f5ca4f8391"}, - {file = "Pillow-9.4.0-cp311-cp311-macosx_10_10_x86_64.whl", hash = "sha256:3fa1284762aacca6dc97474ee9c16f83990b8eeb6697f2ba17140d54b453e133"}, - {file = "Pillow-9.4.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:eaef5d2de3c7e9b21f1e762f289d17b726c2239a42b11e25446abf82b26ac132"}, - {file = "Pillow-9.4.0-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:a4dfdae195335abb4e89cc9762b2edc524f3c6e80d647a9a81bf81e17e3fb6f0"}, - {file = "Pillow-9.4.0-cp311-cp311-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:6abfb51a82e919e3933eb137e17c4ae9c0475a25508ea88993bb59faf82f3b35"}, - {file = "Pillow-9.4.0-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:451f10ef963918e65b8869e17d67db5e2f4ab40e716ee6ce7129b0cde2876eab"}, - {file = "Pillow-9.4.0-cp311-cp311-manylinux_2_28_aarch64.whl", hash = "sha256:6663977496d616b618b6cfa43ec86e479ee62b942e1da76a2c3daa1c75933ef4"}, - {file = "Pillow-9.4.0-cp311-cp311-manylinux_2_28_x86_64.whl", hash = "sha256:60e7da3a3ad1812c128750fc1bc14a7ceeb8d29f77e0a2356a8fb2aa8925287d"}, - {file = "Pillow-9.4.0-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:19005a8e58b7c1796bc0167862b1f54a64d3b44ee5d48152b06bb861458bc0f8"}, - {file = "Pillow-9.4.0-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:f715c32e774a60a337b2bb8ad9839b4abf75b267a0f18806f6f4f5f1688c4b5a"}, - {file = "Pillow-9.4.0-cp311-cp311-win32.whl", hash = "sha256:b222090c455d6d1a64e6b7bb5f4035c4dff479e22455c9eaa1bdd4c75b52c80c"}, - {file = "Pillow-9.4.0-cp311-cp311-win_amd64.whl", hash = "sha256:ba6612b6548220ff5e9df85261bddc811a057b0b465a1226b39bfb8550616aee"}, - {file = "Pillow-9.4.0-cp37-cp37m-macosx_10_10_x86_64.whl", hash = "sha256:5f532a2ad4d174eb73494e7397988e22bf427f91acc8e6ebf5bb10597b49c493"}, - {file = "Pillow-9.4.0-cp37-cp37m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:5dd5a9c3091a0f414a963d427f920368e2b6a4c2f7527fdd82cde8ef0bc7a327"}, - {file = "Pillow-9.4.0-cp37-cp37m-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:ef21af928e807f10bf4141cad4746eee692a0dd3ff56cfb25fce076ec3cc8abe"}, - {file = "Pillow-9.4.0-cp37-cp37m-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:847b114580c5cc9ebaf216dd8c8dbc6b00a3b7ab0131e173d7120e6deade1f57"}, - {file = "Pillow-9.4.0-cp37-cp37m-manylinux_2_28_aarch64.whl", hash = "sha256:653d7fb2df65efefbcbf81ef5fe5e5be931f1ee4332c2893ca638c9b11a409c4"}, - {file = "Pillow-9.4.0-cp37-cp37m-manylinux_2_28_x86_64.whl", hash = "sha256:46f39cab8bbf4a384ba7cb0bc8bae7b7062b6a11cfac1ca4bc144dea90d4a9f5"}, - {file = "Pillow-9.4.0-cp37-cp37m-win32.whl", hash = "sha256:7ac7594397698f77bce84382929747130765f66406dc2cd8b4ab4da68ade4c6e"}, - {file = "Pillow-9.4.0-cp37-cp37m-win_amd64.whl", hash = "sha256:46c259e87199041583658457372a183636ae8cd56dbf3f0755e0f376a7f9d0e6"}, - {file = "Pillow-9.4.0-cp38-cp38-macosx_10_10_x86_64.whl", hash = "sha256:0e51f608da093e5d9038c592b5b575cadc12fd748af1479b5e858045fff955a9"}, - {file = "Pillow-9.4.0-cp38-cp38-macosx_11_0_arm64.whl", hash = "sha256:765cb54c0b8724a7c12c55146ae4647e0274a839fb6de7bcba841e04298e1011"}, - {file = "Pillow-9.4.0-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:519e14e2c49fcf7616d6d2cfc5c70adae95682ae20f0395e9280db85e8d6c4df"}, - {file = "Pillow-9.4.0-cp38-cp38-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:d197df5489004db87d90b918033edbeee0bd6df3848a204bca3ff0a903bef837"}, - {file = "Pillow-9.4.0-cp38-cp38-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0845adc64fe9886db00f5ab68c4a8cd933ab749a87747555cec1c95acea64b0b"}, - {file = "Pillow-9.4.0-cp38-cp38-manylinux_2_28_aarch64.whl", hash = "sha256:e1339790c083c5a4de48f688b4841f18df839eb3c9584a770cbd818b33e26d5d"}, - {file = "Pillow-9.4.0-cp38-cp38-manylinux_2_28_x86_64.whl", hash = "sha256:a96e6e23f2b79433390273eaf8cc94fec9c6370842e577ab10dabdcc7ea0a66b"}, - {file = "Pillow-9.4.0-cp38-cp38-musllinux_1_1_aarch64.whl", hash = "sha256:7cfc287da09f9d2a7ec146ee4d72d6ea1342e770d975e49a8621bf54eaa8f30f"}, - {file = "Pillow-9.4.0-cp38-cp38-musllinux_1_1_x86_64.whl", hash = "sha256:d7081c084ceb58278dd3cf81f836bc818978c0ccc770cbbb202125ddabec6628"}, - {file = "Pillow-9.4.0-cp38-cp38-win32.whl", hash = "sha256:df41112ccce5d47770a0c13651479fbcd8793f34232a2dd9faeccb75eb5d0d0d"}, - {file = "Pillow-9.4.0-cp38-cp38-win_amd64.whl", hash = "sha256:7a21222644ab69ddd9967cfe6f2bb420b460dae4289c9d40ff9a4896e7c35c9a"}, - {file = "Pillow-9.4.0-cp39-cp39-macosx_10_10_x86_64.whl", hash = "sha256:0f3269304c1a7ce82f1759c12ce731ef9b6e95b6df829dccd9fe42912cc48569"}, - {file = "Pillow-9.4.0-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:cb362e3b0976dc994857391b776ddaa8c13c28a16f80ac6522c23d5257156bed"}, - {file = "Pillow-9.4.0-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:a2e0f87144fcbbe54297cae708c5e7f9da21a4646523456b00cc956bd4c65815"}, - {file = "Pillow-9.4.0-cp39-cp39-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:28676836c7796805914b76b1837a40f76827ee0d5398f72f7dcc634bae7c6264"}, - {file = "Pillow-9.4.0-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0884ba7b515163a1a05440a138adeb722b8a6ae2c2b33aea93ea3118dd3a899e"}, - {file = "Pillow-9.4.0-cp39-cp39-manylinux_2_28_aarch64.whl", hash = "sha256:53dcb50fbdc3fb2c55431a9b30caeb2f7027fcd2aeb501459464f0214200a503"}, - {file = "Pillow-9.4.0-cp39-cp39-manylinux_2_28_x86_64.whl", hash = "sha256:e8c5cf126889a4de385c02a2c3d3aba4b00f70234bfddae82a5eaa3ee6d5e3e6"}, - {file = "Pillow-9.4.0-cp39-cp39-musllinux_1_1_aarch64.whl", hash = "sha256:6c6b1389ed66cdd174d040105123a5a1bc91d0aa7059c7261d20e583b6d8cbd2"}, - {file = "Pillow-9.4.0-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:0dd4c681b82214b36273c18ca7ee87065a50e013112eea7d78c7a1b89a739153"}, - {file = "Pillow-9.4.0-cp39-cp39-win32.whl", hash = "sha256:6d9dfb9959a3b0039ee06c1a1a90dc23bac3b430842dcb97908ddde05870601c"}, - {file = "Pillow-9.4.0-cp39-cp39-win_amd64.whl", hash = "sha256:54614444887e0d3043557d9dbc697dbb16cfb5a35d672b7a0fcc1ed0cf1c600b"}, - {file = "Pillow-9.4.0-pp38-pypy38_pp73-macosx_10_10_x86_64.whl", hash = "sha256:b9b752ab91e78234941e44abdecc07f1f0d8f51fb62941d32995b8161f68cfe5"}, - {file = "Pillow-9.4.0-pp38-pypy38_pp73-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:d3b56206244dc8711f7e8b7d6cad4663917cd5b2d950799425076681e8766286"}, - {file = "Pillow-9.4.0-pp38-pypy38_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:aabdab8ec1e7ca7f1434d042bf8b1e92056245fb179790dc97ed040361f16bfd"}, - {file = "Pillow-9.4.0-pp38-pypy38_pp73-manylinux_2_28_x86_64.whl", hash = "sha256:db74f5562c09953b2c5f8ec4b7dfd3f5421f31811e97d1dbc0a7c93d6e3a24df"}, - {file = "Pillow-9.4.0-pp38-pypy38_pp73-win_amd64.whl", hash = "sha256:e9d7747847c53a16a729b6ee5e737cf170f7a16611c143d95aa60a109a59c336"}, - {file = "Pillow-9.4.0-pp39-pypy39_pp73-macosx_10_10_x86_64.whl", hash = "sha256:b52ff4f4e002f828ea6483faf4c4e8deea8d743cf801b74910243c58acc6eda3"}, - {file = "Pillow-9.4.0-pp39-pypy39_pp73-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:575d8912dca808edd9acd6f7795199332696d3469665ef26163cd090fa1f8bfa"}, - {file = "Pillow-9.4.0-pp39-pypy39_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c3c4ed2ff6760e98d262e0cc9c9a7f7b8a9f61aa4d47c58835cdaf7b0b8811bb"}, - {file = "Pillow-9.4.0-pp39-pypy39_pp73-manylinux_2_28_x86_64.whl", hash = "sha256:e621b0246192d3b9cb1dc62c78cfa4c6f6d2ddc0ec207d43c0dedecb914f152a"}, - {file = "Pillow-9.4.0-pp39-pypy39_pp73-win_amd64.whl", hash = "sha256:8f127e7b028900421cad64f51f75c051b628db17fb00e099eb148761eed598c9"}, - {file = "Pillow-9.4.0.tar.gz", hash = "sha256:a1c2d7780448eb93fbcc3789bf3916aa5720d942e37945f4056680317f1cd23e"}, -] - -[package.extras] -docs = ["furo", "olefile", "sphinx (>=2.4)", "sphinx-copybutton", "sphinx-inline-tabs", "sphinx-issues (>=3.0.1)", "sphinx-removed-in", "sphinxext-opengraph"] -tests = ["check-manifest", "coverage", "defusedxml", "markdown2", "olefile", "packaging", "pyroma", "pytest", "pytest-cov", "pytest-timeout"] - -[[package]] -name = "platformdirs" -version = "2.6.2" -description = "A small Python package for determining appropriate platform-specific dirs, e.g. a \"user data dir\"." -category = "dev" -optional = false -python-versions = ">=3.7" -files = [ - {file = "platformdirs-2.6.2-py3-none-any.whl", hash = "sha256:83c8f6d04389165de7c9b6f0c682439697887bca0aa2f1c87ef1826be3584490"}, - {file = "platformdirs-2.6.2.tar.gz", hash = "sha256:e1fea1fe471b9ff8332e229df3cb7de4f53eeea4998d3b6bfff542115e998bd2"}, -] - -[package.extras] -docs = ["furo (>=2022.12.7)", "proselint (>=0.13)", "sphinx (>=5.3)", "sphinx-autodoc-typehints (>=1.19.5)"] -test = ["appdirs (==1.4.4)", "covdefaults (>=2.2.2)", "pytest (>=7.2)", "pytest-cov (>=4)", "pytest-mock (>=3.10)"] - -[[package]] -name = "pluggy" -version = "1.0.0" -description = "plugin and hook calling mechanisms for python" -category = "dev" -optional = false -python-versions = ">=3.6" -files = [ - {file = "pluggy-1.0.0-py2.py3-none-any.whl", hash = "sha256:74134bbf457f031a36d68416e1509f34bd5ccc019f0bcc952c7b909d06b37bd3"}, - {file = "pluggy-1.0.0.tar.gz", hash = "sha256:4224373bacce55f955a878bf9cfa763c1e360858e330072059e10bad68531159"}, -] - -[package.extras] -dev = ["pre-commit", "tox"] -testing = ["pytest", "pytest-benchmark"] - -[[package]] -name = "pre-commit" -version = "3.0.3" -description = "A framework for managing and maintaining multi-language pre-commit hooks." -category = "dev" -optional = false -python-versions = ">=3.8" -files = [ - {file = "pre_commit-3.0.3-py2.py3-none-any.whl", hash = "sha256:83e2e8cc5cbb3691cff9474494816918d865120768aa36c9eda6185126667d21"}, - {file = "pre_commit-3.0.3.tar.gz", hash = "sha256:4187e74fda38f0f700256fb2f757774385503b04292047d0899fc913207f314b"}, -] - -[package.dependencies] -cfgv = ">=2.0.0" -identify = ">=1.0.0" -nodeenv = ">=0.11.1" -pyyaml = ">=5.1" -virtualenv = ">=20.10.0" - -[[package]] -name = "py" -version = "1.11.0" -description = "library with cross-python path, ini-parsing, io, code, log facilities" -category = "dev" -optional = false -python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*, !=3.4.*" -files = [ - {file = "py-1.11.0-py2.py3-none-any.whl", hash = "sha256:607c53218732647dff4acdfcd50cb62615cedf612e72d1724fb1a0cc6405b378"}, - {file = "py-1.11.0.tar.gz", hash = "sha256:51c75c4126074b472f746a24399ad32f6053d1b34b68d2fa41e558e6f4a98719"}, -] - -[[package]] -name = "pycparser" -version = "2.21" -description = "C parser in Python" -category = "main" -optional = false -python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*" -files = [ - {file = "pycparser-2.21-py2.py3-none-any.whl", hash = "sha256:8ee45429555515e1f6b185e78100aea234072576aa43ab53aefcae078162fca9"}, - {file = "pycparser-2.21.tar.gz", hash = "sha256:e644fdec12f7872f86c58ff790da456218b10f863970249516d60a5eaca77206"}, -] - -[[package]] -name = "pydocstyle" -version = "6.3.0" -description = "Python docstring style checker" -category = "dev" -optional = false -python-versions = ">=3.6" -files = [ - {file = "pydocstyle-6.3.0-py3-none-any.whl", hash = "sha256:118762d452a49d6b05e194ef344a55822987a462831ade91ec5c06fd2169d019"}, - {file = "pydocstyle-6.3.0.tar.gz", hash = "sha256:7ce43f0c0ac87b07494eb9c0b462c0b73e6ff276807f204d6b53edc72b7e44e1"}, -] - -[package.dependencies] -snowballstemmer = ">=2.2.0" - -[package.extras] -toml = ["tomli (>=1.2.3)"] - -[[package]] -name = "pygments" -version = "2.14.0" -description = "Pygments is a syntax highlighting package written in Python." -category = "main" -optional = false -python-versions = ">=3.6" -files = [ - {file = "Pygments-2.14.0-py3-none-any.whl", hash = "sha256:fa7bd7bd2771287c0de303af8bfdfc731f51bd2c6a47ab69d117138893b82717"}, - {file = "Pygments-2.14.0.tar.gz", hash = "sha256:b3ed06a9e8ac9a9aae5a6f5dbe78a8a58655d17b43b93c078f094ddc476ae297"}, -] - -[package.extras] -plugins = ["importlib-metadata"] - -[[package]] -name = "pylint" -version = "2.16.1" -description = "python code static checker" -category = "dev" -optional = false -python-versions = ">=3.7.2" -files = [ - {file = "pylint-2.16.1-py3-none-any.whl", hash = "sha256:bad9d7c36037f6043a1e848a43004dfd5ea5ceb05815d713ba56ca4503a9fe37"}, - {file = "pylint-2.16.1.tar.gz", hash = "sha256:ffe7fa536bb38ba35006a7c8a6d2efbfdd3d95bbf21199cad31f76b1c50aaf30"}, -] - -[package.dependencies] -astroid = ">=2.14.1,<=2.16.0-dev0" -colorama = {version = ">=0.4.5", markers = "sys_platform == \"win32\""} -dill = [ - {version = ">=0.2", markers = "python_version < \"3.11\""}, - {version = ">=0.3.6", markers = "python_version >= \"3.11\""}, -] -isort = ">=4.2.5,<6" -mccabe = ">=0.6,<0.8" -platformdirs = ">=2.2.0" -tomli = {version = ">=1.1.0", markers = "python_version < \"3.11\""} -tomlkit = ">=0.10.1" -typing-extensions = {version = ">=3.10.0", markers = "python_version < \"3.10\""} - -[package.extras] -spelling = ["pyenchant (>=3.2,<4.0)"] -testutils = ["gitpython (>3)"] - -[[package]] -name = "pyparsing" -version = "3.0.9" -description = "pyparsing module - Classes and methods to define and execute parsing grammars" -category = "main" -optional = false -python-versions = ">=3.6.8" -files = [ - {file = "pyparsing-3.0.9-py3-none-any.whl", hash = "sha256:5026bae9a10eeaefb61dab2f09052b9f4307d44aee4eda64b309723d8d206bbc"}, - {file = "pyparsing-3.0.9.tar.gz", hash = "sha256:2b020ecf7d21b687f219b71ecad3631f644a47f01403fa1d1036b0c6416d70fb"}, -] - -[package.extras] -diagrams = ["jinja2", "railroad-diagrams"] - -[[package]] -name = "pysocks" -version = "1.7.1" -description = "A Python SOCKS client module. See https://github.com/Anorov/PySocks for more information." -category = "main" -optional = false -python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*" -files = [ - {file = "PySocks-1.7.1-py27-none-any.whl", hash = "sha256:08e69f092cc6dbe92a0fdd16eeb9b9ffbc13cadfe5ca4c7bd92ffb078b293299"}, - {file = "PySocks-1.7.1-py3-none-any.whl", hash = "sha256:2725bd0a9925919b9b51739eea5f9e2bae91e83288108a9ad338b2e3a4435ee5"}, - {file = "PySocks-1.7.1.tar.gz", hash = "sha256:3f8804571ebe159c380ac6de37643bb4685970655d3bba243530d6558b799aa0"}, -] - -[[package]] -name = "pytest" -version = "7.2.1" -description = "pytest: simple powerful testing with Python" -category = "dev" -optional = false -python-versions = ">=3.7" -files = [ - {file = "pytest-7.2.1-py3-none-any.whl", hash = "sha256:c7c6ca206e93355074ae32f7403e8ea12163b1163c976fee7d4d84027c162be5"}, - {file = "pytest-7.2.1.tar.gz", hash = "sha256:d45e0952f3727241918b8fd0f376f5ff6b301cc0777c6f9a556935c92d8a7d42"}, -] - -[package.dependencies] -attrs = ">=19.2.0" -colorama = {version = "*", markers = "sys_platform == \"win32\""} -exceptiongroup = {version = ">=1.0.0rc8", markers = "python_version < \"3.11\""} -iniconfig = "*" -packaging = "*" -pluggy = ">=0.12,<2.0" -tomli = {version = ">=1.0.0", markers = "python_version < \"3.11\""} - -[package.extras] -testing = ["argcomplete", "hypothesis (>=3.56)", "mock", "nose", "pygments (>=2.7.2)", "requests", "xmlschema"] - -[[package]] -name = "pytest-cov" -version = "4.0.0" -description = "Pytest plugin for measuring coverage." -category = "dev" -optional = false -python-versions = ">=3.6" -files = [ - {file = "pytest-cov-4.0.0.tar.gz", hash = "sha256:996b79efde6433cdbd0088872dbc5fb3ed7fe1578b68cdbba634f14bb8dd0470"}, - {file = "pytest_cov-4.0.0-py3-none-any.whl", hash = "sha256:2feb1b751d66a8bd934e5edfa2e961d11309dc37b73b0eabe73b5945fee20f6b"}, -] - -[package.dependencies] -coverage = {version = ">=5.2.1", extras = ["toml"]} -pytest = ">=4.6" - -[package.extras] -testing = ["fields", "hunter", "process-tests", "pytest-xdist", "six", "virtualenv"] - -[[package]] -name = "pytest-html" -version = "3.2.0" -description = "pytest plugin for generating HTML reports" -category = "dev" -optional = false -python-versions = ">=3.6" -files = [ - {file = "pytest-html-3.2.0.tar.gz", hash = "sha256:c4e2f4bb0bffc437f51ad2174a8a3e71df81bbc2f6894604e604af18fbe687c3"}, - {file = "pytest_html-3.2.0-py3-none-any.whl", hash = "sha256:868c08564a68d8b2c26866f1e33178419bb35b1e127c33784a28622eb827f3f3"}, -] - -[package.dependencies] -py = ">=1.8.2" -pytest = ">=5.0,<6.0.0 || >6.0.0" -pytest-metadata = "*" - -[[package]] -name = "pytest-metadata" -version = "2.0.4" -description = "pytest plugin for test session metadata" -category = "dev" -optional = false -python-versions = ">=3.7,<4.0" -files = [ - {file = "pytest_metadata-2.0.4-py3-none-any.whl", hash = "sha256:acb739f89fabb3d798c099e9e0c035003062367a441910aaaf2281bc1972ee14"}, - {file = "pytest_metadata-2.0.4.tar.gz", hash = "sha256:fcc653f65fe3035b478820b5284fbf0f52803622ee3f60a2faed7a7d3ba1f41e"}, -] - -[package.dependencies] -pytest = ">=3.0.0,<8.0.0" - -[[package]] -name = "pyupgrade" -version = "3.3.1" -description = "A tool to automatically upgrade syntax for newer versions." -category = "dev" -optional = false -python-versions = ">=3.7" -files = [ - {file = "pyupgrade-3.3.1-py2.py3-none-any.whl", hash = "sha256:3b93641963df022d605c78aeae4b5956a5296ea24701eafaef9c487527b77e60"}, - {file = "pyupgrade-3.3.1.tar.gz", hash = "sha256:f88bce38b0ba92c2a9a5063c8629e456e8d919b67d2d42c7ecab82ff196f9813"}, -] - -[package.dependencies] -tokenize-rt = ">=3.2.0" - -[[package]] -name = "pyvirtualdisplay" -version = "3.0" -description = "python wrapper for Xvfb, Xephyr and Xvnc" -category = "main" -optional = false -python-versions = "*" -files = [ - {file = "PyVirtualDisplay-3.0-py3-none-any.whl", hash = "sha256:40d4b8dfe4b8de8552e28eb367647f311f88a130bf837fe910e7f180d5477f0e"}, - {file = "PyVirtualDisplay-3.0.tar.gz", hash = "sha256:09755bc3ceb6eb725fb07eca5425f43f2358d3bf08e00d2a9b792a1aedd16159"}, -] - -[[package]] -name = "pyyaml" -version = "6.0" -description = "YAML parser and emitter for Python" -category = "dev" -optional = false -python-versions = ">=3.6" -files = [ - {file = "PyYAML-6.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:d4db7c7aef085872ef65a8fd7d6d09a14ae91f691dec3e87ee5ee0539d516f53"}, - {file = "PyYAML-6.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:9df7ed3b3d2e0ecfe09e14741b857df43adb5a3ddadc919a2d94fbdf78fea53c"}, - {file = "PyYAML-6.0-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:77f396e6ef4c73fdc33a9157446466f1cff553d979bd00ecb64385760c6babdc"}, - {file = "PyYAML-6.0-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:a80a78046a72361de73f8f395f1f1e49f956c6be882eed58505a15f3e430962b"}, - {file = "PyYAML-6.0-cp310-cp310-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_12_x86_64.manylinux2010_x86_64.whl", hash = "sha256:f84fbc98b019fef2ee9a1cb3ce93e3187a6df0b2538a651bfb890254ba9f90b5"}, - {file = "PyYAML-6.0-cp310-cp310-win32.whl", hash = "sha256:2cd5df3de48857ed0544b34e2d40e9fac445930039f3cfe4bcc592a1f836d513"}, - {file = "PyYAML-6.0-cp310-cp310-win_amd64.whl", hash = "sha256:daf496c58a8c52083df09b80c860005194014c3698698d1a57cbcfa182142a3a"}, - {file = "PyYAML-6.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:d4b0ba9512519522b118090257be113b9468d804b19d63c71dbcf4a48fa32358"}, - {file = "PyYAML-6.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:81957921f441d50af23654aa6c5e5eaf9b06aba7f0a19c18a538dc7ef291c5a1"}, - {file = "PyYAML-6.0-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:afa17f5bc4d1b10afd4466fd3a44dc0e245382deca5b3c353d8b757f9e3ecb8d"}, - {file = "PyYAML-6.0-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:dbad0e9d368bb989f4515da330b88a057617d16b6a8245084f1b05400f24609f"}, - {file = "PyYAML-6.0-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:432557aa2c09802be39460360ddffd48156e30721f5e8d917f01d31694216782"}, - {file = "PyYAML-6.0-cp311-cp311-win32.whl", hash = "sha256:bfaef573a63ba8923503d27530362590ff4f576c626d86a9fed95822a8255fd7"}, - {file = "PyYAML-6.0-cp311-cp311-win_amd64.whl", hash = "sha256:01b45c0191e6d66c470b6cf1b9531a771a83c1c4208272ead47a3ae4f2f603bf"}, - {file = "PyYAML-6.0-cp36-cp36m-macosx_10_9_x86_64.whl", hash = "sha256:897b80890765f037df3403d22bab41627ca8811ae55e9a722fd0392850ec4d86"}, - {file = "PyYAML-6.0-cp36-cp36m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:50602afada6d6cbfad699b0c7bb50d5ccffa7e46a3d738092afddc1f9758427f"}, - {file = "PyYAML-6.0-cp36-cp36m-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:48c346915c114f5fdb3ead70312bd042a953a8ce5c7106d5bfb1a5254e47da92"}, - {file = "PyYAML-6.0-cp36-cp36m-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_12_x86_64.manylinux2010_x86_64.whl", hash = "sha256:98c4d36e99714e55cfbaaee6dd5badbc9a1ec339ebfc3b1f52e293aee6bb71a4"}, - {file = "PyYAML-6.0-cp36-cp36m-win32.whl", hash = "sha256:0283c35a6a9fbf047493e3a0ce8d79ef5030852c51e9d911a27badfde0605293"}, - {file = "PyYAML-6.0-cp36-cp36m-win_amd64.whl", hash = "sha256:07751360502caac1c067a8132d150cf3d61339af5691fe9e87803040dbc5db57"}, - {file = "PyYAML-6.0-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:819b3830a1543db06c4d4b865e70ded25be52a2e0631ccd2f6a47a2822f2fd7c"}, - {file = "PyYAML-6.0-cp37-cp37m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:473f9edb243cb1935ab5a084eb238d842fb8f404ed2193a915d1784b5a6b5fc0"}, - {file = "PyYAML-6.0-cp37-cp37m-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:0ce82d761c532fe4ec3f87fc45688bdd3a4c1dc5e0b4a19814b9009a29baefd4"}, - {file = "PyYAML-6.0-cp37-cp37m-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_12_x86_64.manylinux2010_x86_64.whl", hash = "sha256:231710d57adfd809ef5d34183b8ed1eeae3f76459c18fb4a0b373ad56bedcdd9"}, - {file = "PyYAML-6.0-cp37-cp37m-win32.whl", hash = "sha256:c5687b8d43cf58545ade1fe3e055f70eac7a5a1a0bf42824308d868289a95737"}, - {file = "PyYAML-6.0-cp37-cp37m-win_amd64.whl", hash = "sha256:d15a181d1ecd0d4270dc32edb46f7cb7733c7c508857278d3d378d14d606db2d"}, - {file = "PyYAML-6.0-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:0b4624f379dab24d3725ffde76559cff63d9ec94e1736b556dacdfebe5ab6d4b"}, - {file = "PyYAML-6.0-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:213c60cd50106436cc818accf5baa1aba61c0189ff610f64f4a3e8c6726218ba"}, - {file = "PyYAML-6.0-cp38-cp38-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:9fa600030013c4de8165339db93d182b9431076eb98eb40ee068700c9c813e34"}, - {file = "PyYAML-6.0-cp38-cp38-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_12_x86_64.manylinux2010_x86_64.whl", hash = "sha256:277a0ef2981ca40581a47093e9e2d13b3f1fbbeffae064c1d21bfceba2030287"}, - {file = "PyYAML-6.0-cp38-cp38-win32.whl", hash = "sha256:d4eccecf9adf6fbcc6861a38015c2a64f38b9d94838ac1810a9023a0609e1b78"}, - {file = "PyYAML-6.0-cp38-cp38-win_amd64.whl", hash = "sha256:1e4747bc279b4f613a09eb64bba2ba602d8a6664c6ce6396a4d0cd413a50ce07"}, - {file = "PyYAML-6.0-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:055d937d65826939cb044fc8c9b08889e8c743fdc6a32b33e2390f66013e449b"}, - {file = "PyYAML-6.0-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:e61ceaab6f49fb8bdfaa0f92c4b57bcfbea54c09277b1b4f7ac376bfb7a7c174"}, - {file = "PyYAML-6.0-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d67d839ede4ed1b28a4e8909735fc992a923cdb84e618544973d7dfc71540803"}, - {file = "PyYAML-6.0-cp39-cp39-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:cba8c411ef271aa037d7357a2bc8f9ee8b58b9965831d9e51baf703280dc73d3"}, - {file = "PyYAML-6.0-cp39-cp39-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_12_x86_64.manylinux2010_x86_64.whl", hash = "sha256:40527857252b61eacd1d9af500c3337ba8deb8fc298940291486c465c8b46ec0"}, - {file = "PyYAML-6.0-cp39-cp39-win32.whl", hash = "sha256:b5b9eccad747aabaaffbc6064800670f0c297e52c12754eb1d976c57e4f74dcb"}, - {file = "PyYAML-6.0-cp39-cp39-win_amd64.whl", hash = "sha256:b3d267842bf12586ba6c734f89d1f5b871df0273157918b0ccefa29deb05c21c"}, - {file = "PyYAML-6.0.tar.gz", hash = "sha256:68fb519c14306fec9720a2a5b45bc9f0c8d1b9c72adf45c37baedfcd949c35a2"}, -] - -[[package]] -name = "ratelimit" -version = "2.2.1" -description = "API rate limit decorator" -category = "main" -optional = false -python-versions = "*" -files = [ - {file = "ratelimit-2.2.1.tar.gz", hash = "sha256:af8a9b64b821529aca09ebaf6d8d279100d766f19e90b5059ac6a718ca6dee42"}, -] - -[[package]] -name = "requests" -version = "2.28.2" -description = "Python HTTP for Humans." -category = "main" -optional = false -python-versions = ">=3.7, <4" -files = [ - {file = "requests-2.28.2-py3-none-any.whl", hash = "sha256:64299f4909223da747622c030b781c0d7811e359c37124b4bd368fb8c6518baa"}, - {file = "requests-2.28.2.tar.gz", hash = "sha256:98b1b2782e3c6c4904938b84c0eb932721069dfdb9134313beff7c83c2df24bf"}, -] - -[package.dependencies] -certifi = ">=2017.4.17" -charset-normalizer = ">=2,<4" -idna = ">=2.5,<4" -urllib3 = ">=1.21.1,<1.27" - -[package.extras] -socks = ["PySocks (>=1.5.6,!=1.5.7)"] -use-chardet-on-py3 = ["chardet (>=3.0.2,<6)"] - -[[package]] -name = "requests-toolbelt" -version = "0.10.1" -description = "A utility belt for advanced users of python-requests" -category = "main" -optional = false -python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*" -files = [ - {file = "requests-toolbelt-0.10.1.tar.gz", hash = "sha256:62e09f7ff5ccbda92772a29f394a49c3ad6cb181d568b1337626b2abb628a63d"}, - {file = "requests_toolbelt-0.10.1-py2.py3-none-any.whl", hash = "sha256:18565aa58116d9951ac39baa288d3adb5b3ff975c4f25eee78555d89e8f247f7"}, -] - -[package.dependencies] -requests = ">=2.0.1,<3.0.0" - -[[package]] -name = "rich" -version = "13.3.1" -description = "Render rich text, tables, progress bars, syntax highlighting, markdown and more to the terminal" -category = "main" -optional = false -python-versions = ">=3.7.0" -files = [ - {file = "rich-13.3.1-py3-none-any.whl", hash = "sha256:8aa57747f3fc3e977684f0176a88e789be314a99f99b43b75d1e9cb5dc6db9e9"}, - {file = "rich-13.3.1.tar.gz", hash = "sha256:125d96d20c92b946b983d0d392b84ff945461e5a06d3867e9f9e575f8697b67f"}, -] - -[package.dependencies] -markdown-it-py = ">=2.1.0,<3.0.0" -pygments = ">=2.14.0,<3.0.0" -typing-extensions = {version = ">=4.0.0,<5.0", markers = "python_version < \"3.9\""} - -[package.extras] -jupyter = ["ipywidgets (>=7.5.1,<9)"] - -[[package]] -name = "ruamel.yaml" -version = "0.17.21" -description = "ruamel.yaml is a YAML parser/emitter that supports roundtrip preservation of comments, seq/map flow style, and map key order" -category = "dev" -optional = false -python-versions = ">=3" -files = [ - {file = "ruamel.yaml-0.17.21-py3-none-any.whl", hash = "sha256:742b35d3d665023981bd6d16b3d24248ce5df75fdb4e2924e93a05c1f8b61ca7"}, - {file = "ruamel.yaml-0.17.21.tar.gz", hash = "sha256:8b7ce697a2f212752a35c1ac414471dc16c424c9573be4926b56ff3f5d23b7af"}, -] - -[package.dependencies] -"ruamel.yaml.clib" = {version = ">=0.2.6", markers = "platform_python_implementation == \"CPython\" and python_version < \"3.11\""} - -[package.extras] -docs = ["ryd"] -jinja2 = ["ruamel.yaml.jinja2 (>=0.2)"] - -[[package]] -name = "ruamel.yaml.clib" -version = "0.2.7" -description = "C version of reader, parser and emitter for ruamel.yaml derived from libyaml" -category = "dev" -optional = false -python-versions = ">=3.5" -files = [ - {file = "ruamel.yaml.clib-0.2.7-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:d5859983f26d8cd7bb5c287ef452e8aacc86501487634573d260968f753e1d71"}, - {file = "ruamel.yaml.clib-0.2.7-cp310-cp310-macosx_12_0_arm64.whl", hash = "sha256:debc87a9516b237d0466a711b18b6ebeb17ba9f391eb7f91c649c5c4ec5006c7"}, - {file = "ruamel.yaml.clib-0.2.7-cp310-cp310-manylinux2014_aarch64.whl", hash = "sha256:df5828871e6648db72d1c19b4bd24819b80a755c4541d3409f0f7acd0f335c80"}, - {file = "ruamel.yaml.clib-0.2.7-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_24_x86_64.whl", hash = "sha256:efa08d63ef03d079dcae1dfe334f6c8847ba8b645d08df286358b1f5293d24ab"}, - {file = "ruamel.yaml.clib-0.2.7-cp310-cp310-win32.whl", hash = "sha256:763d65baa3b952479c4e972669f679fe490eee058d5aa85da483ebae2009d231"}, - {file = "ruamel.yaml.clib-0.2.7-cp310-cp310-win_amd64.whl", hash = "sha256:d000f258cf42fec2b1bbf2863c61d7b8918d31ffee905da62dede869254d3b8a"}, - {file = "ruamel.yaml.clib-0.2.7-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:045e0626baf1c52e5527bd5db361bc83180faaba2ff586e763d3d5982a876a9e"}, - {file = "ruamel.yaml.clib-0.2.7-cp311-cp311-macosx_12_6_arm64.whl", hash = "sha256:721bc4ba4525f53f6a611ec0967bdcee61b31df5a56801281027a3a6d1c2daf5"}, - {file = "ruamel.yaml.clib-0.2.7-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_24_x86_64.whl", hash = "sha256:41d0f1fa4c6830176eef5b276af04c89320ea616655d01327d5ce65e50575c94"}, - {file = "ruamel.yaml.clib-0.2.7-cp36-cp36m-macosx_10_9_x86_64.whl", hash = "sha256:4b3a93bb9bc662fc1f99c5c3ea8e623d8b23ad22f861eb6fce9377ac07ad6072"}, - {file = "ruamel.yaml.clib-0.2.7-cp36-cp36m-macosx_12_0_arm64.whl", hash = "sha256:a234a20ae07e8469da311e182e70ef6b199d0fbeb6c6cc2901204dd87fb867e8"}, - {file = "ruamel.yaml.clib-0.2.7-cp36-cp36m-manylinux2014_aarch64.whl", hash = "sha256:15910ef4f3e537eea7fe45f8a5d19997479940d9196f357152a09031c5be59f3"}, - {file = "ruamel.yaml.clib-0.2.7-cp36-cp36m-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_24_x86_64.whl", hash = "sha256:370445fd795706fd291ab00c9df38a0caed0f17a6fb46b0f607668ecb16ce763"}, - {file = "ruamel.yaml.clib-0.2.7-cp36-cp36m-win32.whl", hash = "sha256:ecdf1a604009bd35c674b9225a8fa609e0282d9b896c03dd441a91e5f53b534e"}, - {file = "ruamel.yaml.clib-0.2.7-cp36-cp36m-win_amd64.whl", hash = "sha256:f34019dced51047d6f70cb9383b2ae2853b7fc4dce65129a5acd49f4f9256646"}, - {file = "ruamel.yaml.clib-0.2.7-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:2aa261c29a5545adfef9296b7e33941f46aa5bbd21164228e833412af4c9c75f"}, - {file = "ruamel.yaml.clib-0.2.7-cp37-cp37m-macosx_12_0_arm64.whl", hash = "sha256:f01da5790e95815eb5a8a138508c01c758e5f5bc0ce4286c4f7028b8dd7ac3d0"}, - {file = "ruamel.yaml.clib-0.2.7-cp37-cp37m-manylinux2014_aarch64.whl", hash = "sha256:40d030e2329ce5286d6b231b8726959ebbe0404c92f0a578c0e2482182e38282"}, - {file = "ruamel.yaml.clib-0.2.7-cp37-cp37m-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_24_x86_64.whl", hash = "sha256:c3ca1fbba4ae962521e5eb66d72998b51f0f4d0f608d3c0347a48e1af262efa7"}, - {file = "ruamel.yaml.clib-0.2.7-cp37-cp37m-win32.whl", hash = "sha256:7bdb4c06b063f6fd55e472e201317a3bb6cdeeee5d5a38512ea5c01e1acbdd93"}, - {file = "ruamel.yaml.clib-0.2.7-cp37-cp37m-win_amd64.whl", hash = "sha256:be2a7ad8fd8f7442b24323d24ba0b56c51219513cfa45b9ada3b87b76c374d4b"}, - {file = "ruamel.yaml.clib-0.2.7-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:91a789b4aa0097b78c93e3dc4b40040ba55bef518f84a40d4442f713b4094acb"}, - {file = "ruamel.yaml.clib-0.2.7-cp38-cp38-macosx_12_0_arm64.whl", hash = "sha256:99e77daab5d13a48a4054803d052ff40780278240a902b880dd37a51ba01a307"}, - {file = "ruamel.yaml.clib-0.2.7-cp38-cp38-manylinux2014_aarch64.whl", hash = "sha256:3243f48ecd450eddadc2d11b5feb08aca941b5cd98c9b1db14b2fd128be8c697"}, - {file = "ruamel.yaml.clib-0.2.7-cp38-cp38-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_24_x86_64.whl", hash = "sha256:8831a2cedcd0f0927f788c5bdf6567d9dc9cc235646a434986a852af1cb54b4b"}, - {file = "ruamel.yaml.clib-0.2.7-cp38-cp38-win32.whl", hash = "sha256:3110a99e0f94a4a3470ff67fc20d3f96c25b13d24c6980ff841e82bafe827cac"}, - {file = "ruamel.yaml.clib-0.2.7-cp38-cp38-win_amd64.whl", hash = "sha256:92460ce908546ab69770b2e576e4f99fbb4ce6ab4b245345a3869a0a0410488f"}, - {file = "ruamel.yaml.clib-0.2.7-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:5bc0667c1eb8f83a3752b71b9c4ba55ef7c7058ae57022dd9b29065186a113d9"}, - {file = "ruamel.yaml.clib-0.2.7-cp39-cp39-macosx_12_0_arm64.whl", hash = "sha256:4a4d8d417868d68b979076a9be6a38c676eca060785abaa6709c7b31593c35d1"}, - {file = "ruamel.yaml.clib-0.2.7-cp39-cp39-manylinux2014_aarch64.whl", hash = "sha256:bf9a6bc4a0221538b1a7de3ed7bca4c93c02346853f44e1cd764be0023cd3640"}, - {file = "ruamel.yaml.clib-0.2.7-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_24_x86_64.whl", hash = "sha256:a7b301ff08055d73223058b5c46c55638917f04d21577c95e00e0c4d79201a6b"}, - {file = "ruamel.yaml.clib-0.2.7-cp39-cp39-win32.whl", hash = "sha256:d5e51e2901ec2366b79f16c2299a03e74ba4531ddcfacc1416639c557aef0ad8"}, - {file = "ruamel.yaml.clib-0.2.7-cp39-cp39-win_amd64.whl", hash = "sha256:184faeaec61dbaa3cace407cffc5819f7b977e75360e8d5ca19461cd851a5fc5"}, - {file = "ruamel.yaml.clib-0.2.7.tar.gz", hash = "sha256:1f08fd5a2bea9c4180db71678e850b995d2a5f4537be0e94557668cf0f5f9497"}, -] - -[[package]] -name = "safety" -version = "2.3.5" -description = "Checks installed dependencies for known vulnerabilities and licenses." -category = "dev" -optional = false -python-versions = "*" -files = [ - {file = "safety-2.3.5-py3-none-any.whl", hash = "sha256:2227fcac1b22b53c1615af78872b48348661691450aa25d6704a5504dbd1f7e2"}, - {file = "safety-2.3.5.tar.gz", hash = "sha256:a60c11f8952f412cbb165d70cb1f673a3b43a2ba9a93ce11f97e6a4de834aa3a"}, -] - -[package.dependencies] -Click = ">=8.0.2" -dparse = ">=0.6.2" -packaging = ">=21.0,<22.0" -requests = "*" -"ruamel.yaml" = ">=0.17.21" -setuptools = ">=19.3" - -[package.extras] -github = ["jinja2 (>=3.1.0)", "pygithub (>=1.43.3)"] -gitlab = ["python-gitlab (>=1.3.0)"] - -[[package]] -name = "selenium" -version = "4.8.0" -description = "" -category = "main" -optional = false -python-versions = ">=3.7" -files = [ - {file = "selenium-4.8.0-py3-none-any.whl", hash = "sha256:20f28ee4ea9b273b4112a7df5276ebb3052f79ff6eff42a564db6143e5926683"}, - {file = "selenium-4.8.0.tar.gz", hash = "sha256:fee36724d6cf0b18c73781bb8ec7be4a35ab1e2564e64e64e64da75e50e052af"}, -] - -[package.dependencies] -certifi = ">=2021.10.8" -trio = ">=0.17,<1.0" -trio-websocket = ">=0.9,<1.0" -urllib3 = {version = ">=1.26,<2.0", extras = ["socks"]} - -[[package]] -name = "setuptools" -version = "67.1.0" -description = "Easily download, build, install, upgrade, and uninstall Python packages" -category = "dev" -optional = false -python-versions = ">=3.7" -files = [ - {file = "setuptools-67.1.0-py3-none-any.whl", hash = "sha256:a7687c12b444eaac951ea87a9627c4f904ac757e7abdc5aac32833234af90378"}, - {file = "setuptools-67.1.0.tar.gz", hash = "sha256:e261cdf010c11a41cb5cb5f1bf3338a7433832029f559a6a7614bd42a967c300"}, -] - -[package.extras] -docs = ["furo", "jaraco.packaging (>=9)", "jaraco.tidelift (>=1.4)", "pygments-github-lexers (==0.0.5)", "rst.linker (>=1.9)", "sphinx (>=3.5)", "sphinx-favicon", "sphinx-hoverxref (<2)", "sphinx-inline-tabs", "sphinx-lint", "sphinx-notfound-page (==0.8.3)", "sphinx-reredirects", "sphinxcontrib-towncrier"] -testing = ["build[virtualenv]", "filelock (>=3.4.0)", "flake8 (<5)", "flake8-2020", "ini2toml[lite] (>=0.9)", "jaraco.envs (>=2.2)", "jaraco.path (>=3.2.0)", "pip (>=19.1)", "pip-run (>=8.8)", "pytest (>=6)", "pytest-black (>=0.3.7)", "pytest-checkdocs (>=2.4)", "pytest-cov", "pytest-enabler (>=1.3)", "pytest-flake8", "pytest-mypy (>=0.9.1)", "pytest-perf", "pytest-timeout", "pytest-xdist", "tomli-w (>=1.0.0)", "virtualenv (>=13.0.0)", "wheel"] -testing-integration = ["build[virtualenv]", "filelock (>=3.4.0)", "jaraco.envs (>=2.2)", "jaraco.path (>=3.2.0)", "pytest", "pytest-enabler", "pytest-xdist", "tomli", "virtualenv (>=13.0.0)", "wheel"] - -[[package]] -name = "shellingham" -version = "1.5.0.post1" -description = "Tool to Detect Surrounding Shell" -category = "main" -optional = false -python-versions = ">=3.7" -files = [ - {file = "shellingham-1.5.0.post1-py2.py3-none-any.whl", hash = "sha256:368bf8c00754fd4f55afb7bbb86e272df77e4dc76ac29dbcbb81a59e9fc15744"}, - {file = "shellingham-1.5.0.post1.tar.gz", hash = "sha256:823bc5fb5c34d60f285b624e7264f4dda254bc803a3774a147bf99c0e3004a28"}, -] - -[[package]] -name = "six" -version = "1.16.0" -description = "Python 2 and 3 compatibility utilities" -category = "main" -optional = false -python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*" -files = [ - {file = "six-1.16.0-py2.py3-none-any.whl", hash = "sha256:8abb2f1d86890a2dfb989f9a77cfcfd3e47c2a354b01111771326f8aa26e0254"}, - {file = "six-1.16.0.tar.gz", hash = "sha256:1e61c37477a1626458e36f7b1d82aa5c9b094fa4802892072e49de9c60c4c926"}, -] - -[[package]] -name = "smmap" -version = "5.0.0" -description = "A pure Python implementation of a sliding window memory map manager" -category = "dev" -optional = false -python-versions = ">=3.6" -files = [ - {file = "smmap-5.0.0-py3-none-any.whl", hash = "sha256:2aba19d6a040e78d8b09de5c57e96207b09ed71d8e55ce0959eeee6c8e190d94"}, - {file = "smmap-5.0.0.tar.gz", hash = "sha256:c840e62059cd3be204b0c9c9f74be2c09d5648eddd4580d9314c3ecde0b30936"}, -] - -[[package]] -name = "sniffio" -version = "1.3.0" -description = "Sniff out which async library your code is running under" -category = "main" -optional = false -python-versions = ">=3.7" -files = [ - {file = "sniffio-1.3.0-py3-none-any.whl", hash = "sha256:eecefdce1e5bbfb7ad2eeaabf7c1eeb404d7757c379bd1f7e5cce9d8bf425384"}, - {file = "sniffio-1.3.0.tar.gz", hash = "sha256:e60305c5e5d314f5389259b7f22aaa33d8f7dee49763119234af3755c55b9101"}, -] - -[[package]] -name = "snowballstemmer" -version = "2.2.0" -description = "This package provides 29 stemmers for 28 languages generated from Snowball algorithms." -category = "dev" -optional = false -python-versions = "*" -files = [ - {file = "snowballstemmer-2.2.0-py2.py3-none-any.whl", hash = "sha256:c8e1716e83cc398ae16824e5572ae04e0d9fc2c6b985fb0f900f5f0c96ecba1a"}, - {file = "snowballstemmer-2.2.0.tar.gz", hash = "sha256:09b16deb8547d3412ad7b590689584cd0fe25ec8db3be37788be3810cbf19cb1"}, -] - -[[package]] -name = "sortedcontainers" -version = "2.4.0" -description = "Sorted Containers -- Sorted List, Sorted Dict, Sorted Set" -category = "main" -optional = false -python-versions = "*" -files = [ - {file = "sortedcontainers-2.4.0-py2.py3-none-any.whl", hash = "sha256:a163dcaede0f1c021485e957a39245190e74249897e2ae4b2aa38595db237ee0"}, - {file = "sortedcontainers-2.4.0.tar.gz", hash = "sha256:25caa5a06cc30b6b83d11423433f65d1f9d76c4c6a0c90e3379eaa43b9bfdb88"}, -] - -[[package]] -name = "soupsieve" -version = "2.3.2.post1" -description = "A modern CSS selector implementation for Beautiful Soup." -category = "main" -optional = false -python-versions = ">=3.6" -files = [ - {file = "soupsieve-2.3.2.post1-py3-none-any.whl", hash = "sha256:3b2503d3c7084a42b1ebd08116e5f81aadfaea95863628c80a3b774a11b7c759"}, - {file = "soupsieve-2.3.2.post1.tar.gz", hash = "sha256:fc53893b3da2c33de295667a0e19f078c14bf86544af307354de5fcf12a3f30d"}, -] - -[[package]] -name = "stevedore" -version = "4.1.1" -description = "Manage dynamic plugins for Python applications" -category = "dev" -optional = false -python-versions = ">=3.8" -files = [ - {file = "stevedore-4.1.1-py3-none-any.whl", hash = "sha256:aa6436565c069b2946fe4ebff07f5041e0c8bf18c7376dd29edf80cf7d524e4e"}, - {file = "stevedore-4.1.1.tar.gz", hash = "sha256:7f8aeb6e3f90f96832c301bff21a7eb5eefbe894c88c506483d355565d88cc1a"}, -] - -[package.dependencies] -pbr = ">=2.0.0,<2.1.0 || >2.1.0" - -[[package]] -name = "tokenize-rt" -version = "5.0.0" -description = "A wrapper around the stdlib `tokenize` which roundtrips." -category = "dev" -optional = false -python-versions = ">=3.7" -files = [ - {file = "tokenize_rt-5.0.0-py2.py3-none-any.whl", hash = "sha256:c67772c662c6b3dc65edf66808577968fb10badfc2042e3027196bed4daf9e5a"}, - {file = "tokenize_rt-5.0.0.tar.gz", hash = "sha256:3160bc0c3e8491312d0485171dea861fc160a240f5f5766b72a1165408d10740"}, -] - -[[package]] -name = "toml" -version = "0.10.2" -description = "Python Library for Tom's Obvious, Minimal Language" -category = "dev" -optional = false -python-versions = ">=2.6, !=3.0.*, !=3.1.*, !=3.2.*" -files = [ - {file = "toml-0.10.2-py2.py3-none-any.whl", hash = "sha256:806143ae5bfb6a3c6e736a764057db0e6a0e05e338b5630894a5f779cabb4f9b"}, - {file = "toml-0.10.2.tar.gz", hash = "sha256:b3bda1d108d5dd99f4a20d24d9c348e91c4db7ab1b749200bded2f839ccbe68f"}, -] - -[[package]] -name = "tomli" -version = "2.0.1" -description = "A lil' TOML parser" -category = "dev" -optional = false -python-versions = ">=3.7" -files = [ - {file = "tomli-2.0.1-py3-none-any.whl", hash = "sha256:939de3e7a6161af0c887ef91b7d41a53e7c5a1ca976325f429cb46ea9bc30ecc"}, - {file = "tomli-2.0.1.tar.gz", hash = "sha256:de526c12914f0c550d15924c62d72abc48d6fe7364aa87328337a31007fe8a4f"}, -] - -[[package]] -name = "tomlkit" -version = "0.11.6" -description = "Style preserving TOML library" -category = "dev" -optional = false -python-versions = ">=3.6" -files = [ - {file = "tomlkit-0.11.6-py3-none-any.whl", hash = "sha256:07de26b0d8cfc18f871aec595fda24d95b08fef89d147caa861939f37230bf4b"}, - {file = "tomlkit-0.11.6.tar.gz", hash = "sha256:71b952e5721688937fb02cf9d354dbcf0785066149d2855e44531ebdd2b65d73"}, -] - -[[package]] -name = "trio" -version = "0.22.0" -description = "A friendly Python library for async concurrency and I/O" -category = "main" -optional = false -python-versions = ">=3.7" -files = [ - {file = "trio-0.22.0-py3-none-any.whl", hash = "sha256:f1dd0780a89bfc880c7c7994519cb53f62aacb2c25ff487001c0052bd721cdf0"}, - {file = "trio-0.22.0.tar.gz", hash = "sha256:ce68f1c5400a47b137c5a4de72c7c901bd4e7a24fbdebfe9b41de8c6c04eaacf"}, -] - -[package.dependencies] -async-generator = ">=1.9" -attrs = ">=19.2.0" -cffi = {version = ">=1.14", markers = "os_name == \"nt\" and implementation_name != \"pypy\""} -exceptiongroup = {version = ">=1.0.0rc9", markers = "python_version < \"3.11\""} -idna = "*" -outcome = "*" -sniffio = "*" -sortedcontainers = "*" - -[[package]] -name = "trio-websocket" -version = "0.9.2" -description = "WebSocket library for Trio" -category = "main" -optional = false -python-versions = ">=3.5" -files = [ - {file = "trio-websocket-0.9.2.tar.gz", hash = "sha256:a3d34de8fac26023eee701ed1e7bf4da9a8326b61a62934ec9e53b64970fd8fe"}, - {file = "trio_websocket-0.9.2-py3-none-any.whl", hash = "sha256:5b558f6e83cc20a37c3b61202476c5295d1addf57bd65543364e0337e37ed2bc"}, -] - -[package.dependencies] -async-generator = ">=1.10" -trio = ">=0.11" -wsproto = ">=0.14" - -[[package]] -name = "typer" -version = "0.4.2" -description = "Typer, build great CLIs. Easy to code. Based on Python type hints." -category = "main" -optional = false -python-versions = ">=3.6" -files = [ - {file = "typer-0.4.2-py3-none-any.whl", hash = "sha256:023bae00d1baf358a6cc7cea45851639360bb716de687b42b0a4641cd99173f1"}, - {file = "typer-0.4.2.tar.gz", hash = "sha256:b8261c6c0152dd73478b5ba96ba677e5d6948c715c310f7c91079f311f62ec03"}, -] - -[package.dependencies] -click = ">=7.1.1,<9.0.0" -colorama = {version = ">=0.4.3,<0.5.0", optional = true, markers = "extra == \"all\""} -shellingham = {version = ">=1.3.0,<2.0.0", optional = true, markers = "extra == \"all\""} - -[package.extras] -all = ["colorama (>=0.4.3,<0.5.0)", "shellingham (>=1.3.0,<2.0.0)"] -dev = ["autoflake (>=1.3.1,<2.0.0)", "flake8 (>=3.8.3,<4.0.0)", "pre-commit (>=2.17.0,<3.0.0)"] -doc = ["mdx-include (>=1.4.1,<2.0.0)", "mkdocs (>=1.1.2,<2.0.0)", "mkdocs-material (>=8.1.4,<9.0.0)"] -test = ["black (>=22.3.0,<23.0.0)", "coverage (>=5.2,<6.0)", "isort (>=5.0.6,<6.0.0)", "mypy (==0.910)", "pytest (>=4.4.0,<5.4.0)", "pytest-cov (>=2.10.0,<3.0.0)", "pytest-sugar (>=0.9.4,<0.10.0)", "pytest-xdist (>=1.32.0,<2.0.0)", "shellingham (>=1.3.0,<2.0.0)"] - -[[package]] -name = "typing-extensions" -version = "4.4.0" -description = "Backported and Experimental Type Hints for Python 3.7+" -category = "main" -optional = false -python-versions = ">=3.7" -files = [ - {file = "typing_extensions-4.4.0-py3-none-any.whl", hash = "sha256:16fa4864408f655d35ec496218b85f79b3437c829e93320c7c9215ccfd92489e"}, - {file = "typing_extensions-4.4.0.tar.gz", hash = "sha256:1511434bb92bf8dd198c12b1cc812e800d4181cfcb867674e0f8279cc93087aa"}, -] - -[[package]] -name = "undetected-chromedriver" -version = "3.2.1" -description = "('Selenium.webdriver.Chrome replacement with compatiblity for Brave, and other Chromium based browsers.', 'Not triggered by CloudFlare/Imperva/hCaptcha and such.', 'NOTE: results may vary due to many factors. No guarantees are given, except for ongoing efforts in understanding detection algorithms.')" -category = "main" -optional = false -python-versions = "*" -files = [ - {file = "undetected-chromedriver-3.2.1.tar.gz", hash = "sha256:3fe5b6e75b7170efa2f4c53e74bc68ba01d62a30c1a2a5773227fbdd9717d1d8"}, -] - -[package.dependencies] -requests = "*" -selenium = ">=4.0.0" -websockets = "*" - -[[package]] -name = "urllib3" -version = "1.26.14" -description = "HTTP library with thread-safe connection pooling, file post, and more." -category = "main" -optional = false -python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*, !=3.4.*, !=3.5.*" -files = [ - {file = "urllib3-1.26.14-py2.py3-none-any.whl", hash = "sha256:75edcdc2f7d85b137124a6c3c9fc3933cdeaa12ecb9a6a959f22797a0feca7e1"}, - {file = "urllib3-1.26.14.tar.gz", hash = "sha256:076907bf8fd355cde77728471316625a4d2f7e713c125f51953bb5b3eecf4f72"}, -] - -[package.dependencies] -PySocks = {version = ">=1.5.6,<1.5.7 || >1.5.7,<2.0", optional = true, markers = "extra == \"socks\""} - -[package.extras] -brotli = ["brotli (>=1.0.9)", "brotlicffi (>=0.8.0)", "brotlipy (>=0.6.0)"] -secure = ["certifi", "cryptography (>=1.3.4)", "idna (>=2.0.0)", "ipaddress", "pyOpenSSL (>=0.14)", "urllib3-secure-extra"] -socks = ["PySocks (>=1.5.6,!=1.5.7,<2.0)"] - -[[package]] -name = "virtualenv" -version = "20.17.1" -description = "Virtual Python Environment builder" -category = "dev" -optional = false -python-versions = ">=3.6" -files = [ - {file = "virtualenv-20.17.1-py3-none-any.whl", hash = "sha256:ce3b1684d6e1a20a3e5ed36795a97dfc6af29bc3970ca8dab93e11ac6094b3c4"}, - {file = "virtualenv-20.17.1.tar.gz", hash = "sha256:f8b927684efc6f1cc206c9db297a570ab9ad0e51c16fa9e45487d36d1905c058"}, -] - -[package.dependencies] -distlib = ">=0.3.6,<1" -filelock = ">=3.4.1,<4" -platformdirs = ">=2.4,<3" - -[package.extras] -docs = ["proselint (>=0.13)", "sphinx (>=5.3)", "sphinx-argparse (>=0.3.2)", "sphinx-rtd-theme (>=1)", "towncrier (>=22.8)"] -testing = ["coverage (>=6.2)", "coverage-enable-subprocess (>=1)", "flaky (>=3.7)", "packaging (>=21.3)", "pytest (>=7.0.1)", "pytest-env (>=0.6.2)", "pytest-freezegun (>=0.4.2)", "pytest-mock (>=3.6.1)", "pytest-randomly (>=3.10.3)", "pytest-timeout (>=2.1)"] - -[[package]] -name = "websockets" -version = "10.4" -description = "An implementation of the WebSocket Protocol (RFC 6455 & 7692)" -category = "main" -optional = false -python-versions = ">=3.7" -files = [ - {file = "websockets-10.4-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:d58804e996d7d2307173d56c297cf7bc132c52df27a3efaac5e8d43e36c21c48"}, - {file = "websockets-10.4-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:bc0b82d728fe21a0d03e65f81980abbbcb13b5387f733a1a870672c5be26edab"}, - {file = "websockets-10.4-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:ba089c499e1f4155d2a3c2a05d2878a3428cf321c848f2b5a45ce55f0d7d310c"}, - {file = "websockets-10.4-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:33d69ca7612f0ddff3316b0c7b33ca180d464ecac2d115805c044bf0a3b0d032"}, - {file = "websockets-10.4-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:62e627f6b6d4aed919a2052efc408da7a545c606268d5ab5bfab4432734b82b4"}, - {file = "websockets-10.4-cp310-cp310-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:38ea7b82bfcae927eeffc55d2ffa31665dc7fec7b8dc654506b8e5a518eb4d50"}, - {file = "websockets-10.4-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:e0cb5cc6ece6ffa75baccfd5c02cffe776f3f5c8bf486811f9d3ea3453676ce8"}, - {file = "websockets-10.4-cp310-cp310-musllinux_1_1_i686.whl", hash = "sha256:ae5e95cfb53ab1da62185e23b3130e11d64431179debac6dc3c6acf08760e9b1"}, - {file = "websockets-10.4-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:7c584f366f46ba667cfa66020344886cf47088e79c9b9d39c84ce9ea98aaa331"}, - {file = "websockets-10.4-cp310-cp310-win32.whl", hash = "sha256:b029fb2032ae4724d8ae8d4f6b363f2cc39e4c7b12454df8df7f0f563ed3e61a"}, - {file = "websockets-10.4-cp310-cp310-win_amd64.whl", hash = "sha256:8dc96f64ae43dde92530775e9cb169979f414dcf5cff670455d81a6823b42089"}, - {file = "websockets-10.4-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:47a2964021f2110116cc1125b3e6d87ab5ad16dea161949e7244ec583b905bb4"}, - {file = "websockets-10.4-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:e789376b52c295c4946403bd0efecf27ab98f05319df4583d3c48e43c7342c2f"}, - {file = "websockets-10.4-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:7d3f0b61c45c3fa9a349cf484962c559a8a1d80dae6977276df8fd1fa5e3cb8c"}, - {file = "websockets-10.4-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:f55b5905705725af31ccef50e55391621532cd64fbf0bc6f4bac935f0fccec46"}, - {file = "websockets-10.4-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:00c870522cdb69cd625b93f002961ffb0c095394f06ba8c48f17eef7c1541f96"}, - {file = "websockets-10.4-cp311-cp311-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8f38706e0b15d3c20ef6259fd4bc1700cd133b06c3c1bb108ffe3f8947be15fa"}, - {file = "websockets-10.4-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:f2c38d588887a609191d30e902df2a32711f708abfd85d318ca9b367258cfd0c"}, - {file = "websockets-10.4-cp311-cp311-musllinux_1_1_i686.whl", hash = "sha256:fe10ddc59b304cb19a1bdf5bd0a7719cbbc9fbdd57ac80ed436b709fcf889106"}, - {file = "websockets-10.4-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:90fcf8929836d4a0e964d799a58823547df5a5e9afa83081761630553be731f9"}, - {file = "websockets-10.4-cp311-cp311-win32.whl", hash = "sha256:b9968694c5f467bf67ef97ae7ad4d56d14be2751000c1207d31bf3bb8860bae8"}, - {file = "websockets-10.4-cp311-cp311-win_amd64.whl", hash = "sha256:a7a240d7a74bf8d5cb3bfe6be7f21697a28ec4b1a437607bae08ac7acf5b4882"}, - {file = "websockets-10.4-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:74de2b894b47f1d21cbd0b37a5e2b2392ad95d17ae983e64727e18eb281fe7cb"}, - {file = "websockets-10.4-cp37-cp37m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:e3a686ecb4aa0d64ae60c9c9f1a7d5d46cab9bfb5d91a2d303d00e2cd4c4c5cc"}, - {file = "websockets-10.4-cp37-cp37m-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:b0d15c968ea7a65211e084f523151dbf8ae44634de03c801b8bd070b74e85033"}, - {file = "websockets-10.4-cp37-cp37m-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:00213676a2e46b6ebf6045bc11d0f529d9120baa6f58d122b4021ad92adabd41"}, - {file = "websockets-10.4-cp37-cp37m-musllinux_1_1_aarch64.whl", hash = "sha256:e23173580d740bf8822fd0379e4bf30aa1d5a92a4f252d34e893070c081050df"}, - {file = "websockets-10.4-cp37-cp37m-musllinux_1_1_i686.whl", hash = "sha256:dd500e0a5e11969cdd3320935ca2ff1e936f2358f9c2e61f100a1660933320ea"}, - {file = "websockets-10.4-cp37-cp37m-musllinux_1_1_x86_64.whl", hash = "sha256:4239b6027e3d66a89446908ff3027d2737afc1a375f8fd3eea630a4842ec9a0c"}, - {file = "websockets-10.4-cp37-cp37m-win32.whl", hash = "sha256:8a5cc00546e0a701da4639aa0bbcb0ae2bb678c87f46da01ac2d789e1f2d2038"}, - {file = "websockets-10.4-cp37-cp37m-win_amd64.whl", hash = "sha256:a9f9a735deaf9a0cadc2d8c50d1a5bcdbae8b6e539c6e08237bc4082d7c13f28"}, - {file = "websockets-10.4-cp38-cp38-macosx_10_9_universal2.whl", hash = "sha256:5c1289596042fad2cdceb05e1ebf7aadf9995c928e0da2b7a4e99494953b1b94"}, - {file = "websockets-10.4-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:0cff816f51fb33c26d6e2b16b5c7d48eaa31dae5488ace6aae468b361f422b63"}, - {file = "websockets-10.4-cp38-cp38-macosx_11_0_arm64.whl", hash = "sha256:dd9becd5fe29773d140d68d607d66a38f60e31b86df75332703757ee645b6faf"}, - {file = "websockets-10.4-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:45ec8e75b7dbc9539cbfafa570742fe4f676eb8b0d3694b67dabe2f2ceed8aa6"}, - {file = "websockets-10.4-cp38-cp38-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:4f72e5cd0f18f262f5da20efa9e241699e0cf3a766317a17392550c9ad7b37d8"}, - {file = "websockets-10.4-cp38-cp38-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:185929b4808b36a79c65b7865783b87b6841e852ef5407a2fb0c03381092fa3b"}, - {file = "websockets-10.4-cp38-cp38-musllinux_1_1_aarch64.whl", hash = "sha256:7d27a7e34c313b3a7f91adcd05134315002aaf8540d7b4f90336beafaea6217c"}, - {file = "websockets-10.4-cp38-cp38-musllinux_1_1_i686.whl", hash = "sha256:884be66c76a444c59f801ac13f40c76f176f1bfa815ef5b8ed44321e74f1600b"}, - {file = "websockets-10.4-cp38-cp38-musllinux_1_1_x86_64.whl", hash = "sha256:931c039af54fc195fe6ad536fde4b0de04da9d5916e78e55405436348cfb0e56"}, - {file = "websockets-10.4-cp38-cp38-win32.whl", hash = "sha256:db3c336f9eda2532ec0fd8ea49fef7a8df8f6c804cdf4f39e5c5c0d4a4ad9a7a"}, - {file = "websockets-10.4-cp38-cp38-win_amd64.whl", hash = "sha256:48c08473563323f9c9debac781ecf66f94ad5a3680a38fe84dee5388cf5acaf6"}, - {file = "websockets-10.4-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:40e826de3085721dabc7cf9bfd41682dadc02286d8cf149b3ad05bff89311e4f"}, - {file = "websockets-10.4-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:56029457f219ade1f2fc12a6504ea61e14ee227a815531f9738e41203a429112"}, - {file = "websockets-10.4-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:f5fc088b7a32f244c519a048c170f14cf2251b849ef0e20cbbb0fdf0fdaf556f"}, - {file = "websockets-10.4-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:2fc8709c00704194213d45e455adc106ff9e87658297f72d544220e32029cd3d"}, - {file = "websockets-10.4-cp39-cp39-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:0154f7691e4fe6c2b2bc275b5701e8b158dae92a1ab229e2b940efe11905dff4"}, - {file = "websockets-10.4-cp39-cp39-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:4c6d2264f485f0b53adf22697ac11e261ce84805c232ed5dbe6b1bcb84b00ff0"}, - {file = "websockets-10.4-cp39-cp39-musllinux_1_1_aarch64.whl", hash = "sha256:9bc42e8402dc5e9905fb8b9649f57efcb2056693b7e88faa8fb029256ba9c68c"}, - {file = "websockets-10.4-cp39-cp39-musllinux_1_1_i686.whl", hash = "sha256:edc344de4dac1d89300a053ac973299e82d3db56330f3494905643bb68801269"}, - {file = "websockets-10.4-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:84bc2a7d075f32f6ed98652db3a680a17a4edb21ca7f80fe42e38753a58ee02b"}, - {file = "websockets-10.4-cp39-cp39-win32.whl", hash = "sha256:c94ae4faf2d09f7c81847c63843f84fe47bf6253c9d60b20f25edfd30fb12588"}, - {file = "websockets-10.4-cp39-cp39-win_amd64.whl", hash = "sha256:bbccd847aa0c3a69b5f691a84d2341a4f8a629c6922558f2a70611305f902d74"}, - {file = "websockets-10.4-pp37-pypy37_pp73-macosx_10_9_x86_64.whl", hash = "sha256:82ff5e1cae4e855147fd57a2863376ed7454134c2bf49ec604dfe71e446e2193"}, - {file = "websockets-10.4-pp37-pypy37_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d210abe51b5da0ffdbf7b43eed0cfdff8a55a1ab17abbec4301c9ff077dd0342"}, - {file = "websockets-10.4-pp37-pypy37_pp73-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:942de28af58f352a6f588bc72490ae0f4ccd6dfc2bd3de5945b882a078e4e179"}, - {file = "websockets-10.4-pp37-pypy37_pp73-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c9b27d6c1c6cd53dc93614967e9ce00ae7f864a2d9f99fe5ed86706e1ecbf485"}, - {file = "websockets-10.4-pp37-pypy37_pp73-win_amd64.whl", hash = "sha256:3d3cac3e32b2c8414f4f87c1b2ab686fa6284a980ba283617404377cd448f631"}, - {file = "websockets-10.4-pp38-pypy38_pp73-macosx_10_9_x86_64.whl", hash = "sha256:da39dd03d130162deb63da51f6e66ed73032ae62e74aaccc4236e30edccddbb0"}, - {file = "websockets-10.4-pp38-pypy38_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:389f8dbb5c489e305fb113ca1b6bdcdaa130923f77485db5b189de343a179393"}, - {file = "websockets-10.4-pp38-pypy38_pp73-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:09a1814bb15eff7069e51fed0826df0bc0702652b5cb8f87697d469d79c23576"}, - {file = "websockets-10.4-pp38-pypy38_pp73-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:ff64a1d38d156d429404aaa84b27305e957fd10c30e5880d1765c9480bea490f"}, - {file = "websockets-10.4-pp38-pypy38_pp73-win_amd64.whl", hash = "sha256:b343f521b047493dc4022dd338fc6db9d9282658862756b4f6fd0e996c1380e1"}, - {file = "websockets-10.4-pp39-pypy39_pp73-macosx_10_9_x86_64.whl", hash = "sha256:932af322458da7e4e35df32f050389e13d3d96b09d274b22a7aa1808f292fee4"}, - {file = "websockets-10.4-pp39-pypy39_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d6a4162139374a49eb18ef5b2f4da1dd95c994588f5033d64e0bbfda4b6b6fcf"}, - {file = "websockets-10.4-pp39-pypy39_pp73-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:c57e4c1349fbe0e446c9fa7b19ed2f8a4417233b6984277cce392819123142d3"}, - {file = "websockets-10.4-pp39-pypy39_pp73-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:b627c266f295de9dea86bd1112ed3d5fafb69a348af30a2422e16590a8ecba13"}, - {file = "websockets-10.4-pp39-pypy39_pp73-win_amd64.whl", hash = "sha256:05a7233089f8bd355e8cbe127c2e8ca0b4ea55467861906b80d2ebc7db4d6b72"}, - {file = "websockets-10.4.tar.gz", hash = "sha256:eef610b23933c54d5d921c92578ae5f89813438fded840c2e9809d378dc765d3"}, -] - -[[package]] -name = "wrapt" -version = "1.14.1" -description = "Module for decorators, wrappers and monkey patching." -category = "dev" -optional = false -python-versions = "!=3.0.*,!=3.1.*,!=3.2.*,!=3.3.*,!=3.4.*,>=2.7" -files = [ - {file = "wrapt-1.14.1-cp27-cp27m-macosx_10_9_x86_64.whl", hash = "sha256:1b376b3f4896e7930f1f772ac4b064ac12598d1c38d04907e696cc4d794b43d3"}, - {file = "wrapt-1.14.1-cp27-cp27m-manylinux1_i686.whl", hash = "sha256:903500616422a40a98a5a3c4ff4ed9d0066f3b4c951fa286018ecdf0750194ef"}, - {file = "wrapt-1.14.1-cp27-cp27m-manylinux1_x86_64.whl", hash = "sha256:5a9a0d155deafd9448baff28c08e150d9b24ff010e899311ddd63c45c2445e28"}, - {file = "wrapt-1.14.1-cp27-cp27m-manylinux2010_i686.whl", hash = "sha256:ddaea91abf8b0d13443f6dac52e89051a5063c7d014710dcb4d4abb2ff811a59"}, - {file = "wrapt-1.14.1-cp27-cp27m-manylinux2010_x86_64.whl", hash = "sha256:36f582d0c6bc99d5f39cd3ac2a9062e57f3cf606ade29a0a0d6b323462f4dd87"}, - {file = "wrapt-1.14.1-cp27-cp27mu-manylinux1_i686.whl", hash = "sha256:7ef58fb89674095bfc57c4069e95d7a31cfdc0939e2a579882ac7d55aadfd2a1"}, - {file = "wrapt-1.14.1-cp27-cp27mu-manylinux1_x86_64.whl", hash = "sha256:e2f83e18fe2f4c9e7db597e988f72712c0c3676d337d8b101f6758107c42425b"}, - {file = "wrapt-1.14.1-cp27-cp27mu-manylinux2010_i686.whl", hash = "sha256:ee2b1b1769f6707a8a445162ea16dddf74285c3964f605877a20e38545c3c462"}, - {file = "wrapt-1.14.1-cp27-cp27mu-manylinux2010_x86_64.whl", hash = "sha256:833b58d5d0b7e5b9832869f039203389ac7cbf01765639c7309fd50ef619e0b1"}, - {file = "wrapt-1.14.1-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:80bb5c256f1415f747011dc3604b59bc1f91c6e7150bd7db03b19170ee06b320"}, - {file = "wrapt-1.14.1-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:07f7a7d0f388028b2df1d916e94bbb40624c59b48ecc6cbc232546706fac74c2"}, - {file = "wrapt-1.14.1-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:02b41b633c6261feff8ddd8d11c711df6842aba629fdd3da10249a53211a72c4"}, - {file = "wrapt-1.14.1-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:2fe803deacd09a233e4762a1adcea5db5d31e6be577a43352936179d14d90069"}, - {file = "wrapt-1.14.1-cp310-cp310-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:257fd78c513e0fb5cdbe058c27a0624c9884e735bbd131935fd49e9fe719d310"}, - {file = "wrapt-1.14.1-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:4fcc4649dc762cddacd193e6b55bc02edca674067f5f98166d7713b193932b7f"}, - {file = "wrapt-1.14.1-cp310-cp310-musllinux_1_1_i686.whl", hash = "sha256:11871514607b15cfeb87c547a49bca19fde402f32e2b1c24a632506c0a756656"}, - {file = "wrapt-1.14.1-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:8ad85f7f4e20964db4daadcab70b47ab05c7c1cf2a7c1e51087bfaa83831854c"}, - {file = "wrapt-1.14.1-cp310-cp310-win32.whl", hash = "sha256:a9a52172be0b5aae932bef82a79ec0a0ce87288c7d132946d645eba03f0ad8a8"}, - {file = "wrapt-1.14.1-cp310-cp310-win_amd64.whl", hash = "sha256:6d323e1554b3d22cfc03cd3243b5bb815a51f5249fdcbb86fda4bf62bab9e164"}, - {file = "wrapt-1.14.1-cp35-cp35m-manylinux1_i686.whl", hash = "sha256:43ca3bbbe97af00f49efb06e352eae40434ca9d915906f77def219b88e85d907"}, - {file = "wrapt-1.14.1-cp35-cp35m-manylinux1_x86_64.whl", hash = "sha256:6b1a564e6cb69922c7fe3a678b9f9a3c54e72b469875aa8018f18b4d1dd1adf3"}, - {file = "wrapt-1.14.1-cp35-cp35m-manylinux2010_i686.whl", hash = "sha256:00b6d4ea20a906c0ca56d84f93065b398ab74b927a7a3dbd470f6fc503f95dc3"}, - {file = "wrapt-1.14.1-cp35-cp35m-manylinux2010_x86_64.whl", hash = "sha256:a85d2b46be66a71bedde836d9e41859879cc54a2a04fad1191eb50c2066f6e9d"}, - {file = "wrapt-1.14.1-cp35-cp35m-win32.whl", hash = "sha256:dbcda74c67263139358f4d188ae5faae95c30929281bc6866d00573783c422b7"}, - {file = "wrapt-1.14.1-cp35-cp35m-win_amd64.whl", hash = "sha256:b21bb4c09ffabfa0e85e3a6b623e19b80e7acd709b9f91452b8297ace2a8ab00"}, - {file = "wrapt-1.14.1-cp36-cp36m-macosx_10_9_x86_64.whl", hash = "sha256:9e0fd32e0148dd5dea6af5fee42beb949098564cc23211a88d799e434255a1f4"}, - {file = "wrapt-1.14.1-cp36-cp36m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:9736af4641846491aedb3c3f56b9bc5568d92b0692303b5a305301a95dfd38b1"}, - {file = "wrapt-1.14.1-cp36-cp36m-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:5b02d65b9ccf0ef6c34cba6cf5bf2aab1bb2f49c6090bafeecc9cd81ad4ea1c1"}, - {file = "wrapt-1.14.1-cp36-cp36m-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:21ac0156c4b089b330b7666db40feee30a5d52634cc4560e1905d6529a3897ff"}, - {file = "wrapt-1.14.1-cp36-cp36m-musllinux_1_1_aarch64.whl", hash = "sha256:9f3e6f9e05148ff90002b884fbc2a86bd303ae847e472f44ecc06c2cd2fcdb2d"}, - {file = "wrapt-1.14.1-cp36-cp36m-musllinux_1_1_i686.whl", hash = "sha256:6e743de5e9c3d1b7185870f480587b75b1cb604832e380d64f9504a0535912d1"}, - {file = "wrapt-1.14.1-cp36-cp36m-musllinux_1_1_x86_64.whl", hash = "sha256:d79d7d5dc8a32b7093e81e97dad755127ff77bcc899e845f41bf71747af0c569"}, - {file = "wrapt-1.14.1-cp36-cp36m-win32.whl", hash = "sha256:81b19725065dcb43df02b37e03278c011a09e49757287dca60c5aecdd5a0b8ed"}, - {file = "wrapt-1.14.1-cp36-cp36m-win_amd64.whl", hash = "sha256:b014c23646a467558be7da3d6b9fa409b2c567d2110599b7cf9a0c5992b3b471"}, - {file = "wrapt-1.14.1-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:88bd7b6bd70a5b6803c1abf6bca012f7ed963e58c68d76ee20b9d751c74a3248"}, - {file = "wrapt-1.14.1-cp37-cp37m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:b5901a312f4d14c59918c221323068fad0540e34324925c8475263841dbdfe68"}, - {file = "wrapt-1.14.1-cp37-cp37m-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:d77c85fedff92cf788face9bfa3ebaa364448ebb1d765302e9af11bf449ca36d"}, - {file = "wrapt-1.14.1-cp37-cp37m-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8d649d616e5c6a678b26d15ece345354f7c2286acd6db868e65fcc5ff7c24a77"}, - {file = "wrapt-1.14.1-cp37-cp37m-musllinux_1_1_aarch64.whl", hash = "sha256:7d2872609603cb35ca513d7404a94d6d608fc13211563571117046c9d2bcc3d7"}, - {file = "wrapt-1.14.1-cp37-cp37m-musllinux_1_1_i686.whl", hash = "sha256:ee6acae74a2b91865910eef5e7de37dc6895ad96fa23603d1d27ea69df545015"}, - {file = "wrapt-1.14.1-cp37-cp37m-musllinux_1_1_x86_64.whl", hash = "sha256:2b39d38039a1fdad98c87279b48bc5dce2c0ca0d73483b12cb72aa9609278e8a"}, - {file = "wrapt-1.14.1-cp37-cp37m-win32.whl", hash = "sha256:60db23fa423575eeb65ea430cee741acb7c26a1365d103f7b0f6ec412b893853"}, - {file = "wrapt-1.14.1-cp37-cp37m-win_amd64.whl", hash = "sha256:709fe01086a55cf79d20f741f39325018f4df051ef39fe921b1ebe780a66184c"}, - {file = "wrapt-1.14.1-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:8c0ce1e99116d5ab21355d8ebe53d9460366704ea38ae4d9f6933188f327b456"}, - {file = "wrapt-1.14.1-cp38-cp38-macosx_11_0_arm64.whl", hash = "sha256:e3fb1677c720409d5f671e39bac6c9e0e422584e5f518bfd50aa4cbbea02433f"}, - {file = "wrapt-1.14.1-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:642c2e7a804fcf18c222e1060df25fc210b9c58db7c91416fb055897fc27e8cc"}, - {file = "wrapt-1.14.1-cp38-cp38-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:7b7c050ae976e286906dd3f26009e117eb000fb2cf3533398c5ad9ccc86867b1"}, - {file = "wrapt-1.14.1-cp38-cp38-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:ef3f72c9666bba2bab70d2a8b79f2c6d2c1a42a7f7e2b0ec83bb2f9e383950af"}, - {file = "wrapt-1.14.1-cp38-cp38-musllinux_1_1_aarch64.whl", hash = "sha256:01c205616a89d09827986bc4e859bcabd64f5a0662a7fe95e0d359424e0e071b"}, - {file = "wrapt-1.14.1-cp38-cp38-musllinux_1_1_i686.whl", hash = "sha256:5a0f54ce2c092aaf439813735584b9537cad479575a09892b8352fea5e988dc0"}, - {file = "wrapt-1.14.1-cp38-cp38-musllinux_1_1_x86_64.whl", hash = "sha256:2cf71233a0ed05ccdabe209c606fe0bac7379fdcf687f39b944420d2a09fdb57"}, - {file = "wrapt-1.14.1-cp38-cp38-win32.whl", hash = "sha256:aa31fdcc33fef9eb2552cbcbfee7773d5a6792c137b359e82879c101e98584c5"}, - {file = "wrapt-1.14.1-cp38-cp38-win_amd64.whl", hash = "sha256:d1967f46ea8f2db647c786e78d8cc7e4313dbd1b0aca360592d8027b8508e24d"}, - {file = "wrapt-1.14.1-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:3232822c7d98d23895ccc443bbdf57c7412c5a65996c30442ebe6ed3df335383"}, - {file = "wrapt-1.14.1-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:988635d122aaf2bdcef9e795435662bcd65b02f4f4c1ae37fbee7401c440b3a7"}, - {file = "wrapt-1.14.1-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:9cca3c2cdadb362116235fdbd411735de4328c61425b0aa9f872fd76d02c4e86"}, - {file = "wrapt-1.14.1-cp39-cp39-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:d52a25136894c63de15a35bc0bdc5adb4b0e173b9c0d07a2be9d3ca64a332735"}, - {file = "wrapt-1.14.1-cp39-cp39-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:40e7bc81c9e2b2734ea4bc1aceb8a8f0ceaac7c5299bc5d69e37c44d9081d43b"}, - {file = "wrapt-1.14.1-cp39-cp39-musllinux_1_1_aarch64.whl", hash = "sha256:b9b7a708dd92306328117d8c4b62e2194d00c365f18eff11a9b53c6f923b01e3"}, - {file = "wrapt-1.14.1-cp39-cp39-musllinux_1_1_i686.whl", hash = "sha256:6a9a25751acb379b466ff6be78a315e2b439d4c94c1e99cb7266d40a537995d3"}, - {file = "wrapt-1.14.1-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:34aa51c45f28ba7f12accd624225e2b1e5a3a45206aa191f6f9aac931d9d56fe"}, - {file = "wrapt-1.14.1-cp39-cp39-win32.whl", hash = "sha256:dee0ce50c6a2dd9056c20db781e9c1cfd33e77d2d569f5d1d9321c641bb903d5"}, - {file = "wrapt-1.14.1-cp39-cp39-win_amd64.whl", hash = "sha256:dee60e1de1898bde3b238f18340eec6148986da0455d8ba7848d50470a7a32fb"}, - {file = "wrapt-1.14.1.tar.gz", hash = "sha256:380a85cf89e0e69b7cfbe2ea9f765f004ff419f34194018a6827ac0e3edfed4d"}, -] - -[[package]] -name = "wsproto" -version = "1.2.0" -description = "WebSockets state-machine based protocol implementation" -category = "main" -optional = false -python-versions = ">=3.7.0" -files = [ - {file = "wsproto-1.2.0-py3-none-any.whl", hash = "sha256:b9acddd652b585d75b20477888c56642fdade28bdfd3579aa24a4d2c037dd736"}, - {file = "wsproto-1.2.0.tar.gz", hash = "sha256:ad565f26ecb92588a3e43bc3d96164de84cd9902482b130d0ddbaa9664a85065"}, -] - -[package.dependencies] -h11 = ">=0.9.0,<1" - -[metadata] -lock-version = "2.0" -python-versions = "^3.9" -content-hash = "9423b19164dc20282d3bef249e40dec9adc180eda16e6db747bdb81c2ee09035" diff --git a/pyproject.toml b/pyproject.toml index 012caa4..0425cc3 100644 --- a/pyproject.toml +++ b/pyproject.toml @@ -1,177 +1,210 @@ -# Poetry pyproject.toml: https://python-poetry.org/docs/pyproject/ -[build-system] -requires = ["poetry-core>=1.0.0"] -build-backend = "poetry.core.masonry.api" - -[tool.poetry] +[project] name = "youdotcom" -version = "2.0.23" -description = "official api wrapper for you.com and all of its apps" -readme = "README.md" -authors = ["SilkePilon "] -license = "MIT" -repository = "https://github.com/You-OpenSource/You-Python" -homepage = "https://github.com/You-OpenSource/You-Python" - -# Keywords description https://python-poetry.org/docs/pyproject/#keywords -keywords = [] #! Update me - -# Pypi classifiers: https://pypi.org/classifiers/ -classifiers = [ #! Update me - "Development Status :: 3 - Alpha", +version = "3.0.0" +description = "The official Python library for the ydc-search-api API" +dynamic = ["readme"] +license = "Apache-2.0" +authors = [ +{ name = "Ydc Search API", email = "api@you.com" }, +] +dependencies = [ + "httpx>=0.23.0, <1", + "pydantic>=1.9.0, <3", + "typing-extensions>=4.10, <5", + "anyio>=3.5.0, <5", + "distro>=1.7.0, <2", + "sniffio", +] +requires-python = ">= 3.8" +classifiers = [ + "Typing :: Typed", "Intended Audience :: Developers", + "Programming Language :: Python :: 3.8", + "Programming Language :: Python :: 3.9", + "Programming Language :: Python :: 3.10", + "Programming Language :: Python :: 3.11", + "Programming Language :: Python :: 3.12", "Operating System :: OS Independent", + "Operating System :: POSIX", + "Operating System :: MacOS", + "Operating System :: POSIX :: Linux", + "Operating System :: Microsoft :: Windows", "Topic :: Software Development :: Libraries :: Python Modules", - "License :: OSI Approved :: MIT License", - "Programming Language :: Python :: 3", + "License :: OSI Approved :: Apache Software License" +] + +[project.urls] +Homepage = "https://github.com/You-OpenSource/You-Python" +Repository = "https://github.com/You-OpenSource/You-Python" + +[project.optional-dependencies] +aiohttp = ["aiohttp", "httpx_aiohttp>=0.1.6"] + +[tool.rye] +managed = true +# version pins are in requirements-dev.lock +dev-dependencies = [ + "pyright==1.1.399", + "mypy", + "respx", + "pytest", + "pytest-asyncio", + "ruff", + "time-machine", + "nox", + "dirty-equals>=0.6.0", + "importlib-metadata>=6.7.0", + "rich>=13.7.1", + "nest_asyncio==1.6.0", + "pytest-xdist>=3.6.1", ] -[tool.poetry.scripts] -# Entry points for the package https://python-poetry.org/docs/pyproject/#scripts -"youdotcom" = "youdotcom.__main__:app" - -[tool.poetry.dependencies] -python = "^3.8" - -typer = {extras = ["all"], version = "^0.4.0"} -rich = ">=10.14,<14.0" -undetected-chromedriver = "^3.2.1" -markdownify = "^0.11.6" -chromedriver-autoinstaller = "^0.4.0" -PyVirtualDisplay = "^3.0" -ascii-magic = "^1.6" -cloudscraper = "^1.2.66" -click-shell = "^2.1" -ratelimit = "^2.2.1" -fastapi-queue = "^0.1.1" -aioredis = "^2.0.1" -fastapi = "^0.92.0" -gtts = "^2.3.1" -slowapi = "^0.1.7" -uvicorn = "^0.20.0" -pydantic = "^1.10.5" - - -[tool.poetry.dev-dependencies] -bandit = "^1.7.4" -black = {version = "^22.12.0", allow-prereleases = true} -darglint = "^1.8.1" -isort = {extras = ["colors"], version = "^5.11.4"} -mypy = "^1.0.1" -mypy-extensions = "^1.0.0" -pre-commit = "^3.0.3" -pydocstyle = "^6.2.3" -pylint = "^2.15.10" -pytest = "^7.2.1" -pyupgrade = "^3.3.1" -safety = "^2.3.5" -coverage = "^7.2.3" -coverage-badge = "^1.1.0" -pytest-html = "^3.2.0" -pytest-cov = "^4.0.0" -click = "8.1.4" - -[tool.poetry.group.dev.dependencies] -bandit = "^1.7.4" -darglint = "^1.8.1" -isort = {extras = ["colors"], version = "^5.12.0"} -mypy = "^1.0.1" -pre-commit = "^3.0.4" -pydocstyle = "^6.3.0" -pylint = "^2.16.2" -pytest = "^7.2.1" -pyupgrade = "^3.3.1" -safety = "^2.3.5" -coverage = "^7.1.0" -coverage-badge = "^1.1.0" -pytest-html = "^3.2.0" -pytest-cov = "^4.0.0" - -[tool.black] -# https://github.com/psf/black -target-version = ["py39"] -line-length = 200 -color = true - -exclude = ''' -/( - \.git - | \.hg - | \.mypy_cache - | \.tox - | \.venv - | _build - | buck-out - | build - | dist - | env - | venv -)/ -''' - -[tool.isort] -# https://github.com/timothycrosley/isort/ -py_version = 39 -line_length = 200 - -known_typing = ["typing", "types", "typing_extensions", "mypy", "mypy_extensions"] -sections = ["FUTURE", "TYPING", "STDLIB", "THIRDPARTY", "FIRSTPARTY", "LOCALFOLDER"] -include_trailing_comma = true -profile = "black" -multi_line_output = 3 -indent = 4 -color_output = true - -[tool.mypy] -# https://mypy.readthedocs.io/en/latest/config_file.html#using-a-pyproject-toml-file -python_version = 3.9 -pretty = true -show_traceback = true -color_output = true - -allow_redefinition = false -check_untyped_defs = true -disallow_any_generics = true -disallow_incomplete_defs = true -ignore_missing_imports = true -implicit_reexport = false -no_implicit_optional = true -show_column_numbers = true -show_error_codes = true -show_error_context = true -strict_equality = true -strict_optional = true -warn_no_return = true -warn_redundant_casts = true -warn_return_any = true -warn_unreachable = true -warn_unused_configs = true -warn_unused_ignores = true +[tool.rye.scripts] +format = { chain = [ + "format:ruff", + "format:docs", + "fix:ruff", + # run formatting again to fix any inconsistencies when imports are stripped + "format:ruff", +]} +"format:docs" = "python scripts/utils/ruffen-docs.py README.md api.md" +"format:ruff" = "ruff format" + +"lint" = { chain = [ + "check:ruff", + "typecheck", + "check:importable", +]} +"check:ruff" = "ruff check ." +"fix:ruff" = "ruff check --fix ." + +"check:importable" = "python -c 'import ydc_search_api'" + +typecheck = { chain = [ + "typecheck:pyright", + "typecheck:mypy" +]} +"typecheck:pyright" = "pyright" +"typecheck:verify-types" = "pyright --verifytypes ydc_search_api --ignoreexternal" +"typecheck:mypy" = "mypy ." +[build-system] +requires = ["hatchling==1.26.3", "hatch-fancy-pypi-readme"] +build-backend = "hatchling.build" -[tool.pytest.ini_options] -# https://docs.pytest.org/en/6.2.x/customize.html#pyproject-toml -# Directories that are not visited by pytest collector: -norecursedirs =["hooks", "*.egg", ".eggs", "dist", "build", "docs", ".tox", ".git", "__pycache__"] -doctest_optionflags = ["NUMBER", "NORMALIZE_WHITESPACE", "IGNORE_EXCEPTION_DETAIL"] - -# Extra options: -addopts = [ - "--strict-markers", - "--tb=short", - "--doctest-modules", - "--doctest-continue-on-failure", +[tool.hatch.build] +include = [ + "src/*" +] + +[tool.hatch.build.targets.wheel] +packages = ["src/ydc_search_api"] + +[tool.hatch.build.targets.sdist] +# Basically everything except hidden files/directories (such as .github, .devcontainers, .python-version, etc) +include = [ + "/*.toml", + "/*.json", + "/*.lock", + "/*.md", + "/mypy.ini", + "/noxfile.py", + "bin/*", + "examples/*", + "src/*", + "tests/*", ] -[tool.coverage.run] -source = ["tests"] +[tool.hatch.metadata.hooks.fancy-pypi-readme] +content-type = "text/markdown" -[coverage.paths] -source = "youdotcom" +[[tool.hatch.metadata.hooks.fancy-pypi-readme.fragments]] +path = "README.md" -[coverage.run] -branch = true +[[tool.hatch.metadata.hooks.fancy-pypi-readme.substitutions]] +# replace relative links with absolute links +pattern = '\[(.+?)\]\(((?!https?://)\S+?)\)' +replacement = '[\1](https://github.com/You-OpenSource/You-Python/tree/main/\g<2>)' + +[tool.pytest.ini_options] +testpaths = ["tests"] +addopts = "--tb=short -n auto" +xfail_strict = true +asyncio_mode = "auto" +asyncio_default_fixture_loop_scope = "session" +filterwarnings = [ + "error" +] + +[tool.pyright] +# this enables practically every flag given by pyright. +# there are a couple of flags that are still disabled by +# default in strict mode as they are experimental and niche. +typeCheckingMode = "strict" +pythonVersion = "3.8" + +exclude = [ + "_dev", + ".venv", + ".nox", +] + +reportImplicitOverride = true +reportOverlappingOverload = false + +reportImportCycles = false +reportPrivateUsage = false + +[tool.ruff] +line-length = 120 +output-format = "grouped" +target-version = "py37" + +[tool.ruff.format] +docstring-code-format = true + +[tool.ruff.lint] +select = [ + # isort + "I", + # bugbear rules + "B", + # remove unused imports + "F401", + # bare except statements + "E722", + # unused arguments + "ARG", + # print statements + "T201", + "T203", + # misuse of typing.TYPE_CHECKING + "TC004", + # import rules + "TID251", +] +ignore = [ + # mutable defaults + "B006", +] +unfixable = [ + # disable auto fix for print statements + "T201", + "T203", +] -[coverage.report] -fail_under = 50 -show_missing = true +[tool.ruff.lint.flake8-tidy-imports.banned-api] +"functools.lru_cache".msg = "This function does not retain type information for the wrapped function's arguments; The `lru_cache` function from `_utils` should be used instead" + +[tool.ruff.lint.isort] +length-sort = true +length-sort-straight = true +combine-as-imports = true +extra-standard-library = ["typing_extensions"] +known-first-party = ["ydc_search_api", "tests"] + +[tool.ruff.lint.per-file-ignores] +"bin/**.py" = ["T201", "T203"] +"scripts/**.py" = ["T201", "T203"] +"tests/**.py" = ["T201", "T203"] +"examples/**.py" = ["T201", "T203"] diff --git a/release-please-config.json b/release-please-config.json new file mode 100644 index 0000000..8fe7a52 --- /dev/null +++ b/release-please-config.json @@ -0,0 +1,66 @@ +{ + "packages": { + ".": {} + }, + "$schema": "https://raw.githubusercontent.com/stainless-api/release-please/main/schemas/config.json", + "include-v-in-tag": true, + "include-component-in-tag": false, + "versioning": "prerelease", + "prerelease": true, + "bump-minor-pre-major": true, + "bump-patch-for-minor-pre-major": false, + "pull-request-header": "Automated Release PR", + "pull-request-title-pattern": "release: ${version}", + "changelog-sections": [ + { + "type": "feat", + "section": "Features" + }, + { + "type": "fix", + "section": "Bug Fixes" + }, + { + "type": "perf", + "section": "Performance Improvements" + }, + { + "type": "revert", + "section": "Reverts" + }, + { + "type": "chore", + "section": "Chores" + }, + { + "type": "docs", + "section": "Documentation" + }, + { + "type": "style", + "section": "Styles" + }, + { + "type": "refactor", + "section": "Refactors" + }, + { + "type": "test", + "section": "Tests", + "hidden": true + }, + { + "type": "build", + "section": "Build System" + }, + { + "type": "ci", + "section": "Continuous Integration", + "hidden": true + } + ], + "release-type": "python", + "extra-files": [ + "src/ydc_search_api/_version.py" + ] +} \ No newline at end of file diff --git a/release.py b/release.py deleted file mode 100755 index 241d27c..0000000 --- a/release.py +++ /dev/null @@ -1,35 +0,0 @@ -import os -import subprocess -import sys -from importlib import metadata as importlib_metadata - -from github_release import gh_release_create - -version = subprocess.run(["poetry", "version", "-s"], capture_output=True, text=True).stdout.rstrip() - -title = input("title: ") - - -notes = input(r"changes (use \ for a enter): ") - - -with open("RELEASE.md") as file: - # read a list of lines into data - data = file.readlines() - - -notes = str(notes).replace("\\", "\n") -print(len(data)) -data[17] = f"{notes}" - - -with open("RELEASE.md", "w") as file: - file.writelines(data) - - -with open("RELEASE.md") as file2: - # read a list of lines into data - text = file2.read() - - -gh_release_create("You-OpenSource/You-Python", f"{version}", publish=True, name=f"{title} - {version}", body=f"{text}") diff --git a/requirements-dev.lock b/requirements-dev.lock new file mode 100644 index 0000000..518cce4 --- /dev/null +++ b/requirements-dev.lock @@ -0,0 +1,135 @@ +# generated by rye +# use `rye lock` or `rye sync` to update this lockfile +# +# last locked with the following flags: +# pre: false +# features: [] +# all-features: true +# with-sources: false +# generate-hashes: false +# universal: false + +-e file:. +aiohappyeyeballs==2.6.1 + # via aiohttp +aiohttp==3.12.8 + # via httpx-aiohttp + # via youdotcom +aiosignal==1.3.2 + # via aiohttp +annotated-types==0.6.0 + # via pydantic +anyio==4.4.0 + # via httpx + # via youdotcom +argcomplete==3.1.2 + # via nox +async-timeout==5.0.1 + # via aiohttp +attrs==25.3.0 + # via aiohttp +certifi==2023.7.22 + # via httpcore + # via httpx +colorlog==6.7.0 + # via nox +dirty-equals==0.6.0 +distlib==0.3.7 + # via virtualenv +distro==1.8.0 + # via youdotcom +exceptiongroup==1.2.2 + # via anyio + # via pytest +execnet==2.1.1 + # via pytest-xdist +filelock==3.12.4 + # via virtualenv +frozenlist==1.6.2 + # via aiohttp + # via aiosignal +h11==0.14.0 + # via httpcore +httpcore==1.0.2 + # via httpx +httpx==0.28.1 + # via httpx-aiohttp + # via respx + # via youdotcom +httpx-aiohttp==0.1.6 + # via youdotcom +idna==3.4 + # via anyio + # via httpx + # via yarl +importlib-metadata==7.0.0 +iniconfig==2.0.0 + # via pytest +markdown-it-py==3.0.0 + # via rich +mdurl==0.1.2 + # via markdown-it-py +multidict==6.4.4 + # via aiohttp + # via yarl +mypy==1.14.1 +mypy-extensions==1.0.0 + # via mypy +nest-asyncio==1.6.0 +nodeenv==1.8.0 + # via pyright +nox==2023.4.22 +packaging==23.2 + # via nox + # via pytest +platformdirs==3.11.0 + # via virtualenv +pluggy==1.5.0 + # via pytest +propcache==0.3.1 + # via aiohttp + # via yarl +pydantic==2.10.3 + # via youdotcom +pydantic-core==2.27.1 + # via pydantic +pygments==2.18.0 + # via rich +pyright==1.1.399 +pytest==8.3.3 + # via pytest-asyncio + # via pytest-xdist +pytest-asyncio==0.24.0 +pytest-xdist==3.7.0 +python-dateutil==2.8.2 + # via time-machine +pytz==2023.3.post1 + # via dirty-equals +respx==0.22.0 +rich==13.7.1 +ruff==0.9.4 +setuptools==68.2.2 + # via nodeenv +six==1.16.0 + # via python-dateutil +sniffio==1.3.0 + # via anyio + # via youdotcom +time-machine==2.9.0 +tomli==2.0.2 + # via mypy + # via pytest +typing-extensions==4.12.2 + # via anyio + # via multidict + # via mypy + # via pydantic + # via pydantic-core + # via pyright + # via youdotcom +virtualenv==20.24.5 + # via nox +yarl==1.20.0 + # via aiohttp +zipp==3.17.0 + # via importlib-metadata diff --git a/requirements.lock b/requirements.lock new file mode 100644 index 0000000..08a10dc --- /dev/null +++ b/requirements.lock @@ -0,0 +1,72 @@ +# generated by rye +# use `rye lock` or `rye sync` to update this lockfile +# +# last locked with the following flags: +# pre: false +# features: [] +# all-features: true +# with-sources: false +# generate-hashes: false +# universal: false + +-e file:. +aiohappyeyeballs==2.6.1 + # via aiohttp +aiohttp==3.12.8 + # via httpx-aiohttp + # via youdotcom +aiosignal==1.3.2 + # via aiohttp +annotated-types==0.6.0 + # via pydantic +anyio==4.4.0 + # via httpx + # via youdotcom +async-timeout==5.0.1 + # via aiohttp +attrs==25.3.0 + # via aiohttp +certifi==2023.7.22 + # via httpcore + # via httpx +distro==1.8.0 + # via youdotcom +exceptiongroup==1.2.2 + # via anyio +frozenlist==1.6.2 + # via aiohttp + # via aiosignal +h11==0.14.0 + # via httpcore +httpcore==1.0.2 + # via httpx +httpx==0.28.1 + # via httpx-aiohttp + # via youdotcom +httpx-aiohttp==0.1.6 + # via youdotcom +idna==3.4 + # via anyio + # via httpx + # via yarl +multidict==6.4.4 + # via aiohttp + # via yarl +propcache==0.3.1 + # via aiohttp + # via yarl +pydantic==2.10.3 + # via youdotcom +pydantic-core==2.27.1 + # via pydantic +sniffio==1.3.0 + # via anyio + # via youdotcom +typing-extensions==4.12.2 + # via anyio + # via multidict + # via pydantic + # via pydantic-core + # via youdotcom +yarl==1.20.0 + # via aiohttp diff --git a/requirements.txt b/requirements.txt deleted file mode 100755 index d96280a..0000000 --- a/requirements.txt +++ /dev/null @@ -1,34 +0,0 @@ -async-generator==1.10; python_version >= "3.7" and python_version < "4.0" -attrs==22.2.0; python_version >= "3.7" and python_version < "4.0" -beautifulsoup4==4.11.2; python_full_version >= "3.6.0" -certifi==2022.12.7; python_version >= "3.7" and python_version < "4" -cffi==1.15.1; os_name == "nt" and implementation_name != "pypy" and python_version >= "3.7" and python_version < "4.0" -charset-normalizer==2.1.1; python_version >= "3.7" and python_version < "4" and python_full_version >= "3.6.0" -chromedriver-autoinstaller==0.4.0; python_version >= "3.6" -click==8.0.4; python_version >= "3.6" -colorama==0.4.6; python_version >= "3.6" and python_full_version >= "3.7.0" and python_full_version < "4.0.0" and (python_version >= "3.6" and python_full_version < "3.0.0" and platform_system == "Windows" or platform_system == "Windows" and python_version >= "3.6" and python_full_version >= "3.7.0") -commonmark==0.9.1; python_full_version >= "3.6.2" and python_full_version < "4.0.0" -exceptiongroup==1.1.0; python_version >= "3.7" and python_version < "3.11" -h11==0.14.0; python_version >= "3.7" and python_version < "4.0" and python_full_version >= "3.7.0" -idna==3.4; python_version >= "3.7" and python_version < "4" -markdownify==0.11.6 -outcome==1.2.0; python_version >= "3.7" and python_version < "4.0" -pycparser==2.21; python_version >= "3.7" and python_full_version < "3.0.0" and os_name == "nt" and implementation_name != "pypy" and python_version < "4.0" or os_name == "nt" and implementation_name != "pypy" and python_version >= "3.7" and python_version < "4.0" and python_full_version >= "3.4.0" -pygments==2.13.0; python_full_version >= "3.6.2" and python_full_version < "4.0.0" and python_version >= "3.6" -pysocks==1.7.1; python_version >= "3.7" and python_full_version < "3.0.0" and python_version < "4" or python_version >= "3.7" and python_version < "4" and python_full_version >= "3.6.0" -pyvirtualdisplay==3.0 -requests==2.28.1; python_version >= "3.7" and python_version < "4" -rich==10.16.2; python_full_version >= "3.6.2" and python_full_version < "4.0.0" -selenium==4.7.2; python_version >= "3.7" and python_version < "4.0" -shellingham==1.5.0.post1; python_version >= "3.6" -six==1.16.0; python_version >= "2.7" and python_full_version < "3.0.0" or python_full_version >= "3.3.0" -sniffio==1.3.0; python_version >= "3.7" and python_version < "4.0" -sortedcontainers==2.4.0; python_version >= "3.7" and python_version < "4.0" -soupsieve==2.3.2.post1; python_version >= "3.6" and python_full_version >= "3.6.0" -trio-websocket==0.9.2; python_version >= "3.7" and python_version < "4.0" -trio==0.22.0; python_version >= "3.7" and python_version < "4.0" -typer==0.4.2; python_version >= "3.6" -undetected-chromedriver==3.2.1 -urllib3==1.26.13; python_version >= "3.7" and python_full_version < "3.0.0" and python_version < "4" or python_version >= "3.7" and python_version < "4" and python_full_version >= "3.6.0" -websockets==10.4; python_version >= "3.7" -wsproto==1.2.0; python_version >= "3.7" and python_version < "4.0" and python_full_version >= "3.7.0" diff --git a/scripts/bootstrap b/scripts/bootstrap new file mode 100755 index 0000000..e84fe62 --- /dev/null +++ b/scripts/bootstrap @@ -0,0 +1,19 @@ +#!/usr/bin/env bash + +set -e + +cd "$(dirname "$0")/.." + +if ! command -v rye >/dev/null 2>&1 && [ -f "Brewfile" ] && [ "$(uname -s)" = "Darwin" ]; then + brew bundle check >/dev/null 2>&1 || { + echo "==> Installing Homebrew dependencies…" + brew bundle + } +fi + +echo "==> Installing Python dependencies…" + +# experimental uv support makes installations significantly faster +rye config --set-bool behavior.use-uv=true + +rye sync --all-features diff --git a/scripts/format b/scripts/format new file mode 100755 index 0000000..667ec2d --- /dev/null +++ b/scripts/format @@ -0,0 +1,8 @@ +#!/usr/bin/env bash + +set -e + +cd "$(dirname "$0")/.." + +echo "==> Running formatters" +rye run format diff --git a/scripts/lint b/scripts/lint new file mode 100755 index 0000000..c910263 --- /dev/null +++ b/scripts/lint @@ -0,0 +1,11 @@ +#!/usr/bin/env bash + +set -e + +cd "$(dirname "$0")/.." + +echo "==> Running lints" +rye run lint + +echo "==> Making sure it imports" +rye run python -c 'import ydc_search_api' diff --git a/scripts/mock b/scripts/mock new file mode 100755 index 0000000..d2814ae --- /dev/null +++ b/scripts/mock @@ -0,0 +1,41 @@ +#!/usr/bin/env bash + +set -e + +cd "$(dirname "$0")/.." + +if [[ -n "$1" && "$1" != '--'* ]]; then + URL="$1" + shift +else + URL="$(grep 'openapi_spec_url' .stats.yml | cut -d' ' -f2)" +fi + +# Check if the URL is empty +if [ -z "$URL" ]; then + echo "Error: No OpenAPI spec path/url provided or found in .stats.yml" + exit 1 +fi + +echo "==> Starting mock server with URL ${URL}" + +# Run prism mock on the given spec +if [ "$1" == "--daemon" ]; then + npm exec --package=@stainless-api/prism-cli@5.8.5 -- prism mock "$URL" &> .prism.log & + + # Wait for server to come online + echo -n "Waiting for server" + while ! grep -q "βœ– fatal\|Prism is listening" ".prism.log" ; do + echo -n "." + sleep 0.1 + done + + if grep -q "βœ– fatal" ".prism.log"; then + cat .prism.log + exit 1 + fi + + echo +else + npm exec --package=@stainless-api/prism-cli@5.8.5 -- prism mock "$URL" +fi diff --git a/scripts/test b/scripts/test new file mode 100755 index 0000000..2b87845 --- /dev/null +++ b/scripts/test @@ -0,0 +1,61 @@ +#!/usr/bin/env bash + +set -e + +cd "$(dirname "$0")/.." + +RED='\033[0;31m' +GREEN='\033[0;32m' +YELLOW='\033[0;33m' +NC='\033[0m' # No Color + +function prism_is_running() { + curl --silent "http://localhost:4010" >/dev/null 2>&1 +} + +kill_server_on_port() { + pids=$(lsof -t -i tcp:"$1" || echo "") + if [ "$pids" != "" ]; then + kill "$pids" + echo "Stopped $pids." + fi +} + +function is_overriding_api_base_url() { + [ -n "$TEST_API_BASE_URL" ] +} + +if ! is_overriding_api_base_url && ! prism_is_running ; then + # When we exit this script, make sure to kill the background mock server process + trap 'kill_server_on_port 4010' EXIT + + # Start the dev server + ./scripts/mock --daemon +fi + +if is_overriding_api_base_url ; then + echo -e "${GREEN}βœ” Running tests against ${TEST_API_BASE_URL}${NC}" + echo +elif ! prism_is_running ; then + echo -e "${RED}ERROR:${NC} The test suite will not run without a mock Prism server" + echo -e "running against your OpenAPI spec." + echo + echo -e "To run the server, pass in the path or url of your OpenAPI" + echo -e "spec to the prism command:" + echo + echo -e " \$ ${YELLOW}npm exec --package=@stoplight/prism-cli@~5.3.2 -- prism mock path/to/your.openapi.yml${NC}" + echo + + exit 1 +else + echo -e "${GREEN}βœ” Mock prism server is running with your OpenAPI spec${NC}" + echo +fi + +export DEFER_PYDANTIC_BUILD=false + +echo "==> Running tests" +rye run pytest "$@" + +echo "==> Running Pydantic v1 tests" +rye run nox -s test-pydantic-v1 -- "$@" diff --git a/scripts/utils/ruffen-docs.py b/scripts/utils/ruffen-docs.py new file mode 100644 index 0000000..0cf2bd2 --- /dev/null +++ b/scripts/utils/ruffen-docs.py @@ -0,0 +1,167 @@ +# fork of https://github.com/asottile/blacken-docs adapted for ruff +from __future__ import annotations + +import re +import sys +import argparse +import textwrap +import contextlib +import subprocess +from typing import Match, Optional, Sequence, Generator, NamedTuple, cast + +MD_RE = re.compile( + r"(?P^(?P *)```\s*python\n)" r"(?P.*?)" r"(?P^(?P=indent)```\s*$)", + re.DOTALL | re.MULTILINE, +) +MD_PYCON_RE = re.compile( + r"(?P^(?P *)```\s*pycon\n)" r"(?P.*?)" r"(?P^(?P=indent)```.*$)", + re.DOTALL | re.MULTILINE, +) +PYCON_PREFIX = ">>> " +PYCON_CONTINUATION_PREFIX = "..." +PYCON_CONTINUATION_RE = re.compile( + rf"^{re.escape(PYCON_CONTINUATION_PREFIX)}( |$)", +) +DEFAULT_LINE_LENGTH = 100 + + +class CodeBlockError(NamedTuple): + offset: int + exc: Exception + + +def format_str( + src: str, +) -> tuple[str, Sequence[CodeBlockError]]: + errors: list[CodeBlockError] = [] + + @contextlib.contextmanager + def _collect_error(match: Match[str]) -> Generator[None, None, None]: + try: + yield + except Exception as e: + errors.append(CodeBlockError(match.start(), e)) + + def _md_match(match: Match[str]) -> str: + code = textwrap.dedent(match["code"]) + with _collect_error(match): + code = format_code_block(code) + code = textwrap.indent(code, match["indent"]) + return f"{match['before']}{code}{match['after']}" + + def _pycon_match(match: Match[str]) -> str: + code = "" + fragment = cast(Optional[str], None) + + def finish_fragment() -> None: + nonlocal code + nonlocal fragment + + if fragment is not None: + with _collect_error(match): + fragment = format_code_block(fragment) + fragment_lines = fragment.splitlines() + code += f"{PYCON_PREFIX}{fragment_lines[0]}\n" + for line in fragment_lines[1:]: + # Skip blank lines to handle Black adding a blank above + # functions within blocks. A blank line would end the REPL + # continuation prompt. + # + # >>> if True: + # ... def f(): + # ... pass + # ... + if line: + code += f"{PYCON_CONTINUATION_PREFIX} {line}\n" + if fragment_lines[-1].startswith(" "): + code += f"{PYCON_CONTINUATION_PREFIX}\n" + fragment = None + + indentation = None + for line in match["code"].splitlines(): + orig_line, line = line, line.lstrip() + if indentation is None and line: + indentation = len(orig_line) - len(line) + continuation_match = PYCON_CONTINUATION_RE.match(line) + if continuation_match and fragment is not None: + fragment += line[continuation_match.end() :] + "\n" + else: + finish_fragment() + if line.startswith(PYCON_PREFIX): + fragment = line[len(PYCON_PREFIX) :] + "\n" + else: + code += orig_line[indentation:] + "\n" + finish_fragment() + return code + + def _md_pycon_match(match: Match[str]) -> str: + code = _pycon_match(match) + code = textwrap.indent(code, match["indent"]) + return f"{match['before']}{code}{match['after']}" + + src = MD_RE.sub(_md_match, src) + src = MD_PYCON_RE.sub(_md_pycon_match, src) + return src, errors + + +def format_code_block(code: str) -> str: + return subprocess.check_output( + [ + sys.executable, + "-m", + "ruff", + "format", + "--stdin-filename=script.py", + f"--line-length={DEFAULT_LINE_LENGTH}", + ], + encoding="utf-8", + input=code, + ) + + +def format_file( + filename: str, + skip_errors: bool, +) -> int: + with open(filename, encoding="UTF-8") as f: + contents = f.read() + new_contents, errors = format_str(contents) + for error in errors: + lineno = contents[: error.offset].count("\n") + 1 + print(f"{filename}:{lineno}: code block parse error {error.exc}") + if errors and not skip_errors: + return 1 + if contents != new_contents: + print(f"{filename}: Rewriting...") + with open(filename, "w", encoding="UTF-8") as f: + f.write(new_contents) + return 0 + else: + return 0 + + +def main(argv: Sequence[str] | None = None) -> int: + parser = argparse.ArgumentParser() + parser.add_argument( + "-l", + "--line-length", + type=int, + default=DEFAULT_LINE_LENGTH, + ) + parser.add_argument( + "-S", + "--skip-string-normalization", + action="store_true", + ) + parser.add_argument("-E", "--skip-errors", action="store_true") + parser.add_argument("filenames", nargs="*") + args = parser.parse_args(argv) + + retv = 0 + for filename in args.filenames: + retv |= format_file(filename, skip_errors=args.skip_errors) + return retv + + +if __name__ == "__main__": + raise SystemExit(main()) diff --git a/scripts/utils/upload-artifact.sh b/scripts/utils/upload-artifact.sh new file mode 100755 index 0000000..74f1f78 --- /dev/null +++ b/scripts/utils/upload-artifact.sh @@ -0,0 +1,27 @@ +#!/usr/bin/env bash +set -exuo pipefail + +FILENAME=$(basename dist/*.whl) + +RESPONSE=$(curl -X POST "$URL?filename=$FILENAME" \ + -H "Authorization: Bearer $AUTH" \ + -H "Content-Type: application/json") + +SIGNED_URL=$(echo "$RESPONSE" | jq -r '.url') + +if [[ "$SIGNED_URL" == "null" ]]; then + echo -e "\033[31mFailed to get signed URL.\033[0m" + exit 1 +fi + +UPLOAD_RESPONSE=$(curl -v -X PUT \ + -H "Content-Type: binary/octet-stream" \ + --data-binary "@dist/$FILENAME" "$SIGNED_URL" 2>&1) + +if echo "$UPLOAD_RESPONSE" | grep -q "HTTP/[0-9.]* 200"; then + echo -e "\033[32mUploaded build to Stainless storage.\033[0m" + echo -e "\033[32mInstallation: pip install 'https://pkg.stainless.com/s/ydc-search-api-python/$SHA/$FILENAME'\033[0m" +else + echo -e "\033[31mFailed to upload artifact.\033[0m" + exit 1 +fi diff --git a/setup.cfg b/setup.cfg deleted file mode 100755 index 3c46a08..0000000 --- a/setup.cfg +++ /dev/null @@ -1,4 +0,0 @@ -[darglint] -# https://github.com/terrencepreilly/darglint -strictness = long -docstring_style = google diff --git a/src/ydc_search_api/__init__.py b/src/ydc_search_api/__init__.py new file mode 100644 index 0000000..7b2b660 --- /dev/null +++ b/src/ydc_search_api/__init__.py @@ -0,0 +1,100 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +import typing as _t + +from . import types +from ._types import NOT_GIVEN, Omit, NoneType, NotGiven, Transport, ProxiesTypes +from ._utils import file_from_path +from ._client import ( + Client, + Stream, + Timeout, + Transport, + AsyncClient, + AsyncStream, + YdcSearchAPI, + RequestOptions, + AsyncYdcSearchAPI, +) +from ._models import BaseModel +from ._version import __title__, __version__ +from ._response import APIResponse as APIResponse, AsyncAPIResponse as AsyncAPIResponse +from ._constants import DEFAULT_TIMEOUT, DEFAULT_MAX_RETRIES, DEFAULT_CONNECTION_LIMITS +from ._exceptions import ( + APIError, + ConflictError, + NotFoundError, + APIStatusError, + RateLimitError, + APITimeoutError, + BadRequestError, + YdcSearchAPIError, + APIConnectionError, + AuthenticationError, + InternalServerError, + PermissionDeniedError, + UnprocessableEntityError, + APIResponseValidationError, +) +from ._base_client import DefaultHttpxClient, DefaultAioHttpClient, DefaultAsyncHttpxClient +from ._utils._logs import setup_logging as _setup_logging + +__all__ = [ + "types", + "__version__", + "__title__", + "NoneType", + "Transport", + "ProxiesTypes", + "NotGiven", + "NOT_GIVEN", + "Omit", + "YdcSearchAPIError", + "APIError", + "APIStatusError", + "APITimeoutError", + "APIConnectionError", + "APIResponseValidationError", + "BadRequestError", + "AuthenticationError", + "PermissionDeniedError", + "NotFoundError", + "ConflictError", + "UnprocessableEntityError", + "RateLimitError", + "InternalServerError", + "Timeout", + "RequestOptions", + "Client", + "AsyncClient", + "Stream", + "AsyncStream", + "YdcSearchAPI", + "AsyncYdcSearchAPI", + "file_from_path", + "BaseModel", + "DEFAULT_TIMEOUT", + "DEFAULT_MAX_RETRIES", + "DEFAULT_CONNECTION_LIMITS", + "DefaultHttpxClient", + "DefaultAsyncHttpxClient", + "DefaultAioHttpClient", +] + +if not _t.TYPE_CHECKING: + from ._utils._resources_proxy import resources as resources + +_setup_logging() + +# Update the __module__ attribute for exported symbols so that +# error messages point to this module instead of the module +# it was originally defined in, e.g. +# ydc_search_api._exceptions.NotFoundError -> ydc_search_api.NotFoundError +__locals = locals() +for __name in __all__: + if not __name.startswith("__"): + try: + __locals[__name].__module__ = "ydc_search_api" + except (TypeError, AttributeError): + # Some of our exported symbols are builtins which we can't set attributes for. + pass diff --git a/src/ydc_search_api/_base_client.py b/src/ydc_search_api/_base_client.py new file mode 100644 index 0000000..0acc4b0 --- /dev/null +++ b/src/ydc_search_api/_base_client.py @@ -0,0 +1,1985 @@ +from __future__ import annotations + +import sys +import json +import time +import uuid +import email +import asyncio +import inspect +import logging +import platform +import email.utils +from types import TracebackType +from random import random +from typing import ( + TYPE_CHECKING, + Any, + Dict, + Type, + Union, + Generic, + Mapping, + TypeVar, + Iterable, + Iterator, + Optional, + Generator, + AsyncIterator, + cast, + overload, +) +from typing_extensions import Literal, override, get_origin + +import anyio +import httpx +import distro +import pydantic +from httpx import URL +from pydantic import PrivateAttr + +from . import _exceptions +from ._qs import Querystring +from ._files import to_httpx_files, async_to_httpx_files +from ._types import ( + NOT_GIVEN, + Body, + Omit, + Query, + Headers, + Timeout, + NotGiven, + ResponseT, + AnyMapping, + PostParser, + RequestFiles, + HttpxSendArgs, + RequestOptions, + HttpxRequestFiles, + ModelBuilderProtocol, +) +from ._utils import is_dict, is_list, asyncify, is_given, lru_cache, is_mapping +from ._compat import PYDANTIC_V2, model_copy, model_dump +from ._models import GenericModel, FinalRequestOptions, validate_type, construct_type +from ._response import ( + APIResponse, + BaseAPIResponse, + AsyncAPIResponse, + extract_response_type, +) +from ._constants import ( + DEFAULT_TIMEOUT, + MAX_RETRY_DELAY, + DEFAULT_MAX_RETRIES, + INITIAL_RETRY_DELAY, + RAW_RESPONSE_HEADER, + OVERRIDE_CAST_TO_HEADER, + DEFAULT_CONNECTION_LIMITS, +) +from ._streaming import Stream, SSEDecoder, AsyncStream, SSEBytesDecoder +from ._exceptions import ( + APIStatusError, + APITimeoutError, + APIConnectionError, + APIResponseValidationError, +) + +log: logging.Logger = logging.getLogger(__name__) + +# TODO: make base page type vars covariant +SyncPageT = TypeVar("SyncPageT", bound="BaseSyncPage[Any]") +AsyncPageT = TypeVar("AsyncPageT", bound="BaseAsyncPage[Any]") + + +_T = TypeVar("_T") +_T_co = TypeVar("_T_co", covariant=True) + +_StreamT = TypeVar("_StreamT", bound=Stream[Any]) +_AsyncStreamT = TypeVar("_AsyncStreamT", bound=AsyncStream[Any]) + +if TYPE_CHECKING: + from httpx._config import ( + DEFAULT_TIMEOUT_CONFIG, # pyright: ignore[reportPrivateImportUsage] + ) + + HTTPX_DEFAULT_TIMEOUT = DEFAULT_TIMEOUT_CONFIG +else: + try: + from httpx._config import DEFAULT_TIMEOUT_CONFIG as HTTPX_DEFAULT_TIMEOUT + except ImportError: + # taken from https://github.com/encode/httpx/blob/3ba5fe0d7ac70222590e759c31442b1cab263791/httpx/_config.py#L366 + HTTPX_DEFAULT_TIMEOUT = Timeout(5.0) + + +class PageInfo: + """Stores the necessary information to build the request to retrieve the next page. + + Either `url` or `params` must be set. + """ + + url: URL | NotGiven + params: Query | NotGiven + json: Body | NotGiven + + @overload + def __init__( + self, + *, + url: URL, + ) -> None: ... + + @overload + def __init__( + self, + *, + params: Query, + ) -> None: ... + + @overload + def __init__( + self, + *, + json: Body, + ) -> None: ... + + def __init__( + self, + *, + url: URL | NotGiven = NOT_GIVEN, + json: Body | NotGiven = NOT_GIVEN, + params: Query | NotGiven = NOT_GIVEN, + ) -> None: + self.url = url + self.json = json + self.params = params + + @override + def __repr__(self) -> str: + if self.url: + return f"{self.__class__.__name__}(url={self.url})" + if self.json: + return f"{self.__class__.__name__}(json={self.json})" + return f"{self.__class__.__name__}(params={self.params})" + + +class BasePage(GenericModel, Generic[_T]): + """ + Defines the core interface for pagination. + + Type Args: + ModelT: The pydantic model that represents an item in the response. + + Methods: + has_next_page(): Check if there is another page available + next_page_info(): Get the necessary information to make a request for the next page + """ + + _options: FinalRequestOptions = PrivateAttr() + _model: Type[_T] = PrivateAttr() + + def has_next_page(self) -> bool: + items = self._get_page_items() + if not items: + return False + return self.next_page_info() is not None + + def next_page_info(self) -> Optional[PageInfo]: ... + + def _get_page_items(self) -> Iterable[_T]: # type: ignore[empty-body] + ... + + def _params_from_url(self, url: URL) -> httpx.QueryParams: + # TODO: do we have to preprocess params here? + return httpx.QueryParams(cast(Any, self._options.params)).merge(url.params) + + def _info_to_options(self, info: PageInfo) -> FinalRequestOptions: + options = model_copy(self._options) + options._strip_raw_response_header() + + if not isinstance(info.params, NotGiven): + options.params = {**options.params, **info.params} + return options + + if not isinstance(info.url, NotGiven): + params = self._params_from_url(info.url) + url = info.url.copy_with(params=params) + options.params = dict(url.params) + options.url = str(url) + return options + + if not isinstance(info.json, NotGiven): + if not is_mapping(info.json): + raise TypeError("Pagination is only supported with mappings") + + if not options.json_data: + options.json_data = {**info.json} + else: + if not is_mapping(options.json_data): + raise TypeError("Pagination is only supported with mappings") + + options.json_data = {**options.json_data, **info.json} + return options + + raise ValueError("Unexpected PageInfo state") + + +class BaseSyncPage(BasePage[_T], Generic[_T]): + _client: SyncAPIClient = pydantic.PrivateAttr() + + def _set_private_attributes( + self, + client: SyncAPIClient, + model: Type[_T], + options: FinalRequestOptions, + ) -> None: + if PYDANTIC_V2 and getattr(self, "__pydantic_private__", None) is None: + self.__pydantic_private__ = {} + + self._model = model + self._client = client + self._options = options + + # Pydantic uses a custom `__iter__` method to support casting BaseModels + # to dictionaries. e.g. dict(model). + # As we want to support `for item in page`, this is inherently incompatible + # with the default pydantic behaviour. It is not possible to support both + # use cases at once. Fortunately, this is not a big deal as all other pydantic + # methods should continue to work as expected as there is an alternative method + # to cast a model to a dictionary, model.dict(), which is used internally + # by pydantic. + def __iter__(self) -> Iterator[_T]: # type: ignore + for page in self.iter_pages(): + for item in page._get_page_items(): + yield item + + def iter_pages(self: SyncPageT) -> Iterator[SyncPageT]: + page = self + while True: + yield page + if page.has_next_page(): + page = page.get_next_page() + else: + return + + def get_next_page(self: SyncPageT) -> SyncPageT: + info = self.next_page_info() + if not info: + raise RuntimeError( + "No next page expected; please check `.has_next_page()` before calling `.get_next_page()`." + ) + + options = self._info_to_options(info) + return self._client._request_api_list(self._model, page=self.__class__, options=options) + + +class AsyncPaginator(Generic[_T, AsyncPageT]): + def __init__( + self, + client: AsyncAPIClient, + options: FinalRequestOptions, + page_cls: Type[AsyncPageT], + model: Type[_T], + ) -> None: + self._model = model + self._client = client + self._options = options + self._page_cls = page_cls + + def __await__(self) -> Generator[Any, None, AsyncPageT]: + return self._get_page().__await__() + + async def _get_page(self) -> AsyncPageT: + def _parser(resp: AsyncPageT) -> AsyncPageT: + resp._set_private_attributes( + model=self._model, + options=self._options, + client=self._client, + ) + return resp + + self._options.post_parser = _parser + + return await self._client.request(self._page_cls, self._options) + + async def __aiter__(self) -> AsyncIterator[_T]: + # https://github.com/microsoft/pyright/issues/3464 + page = cast( + AsyncPageT, + await self, # type: ignore + ) + async for item in page: + yield item + + +class BaseAsyncPage(BasePage[_T], Generic[_T]): + _client: AsyncAPIClient = pydantic.PrivateAttr() + + def _set_private_attributes( + self, + model: Type[_T], + client: AsyncAPIClient, + options: FinalRequestOptions, + ) -> None: + if PYDANTIC_V2 and getattr(self, "__pydantic_private__", None) is None: + self.__pydantic_private__ = {} + + self._model = model + self._client = client + self._options = options + + async def __aiter__(self) -> AsyncIterator[_T]: + async for page in self.iter_pages(): + for item in page._get_page_items(): + yield item + + async def iter_pages(self: AsyncPageT) -> AsyncIterator[AsyncPageT]: + page = self + while True: + yield page + if page.has_next_page(): + page = await page.get_next_page() + else: + return + + async def get_next_page(self: AsyncPageT) -> AsyncPageT: + info = self.next_page_info() + if not info: + raise RuntimeError( + "No next page expected; please check `.has_next_page()` before calling `.get_next_page()`." + ) + + options = self._info_to_options(info) + return await self._client._request_api_list(self._model, page=self.__class__, options=options) + + +_HttpxClientT = TypeVar("_HttpxClientT", bound=Union[httpx.Client, httpx.AsyncClient]) +_DefaultStreamT = TypeVar("_DefaultStreamT", bound=Union[Stream[Any], AsyncStream[Any]]) + + +class BaseClient(Generic[_HttpxClientT, _DefaultStreamT]): + _client: _HttpxClientT + _version: str + _base_url: URL + max_retries: int + timeout: Union[float, Timeout, None] + _strict_response_validation: bool + _idempotency_header: str | None + _default_stream_cls: type[_DefaultStreamT] | None = None + + def __init__( + self, + *, + version: str, + base_url: str | URL, + _strict_response_validation: bool, + max_retries: int = DEFAULT_MAX_RETRIES, + timeout: float | Timeout | None = DEFAULT_TIMEOUT, + custom_headers: Mapping[str, str] | None = None, + custom_query: Mapping[str, object] | None = None, + ) -> None: + self._version = version + self._base_url = self._enforce_trailing_slash(URL(base_url)) + self.max_retries = max_retries + self.timeout = timeout + self._custom_headers = custom_headers or {} + self._custom_query = custom_query or {} + self._strict_response_validation = _strict_response_validation + self._idempotency_header = None + self._platform: Platform | None = None + + if max_retries is None: # pyright: ignore[reportUnnecessaryComparison] + raise TypeError( + "max_retries cannot be None. If you want to disable retries, pass `0`; if you want unlimited retries, pass `math.inf` or a very high number; if you want the default behavior, pass `ydc_search_api.DEFAULT_MAX_RETRIES`" + ) + + def _enforce_trailing_slash(self, url: URL) -> URL: + if url.raw_path.endswith(b"/"): + return url + return url.copy_with(raw_path=url.raw_path + b"/") + + def _make_status_error_from_response( + self, + response: httpx.Response, + ) -> APIStatusError: + if response.is_closed and not response.is_stream_consumed: + # We can't read the response body as it has been closed + # before it was read. This can happen if an event hook + # raises a status error. + body = None + err_msg = f"Error code: {response.status_code}" + else: + err_text = response.text.strip() + body = err_text + + try: + body = json.loads(err_text) + err_msg = f"Error code: {response.status_code} - {body}" + except Exception: + err_msg = err_text or f"Error code: {response.status_code}" + + return self._make_status_error(err_msg, body=body, response=response) + + def _make_status_error( + self, + err_msg: str, + *, + body: object, + response: httpx.Response, + ) -> _exceptions.APIStatusError: + raise NotImplementedError() + + def _build_headers(self, options: FinalRequestOptions, *, retries_taken: int = 0) -> httpx.Headers: + custom_headers = options.headers or {} + headers_dict = _merge_mappings(self.default_headers, custom_headers) + self._validate_headers(headers_dict, custom_headers) + + # headers are case-insensitive while dictionaries are not. + headers = httpx.Headers(headers_dict) + + idempotency_header = self._idempotency_header + if idempotency_header and options.idempotency_key and idempotency_header not in headers: + headers[idempotency_header] = options.idempotency_key + + # Don't set these headers if they were already set or removed by the caller. We check + # `custom_headers`, which can contain `Omit()`, instead of `headers` to account for the removal case. + lower_custom_headers = [header.lower() for header in custom_headers] + if "x-stainless-retry-count" not in lower_custom_headers: + headers["x-stainless-retry-count"] = str(retries_taken) + if "x-stainless-read-timeout" not in lower_custom_headers: + timeout = self.timeout if isinstance(options.timeout, NotGiven) else options.timeout + if isinstance(timeout, Timeout): + timeout = timeout.read + if timeout is not None: + headers["x-stainless-read-timeout"] = str(timeout) + + return headers + + def _prepare_url(self, url: str) -> URL: + """ + Merge a URL argument together with any 'base_url' on the client, + to create the URL used for the outgoing request. + """ + # Copied from httpx's `_merge_url` method. + merge_url = URL(url) + if merge_url.is_relative_url: + merge_raw_path = self.base_url.raw_path + merge_url.raw_path.lstrip(b"/") + return self.base_url.copy_with(raw_path=merge_raw_path) + + return merge_url + + def _make_sse_decoder(self) -> SSEDecoder | SSEBytesDecoder: + return SSEDecoder() + + def _build_request( + self, + options: FinalRequestOptions, + *, + retries_taken: int = 0, + ) -> httpx.Request: + if log.isEnabledFor(logging.DEBUG): + log.debug("Request options: %s", model_dump(options, exclude_unset=True)) + + kwargs: dict[str, Any] = {} + + json_data = options.json_data + if options.extra_json is not None: + if json_data is None: + json_data = cast(Body, options.extra_json) + elif is_mapping(json_data): + json_data = _merge_mappings(json_data, options.extra_json) + else: + raise RuntimeError(f"Unexpected JSON data type, {type(json_data)}, cannot merge with `extra_body`") + + headers = self._build_headers(options, retries_taken=retries_taken) + params = _merge_mappings(self.default_query, options.params) + content_type = headers.get("Content-Type") + files = options.files + + # If the given Content-Type header is multipart/form-data then it + # has to be removed so that httpx can generate the header with + # additional information for us as it has to be in this form + # for the server to be able to correctly parse the request: + # multipart/form-data; boundary=---abc-- + if content_type is not None and content_type.startswith("multipart/form-data"): + if "boundary" not in content_type: + # only remove the header if the boundary hasn't been explicitly set + # as the caller doesn't want httpx to come up with their own boundary + headers.pop("Content-Type") + + # As we are now sending multipart/form-data instead of application/json + # we need to tell httpx to use it, https://www.python-httpx.org/advanced/clients/#multipart-file-encoding + if json_data: + if not is_dict(json_data): + raise TypeError( + f"Expected query input to be a dictionary for multipart requests but got {type(json_data)} instead." + ) + kwargs["data"] = self._serialize_multipartform(json_data) + + # httpx determines whether or not to send a "multipart/form-data" + # request based on the truthiness of the "files" argument. + # This gets around that issue by generating a dict value that + # evaluates to true. + # + # https://github.com/encode/httpx/discussions/2399#discussioncomment-3814186 + if not files: + files = cast(HttpxRequestFiles, ForceMultipartDict()) + + prepared_url = self._prepare_url(options.url) + if "_" in prepared_url.host: + # work around https://github.com/encode/httpx/discussions/2880 + kwargs["extensions"] = {"sni_hostname": prepared_url.host.replace("_", "-")} + + # TODO: report this error to httpx + return self._client.build_request( # pyright: ignore[reportUnknownMemberType] + headers=headers, + timeout=self.timeout if isinstance(options.timeout, NotGiven) else options.timeout, + method=options.method, + url=prepared_url, + # the `Query` type that we use is incompatible with qs' + # `Params` type as it needs to be typed as `Mapping[str, object]` + # so that passing a `TypedDict` doesn't cause an error. + # https://github.com/microsoft/pyright/issues/3526#event-6715453066 + params=self.qs.stringify(cast(Mapping[str, Any], params)) if params else None, + json=json_data if is_given(json_data) else None, + files=files, + **kwargs, + ) + + def _serialize_multipartform(self, data: Mapping[object, object]) -> dict[str, object]: + items = self.qs.stringify_items( + # TODO: type ignore is required as stringify_items is well typed but we can't be + # well typed without heavy validation. + data, # type: ignore + array_format="brackets", + ) + serialized: dict[str, object] = {} + for key, value in items: + existing = serialized.get(key) + + if not existing: + serialized[key] = value + continue + + # If a value has already been set for this key then that + # means we're sending data like `array[]=[1, 2, 3]` and we + # need to tell httpx that we want to send multiple values with + # the same key which is done by using a list or a tuple. + # + # Note: 2d arrays should never result in the same key at both + # levels so it's safe to assume that if the value is a list, + # it was because we changed it to be a list. + if is_list(existing): + existing.append(value) + else: + serialized[key] = [existing, value] + + return serialized + + def _maybe_override_cast_to(self, cast_to: type[ResponseT], options: FinalRequestOptions) -> type[ResponseT]: + if not is_given(options.headers): + return cast_to + + # make a copy of the headers so we don't mutate user-input + headers = dict(options.headers) + + # we internally support defining a temporary header to override the + # default `cast_to` type for use with `.with_raw_response` and `.with_streaming_response` + # see _response.py for implementation details + override_cast_to = headers.pop(OVERRIDE_CAST_TO_HEADER, NOT_GIVEN) + if is_given(override_cast_to): + options.headers = headers + return cast(Type[ResponseT], override_cast_to) + + return cast_to + + def _should_stream_response_body(self, request: httpx.Request) -> bool: + return request.headers.get(RAW_RESPONSE_HEADER) == "stream" # type: ignore[no-any-return] + + def _process_response_data( + self, + *, + data: object, + cast_to: type[ResponseT], + response: httpx.Response, + ) -> ResponseT: + if data is None: + return cast(ResponseT, None) + + if cast_to is object: + return cast(ResponseT, data) + + try: + if inspect.isclass(cast_to) and issubclass(cast_to, ModelBuilderProtocol): + return cast(ResponseT, cast_to.build(response=response, data=data)) + + if self._strict_response_validation: + return cast(ResponseT, validate_type(type_=cast_to, value=data)) + + return cast(ResponseT, construct_type(type_=cast_to, value=data)) + except pydantic.ValidationError as err: + raise APIResponseValidationError(response=response, body=data) from err + + @property + def qs(self) -> Querystring: + return Querystring() + + @property + def custom_auth(self) -> httpx.Auth | None: + return None + + @property + def auth_headers(self) -> dict[str, str]: + return {} + + @property + def default_headers(self) -> dict[str, str | Omit]: + return { + "Accept": "application/json", + "Content-Type": "application/json", + "User-Agent": self.user_agent, + **self.platform_headers(), + **self.auth_headers, + **self._custom_headers, + } + + @property + def default_query(self) -> dict[str, object]: + return { + **self._custom_query, + } + + def _validate_headers( + self, + headers: Headers, # noqa: ARG002 + custom_headers: Headers, # noqa: ARG002 + ) -> None: + """Validate the given default headers and custom headers. + + Does nothing by default. + """ + return + + @property + def user_agent(self) -> str: + return f"{self.__class__.__name__}/Python {self._version}" + + @property + def base_url(self) -> URL: + return self._base_url + + @base_url.setter + def base_url(self, url: URL | str) -> None: + self._base_url = self._enforce_trailing_slash(url if isinstance(url, URL) else URL(url)) + + def platform_headers(self) -> Dict[str, str]: + # the actual implementation is in a separate `lru_cache` decorated + # function because adding `lru_cache` to methods will leak memory + # https://github.com/python/cpython/issues/88476 + return platform_headers(self._version, platform=self._platform) + + def _parse_retry_after_header(self, response_headers: Optional[httpx.Headers] = None) -> float | None: + """Returns a float of the number of seconds (not milliseconds) to wait after retrying, or None if unspecified. + + About the Retry-After header: https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Retry-After + See also https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Retry-After#syntax + """ + if response_headers is None: + return None + + # First, try the non-standard `retry-after-ms` header for milliseconds, + # which is more precise than integer-seconds `retry-after` + try: + retry_ms_header = response_headers.get("retry-after-ms", None) + return float(retry_ms_header) / 1000 + except (TypeError, ValueError): + pass + + # Next, try parsing `retry-after` header as seconds (allowing nonstandard floats). + retry_header = response_headers.get("retry-after") + try: + # note: the spec indicates that this should only ever be an integer + # but if someone sends a float there's no reason for us to not respect it + return float(retry_header) + except (TypeError, ValueError): + pass + + # Last, try parsing `retry-after` as a date. + retry_date_tuple = email.utils.parsedate_tz(retry_header) + if retry_date_tuple is None: + return None + + retry_date = email.utils.mktime_tz(retry_date_tuple) + return float(retry_date - time.time()) + + def _calculate_retry_timeout( + self, + remaining_retries: int, + options: FinalRequestOptions, + response_headers: Optional[httpx.Headers] = None, + ) -> float: + max_retries = options.get_max_retries(self.max_retries) + + # If the API asks us to wait a certain amount of time (and it's a reasonable amount), just do what it says. + retry_after = self._parse_retry_after_header(response_headers) + if retry_after is not None and 0 < retry_after <= 60: + return retry_after + + # Also cap retry count to 1000 to avoid any potential overflows with `pow` + nb_retries = min(max_retries - remaining_retries, 1000) + + # Apply exponential backoff, but not more than the max. + sleep_seconds = min(INITIAL_RETRY_DELAY * pow(2.0, nb_retries), MAX_RETRY_DELAY) + + # Apply some jitter, plus-or-minus half a second. + jitter = 1 - 0.25 * random() + timeout = sleep_seconds * jitter + return timeout if timeout >= 0 else 0 + + def _should_retry(self, response: httpx.Response) -> bool: + # Note: this is not a standard header + should_retry_header = response.headers.get("x-should-retry") + + # If the server explicitly says whether or not to retry, obey. + if should_retry_header == "true": + log.debug("Retrying as header `x-should-retry` is set to `true`") + return True + if should_retry_header == "false": + log.debug("Not retrying as header `x-should-retry` is set to `false`") + return False + + # Retry on request timeouts. + if response.status_code == 408: + log.debug("Retrying due to status code %i", response.status_code) + return True + + # Retry on lock timeouts. + if response.status_code == 409: + log.debug("Retrying due to status code %i", response.status_code) + return True + + # Retry on rate limits. + if response.status_code == 429: + log.debug("Retrying due to status code %i", response.status_code) + return True + + # Retry internal errors. + if response.status_code >= 500: + log.debug("Retrying due to status code %i", response.status_code) + return True + + log.debug("Not retrying") + return False + + def _idempotency_key(self) -> str: + return f"stainless-python-retry-{uuid.uuid4()}" + + +class _DefaultHttpxClient(httpx.Client): + def __init__(self, **kwargs: Any) -> None: + kwargs.setdefault("timeout", DEFAULT_TIMEOUT) + kwargs.setdefault("limits", DEFAULT_CONNECTION_LIMITS) + kwargs.setdefault("follow_redirects", True) + super().__init__(**kwargs) + + +if TYPE_CHECKING: + DefaultHttpxClient = httpx.Client + """An alias to `httpx.Client` that provides the same defaults that this SDK + uses internally. + + This is useful because overriding the `http_client` with your own instance of + `httpx.Client` will result in httpx's defaults being used, not ours. + """ +else: + DefaultHttpxClient = _DefaultHttpxClient + + +class SyncHttpxClientWrapper(DefaultHttpxClient): + def __del__(self) -> None: + if self.is_closed: + return + + try: + self.close() + except Exception: + pass + + +class SyncAPIClient(BaseClient[httpx.Client, Stream[Any]]): + _client: httpx.Client + _default_stream_cls: type[Stream[Any]] | None = None + + def __init__( + self, + *, + version: str, + base_url: str | URL, + max_retries: int = DEFAULT_MAX_RETRIES, + timeout: float | Timeout | None | NotGiven = NOT_GIVEN, + http_client: httpx.Client | None = None, + custom_headers: Mapping[str, str] | None = None, + custom_query: Mapping[str, object] | None = None, + _strict_response_validation: bool, + ) -> None: + if not is_given(timeout): + # if the user passed in a custom http client with a non-default + # timeout set then we use that timeout. + # + # note: there is an edge case here where the user passes in a client + # where they've explicitly set the timeout to match the default timeout + # as this check is structural, meaning that we'll think they didn't + # pass in a timeout and will ignore it + if http_client and http_client.timeout != HTTPX_DEFAULT_TIMEOUT: + timeout = http_client.timeout + else: + timeout = DEFAULT_TIMEOUT + + if http_client is not None and not isinstance(http_client, httpx.Client): # pyright: ignore[reportUnnecessaryIsInstance] + raise TypeError( + f"Invalid `http_client` argument; Expected an instance of `httpx.Client` but got {type(http_client)}" + ) + + super().__init__( + version=version, + # cast to a valid type because mypy doesn't understand our type narrowing + timeout=cast(Timeout, timeout), + base_url=base_url, + max_retries=max_retries, + custom_query=custom_query, + custom_headers=custom_headers, + _strict_response_validation=_strict_response_validation, + ) + self._client = http_client or SyncHttpxClientWrapper( + base_url=base_url, + # cast to a valid type because mypy doesn't understand our type narrowing + timeout=cast(Timeout, timeout), + ) + + def is_closed(self) -> bool: + return self._client.is_closed + + def close(self) -> None: + """Close the underlying HTTPX client. + + The client will *not* be usable after this. + """ + # If an error is thrown while constructing a client, self._client + # may not be present + if hasattr(self, "_client"): + self._client.close() + + def __enter__(self: _T) -> _T: + return self + + def __exit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + self.close() + + def _prepare_options( + self, + options: FinalRequestOptions, # noqa: ARG002 + ) -> FinalRequestOptions: + """Hook for mutating the given options""" + return options + + def _prepare_request( + self, + request: httpx.Request, # noqa: ARG002 + ) -> None: + """This method is used as a callback for mutating the `Request` object + after it has been constructed. + This is useful for cases where you want to add certain headers based off of + the request properties, e.g. `url`, `method` etc. + """ + return None + + @overload + def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: Literal[True], + stream_cls: Type[_StreamT], + ) -> _StreamT: ... + + @overload + def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: bool = False, + stream_cls: Type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: ... + + def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: bool = False, + stream_cls: type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: + cast_to = self._maybe_override_cast_to(cast_to, options) + + # create a copy of the options we were given so that if the + # options are mutated later & we then retry, the retries are + # given the original options + input_options = model_copy(options) + if input_options.idempotency_key is None and input_options.method.lower() != "get": + # ensure the idempotency key is reused between requests + input_options.idempotency_key = self._idempotency_key() + + response: httpx.Response | None = None + max_retries = input_options.get_max_retries(self.max_retries) + + retries_taken = 0 + for retries_taken in range(max_retries + 1): + options = model_copy(input_options) + options = self._prepare_options(options) + + remaining_retries = max_retries - retries_taken + request = self._build_request(options, retries_taken=retries_taken) + self._prepare_request(request) + + kwargs: HttpxSendArgs = {} + if self.custom_auth is not None: + kwargs["auth"] = self.custom_auth + + if options.follow_redirects is not None: + kwargs["follow_redirects"] = options.follow_redirects + + log.debug("Sending HTTP Request: %s %s", request.method, request.url) + + response = None + try: + response = self._client.send( + request, + stream=stream or self._should_stream_response_body(request=request), + **kwargs, + ) + except httpx.TimeoutException as err: + log.debug("Encountered httpx.TimeoutException", exc_info=True) + + if remaining_retries > 0: + self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=None, + ) + continue + + log.debug("Raising timeout error") + raise APITimeoutError(request=request) from err + except Exception as err: + log.debug("Encountered Exception", exc_info=True) + + if remaining_retries > 0: + self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=None, + ) + continue + + log.debug("Raising connection error") + raise APIConnectionError(request=request) from err + + log.debug( + 'HTTP Response: %s %s "%i %s" %s', + request.method, + request.url, + response.status_code, + response.reason_phrase, + response.headers, + ) + + try: + response.raise_for_status() + except httpx.HTTPStatusError as err: # thrown on 4xx and 5xx status code + log.debug("Encountered httpx.HTTPStatusError", exc_info=True) + + if remaining_retries > 0 and self._should_retry(err.response): + err.response.close() + self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=response, + ) + continue + + # If the response is streamed then we need to explicitly read the response + # to completion before attempting to access the response text. + if not err.response.is_closed: + err.response.read() + + log.debug("Re-raising status error") + raise self._make_status_error_from_response(err.response) from None + + break + + assert response is not None, "could not resolve response (should never happen)" + return self._process_response( + cast_to=cast_to, + options=options, + response=response, + stream=stream, + stream_cls=stream_cls, + retries_taken=retries_taken, + ) + + def _sleep_for_retry( + self, *, retries_taken: int, max_retries: int, options: FinalRequestOptions, response: httpx.Response | None + ) -> None: + remaining_retries = max_retries - retries_taken + if remaining_retries == 1: + log.debug("1 retry left") + else: + log.debug("%i retries left", remaining_retries) + + timeout = self._calculate_retry_timeout(remaining_retries, options, response.headers if response else None) + log.info("Retrying request to %s in %f seconds", options.url, timeout) + + time.sleep(timeout) + + def _process_response( + self, + *, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + response: httpx.Response, + stream: bool, + stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None, + retries_taken: int = 0, + ) -> ResponseT: + origin = get_origin(cast_to) or cast_to + + if ( + inspect.isclass(origin) + and issubclass(origin, BaseAPIResponse) + # we only want to actually return the custom BaseAPIResponse class if we're + # returning the raw response, or if we're not streaming SSE, as if we're streaming + # SSE then `cast_to` doesn't actively reflect the type we need to parse into + and (not stream or bool(response.request.headers.get(RAW_RESPONSE_HEADER))) + ): + if not issubclass(origin, APIResponse): + raise TypeError(f"API Response types must subclass {APIResponse}; Received {origin}") + + response_cls = cast("type[BaseAPIResponse[Any]]", cast_to) + return cast( + ResponseT, + response_cls( + raw=response, + client=self, + cast_to=extract_response_type(response_cls), + stream=stream, + stream_cls=stream_cls, + options=options, + retries_taken=retries_taken, + ), + ) + + if cast_to == httpx.Response: + return cast(ResponseT, response) + + api_response = APIResponse( + raw=response, + client=self, + cast_to=cast("type[ResponseT]", cast_to), # pyright: ignore[reportUnnecessaryCast] + stream=stream, + stream_cls=stream_cls, + options=options, + retries_taken=retries_taken, + ) + if bool(response.request.headers.get(RAW_RESPONSE_HEADER)): + return cast(ResponseT, api_response) + + return api_response.parse() + + def _request_api_list( + self, + model: Type[object], + page: Type[SyncPageT], + options: FinalRequestOptions, + ) -> SyncPageT: + def _parser(resp: SyncPageT) -> SyncPageT: + resp._set_private_attributes( + client=self, + model=model, + options=options, + ) + return resp + + options.post_parser = _parser + + return self.request(page, options, stream=False) + + @overload + def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: Literal[True], + stream_cls: type[_StreamT], + ) -> _StreamT: ... + + @overload + def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: bool, + stream_cls: type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: ... + + def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: bool = False, + stream_cls: type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: + opts = FinalRequestOptions.construct(method="get", url=path, **options) + # cast is required because mypy complains about returning Any even though + # it understands the type variables + return cast(ResponseT, self.request(cast_to, opts, stream=stream, stream_cls=stream_cls)) + + @overload + def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + options: RequestOptions = {}, + files: RequestFiles | None = None, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + options: RequestOptions = {}, + files: RequestFiles | None = None, + stream: Literal[True], + stream_cls: type[_StreamT], + ) -> _StreamT: ... + + @overload + def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + options: RequestOptions = {}, + files: RequestFiles | None = None, + stream: bool, + stream_cls: type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: ... + + def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + options: RequestOptions = {}, + files: RequestFiles | None = None, + stream: bool = False, + stream_cls: type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: + opts = FinalRequestOptions.construct( + method="post", url=path, json_data=body, files=to_httpx_files(files), **options + ) + return cast(ResponseT, self.request(cast_to, opts, stream=stream, stream_cls=stream_cls)) + + def patch( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + opts = FinalRequestOptions.construct(method="patch", url=path, json_data=body, **options) + return self.request(cast_to, opts) + + def put( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + opts = FinalRequestOptions.construct( + method="put", url=path, json_data=body, files=to_httpx_files(files), **options + ) + return self.request(cast_to, opts) + + def delete( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + opts = FinalRequestOptions.construct(method="delete", url=path, json_data=body, **options) + return self.request(cast_to, opts) + + def get_api_list( + self, + path: str, + *, + model: Type[object], + page: Type[SyncPageT], + body: Body | None = None, + options: RequestOptions = {}, + method: str = "get", + ) -> SyncPageT: + opts = FinalRequestOptions.construct(method=method, url=path, json_data=body, **options) + return self._request_api_list(model, page, opts) + + +class _DefaultAsyncHttpxClient(httpx.AsyncClient): + def __init__(self, **kwargs: Any) -> None: + kwargs.setdefault("timeout", DEFAULT_TIMEOUT) + kwargs.setdefault("limits", DEFAULT_CONNECTION_LIMITS) + kwargs.setdefault("follow_redirects", True) + super().__init__(**kwargs) + + +try: + import httpx_aiohttp +except ImportError: + + class _DefaultAioHttpClient(httpx.AsyncClient): + def __init__(self, **_kwargs: Any) -> None: + raise RuntimeError("To use the aiohttp client you must have installed the package with the `aiohttp` extra") +else: + + class _DefaultAioHttpClient(httpx_aiohttp.HttpxAiohttpClient): # type: ignore + def __init__(self, **kwargs: Any) -> None: + kwargs.setdefault("timeout", DEFAULT_TIMEOUT) + kwargs.setdefault("limits", DEFAULT_CONNECTION_LIMITS) + kwargs.setdefault("follow_redirects", True) + + super().__init__(**kwargs) + + +if TYPE_CHECKING: + DefaultAsyncHttpxClient = httpx.AsyncClient + """An alias to `httpx.AsyncClient` that provides the same defaults that this SDK + uses internally. + + This is useful because overriding the `http_client` with your own instance of + `httpx.AsyncClient` will result in httpx's defaults being used, not ours. + """ + + DefaultAioHttpClient = httpx.AsyncClient + """An alias to `httpx.AsyncClient` that changes the default HTTP transport to `aiohttp`.""" +else: + DefaultAsyncHttpxClient = _DefaultAsyncHttpxClient + DefaultAioHttpClient = _DefaultAioHttpClient + + +class AsyncHttpxClientWrapper(DefaultAsyncHttpxClient): + def __del__(self) -> None: + if self.is_closed: + return + + try: + # TODO(someday): support non asyncio runtimes here + asyncio.get_running_loop().create_task(self.aclose()) + except Exception: + pass + + +class AsyncAPIClient(BaseClient[httpx.AsyncClient, AsyncStream[Any]]): + _client: httpx.AsyncClient + _default_stream_cls: type[AsyncStream[Any]] | None = None + + def __init__( + self, + *, + version: str, + base_url: str | URL, + _strict_response_validation: bool, + max_retries: int = DEFAULT_MAX_RETRIES, + timeout: float | Timeout | None | NotGiven = NOT_GIVEN, + http_client: httpx.AsyncClient | None = None, + custom_headers: Mapping[str, str] | None = None, + custom_query: Mapping[str, object] | None = None, + ) -> None: + if not is_given(timeout): + # if the user passed in a custom http client with a non-default + # timeout set then we use that timeout. + # + # note: there is an edge case here where the user passes in a client + # where they've explicitly set the timeout to match the default timeout + # as this check is structural, meaning that we'll think they didn't + # pass in a timeout and will ignore it + if http_client and http_client.timeout != HTTPX_DEFAULT_TIMEOUT: + timeout = http_client.timeout + else: + timeout = DEFAULT_TIMEOUT + + if http_client is not None and not isinstance(http_client, httpx.AsyncClient): # pyright: ignore[reportUnnecessaryIsInstance] + raise TypeError( + f"Invalid `http_client` argument; Expected an instance of `httpx.AsyncClient` but got {type(http_client)}" + ) + + super().__init__( + version=version, + base_url=base_url, + # cast to a valid type because mypy doesn't understand our type narrowing + timeout=cast(Timeout, timeout), + max_retries=max_retries, + custom_query=custom_query, + custom_headers=custom_headers, + _strict_response_validation=_strict_response_validation, + ) + self._client = http_client or AsyncHttpxClientWrapper( + base_url=base_url, + # cast to a valid type because mypy doesn't understand our type narrowing + timeout=cast(Timeout, timeout), + ) + + def is_closed(self) -> bool: + return self._client.is_closed + + async def close(self) -> None: + """Close the underlying HTTPX client. + + The client will *not* be usable after this. + """ + await self._client.aclose() + + async def __aenter__(self: _T) -> _T: + return self + + async def __aexit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + await self.close() + + async def _prepare_options( + self, + options: FinalRequestOptions, # noqa: ARG002 + ) -> FinalRequestOptions: + """Hook for mutating the given options""" + return options + + async def _prepare_request( + self, + request: httpx.Request, # noqa: ARG002 + ) -> None: + """This method is used as a callback for mutating the `Request` object + after it has been constructed. + This is useful for cases where you want to add certain headers based off of + the request properties, e.g. `url`, `method` etc. + """ + return None + + @overload + async def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + async def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: Literal[True], + stream_cls: type[_AsyncStreamT], + ) -> _AsyncStreamT: ... + + @overload + async def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: bool, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: ... + + async def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: bool = False, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: + if self._platform is None: + # `get_platform` can make blocking IO calls so we + # execute it earlier while we are in an async context + self._platform = await asyncify(get_platform)() + + cast_to = self._maybe_override_cast_to(cast_to, options) + + # create a copy of the options we were given so that if the + # options are mutated later & we then retry, the retries are + # given the original options + input_options = model_copy(options) + if input_options.idempotency_key is None and input_options.method.lower() != "get": + # ensure the idempotency key is reused between requests + input_options.idempotency_key = self._idempotency_key() + + response: httpx.Response | None = None + max_retries = input_options.get_max_retries(self.max_retries) + + retries_taken = 0 + for retries_taken in range(max_retries + 1): + options = model_copy(input_options) + options = await self._prepare_options(options) + + remaining_retries = max_retries - retries_taken + request = self._build_request(options, retries_taken=retries_taken) + await self._prepare_request(request) + + kwargs: HttpxSendArgs = {} + if self.custom_auth is not None: + kwargs["auth"] = self.custom_auth + + if options.follow_redirects is not None: + kwargs["follow_redirects"] = options.follow_redirects + + log.debug("Sending HTTP Request: %s %s", request.method, request.url) + + response = None + try: + response = await self._client.send( + request, + stream=stream or self._should_stream_response_body(request=request), + **kwargs, + ) + except httpx.TimeoutException as err: + log.debug("Encountered httpx.TimeoutException", exc_info=True) + + if remaining_retries > 0: + await self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=None, + ) + continue + + log.debug("Raising timeout error") + raise APITimeoutError(request=request) from err + except Exception as err: + log.debug("Encountered Exception", exc_info=True) + + if remaining_retries > 0: + await self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=None, + ) + continue + + log.debug("Raising connection error") + raise APIConnectionError(request=request) from err + + log.debug( + 'HTTP Response: %s %s "%i %s" %s', + request.method, + request.url, + response.status_code, + response.reason_phrase, + response.headers, + ) + + try: + response.raise_for_status() + except httpx.HTTPStatusError as err: # thrown on 4xx and 5xx status code + log.debug("Encountered httpx.HTTPStatusError", exc_info=True) + + if remaining_retries > 0 and self._should_retry(err.response): + await err.response.aclose() + await self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=response, + ) + continue + + # If the response is streamed then we need to explicitly read the response + # to completion before attempting to access the response text. + if not err.response.is_closed: + await err.response.aread() + + log.debug("Re-raising status error") + raise self._make_status_error_from_response(err.response) from None + + break + + assert response is not None, "could not resolve response (should never happen)" + return await self._process_response( + cast_to=cast_to, + options=options, + response=response, + stream=stream, + stream_cls=stream_cls, + retries_taken=retries_taken, + ) + + async def _sleep_for_retry( + self, *, retries_taken: int, max_retries: int, options: FinalRequestOptions, response: httpx.Response | None + ) -> None: + remaining_retries = max_retries - retries_taken + if remaining_retries == 1: + log.debug("1 retry left") + else: + log.debug("%i retries left", remaining_retries) + + timeout = self._calculate_retry_timeout(remaining_retries, options, response.headers if response else None) + log.info("Retrying request to %s in %f seconds", options.url, timeout) + + await anyio.sleep(timeout) + + async def _process_response( + self, + *, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + response: httpx.Response, + stream: bool, + stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None, + retries_taken: int = 0, + ) -> ResponseT: + origin = get_origin(cast_to) or cast_to + + if ( + inspect.isclass(origin) + and issubclass(origin, BaseAPIResponse) + # we only want to actually return the custom BaseAPIResponse class if we're + # returning the raw response, or if we're not streaming SSE, as if we're streaming + # SSE then `cast_to` doesn't actively reflect the type we need to parse into + and (not stream or bool(response.request.headers.get(RAW_RESPONSE_HEADER))) + ): + if not issubclass(origin, AsyncAPIResponse): + raise TypeError(f"API Response types must subclass {AsyncAPIResponse}; Received {origin}") + + response_cls = cast("type[BaseAPIResponse[Any]]", cast_to) + return cast( + "ResponseT", + response_cls( + raw=response, + client=self, + cast_to=extract_response_type(response_cls), + stream=stream, + stream_cls=stream_cls, + options=options, + retries_taken=retries_taken, + ), + ) + + if cast_to == httpx.Response: + return cast(ResponseT, response) + + api_response = AsyncAPIResponse( + raw=response, + client=self, + cast_to=cast("type[ResponseT]", cast_to), # pyright: ignore[reportUnnecessaryCast] + stream=stream, + stream_cls=stream_cls, + options=options, + retries_taken=retries_taken, + ) + if bool(response.request.headers.get(RAW_RESPONSE_HEADER)): + return cast(ResponseT, api_response) + + return await api_response.parse() + + def _request_api_list( + self, + model: Type[_T], + page: Type[AsyncPageT], + options: FinalRequestOptions, + ) -> AsyncPaginator[_T, AsyncPageT]: + return AsyncPaginator(client=self, options=options, page_cls=page, model=model) + + @overload + async def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + async def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: Literal[True], + stream_cls: type[_AsyncStreamT], + ) -> _AsyncStreamT: ... + + @overload + async def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: bool, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: ... + + async def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: bool = False, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: + opts = FinalRequestOptions.construct(method="get", url=path, **options) + return await self.request(cast_to, opts, stream=stream, stream_cls=stream_cls) + + @overload + async def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + async def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + stream: Literal[True], + stream_cls: type[_AsyncStreamT], + ) -> _AsyncStreamT: ... + + @overload + async def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + stream: bool, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: ... + + async def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + stream: bool = False, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: + opts = FinalRequestOptions.construct( + method="post", url=path, json_data=body, files=await async_to_httpx_files(files), **options + ) + return await self.request(cast_to, opts, stream=stream, stream_cls=stream_cls) + + async def patch( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + opts = FinalRequestOptions.construct(method="patch", url=path, json_data=body, **options) + return await self.request(cast_to, opts) + + async def put( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + opts = FinalRequestOptions.construct( + method="put", url=path, json_data=body, files=await async_to_httpx_files(files), **options + ) + return await self.request(cast_to, opts) + + async def delete( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + opts = FinalRequestOptions.construct(method="delete", url=path, json_data=body, **options) + return await self.request(cast_to, opts) + + def get_api_list( + self, + path: str, + *, + model: Type[_T], + page: Type[AsyncPageT], + body: Body | None = None, + options: RequestOptions = {}, + method: str = "get", + ) -> AsyncPaginator[_T, AsyncPageT]: + opts = FinalRequestOptions.construct(method=method, url=path, json_data=body, **options) + return self._request_api_list(model, page, opts) + + +def make_request_options( + *, + query: Query | None = None, + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + idempotency_key: str | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + post_parser: PostParser | NotGiven = NOT_GIVEN, +) -> RequestOptions: + """Create a dict of type RequestOptions without keys of NotGiven values.""" + options: RequestOptions = {} + if extra_headers is not None: + options["headers"] = extra_headers + + if extra_body is not None: + options["extra_json"] = cast(AnyMapping, extra_body) + + if query is not None: + options["params"] = query + + if extra_query is not None: + options["params"] = {**options.get("params", {}), **extra_query} + + if not isinstance(timeout, NotGiven): + options["timeout"] = timeout + + if idempotency_key is not None: + options["idempotency_key"] = idempotency_key + + if is_given(post_parser): + # internal + options["post_parser"] = post_parser # type: ignore + + return options + + +class ForceMultipartDict(Dict[str, None]): + def __bool__(self) -> bool: + return True + + +class OtherPlatform: + def __init__(self, name: str) -> None: + self.name = name + + @override + def __str__(self) -> str: + return f"Other:{self.name}" + + +Platform = Union[ + OtherPlatform, + Literal[ + "MacOS", + "Linux", + "Windows", + "FreeBSD", + "OpenBSD", + "iOS", + "Android", + "Unknown", + ], +] + + +def get_platform() -> Platform: + try: + system = platform.system().lower() + platform_name = platform.platform().lower() + except Exception: + return "Unknown" + + if "iphone" in platform_name or "ipad" in platform_name: + # Tested using Python3IDE on an iPhone 11 and Pythonista on an iPad 7 + # system is Darwin and platform_name is a string like: + # - Darwin-21.6.0-iPhone12,1-64bit + # - Darwin-21.6.0-iPad7,11-64bit + return "iOS" + + if system == "darwin": + return "MacOS" + + if system == "windows": + return "Windows" + + if "android" in platform_name: + # Tested using Pydroid 3 + # system is Linux and platform_name is a string like 'Linux-5.10.81-android12-9-00001-geba40aecb3b7-ab8534902-aarch64-with-libc' + return "Android" + + if system == "linux": + # https://distro.readthedocs.io/en/latest/#distro.id + distro_id = distro.id() + if distro_id == "freebsd": + return "FreeBSD" + + if distro_id == "openbsd": + return "OpenBSD" + + return "Linux" + + if platform_name: + return OtherPlatform(platform_name) + + return "Unknown" + + +@lru_cache(maxsize=None) +def platform_headers(version: str, *, platform: Platform | None) -> Dict[str, str]: + return { + "X-Stainless-Lang": "python", + "X-Stainless-Package-Version": version, + "X-Stainless-OS": str(platform or get_platform()), + "X-Stainless-Arch": str(get_architecture()), + "X-Stainless-Runtime": get_python_runtime(), + "X-Stainless-Runtime-Version": get_python_version(), + } + + +class OtherArch: + def __init__(self, name: str) -> None: + self.name = name + + @override + def __str__(self) -> str: + return f"other:{self.name}" + + +Arch = Union[OtherArch, Literal["x32", "x64", "arm", "arm64", "unknown"]] + + +def get_python_runtime() -> str: + try: + return platform.python_implementation() + except Exception: + return "unknown" + + +def get_python_version() -> str: + try: + return platform.python_version() + except Exception: + return "unknown" + + +def get_architecture() -> Arch: + try: + machine = platform.machine().lower() + except Exception: + return "unknown" + + if machine in ("arm64", "aarch64"): + return "arm64" + + # TODO: untested + if machine == "arm": + return "arm" + + if machine == "x86_64": + return "x64" + + # TODO: untested + if sys.maxsize <= 2**32: + return "x32" + + if machine: + return OtherArch(machine) + + return "unknown" + + +def _merge_mappings( + obj1: Mapping[_T_co, Union[_T, Omit]], + obj2: Mapping[_T_co, Union[_T, Omit]], +) -> Dict[_T_co, _T]: + """Merge two mappings of the same type, removing any values that are instances of `Omit`. + + In cases with duplicate keys the second mapping takes precedence. + """ + merged = {**obj1, **obj2} + return {key: value for key, value in merged.items() if not isinstance(value, Omit)} diff --git a/src/ydc_search_api/_client.py b/src/ydc_search_api/_client.py new file mode 100644 index 0000000..90d81c8 --- /dev/null +++ b/src/ydc_search_api/_client.py @@ -0,0 +1,411 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +from typing import Any, Union, Mapping +from typing_extensions import Self, override + +import httpx + +from . import _exceptions +from ._qs import Querystring +from ._types import ( + NOT_GIVEN, + Omit, + Timeout, + NotGiven, + Transport, + ProxiesTypes, + RequestOptions, +) +from ._utils import is_given, get_async_library +from ._version import __version__ +from .resources import news, search +from ._streaming import Stream as Stream, AsyncStream as AsyncStream +from ._exceptions import APIStatusError, YdcSearchAPIError +from ._base_client import ( + DEFAULT_MAX_RETRIES, + SyncAPIClient, + AsyncAPIClient, +) + +__all__ = [ + "Timeout", + "Transport", + "ProxiesTypes", + "RequestOptions", + "YdcSearchAPI", + "AsyncYdcSearchAPI", + "Client", + "AsyncClient", +] + + +class YdcSearchAPI(SyncAPIClient): + search: search.SearchResource + news: news.NewsResource + with_raw_response: YdcSearchAPIWithRawResponse + with_streaming_response: YdcSearchAPIWithStreamedResponse + + # client options + api_key: str + + def __init__( + self, + *, + api_key: str | None = None, + base_url: str | httpx.URL | None = None, + timeout: Union[float, Timeout, None, NotGiven] = NOT_GIVEN, + max_retries: int = DEFAULT_MAX_RETRIES, + default_headers: Mapping[str, str] | None = None, + default_query: Mapping[str, object] | None = None, + # Configure a custom httpx client. + # We provide a `DefaultHttpxClient` class that you can pass to retain the default values we use for `limits`, `timeout` & `follow_redirects`. + # See the [httpx documentation](https://www.python-httpx.org/api/#client) for more details. + http_client: httpx.Client | None = None, + # Enable or disable schema validation for data returned by the API. + # When enabled an error APIResponseValidationError is raised + # if the API responds with invalid data for the expected schema. + # + # This parameter may be removed or changed in the future. + # If you rely on this feature, please open a GitHub issue + # outlining your use-case to help us decide if it should be + # part of our public interface in the future. + _strict_response_validation: bool = False, + ) -> None: + """Construct a new synchronous YdcSearchAPI client instance. + + This automatically infers the `api_key` argument from the `YDC_SEARCH_API_API_KEY` environment variable if it is not provided. + """ + if api_key is None: + api_key = os.environ.get("YDC_SEARCH_API_API_KEY") + if api_key is None: + raise YdcSearchAPIError( + "The api_key client option must be set either by passing api_key to the client or by setting the YDC_SEARCH_API_API_KEY environment variable" + ) + self.api_key = api_key + + if base_url is None: + base_url = os.environ.get("YDC_SEARCH_API_BASE_URL") + if base_url is None: + base_url = f"https://api.ydc-index.io" + + super().__init__( + version=__version__, + base_url=base_url, + max_retries=max_retries, + timeout=timeout, + http_client=http_client, + custom_headers=default_headers, + custom_query=default_query, + _strict_response_validation=_strict_response_validation, + ) + + self.search = search.SearchResource(self) + self.news = news.NewsResource(self) + self.with_raw_response = YdcSearchAPIWithRawResponse(self) + self.with_streaming_response = YdcSearchAPIWithStreamedResponse(self) + + @property + @override + def qs(self) -> Querystring: + return Querystring(array_format="comma") + + @property + @override + def auth_headers(self) -> dict[str, str]: + api_key = self.api_key + return {"X-API-Key": api_key} + + @property + @override + def default_headers(self) -> dict[str, str | Omit]: + return { + **super().default_headers, + "X-Stainless-Async": "false", + **self._custom_headers, + } + + def copy( + self, + *, + api_key: str | None = None, + base_url: str | httpx.URL | None = None, + timeout: float | Timeout | None | NotGiven = NOT_GIVEN, + http_client: httpx.Client | None = None, + max_retries: int | NotGiven = NOT_GIVEN, + default_headers: Mapping[str, str] | None = None, + set_default_headers: Mapping[str, str] | None = None, + default_query: Mapping[str, object] | None = None, + set_default_query: Mapping[str, object] | None = None, + _extra_kwargs: Mapping[str, Any] = {}, + ) -> Self: + """ + Create a new client instance re-using the same options given to the current client with optional overriding. + """ + if default_headers is not None and set_default_headers is not None: + raise ValueError("The `default_headers` and `set_default_headers` arguments are mutually exclusive") + + if default_query is not None and set_default_query is not None: + raise ValueError("The `default_query` and `set_default_query` arguments are mutually exclusive") + + headers = self._custom_headers + if default_headers is not None: + headers = {**headers, **default_headers} + elif set_default_headers is not None: + headers = set_default_headers + + params = self._custom_query + if default_query is not None: + params = {**params, **default_query} + elif set_default_query is not None: + params = set_default_query + + http_client = http_client or self._client + return self.__class__( + api_key=api_key or self.api_key, + base_url=base_url or self.base_url, + timeout=self.timeout if isinstance(timeout, NotGiven) else timeout, + http_client=http_client, + max_retries=max_retries if is_given(max_retries) else self.max_retries, + default_headers=headers, + default_query=params, + **_extra_kwargs, + ) + + # Alias for `copy` for nicer inline usage, e.g. + # client.with_options(timeout=10).foo.create(...) + with_options = copy + + @override + def _make_status_error( + self, + err_msg: str, + *, + body: object, + response: httpx.Response, + ) -> APIStatusError: + if response.status_code == 400: + return _exceptions.BadRequestError(err_msg, response=response, body=body) + + if response.status_code == 401: + return _exceptions.AuthenticationError(err_msg, response=response, body=body) + + if response.status_code == 403: + return _exceptions.PermissionDeniedError(err_msg, response=response, body=body) + + if response.status_code == 404: + return _exceptions.NotFoundError(err_msg, response=response, body=body) + + if response.status_code == 409: + return _exceptions.ConflictError(err_msg, response=response, body=body) + + if response.status_code == 422: + return _exceptions.UnprocessableEntityError(err_msg, response=response, body=body) + + if response.status_code == 429: + return _exceptions.RateLimitError(err_msg, response=response, body=body) + + if response.status_code >= 500: + return _exceptions.InternalServerError(err_msg, response=response, body=body) + return APIStatusError(err_msg, response=response, body=body) + + +class AsyncYdcSearchAPI(AsyncAPIClient): + search: search.AsyncSearchResource + news: news.AsyncNewsResource + with_raw_response: AsyncYdcSearchAPIWithRawResponse + with_streaming_response: AsyncYdcSearchAPIWithStreamedResponse + + # client options + api_key: str + + def __init__( + self, + *, + api_key: str | None = None, + base_url: str | httpx.URL | None = None, + timeout: Union[float, Timeout, None, NotGiven] = NOT_GIVEN, + max_retries: int = DEFAULT_MAX_RETRIES, + default_headers: Mapping[str, str] | None = None, + default_query: Mapping[str, object] | None = None, + # Configure a custom httpx client. + # We provide a `DefaultAsyncHttpxClient` class that you can pass to retain the default values we use for `limits`, `timeout` & `follow_redirects`. + # See the [httpx documentation](https://www.python-httpx.org/api/#asyncclient) for more details. + http_client: httpx.AsyncClient | None = None, + # Enable or disable schema validation for data returned by the API. + # When enabled an error APIResponseValidationError is raised + # if the API responds with invalid data for the expected schema. + # + # This parameter may be removed or changed in the future. + # If you rely on this feature, please open a GitHub issue + # outlining your use-case to help us decide if it should be + # part of our public interface in the future. + _strict_response_validation: bool = False, + ) -> None: + """Construct a new async AsyncYdcSearchAPI client instance. + + This automatically infers the `api_key` argument from the `YDC_SEARCH_API_API_KEY` environment variable if it is not provided. + """ + if api_key is None: + api_key = os.environ.get("YDC_SEARCH_API_API_KEY") + if api_key is None: + raise YdcSearchAPIError( + "The api_key client option must be set either by passing api_key to the client or by setting the YDC_SEARCH_API_API_KEY environment variable" + ) + self.api_key = api_key + + if base_url is None: + base_url = os.environ.get("YDC_SEARCH_API_BASE_URL") + if base_url is None: + base_url = f"https://api.ydc-index.io" + + super().__init__( + version=__version__, + base_url=base_url, + max_retries=max_retries, + timeout=timeout, + http_client=http_client, + custom_headers=default_headers, + custom_query=default_query, + _strict_response_validation=_strict_response_validation, + ) + + self.search = search.AsyncSearchResource(self) + self.news = news.AsyncNewsResource(self) + self.with_raw_response = AsyncYdcSearchAPIWithRawResponse(self) + self.with_streaming_response = AsyncYdcSearchAPIWithStreamedResponse(self) + + @property + @override + def qs(self) -> Querystring: + return Querystring(array_format="comma") + + @property + @override + def auth_headers(self) -> dict[str, str]: + api_key = self.api_key + return {"X-API-Key": api_key} + + @property + @override + def default_headers(self) -> dict[str, str | Omit]: + return { + **super().default_headers, + "X-Stainless-Async": f"async:{get_async_library()}", + **self._custom_headers, + } + + def copy( + self, + *, + api_key: str | None = None, + base_url: str | httpx.URL | None = None, + timeout: float | Timeout | None | NotGiven = NOT_GIVEN, + http_client: httpx.AsyncClient | None = None, + max_retries: int | NotGiven = NOT_GIVEN, + default_headers: Mapping[str, str] | None = None, + set_default_headers: Mapping[str, str] | None = None, + default_query: Mapping[str, object] | None = None, + set_default_query: Mapping[str, object] | None = None, + _extra_kwargs: Mapping[str, Any] = {}, + ) -> Self: + """ + Create a new client instance re-using the same options given to the current client with optional overriding. + """ + if default_headers is not None and set_default_headers is not None: + raise ValueError("The `default_headers` and `set_default_headers` arguments are mutually exclusive") + + if default_query is not None and set_default_query is not None: + raise ValueError("The `default_query` and `set_default_query` arguments are mutually exclusive") + + headers = self._custom_headers + if default_headers is not None: + headers = {**headers, **default_headers} + elif set_default_headers is not None: + headers = set_default_headers + + params = self._custom_query + if default_query is not None: + params = {**params, **default_query} + elif set_default_query is not None: + params = set_default_query + + http_client = http_client or self._client + return self.__class__( + api_key=api_key or self.api_key, + base_url=base_url or self.base_url, + timeout=self.timeout if isinstance(timeout, NotGiven) else timeout, + http_client=http_client, + max_retries=max_retries if is_given(max_retries) else self.max_retries, + default_headers=headers, + default_query=params, + **_extra_kwargs, + ) + + # Alias for `copy` for nicer inline usage, e.g. + # client.with_options(timeout=10).foo.create(...) + with_options = copy + + @override + def _make_status_error( + self, + err_msg: str, + *, + body: object, + response: httpx.Response, + ) -> APIStatusError: + if response.status_code == 400: + return _exceptions.BadRequestError(err_msg, response=response, body=body) + + if response.status_code == 401: + return _exceptions.AuthenticationError(err_msg, response=response, body=body) + + if response.status_code == 403: + return _exceptions.PermissionDeniedError(err_msg, response=response, body=body) + + if response.status_code == 404: + return _exceptions.NotFoundError(err_msg, response=response, body=body) + + if response.status_code == 409: + return _exceptions.ConflictError(err_msg, response=response, body=body) + + if response.status_code == 422: + return _exceptions.UnprocessableEntityError(err_msg, response=response, body=body) + + if response.status_code == 429: + return _exceptions.RateLimitError(err_msg, response=response, body=body) + + if response.status_code >= 500: + return _exceptions.InternalServerError(err_msg, response=response, body=body) + return APIStatusError(err_msg, response=response, body=body) + + +class YdcSearchAPIWithRawResponse: + def __init__(self, client: YdcSearchAPI) -> None: + self.search = search.SearchResourceWithRawResponse(client.search) + self.news = news.NewsResourceWithRawResponse(client.news) + + +class AsyncYdcSearchAPIWithRawResponse: + def __init__(self, client: AsyncYdcSearchAPI) -> None: + self.search = search.AsyncSearchResourceWithRawResponse(client.search) + self.news = news.AsyncNewsResourceWithRawResponse(client.news) + + +class YdcSearchAPIWithStreamedResponse: + def __init__(self, client: YdcSearchAPI) -> None: + self.search = search.SearchResourceWithStreamingResponse(client.search) + self.news = news.NewsResourceWithStreamingResponse(client.news) + + +class AsyncYdcSearchAPIWithStreamedResponse: + def __init__(self, client: AsyncYdcSearchAPI) -> None: + self.search = search.AsyncSearchResourceWithStreamingResponse(client.search) + self.news = news.AsyncNewsResourceWithStreamingResponse(client.news) + + +Client = YdcSearchAPI + +AsyncClient = AsyncYdcSearchAPI diff --git a/src/ydc_search_api/_compat.py b/src/ydc_search_api/_compat.py new file mode 100644 index 0000000..92d9ee6 --- /dev/null +++ b/src/ydc_search_api/_compat.py @@ -0,0 +1,219 @@ +from __future__ import annotations + +from typing import TYPE_CHECKING, Any, Union, Generic, TypeVar, Callable, cast, overload +from datetime import date, datetime +from typing_extensions import Self, Literal + +import pydantic +from pydantic.fields import FieldInfo + +from ._types import IncEx, StrBytesIntFloat + +_T = TypeVar("_T") +_ModelT = TypeVar("_ModelT", bound=pydantic.BaseModel) + +# --------------- Pydantic v2 compatibility --------------- + +# Pyright incorrectly reports some of our functions as overriding a method when they don't +# pyright: reportIncompatibleMethodOverride=false + +PYDANTIC_V2 = pydantic.VERSION.startswith("2.") + +# v1 re-exports +if TYPE_CHECKING: + + def parse_date(value: date | StrBytesIntFloat) -> date: # noqa: ARG001 + ... + + def parse_datetime(value: Union[datetime, StrBytesIntFloat]) -> datetime: # noqa: ARG001 + ... + + def get_args(t: type[Any]) -> tuple[Any, ...]: # noqa: ARG001 + ... + + def is_union(tp: type[Any] | None) -> bool: # noqa: ARG001 + ... + + def get_origin(t: type[Any]) -> type[Any] | None: # noqa: ARG001 + ... + + def is_literal_type(type_: type[Any]) -> bool: # noqa: ARG001 + ... + + def is_typeddict(type_: type[Any]) -> bool: # noqa: ARG001 + ... + +else: + if PYDANTIC_V2: + from pydantic.v1.typing import ( + get_args as get_args, + is_union as is_union, + get_origin as get_origin, + is_typeddict as is_typeddict, + is_literal_type as is_literal_type, + ) + from pydantic.v1.datetime_parse import parse_date as parse_date, parse_datetime as parse_datetime + else: + from pydantic.typing import ( + get_args as get_args, + is_union as is_union, + get_origin as get_origin, + is_typeddict as is_typeddict, + is_literal_type as is_literal_type, + ) + from pydantic.datetime_parse import parse_date as parse_date, parse_datetime as parse_datetime + + +# refactored config +if TYPE_CHECKING: + from pydantic import ConfigDict as ConfigDict +else: + if PYDANTIC_V2: + from pydantic import ConfigDict + else: + # TODO: provide an error message here? + ConfigDict = None + + +# renamed methods / properties +def parse_obj(model: type[_ModelT], value: object) -> _ModelT: + if PYDANTIC_V2: + return model.model_validate(value) + else: + return cast(_ModelT, model.parse_obj(value)) # pyright: ignore[reportDeprecated, reportUnnecessaryCast] + + +def field_is_required(field: FieldInfo) -> bool: + if PYDANTIC_V2: + return field.is_required() + return field.required # type: ignore + + +def field_get_default(field: FieldInfo) -> Any: + value = field.get_default() + if PYDANTIC_V2: + from pydantic_core import PydanticUndefined + + if value == PydanticUndefined: + return None + return value + return value + + +def field_outer_type(field: FieldInfo) -> Any: + if PYDANTIC_V2: + return field.annotation + return field.outer_type_ # type: ignore + + +def get_model_config(model: type[pydantic.BaseModel]) -> Any: + if PYDANTIC_V2: + return model.model_config + return model.__config__ # type: ignore + + +def get_model_fields(model: type[pydantic.BaseModel]) -> dict[str, FieldInfo]: + if PYDANTIC_V2: + return model.model_fields + return model.__fields__ # type: ignore + + +def model_copy(model: _ModelT, *, deep: bool = False) -> _ModelT: + if PYDANTIC_V2: + return model.model_copy(deep=deep) + return model.copy(deep=deep) # type: ignore + + +def model_json(model: pydantic.BaseModel, *, indent: int | None = None) -> str: + if PYDANTIC_V2: + return model.model_dump_json(indent=indent) + return model.json(indent=indent) # type: ignore + + +def model_dump( + model: pydantic.BaseModel, + *, + exclude: IncEx | None = None, + exclude_unset: bool = False, + exclude_defaults: bool = False, + warnings: bool = True, + mode: Literal["json", "python"] = "python", +) -> dict[str, Any]: + if PYDANTIC_V2 or hasattr(model, "model_dump"): + return model.model_dump( + mode=mode, + exclude=exclude, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + # warnings are not supported in Pydantic v1 + warnings=warnings if PYDANTIC_V2 else True, + ) + return cast( + "dict[str, Any]", + model.dict( # pyright: ignore[reportDeprecated, reportUnnecessaryCast] + exclude=exclude, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + ), + ) + + +def model_parse(model: type[_ModelT], data: Any) -> _ModelT: + if PYDANTIC_V2: + return model.model_validate(data) + return model.parse_obj(data) # pyright: ignore[reportDeprecated] + + +# generic models +if TYPE_CHECKING: + + class GenericModel(pydantic.BaseModel): ... + +else: + if PYDANTIC_V2: + # there no longer needs to be a distinction in v2 but + # we still have to create our own subclass to avoid + # inconsistent MRO ordering errors + class GenericModel(pydantic.BaseModel): ... + + else: + import pydantic.generics + + class GenericModel(pydantic.generics.GenericModel, pydantic.BaseModel): ... + + +# cached properties +if TYPE_CHECKING: + cached_property = property + + # we define a separate type (copied from typeshed) + # that represents that `cached_property` is `set`able + # at runtime, which differs from `@property`. + # + # this is a separate type as editors likely special case + # `@property` and we don't want to cause issues just to have + # more helpful internal types. + + class typed_cached_property(Generic[_T]): + func: Callable[[Any], _T] + attrname: str | None + + def __init__(self, func: Callable[[Any], _T]) -> None: ... + + @overload + def __get__(self, instance: None, owner: type[Any] | None = None) -> Self: ... + + @overload + def __get__(self, instance: object, owner: type[Any] | None = None) -> _T: ... + + def __get__(self, instance: object, owner: type[Any] | None = None) -> _T | Self: + raise NotImplementedError() + + def __set_name__(self, owner: type[Any], name: str) -> None: ... + + # __set__ is not defined at runtime, but @cached_property is designed to be settable + def __set__(self, instance: object, value: _T) -> None: ... +else: + from functools import cached_property as cached_property + + typed_cached_property = cached_property diff --git a/src/ydc_search_api/_constants.py b/src/ydc_search_api/_constants.py new file mode 100644 index 0000000..6ddf2c7 --- /dev/null +++ b/src/ydc_search_api/_constants.py @@ -0,0 +1,14 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +import httpx + +RAW_RESPONSE_HEADER = "X-Stainless-Raw-Response" +OVERRIDE_CAST_TO_HEADER = "____stainless_override_cast_to" + +# default timeout is 1 minute +DEFAULT_TIMEOUT = httpx.Timeout(timeout=60, connect=5.0) +DEFAULT_MAX_RETRIES = 2 +DEFAULT_CONNECTION_LIMITS = httpx.Limits(max_connections=100, max_keepalive_connections=20) + +INITIAL_RETRY_DELAY = 0.5 +MAX_RETRY_DELAY = 8.0 diff --git a/src/ydc_search_api/_exceptions.py b/src/ydc_search_api/_exceptions.py new file mode 100644 index 0000000..f1e1d22 --- /dev/null +++ b/src/ydc_search_api/_exceptions.py @@ -0,0 +1,108 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing_extensions import Literal + +import httpx + +__all__ = [ + "BadRequestError", + "AuthenticationError", + "PermissionDeniedError", + "NotFoundError", + "ConflictError", + "UnprocessableEntityError", + "RateLimitError", + "InternalServerError", +] + + +class YdcSearchAPIError(Exception): + pass + + +class APIError(YdcSearchAPIError): + message: str + request: httpx.Request + + body: object | None + """The API response body. + + If the API responded with a valid JSON structure then this property will be the + decoded result. + + If it isn't a valid JSON structure then this will be the raw response. + + If there was no response associated with this error then it will be `None`. + """ + + def __init__(self, message: str, request: httpx.Request, *, body: object | None) -> None: # noqa: ARG002 + super().__init__(message) + self.request = request + self.message = message + self.body = body + + +class APIResponseValidationError(APIError): + response: httpx.Response + status_code: int + + def __init__(self, response: httpx.Response, body: object | None, *, message: str | None = None) -> None: + super().__init__(message or "Data returned by API invalid for expected schema.", response.request, body=body) + self.response = response + self.status_code = response.status_code + + +class APIStatusError(APIError): + """Raised when an API response has a status code of 4xx or 5xx.""" + + response: httpx.Response + status_code: int + + def __init__(self, message: str, *, response: httpx.Response, body: object | None) -> None: + super().__init__(message, response.request, body=body) + self.response = response + self.status_code = response.status_code + + +class APIConnectionError(APIError): + def __init__(self, *, message: str = "Connection error.", request: httpx.Request) -> None: + super().__init__(message, request, body=None) + + +class APITimeoutError(APIConnectionError): + def __init__(self, request: httpx.Request) -> None: + super().__init__(message="Request timed out.", request=request) + + +class BadRequestError(APIStatusError): + status_code: Literal[400] = 400 # pyright: ignore[reportIncompatibleVariableOverride] + + +class AuthenticationError(APIStatusError): + status_code: Literal[401] = 401 # pyright: ignore[reportIncompatibleVariableOverride] + + +class PermissionDeniedError(APIStatusError): + status_code: Literal[403] = 403 # pyright: ignore[reportIncompatibleVariableOverride] + + +class NotFoundError(APIStatusError): + status_code: Literal[404] = 404 # pyright: ignore[reportIncompatibleVariableOverride] + + +class ConflictError(APIStatusError): + status_code: Literal[409] = 409 # pyright: ignore[reportIncompatibleVariableOverride] + + +class UnprocessableEntityError(APIStatusError): + status_code: Literal[422] = 422 # pyright: ignore[reportIncompatibleVariableOverride] + + +class RateLimitError(APIStatusError): + status_code: Literal[429] = 429 # pyright: ignore[reportIncompatibleVariableOverride] + + +class InternalServerError(APIStatusError): + pass diff --git a/src/ydc_search_api/_files.py b/src/ydc_search_api/_files.py new file mode 100644 index 0000000..715cc20 --- /dev/null +++ b/src/ydc_search_api/_files.py @@ -0,0 +1,123 @@ +from __future__ import annotations + +import io +import os +import pathlib +from typing import overload +from typing_extensions import TypeGuard + +import anyio + +from ._types import ( + FileTypes, + FileContent, + RequestFiles, + HttpxFileTypes, + Base64FileInput, + HttpxFileContent, + HttpxRequestFiles, +) +from ._utils import is_tuple_t, is_mapping_t, is_sequence_t + + +def is_base64_file_input(obj: object) -> TypeGuard[Base64FileInput]: + return isinstance(obj, io.IOBase) or isinstance(obj, os.PathLike) + + +def is_file_content(obj: object) -> TypeGuard[FileContent]: + return ( + isinstance(obj, bytes) or isinstance(obj, tuple) or isinstance(obj, io.IOBase) or isinstance(obj, os.PathLike) + ) + + +def assert_is_file_content(obj: object, *, key: str | None = None) -> None: + if not is_file_content(obj): + prefix = f"Expected entry at `{key}`" if key is not None else f"Expected file input `{obj!r}`" + raise RuntimeError( + f"{prefix} to be bytes, an io.IOBase instance, PathLike or a tuple but received {type(obj)} instead." + ) from None + + +@overload +def to_httpx_files(files: None) -> None: ... + + +@overload +def to_httpx_files(files: RequestFiles) -> HttpxRequestFiles: ... + + +def to_httpx_files(files: RequestFiles | None) -> HttpxRequestFiles | None: + if files is None: + return None + + if is_mapping_t(files): + files = {key: _transform_file(file) for key, file in files.items()} + elif is_sequence_t(files): + files = [(key, _transform_file(file)) for key, file in files] + else: + raise TypeError(f"Unexpected file type input {type(files)}, expected mapping or sequence") + + return files + + +def _transform_file(file: FileTypes) -> HttpxFileTypes: + if is_file_content(file): + if isinstance(file, os.PathLike): + path = pathlib.Path(file) + return (path.name, path.read_bytes()) + + return file + + if is_tuple_t(file): + return (file[0], _read_file_content(file[1]), *file[2:]) + + raise TypeError(f"Expected file types input to be a FileContent type or to be a tuple") + + +def _read_file_content(file: FileContent) -> HttpxFileContent: + if isinstance(file, os.PathLike): + return pathlib.Path(file).read_bytes() + return file + + +@overload +async def async_to_httpx_files(files: None) -> None: ... + + +@overload +async def async_to_httpx_files(files: RequestFiles) -> HttpxRequestFiles: ... + + +async def async_to_httpx_files(files: RequestFiles | None) -> HttpxRequestFiles | None: + if files is None: + return None + + if is_mapping_t(files): + files = {key: await _async_transform_file(file) for key, file in files.items()} + elif is_sequence_t(files): + files = [(key, await _async_transform_file(file)) for key, file in files] + else: + raise TypeError("Unexpected file type input {type(files)}, expected mapping or sequence") + + return files + + +async def _async_transform_file(file: FileTypes) -> HttpxFileTypes: + if is_file_content(file): + if isinstance(file, os.PathLike): + path = anyio.Path(file) + return (path.name, await path.read_bytes()) + + return file + + if is_tuple_t(file): + return (file[0], await _async_read_file_content(file[1]), *file[2:]) + + raise TypeError(f"Expected file types input to be a FileContent type or to be a tuple") + + +async def _async_read_file_content(file: FileContent) -> HttpxFileContent: + if isinstance(file, os.PathLike): + return await anyio.Path(file).read_bytes() + + return file diff --git a/src/ydc_search_api/_models.py b/src/ydc_search_api/_models.py new file mode 100644 index 0000000..4f21498 --- /dev/null +++ b/src/ydc_search_api/_models.py @@ -0,0 +1,805 @@ +from __future__ import annotations + +import os +import inspect +from typing import TYPE_CHECKING, Any, Type, Union, Generic, TypeVar, Callable, cast +from datetime import date, datetime +from typing_extensions import ( + Unpack, + Literal, + ClassVar, + Protocol, + Required, + ParamSpec, + TypedDict, + TypeGuard, + final, + override, + runtime_checkable, +) + +import pydantic +from pydantic.fields import FieldInfo + +from ._types import ( + Body, + IncEx, + Query, + ModelT, + Headers, + Timeout, + NotGiven, + AnyMapping, + HttpxRequestFiles, +) +from ._utils import ( + PropertyInfo, + is_list, + is_given, + json_safe, + lru_cache, + is_mapping, + parse_date, + coerce_boolean, + parse_datetime, + strip_not_given, + extract_type_arg, + is_annotated_type, + is_type_alias_type, + strip_annotated_type, +) +from ._compat import ( + PYDANTIC_V2, + ConfigDict, + GenericModel as BaseGenericModel, + get_args, + is_union, + parse_obj, + get_origin, + is_literal_type, + get_model_config, + get_model_fields, + field_get_default, +) +from ._constants import RAW_RESPONSE_HEADER + +if TYPE_CHECKING: + from pydantic_core.core_schema import ModelField, ModelSchema, LiteralSchema, ModelFieldsSchema + +__all__ = ["BaseModel", "GenericModel"] + +_T = TypeVar("_T") +_BaseModelT = TypeVar("_BaseModelT", bound="BaseModel") + +P = ParamSpec("P") + + +@runtime_checkable +class _ConfigProtocol(Protocol): + allow_population_by_field_name: bool + + +class BaseModel(pydantic.BaseModel): + if PYDANTIC_V2: + model_config: ClassVar[ConfigDict] = ConfigDict( + extra="allow", defer_build=coerce_boolean(os.environ.get("DEFER_PYDANTIC_BUILD", "true")) + ) + else: + + @property + @override + def model_fields_set(self) -> set[str]: + # a forwards-compat shim for pydantic v2 + return self.__fields_set__ # type: ignore + + class Config(pydantic.BaseConfig): # pyright: ignore[reportDeprecated] + extra: Any = pydantic.Extra.allow # type: ignore + + def to_dict( + self, + *, + mode: Literal["json", "python"] = "python", + use_api_names: bool = True, + exclude_unset: bool = True, + exclude_defaults: bool = False, + exclude_none: bool = False, + warnings: bool = True, + ) -> dict[str, object]: + """Recursively generate a dictionary representation of the model, optionally specifying which fields to include or exclude. + + By default, fields that were not set by the API will not be included, + and keys will match the API response, *not* the property names from the model. + + For example, if the API responds with `"fooBar": true` but we've defined a `foo_bar: bool` property, + the output will use the `"fooBar"` key (unless `use_api_names=False` is passed). + + Args: + mode: + If mode is 'json', the dictionary will only contain JSON serializable types. e.g. `datetime` will be turned into a string, `"2024-3-22T18:11:19.117000Z"`. + If mode is 'python', the dictionary may contain any Python objects. e.g. `datetime(2024, 3, 22)` + + use_api_names: Whether to use the key that the API responded with or the property name. Defaults to `True`. + exclude_unset: Whether to exclude fields that have not been explicitly set. + exclude_defaults: Whether to exclude fields that are set to their default value from the output. + exclude_none: Whether to exclude fields that have a value of `None` from the output. + warnings: Whether to log warnings when invalid fields are encountered. This is only supported in Pydantic v2. + """ + return self.model_dump( + mode=mode, + by_alias=use_api_names, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + exclude_none=exclude_none, + warnings=warnings, + ) + + def to_json( + self, + *, + indent: int | None = 2, + use_api_names: bool = True, + exclude_unset: bool = True, + exclude_defaults: bool = False, + exclude_none: bool = False, + warnings: bool = True, + ) -> str: + """Generates a JSON string representing this model as it would be received from or sent to the API (but with indentation). + + By default, fields that were not set by the API will not be included, + and keys will match the API response, *not* the property names from the model. + + For example, if the API responds with `"fooBar": true` but we've defined a `foo_bar: bool` property, + the output will use the `"fooBar"` key (unless `use_api_names=False` is passed). + + Args: + indent: Indentation to use in the JSON output. If `None` is passed, the output will be compact. Defaults to `2` + use_api_names: Whether to use the key that the API responded with or the property name. Defaults to `True`. + exclude_unset: Whether to exclude fields that have not been explicitly set. + exclude_defaults: Whether to exclude fields that have the default value. + exclude_none: Whether to exclude fields that have a value of `None`. + warnings: Whether to show any warnings that occurred during serialization. This is only supported in Pydantic v2. + """ + return self.model_dump_json( + indent=indent, + by_alias=use_api_names, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + exclude_none=exclude_none, + warnings=warnings, + ) + + @override + def __str__(self) -> str: + # mypy complains about an invalid self arg + return f"{self.__repr_name__()}({self.__repr_str__(', ')})" # type: ignore[misc] + + # Override the 'construct' method in a way that supports recursive parsing without validation. + # Based on https://github.com/samuelcolvin/pydantic/issues/1168#issuecomment-817742836. + @classmethod + @override + def construct( # pyright: ignore[reportIncompatibleMethodOverride] + __cls: Type[ModelT], + _fields_set: set[str] | None = None, + **values: object, + ) -> ModelT: + m = __cls.__new__(__cls) + fields_values: dict[str, object] = {} + + config = get_model_config(__cls) + populate_by_name = ( + config.allow_population_by_field_name + if isinstance(config, _ConfigProtocol) + else config.get("populate_by_name") + ) + + if _fields_set is None: + _fields_set = set() + + model_fields = get_model_fields(__cls) + for name, field in model_fields.items(): + key = field.alias + if key is None or (key not in values and populate_by_name): + key = name + + if key in values: + fields_values[name] = _construct_field(value=values[key], field=field, key=key) + _fields_set.add(name) + else: + fields_values[name] = field_get_default(field) + + _extra = {} + for key, value in values.items(): + if key not in model_fields: + if PYDANTIC_V2: + _extra[key] = value + else: + _fields_set.add(key) + fields_values[key] = value + + object.__setattr__(m, "__dict__", fields_values) + + if PYDANTIC_V2: + # these properties are copied from Pydantic's `model_construct()` method + object.__setattr__(m, "__pydantic_private__", None) + object.__setattr__(m, "__pydantic_extra__", _extra) + object.__setattr__(m, "__pydantic_fields_set__", _fields_set) + else: + # init_private_attributes() does not exist in v2 + m._init_private_attributes() # type: ignore + + # copied from Pydantic v1's `construct()` method + object.__setattr__(m, "__fields_set__", _fields_set) + + return m + + if not TYPE_CHECKING: + # type checkers incorrectly complain about this assignment + # because the type signatures are technically different + # although not in practice + model_construct = construct + + if not PYDANTIC_V2: + # we define aliases for some of the new pydantic v2 methods so + # that we can just document these methods without having to specify + # a specific pydantic version as some users may not know which + # pydantic version they are currently using + + @override + def model_dump( + self, + *, + mode: Literal["json", "python"] | str = "python", + include: IncEx | None = None, + exclude: IncEx | None = None, + by_alias: bool = False, + exclude_unset: bool = False, + exclude_defaults: bool = False, + exclude_none: bool = False, + round_trip: bool = False, + warnings: bool | Literal["none", "warn", "error"] = True, + context: dict[str, Any] | None = None, + serialize_as_any: bool = False, + ) -> dict[str, Any]: + """Usage docs: https://docs.pydantic.dev/2.4/concepts/serialization/#modelmodel_dump + + Generate a dictionary representation of the model, optionally specifying which fields to include or exclude. + + Args: + mode: The mode in which `to_python` should run. + If mode is 'json', the dictionary will only contain JSON serializable types. + If mode is 'python', the dictionary may contain any Python objects. + include: A list of fields to include in the output. + exclude: A list of fields to exclude from the output. + by_alias: Whether to use the field's alias in the dictionary key if defined. + exclude_unset: Whether to exclude fields that are unset or None from the output. + exclude_defaults: Whether to exclude fields that are set to their default value from the output. + exclude_none: Whether to exclude fields that have a value of `None` from the output. + round_trip: Whether to enable serialization and deserialization round-trip support. + warnings: Whether to log warnings when invalid fields are encountered. + + Returns: + A dictionary representation of the model. + """ + if mode not in {"json", "python"}: + raise ValueError("mode must be either 'json' or 'python'") + if round_trip != False: + raise ValueError("round_trip is only supported in Pydantic v2") + if warnings != True: + raise ValueError("warnings is only supported in Pydantic v2") + if context is not None: + raise ValueError("context is only supported in Pydantic v2") + if serialize_as_any != False: + raise ValueError("serialize_as_any is only supported in Pydantic v2") + dumped = super().dict( # pyright: ignore[reportDeprecated] + include=include, + exclude=exclude, + by_alias=by_alias, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + exclude_none=exclude_none, + ) + + return cast(dict[str, Any], json_safe(dumped)) if mode == "json" else dumped + + @override + def model_dump_json( + self, + *, + indent: int | None = None, + include: IncEx | None = None, + exclude: IncEx | None = None, + by_alias: bool = False, + exclude_unset: bool = False, + exclude_defaults: bool = False, + exclude_none: bool = False, + round_trip: bool = False, + warnings: bool | Literal["none", "warn", "error"] = True, + context: dict[str, Any] | None = None, + serialize_as_any: bool = False, + ) -> str: + """Usage docs: https://docs.pydantic.dev/2.4/concepts/serialization/#modelmodel_dump_json + + Generates a JSON representation of the model using Pydantic's `to_json` method. + + Args: + indent: Indentation to use in the JSON output. If None is passed, the output will be compact. + include: Field(s) to include in the JSON output. Can take either a string or set of strings. + exclude: Field(s) to exclude from the JSON output. Can take either a string or set of strings. + by_alias: Whether to serialize using field aliases. + exclude_unset: Whether to exclude fields that have not been explicitly set. + exclude_defaults: Whether to exclude fields that have the default value. + exclude_none: Whether to exclude fields that have a value of `None`. + round_trip: Whether to use serialization/deserialization between JSON and class instance. + warnings: Whether to show any warnings that occurred during serialization. + + Returns: + A JSON string representation of the model. + """ + if round_trip != False: + raise ValueError("round_trip is only supported in Pydantic v2") + if warnings != True: + raise ValueError("warnings is only supported in Pydantic v2") + if context is not None: + raise ValueError("context is only supported in Pydantic v2") + if serialize_as_any != False: + raise ValueError("serialize_as_any is only supported in Pydantic v2") + return super().json( # type: ignore[reportDeprecated] + indent=indent, + include=include, + exclude=exclude, + by_alias=by_alias, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + exclude_none=exclude_none, + ) + + +def _construct_field(value: object, field: FieldInfo, key: str) -> object: + if value is None: + return field_get_default(field) + + if PYDANTIC_V2: + type_ = field.annotation + else: + type_ = cast(type, field.outer_type_) # type: ignore + + if type_ is None: + raise RuntimeError(f"Unexpected field type is None for {key}") + + return construct_type(value=value, type_=type_) + + +def is_basemodel(type_: type) -> bool: + """Returns whether or not the given type is either a `BaseModel` or a union of `BaseModel`""" + if is_union(type_): + for variant in get_args(type_): + if is_basemodel(variant): + return True + + return False + + return is_basemodel_type(type_) + + +def is_basemodel_type(type_: type) -> TypeGuard[type[BaseModel] | type[GenericModel]]: + origin = get_origin(type_) or type_ + if not inspect.isclass(origin): + return False + return issubclass(origin, BaseModel) or issubclass(origin, GenericModel) + + +def build( + base_model_cls: Callable[P, _BaseModelT], + *args: P.args, + **kwargs: P.kwargs, +) -> _BaseModelT: + """Construct a BaseModel class without validation. + + This is useful for cases where you need to instantiate a `BaseModel` + from an API response as this provides type-safe params which isn't supported + by helpers like `construct_type()`. + + ```py + build(MyModel, my_field_a="foo", my_field_b=123) + ``` + """ + if args: + raise TypeError( + "Received positional arguments which are not supported; Keyword arguments must be used instead", + ) + + return cast(_BaseModelT, construct_type(type_=base_model_cls, value=kwargs)) + + +def construct_type_unchecked(*, value: object, type_: type[_T]) -> _T: + """Loose coercion to the expected type with construction of nested values. + + Note: the returned value from this function is not guaranteed to match the + given type. + """ + return cast(_T, construct_type(value=value, type_=type_)) + + +def construct_type(*, value: object, type_: object) -> object: + """Loose coercion to the expected type with construction of nested values. + + If the given value does not match the expected type then it is returned as-is. + """ + + # store a reference to the original type we were given before we extract any inner + # types so that we can properly resolve forward references in `TypeAliasType` annotations + original_type = None + + # we allow `object` as the input type because otherwise, passing things like + # `Literal['value']` will be reported as a type error by type checkers + type_ = cast("type[object]", type_) + if is_type_alias_type(type_): + original_type = type_ # type: ignore[unreachable] + type_ = type_.__value__ # type: ignore[unreachable] + + # unwrap `Annotated[T, ...]` -> `T` + if is_annotated_type(type_): + meta: tuple[Any, ...] = get_args(type_)[1:] + type_ = extract_type_arg(type_, 0) + else: + meta = tuple() + + # we need to use the origin class for any types that are subscripted generics + # e.g. Dict[str, object] + origin = get_origin(type_) or type_ + args = get_args(type_) + + if is_union(origin): + try: + return validate_type(type_=cast("type[object]", original_type or type_), value=value) + except Exception: + pass + + # if the type is a discriminated union then we want to construct the right variant + # in the union, even if the data doesn't match exactly, otherwise we'd break code + # that relies on the constructed class types, e.g. + # + # class FooType: + # kind: Literal['foo'] + # value: str + # + # class BarType: + # kind: Literal['bar'] + # value: int + # + # without this block, if the data we get is something like `{'kind': 'bar', 'value': 'foo'}` then + # we'd end up constructing `FooType` when it should be `BarType`. + discriminator = _build_discriminated_union_meta(union=type_, meta_annotations=meta) + if discriminator and is_mapping(value): + variant_value = value.get(discriminator.field_alias_from or discriminator.field_name) + if variant_value and isinstance(variant_value, str): + variant_type = discriminator.mapping.get(variant_value) + if variant_type: + return construct_type(type_=variant_type, value=value) + + # if the data is not valid, use the first variant that doesn't fail while deserializing + for variant in args: + try: + return construct_type(value=value, type_=variant) + except Exception: + continue + + raise RuntimeError(f"Could not convert data into a valid instance of {type_}") + + if origin == dict: + if not is_mapping(value): + return value + + _, items_type = get_args(type_) # Dict[_, items_type] + return {key: construct_type(value=item, type_=items_type) for key, item in value.items()} + + if ( + not is_literal_type(type_) + and inspect.isclass(origin) + and (issubclass(origin, BaseModel) or issubclass(origin, GenericModel)) + ): + if is_list(value): + return [cast(Any, type_).construct(**entry) if is_mapping(entry) else entry for entry in value] + + if is_mapping(value): + if issubclass(type_, BaseModel): + return type_.construct(**value) # type: ignore[arg-type] + + return cast(Any, type_).construct(**value) + + if origin == list: + if not is_list(value): + return value + + inner_type = args[0] # List[inner_type] + return [construct_type(value=entry, type_=inner_type) for entry in value] + + if origin == float: + if isinstance(value, int): + coerced = float(value) + if coerced != value: + return value + return coerced + + return value + + if type_ == datetime: + try: + return parse_datetime(value) # type: ignore + except Exception: + return value + + if type_ == date: + try: + return parse_date(value) # type: ignore + except Exception: + return value + + return value + + +@runtime_checkable +class CachedDiscriminatorType(Protocol): + __discriminator__: DiscriminatorDetails + + +class DiscriminatorDetails: + field_name: str + """The name of the discriminator field in the variant class, e.g. + + ```py + class Foo(BaseModel): + type: Literal['foo'] + ``` + + Will result in field_name='type' + """ + + field_alias_from: str | None + """The name of the discriminator field in the API response, e.g. + + ```py + class Foo(BaseModel): + type: Literal['foo'] = Field(alias='type_from_api') + ``` + + Will result in field_alias_from='type_from_api' + """ + + mapping: dict[str, type] + """Mapping of discriminator value to variant type, e.g. + + {'foo': FooVariant, 'bar': BarVariant} + """ + + def __init__( + self, + *, + mapping: dict[str, type], + discriminator_field: str, + discriminator_alias: str | None, + ) -> None: + self.mapping = mapping + self.field_name = discriminator_field + self.field_alias_from = discriminator_alias + + +def _build_discriminated_union_meta(*, union: type, meta_annotations: tuple[Any, ...]) -> DiscriminatorDetails | None: + if isinstance(union, CachedDiscriminatorType): + return union.__discriminator__ + + discriminator_field_name: str | None = None + + for annotation in meta_annotations: + if isinstance(annotation, PropertyInfo) and annotation.discriminator is not None: + discriminator_field_name = annotation.discriminator + break + + if not discriminator_field_name: + return None + + mapping: dict[str, type] = {} + discriminator_alias: str | None = None + + for variant in get_args(union): + variant = strip_annotated_type(variant) + if is_basemodel_type(variant): + if PYDANTIC_V2: + field = _extract_field_schema_pv2(variant, discriminator_field_name) + if not field: + continue + + # Note: if one variant defines an alias then they all should + discriminator_alias = field.get("serialization_alias") + + field_schema = field["schema"] + + if field_schema["type"] == "literal": + for entry in cast("LiteralSchema", field_schema)["expected"]: + if isinstance(entry, str): + mapping[entry] = variant + else: + field_info = cast("dict[str, FieldInfo]", variant.__fields__).get(discriminator_field_name) # pyright: ignore[reportDeprecated, reportUnnecessaryCast] + if not field_info: + continue + + # Note: if one variant defines an alias then they all should + discriminator_alias = field_info.alias + + if (annotation := getattr(field_info, "annotation", None)) and is_literal_type(annotation): + for entry in get_args(annotation): + if isinstance(entry, str): + mapping[entry] = variant + + if not mapping: + return None + + details = DiscriminatorDetails( + mapping=mapping, + discriminator_field=discriminator_field_name, + discriminator_alias=discriminator_alias, + ) + cast(CachedDiscriminatorType, union).__discriminator__ = details + return details + + +def _extract_field_schema_pv2(model: type[BaseModel], field_name: str) -> ModelField | None: + schema = model.__pydantic_core_schema__ + if schema["type"] == "definitions": + schema = schema["schema"] + + if schema["type"] != "model": + return None + + schema = cast("ModelSchema", schema) + fields_schema = schema["schema"] + if fields_schema["type"] != "model-fields": + return None + + fields_schema = cast("ModelFieldsSchema", fields_schema) + field = fields_schema["fields"].get(field_name) + if not field: + return None + + return cast("ModelField", field) # pyright: ignore[reportUnnecessaryCast] + + +def validate_type(*, type_: type[_T], value: object) -> _T: + """Strict validation that the given value matches the expected type""" + if inspect.isclass(type_) and issubclass(type_, pydantic.BaseModel): + return cast(_T, parse_obj(type_, value)) + + return cast(_T, _validate_non_model_type(type_=type_, value=value)) + + +def set_pydantic_config(typ: Any, config: pydantic.ConfigDict) -> None: + """Add a pydantic config for the given type. + + Note: this is a no-op on Pydantic v1. + """ + setattr(typ, "__pydantic_config__", config) # noqa: B010 + + +# our use of subclassing here causes weirdness for type checkers, +# so we just pretend that we don't subclass +if TYPE_CHECKING: + GenericModel = BaseModel +else: + + class GenericModel(BaseGenericModel, BaseModel): + pass + + +if PYDANTIC_V2: + from pydantic import TypeAdapter as _TypeAdapter + + _CachedTypeAdapter = cast("TypeAdapter[object]", lru_cache(maxsize=None)(_TypeAdapter)) + + if TYPE_CHECKING: + from pydantic import TypeAdapter + else: + TypeAdapter = _CachedTypeAdapter + + def _validate_non_model_type(*, type_: type[_T], value: object) -> _T: + return TypeAdapter(type_).validate_python(value) + +elif not TYPE_CHECKING: # TODO: condition is weird + + class RootModel(GenericModel, Generic[_T]): + """Used as a placeholder to easily convert runtime types to a Pydantic format + to provide validation. + + For example: + ```py + validated = RootModel[int](__root__="5").__root__ + # validated: 5 + ``` + """ + + __root__: _T + + def _validate_non_model_type(*, type_: type[_T], value: object) -> _T: + model = _create_pydantic_model(type_).validate(value) + return cast(_T, model.__root__) + + def _create_pydantic_model(type_: _T) -> Type[RootModel[_T]]: + return RootModel[type_] # type: ignore + + +class FinalRequestOptionsInput(TypedDict, total=False): + method: Required[str] + url: Required[str] + params: Query + headers: Headers + max_retries: int + timeout: float | Timeout | None + files: HttpxRequestFiles | None + idempotency_key: str + json_data: Body + extra_json: AnyMapping + follow_redirects: bool + + +@final +class FinalRequestOptions(pydantic.BaseModel): + method: str + url: str + params: Query = {} + headers: Union[Headers, NotGiven] = NotGiven() + max_retries: Union[int, NotGiven] = NotGiven() + timeout: Union[float, Timeout, None, NotGiven] = NotGiven() + files: Union[HttpxRequestFiles, None] = None + idempotency_key: Union[str, None] = None + post_parser: Union[Callable[[Any], Any], NotGiven] = NotGiven() + follow_redirects: Union[bool, None] = None + + # It should be noted that we cannot use `json` here as that would override + # a BaseModel method in an incompatible fashion. + json_data: Union[Body, None] = None + extra_json: Union[AnyMapping, None] = None + + if PYDANTIC_V2: + model_config: ClassVar[ConfigDict] = ConfigDict(arbitrary_types_allowed=True) + else: + + class Config(pydantic.BaseConfig): # pyright: ignore[reportDeprecated] + arbitrary_types_allowed: bool = True + + def get_max_retries(self, max_retries: int) -> int: + if isinstance(self.max_retries, NotGiven): + return max_retries + return self.max_retries + + def _strip_raw_response_header(self) -> None: + if not is_given(self.headers): + return + + if self.headers.get(RAW_RESPONSE_HEADER): + self.headers = {**self.headers} + self.headers.pop(RAW_RESPONSE_HEADER) + + # override the `construct` method so that we can run custom transformations. + # this is necessary as we don't want to do any actual runtime type checking + # (which means we can't use validators) but we do want to ensure that `NotGiven` + # values are not present + # + # type ignore required because we're adding explicit types to `**values` + @classmethod + def construct( # type: ignore + cls, + _fields_set: set[str] | None = None, + **values: Unpack[FinalRequestOptionsInput], + ) -> FinalRequestOptions: + kwargs: dict[str, Any] = { + # we unconditionally call `strip_not_given` on any value + # as it will just ignore any non-mapping types + key: strip_not_given(value) + for key, value in values.items() + } + if PYDANTIC_V2: + return super().model_construct(_fields_set, **kwargs) + return cast(FinalRequestOptions, super().construct(_fields_set, **kwargs)) # pyright: ignore[reportDeprecated] + + if not TYPE_CHECKING: + # type checkers incorrectly complain about this assignment + model_construct = construct diff --git a/src/ydc_search_api/_qs.py b/src/ydc_search_api/_qs.py new file mode 100644 index 0000000..274320c --- /dev/null +++ b/src/ydc_search_api/_qs.py @@ -0,0 +1,150 @@ +from __future__ import annotations + +from typing import Any, List, Tuple, Union, Mapping, TypeVar +from urllib.parse import parse_qs, urlencode +from typing_extensions import Literal, get_args + +from ._types import NOT_GIVEN, NotGiven, NotGivenOr +from ._utils import flatten + +_T = TypeVar("_T") + + +ArrayFormat = Literal["comma", "repeat", "indices", "brackets"] +NestedFormat = Literal["dots", "brackets"] + +PrimitiveData = Union[str, int, float, bool, None] +# this should be Data = Union[PrimitiveData, "List[Data]", "Tuple[Data]", "Mapping[str, Data]"] +# https://github.com/microsoft/pyright/issues/3555 +Data = Union[PrimitiveData, List[Any], Tuple[Any], "Mapping[str, Any]"] +Params = Mapping[str, Data] + + +class Querystring: + array_format: ArrayFormat + nested_format: NestedFormat + + def __init__( + self, + *, + array_format: ArrayFormat = "repeat", + nested_format: NestedFormat = "brackets", + ) -> None: + self.array_format = array_format + self.nested_format = nested_format + + def parse(self, query: str) -> Mapping[str, object]: + # Note: custom format syntax is not supported yet + return parse_qs(query) + + def stringify( + self, + params: Params, + *, + array_format: NotGivenOr[ArrayFormat] = NOT_GIVEN, + nested_format: NotGivenOr[NestedFormat] = NOT_GIVEN, + ) -> str: + return urlencode( + self.stringify_items( + params, + array_format=array_format, + nested_format=nested_format, + ) + ) + + def stringify_items( + self, + params: Params, + *, + array_format: NotGivenOr[ArrayFormat] = NOT_GIVEN, + nested_format: NotGivenOr[NestedFormat] = NOT_GIVEN, + ) -> list[tuple[str, str]]: + opts = Options( + qs=self, + array_format=array_format, + nested_format=nested_format, + ) + return flatten([self._stringify_item(key, value, opts) for key, value in params.items()]) + + def _stringify_item( + self, + key: str, + value: Data, + opts: Options, + ) -> list[tuple[str, str]]: + if isinstance(value, Mapping): + items: list[tuple[str, str]] = [] + nested_format = opts.nested_format + for subkey, subvalue in value.items(): + items.extend( + self._stringify_item( + # TODO: error if unknown format + f"{key}.{subkey}" if nested_format == "dots" else f"{key}[{subkey}]", + subvalue, + opts, + ) + ) + return items + + if isinstance(value, (list, tuple)): + array_format = opts.array_format + if array_format == "comma": + return [ + ( + key, + ",".join(self._primitive_value_to_str(item) for item in value if item is not None), + ), + ] + elif array_format == "repeat": + items = [] + for item in value: + items.extend(self._stringify_item(key, item, opts)) + return items + elif array_format == "indices": + raise NotImplementedError("The array indices format is not supported yet") + elif array_format == "brackets": + items = [] + key = key + "[]" + for item in value: + items.extend(self._stringify_item(key, item, opts)) + return items + else: + raise NotImplementedError( + f"Unknown array_format value: {array_format}, choose from {', '.join(get_args(ArrayFormat))}" + ) + + serialised = self._primitive_value_to_str(value) + if not serialised: + return [] + return [(key, serialised)] + + def _primitive_value_to_str(self, value: PrimitiveData) -> str: + # copied from httpx + if value is True: + return "true" + elif value is False: + return "false" + elif value is None: + return "" + return str(value) + + +_qs = Querystring() +parse = _qs.parse +stringify = _qs.stringify +stringify_items = _qs.stringify_items + + +class Options: + array_format: ArrayFormat + nested_format: NestedFormat + + def __init__( + self, + qs: Querystring = _qs, + *, + array_format: NotGivenOr[ArrayFormat] = NOT_GIVEN, + nested_format: NotGivenOr[NestedFormat] = NOT_GIVEN, + ) -> None: + self.array_format = qs.array_format if isinstance(array_format, NotGiven) else array_format + self.nested_format = qs.nested_format if isinstance(nested_format, NotGiven) else nested_format diff --git a/src/ydc_search_api/_resource.py b/src/ydc_search_api/_resource.py new file mode 100644 index 0000000..7655210 --- /dev/null +++ b/src/ydc_search_api/_resource.py @@ -0,0 +1,43 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import time +from typing import TYPE_CHECKING + +import anyio + +if TYPE_CHECKING: + from ._client import YdcSearchAPI, AsyncYdcSearchAPI + + +class SyncAPIResource: + _client: YdcSearchAPI + + def __init__(self, client: YdcSearchAPI) -> None: + self._client = client + self._get = client.get + self._post = client.post + self._patch = client.patch + self._put = client.put + self._delete = client.delete + self._get_api_list = client.get_api_list + + def _sleep(self, seconds: float) -> None: + time.sleep(seconds) + + +class AsyncAPIResource: + _client: AsyncYdcSearchAPI + + def __init__(self, client: AsyncYdcSearchAPI) -> None: + self._client = client + self._get = client.get + self._post = client.post + self._patch = client.patch + self._put = client.put + self._delete = client.delete + self._get_api_list = client.get_api_list + + async def _sleep(self, seconds: float) -> None: + await anyio.sleep(seconds) diff --git a/src/ydc_search_api/_response.py b/src/ydc_search_api/_response.py new file mode 100644 index 0000000..2d79399 --- /dev/null +++ b/src/ydc_search_api/_response.py @@ -0,0 +1,832 @@ +from __future__ import annotations + +import os +import inspect +import logging +import datetime +import functools +from types import TracebackType +from typing import ( + TYPE_CHECKING, + Any, + Union, + Generic, + TypeVar, + Callable, + Iterator, + AsyncIterator, + cast, + overload, +) +from typing_extensions import Awaitable, ParamSpec, override, get_origin + +import anyio +import httpx +import pydantic + +from ._types import NoneType +from ._utils import is_given, extract_type_arg, is_annotated_type, is_type_alias_type, extract_type_var_from_base +from ._models import BaseModel, is_basemodel +from ._constants import RAW_RESPONSE_HEADER, OVERRIDE_CAST_TO_HEADER +from ._streaming import Stream, AsyncStream, is_stream_class_type, extract_stream_chunk_type +from ._exceptions import YdcSearchAPIError, APIResponseValidationError + +if TYPE_CHECKING: + from ._models import FinalRequestOptions + from ._base_client import BaseClient + + +P = ParamSpec("P") +R = TypeVar("R") +_T = TypeVar("_T") +_APIResponseT = TypeVar("_APIResponseT", bound="APIResponse[Any]") +_AsyncAPIResponseT = TypeVar("_AsyncAPIResponseT", bound="AsyncAPIResponse[Any]") + +log: logging.Logger = logging.getLogger(__name__) + + +class BaseAPIResponse(Generic[R]): + _cast_to: type[R] + _client: BaseClient[Any, Any] + _parsed_by_type: dict[type[Any], Any] + _is_sse_stream: bool + _stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None + _options: FinalRequestOptions + + http_response: httpx.Response + + retries_taken: int + """The number of retries made. If no retries happened this will be `0`""" + + def __init__( + self, + *, + raw: httpx.Response, + cast_to: type[R], + client: BaseClient[Any, Any], + stream: bool, + stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None, + options: FinalRequestOptions, + retries_taken: int = 0, + ) -> None: + self._cast_to = cast_to + self._client = client + self._parsed_by_type = {} + self._is_sse_stream = stream + self._stream_cls = stream_cls + self._options = options + self.http_response = raw + self.retries_taken = retries_taken + + @property + def headers(self) -> httpx.Headers: + return self.http_response.headers + + @property + def http_request(self) -> httpx.Request: + """Returns the httpx Request instance associated with the current response.""" + return self.http_response.request + + @property + def status_code(self) -> int: + return self.http_response.status_code + + @property + def url(self) -> httpx.URL: + """Returns the URL for which the request was made.""" + return self.http_response.url + + @property + def method(self) -> str: + return self.http_request.method + + @property + def http_version(self) -> str: + return self.http_response.http_version + + @property + def elapsed(self) -> datetime.timedelta: + """The time taken for the complete request/response cycle to complete.""" + return self.http_response.elapsed + + @property + def is_closed(self) -> bool: + """Whether or not the response body has been closed. + + If this is False then there is response data that has not been read yet. + You must either fully consume the response body or call `.close()` + before discarding the response to prevent resource leaks. + """ + return self.http_response.is_closed + + @override + def __repr__(self) -> str: + return ( + f"<{self.__class__.__name__} [{self.status_code} {self.http_response.reason_phrase}] type={self._cast_to}>" + ) + + def _parse(self, *, to: type[_T] | None = None) -> R | _T: + cast_to = to if to is not None else self._cast_to + + # unwrap `TypeAlias('Name', T)` -> `T` + if is_type_alias_type(cast_to): + cast_to = cast_to.__value__ # type: ignore[unreachable] + + # unwrap `Annotated[T, ...]` -> `T` + if cast_to and is_annotated_type(cast_to): + cast_to = extract_type_arg(cast_to, 0) + + origin = get_origin(cast_to) or cast_to + + if self._is_sse_stream: + if to: + if not is_stream_class_type(to): + raise TypeError(f"Expected custom parse type to be a subclass of {Stream} or {AsyncStream}") + + return cast( + _T, + to( + cast_to=extract_stream_chunk_type( + to, + failure_message="Expected custom stream type to be passed with a type argument, e.g. Stream[ChunkType]", + ), + response=self.http_response, + client=cast(Any, self._client), + ), + ) + + if self._stream_cls: + return cast( + R, + self._stream_cls( + cast_to=extract_stream_chunk_type(self._stream_cls), + response=self.http_response, + client=cast(Any, self._client), + ), + ) + + stream_cls = cast("type[Stream[Any]] | type[AsyncStream[Any]] | None", self._client._default_stream_cls) + if stream_cls is None: + raise MissingStreamClassError() + + return cast( + R, + stream_cls( + cast_to=cast_to, + response=self.http_response, + client=cast(Any, self._client), + ), + ) + + if cast_to is NoneType: + return cast(R, None) + + response = self.http_response + if cast_to == str: + return cast(R, response.text) + + if cast_to == bytes: + return cast(R, response.content) + + if cast_to == int: + return cast(R, int(response.text)) + + if cast_to == float: + return cast(R, float(response.text)) + + if cast_to == bool: + return cast(R, response.text.lower() == "true") + + if origin == APIResponse: + raise RuntimeError("Unexpected state - cast_to is `APIResponse`") + + if inspect.isclass(origin) and issubclass(origin, httpx.Response): + # Because of the invariance of our ResponseT TypeVar, users can subclass httpx.Response + # and pass that class to our request functions. We cannot change the variance to be either + # covariant or contravariant as that makes our usage of ResponseT illegal. We could construct + # the response class ourselves but that is something that should be supported directly in httpx + # as it would be easy to incorrectly construct the Response object due to the multitude of arguments. + if cast_to != httpx.Response: + raise ValueError(f"Subclasses of httpx.Response cannot be passed to `cast_to`") + return cast(R, response) + + if ( + inspect.isclass( + origin # pyright: ignore[reportUnknownArgumentType] + ) + and not issubclass(origin, BaseModel) + and issubclass(origin, pydantic.BaseModel) + ): + raise TypeError( + "Pydantic models must subclass our base model type, e.g. `from ydc_search_api import BaseModel`" + ) + + if ( + cast_to is not object + and not origin is list + and not origin is dict + and not origin is Union + and not issubclass(origin, BaseModel) + ): + raise RuntimeError( + f"Unsupported type, expected {cast_to} to be a subclass of {BaseModel}, {dict}, {list}, {Union}, {NoneType}, {str} or {httpx.Response}." + ) + + # split is required to handle cases where additional information is included + # in the response, e.g. application/json; charset=utf-8 + content_type, *_ = response.headers.get("content-type", "*").split(";") + if not content_type.endswith("json"): + if is_basemodel(cast_to): + try: + data = response.json() + except Exception as exc: + log.debug("Could not read JSON from response data due to %s - %s", type(exc), exc) + else: + return self._client._process_response_data( + data=data, + cast_to=cast_to, # type: ignore + response=response, + ) + + if self._client._strict_response_validation: + raise APIResponseValidationError( + response=response, + message=f"Expected Content-Type response header to be `application/json` but received `{content_type}` instead.", + body=response.text, + ) + + # If the API responds with content that isn't JSON then we just return + # the (decoded) text without performing any parsing so that you can still + # handle the response however you need to. + return response.text # type: ignore + + data = response.json() + + return self._client._process_response_data( + data=data, + cast_to=cast_to, # type: ignore + response=response, + ) + + +class APIResponse(BaseAPIResponse[R]): + @overload + def parse(self, *, to: type[_T]) -> _T: ... + + @overload + def parse(self) -> R: ... + + def parse(self, *, to: type[_T] | None = None) -> R | _T: + """Returns the rich python representation of this response's data. + + For lower-level control, see `.read()`, `.json()`, `.iter_bytes()`. + + You can customise the type that the response is parsed into through + the `to` argument, e.g. + + ```py + from ydc_search_api import BaseModel + + + class MyModel(BaseModel): + foo: str + + + obj = response.parse(to=MyModel) + print(obj.foo) + ``` + + We support parsing: + - `BaseModel` + - `dict` + - `list` + - `Union` + - `str` + - `int` + - `float` + - `httpx.Response` + """ + cache_key = to if to is not None else self._cast_to + cached = self._parsed_by_type.get(cache_key) + if cached is not None: + return cached # type: ignore[no-any-return] + + if not self._is_sse_stream: + self.read() + + parsed = self._parse(to=to) + if is_given(self._options.post_parser): + parsed = self._options.post_parser(parsed) + + self._parsed_by_type[cache_key] = parsed + return parsed + + def read(self) -> bytes: + """Read and return the binary response content.""" + try: + return self.http_response.read() + except httpx.StreamConsumed as exc: + # The default error raised by httpx isn't very + # helpful in our case so we re-raise it with + # a different error message. + raise StreamAlreadyConsumed() from exc + + def text(self) -> str: + """Read and decode the response content into a string.""" + self.read() + return self.http_response.text + + def json(self) -> object: + """Read and decode the JSON response content.""" + self.read() + return self.http_response.json() + + def close(self) -> None: + """Close the response and release the connection. + + Automatically called if the response body is read to completion. + """ + self.http_response.close() + + def iter_bytes(self, chunk_size: int | None = None) -> Iterator[bytes]: + """ + A byte-iterator over the decoded response content. + + This automatically handles gzip, deflate and brotli encoded responses. + """ + for chunk in self.http_response.iter_bytes(chunk_size): + yield chunk + + def iter_text(self, chunk_size: int | None = None) -> Iterator[str]: + """A str-iterator over the decoded response content + that handles both gzip, deflate, etc but also detects the content's + string encoding. + """ + for chunk in self.http_response.iter_text(chunk_size): + yield chunk + + def iter_lines(self) -> Iterator[str]: + """Like `iter_text()` but will only yield chunks for each line""" + for chunk in self.http_response.iter_lines(): + yield chunk + + +class AsyncAPIResponse(BaseAPIResponse[R]): + @overload + async def parse(self, *, to: type[_T]) -> _T: ... + + @overload + async def parse(self) -> R: ... + + async def parse(self, *, to: type[_T] | None = None) -> R | _T: + """Returns the rich python representation of this response's data. + + For lower-level control, see `.read()`, `.json()`, `.iter_bytes()`. + + You can customise the type that the response is parsed into through + the `to` argument, e.g. + + ```py + from ydc_search_api import BaseModel + + + class MyModel(BaseModel): + foo: str + + + obj = response.parse(to=MyModel) + print(obj.foo) + ``` + + We support parsing: + - `BaseModel` + - `dict` + - `list` + - `Union` + - `str` + - `httpx.Response` + """ + cache_key = to if to is not None else self._cast_to + cached = self._parsed_by_type.get(cache_key) + if cached is not None: + return cached # type: ignore[no-any-return] + + if not self._is_sse_stream: + await self.read() + + parsed = self._parse(to=to) + if is_given(self._options.post_parser): + parsed = self._options.post_parser(parsed) + + self._parsed_by_type[cache_key] = parsed + return parsed + + async def read(self) -> bytes: + """Read and return the binary response content.""" + try: + return await self.http_response.aread() + except httpx.StreamConsumed as exc: + # the default error raised by httpx isn't very + # helpful in our case so we re-raise it with + # a different error message + raise StreamAlreadyConsumed() from exc + + async def text(self) -> str: + """Read and decode the response content into a string.""" + await self.read() + return self.http_response.text + + async def json(self) -> object: + """Read and decode the JSON response content.""" + await self.read() + return self.http_response.json() + + async def close(self) -> None: + """Close the response and release the connection. + + Automatically called if the response body is read to completion. + """ + await self.http_response.aclose() + + async def iter_bytes(self, chunk_size: int | None = None) -> AsyncIterator[bytes]: + """ + A byte-iterator over the decoded response content. + + This automatically handles gzip, deflate and brotli encoded responses. + """ + async for chunk in self.http_response.aiter_bytes(chunk_size): + yield chunk + + async def iter_text(self, chunk_size: int | None = None) -> AsyncIterator[str]: + """A str-iterator over the decoded response content + that handles both gzip, deflate, etc but also detects the content's + string encoding. + """ + async for chunk in self.http_response.aiter_text(chunk_size): + yield chunk + + async def iter_lines(self) -> AsyncIterator[str]: + """Like `iter_text()` but will only yield chunks for each line""" + async for chunk in self.http_response.aiter_lines(): + yield chunk + + +class BinaryAPIResponse(APIResponse[bytes]): + """Subclass of APIResponse providing helpers for dealing with binary data. + + Note: If you want to stream the response data instead of eagerly reading it + all at once then you should use `.with_streaming_response` when making + the API request, e.g. `.with_streaming_response.get_binary_response()` + """ + + def write_to_file( + self, + file: str | os.PathLike[str], + ) -> None: + """Write the output to the given file. + + Accepts a filename or any path-like object, e.g. pathlib.Path + + Note: if you want to stream the data to the file instead of writing + all at once then you should use `.with_streaming_response` when making + the API request, e.g. `.with_streaming_response.get_binary_response()` + """ + with open(file, mode="wb") as f: + for data in self.iter_bytes(): + f.write(data) + + +class AsyncBinaryAPIResponse(AsyncAPIResponse[bytes]): + """Subclass of APIResponse providing helpers for dealing with binary data. + + Note: If you want to stream the response data instead of eagerly reading it + all at once then you should use `.with_streaming_response` when making + the API request, e.g. `.with_streaming_response.get_binary_response()` + """ + + async def write_to_file( + self, + file: str | os.PathLike[str], + ) -> None: + """Write the output to the given file. + + Accepts a filename or any path-like object, e.g. pathlib.Path + + Note: if you want to stream the data to the file instead of writing + all at once then you should use `.with_streaming_response` when making + the API request, e.g. `.with_streaming_response.get_binary_response()` + """ + path = anyio.Path(file) + async with await path.open(mode="wb") as f: + async for data in self.iter_bytes(): + await f.write(data) + + +class StreamedBinaryAPIResponse(APIResponse[bytes]): + def stream_to_file( + self, + file: str | os.PathLike[str], + *, + chunk_size: int | None = None, + ) -> None: + """Streams the output to the given file. + + Accepts a filename or any path-like object, e.g. pathlib.Path + """ + with open(file, mode="wb") as f: + for data in self.iter_bytes(chunk_size): + f.write(data) + + +class AsyncStreamedBinaryAPIResponse(AsyncAPIResponse[bytes]): + async def stream_to_file( + self, + file: str | os.PathLike[str], + *, + chunk_size: int | None = None, + ) -> None: + """Streams the output to the given file. + + Accepts a filename or any path-like object, e.g. pathlib.Path + """ + path = anyio.Path(file) + async with await path.open(mode="wb") as f: + async for data in self.iter_bytes(chunk_size): + await f.write(data) + + +class MissingStreamClassError(TypeError): + def __init__(self) -> None: + super().__init__( + "The `stream` argument was set to `True` but the `stream_cls` argument was not given. See `ydc_search_api._streaming` for reference", + ) + + +class StreamAlreadyConsumed(YdcSearchAPIError): + """ + Attempted to read or stream content, but the content has already + been streamed. + + This can happen if you use a method like `.iter_lines()` and then attempt + to read th entire response body afterwards, e.g. + + ```py + response = await client.post(...) + async for line in response.iter_lines(): + ... # do something with `line` + + content = await response.read() + # ^ error + ``` + + If you want this behaviour you'll need to either manually accumulate the response + content or call `await response.read()` before iterating over the stream. + """ + + def __init__(self) -> None: + message = ( + "Attempted to read or stream some content, but the content has " + "already been streamed. " + "This could be due to attempting to stream the response " + "content more than once." + "\n\n" + "You can fix this by manually accumulating the response content while streaming " + "or by calling `.read()` before starting to stream." + ) + super().__init__(message) + + +class ResponseContextManager(Generic[_APIResponseT]): + """Context manager for ensuring that a request is not made + until it is entered and that the response will always be closed + when the context manager exits + """ + + def __init__(self, request_func: Callable[[], _APIResponseT]) -> None: + self._request_func = request_func + self.__response: _APIResponseT | None = None + + def __enter__(self) -> _APIResponseT: + self.__response = self._request_func() + return self.__response + + def __exit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + if self.__response is not None: + self.__response.close() + + +class AsyncResponseContextManager(Generic[_AsyncAPIResponseT]): + """Context manager for ensuring that a request is not made + until it is entered and that the response will always be closed + when the context manager exits + """ + + def __init__(self, api_request: Awaitable[_AsyncAPIResponseT]) -> None: + self._api_request = api_request + self.__response: _AsyncAPIResponseT | None = None + + async def __aenter__(self) -> _AsyncAPIResponseT: + self.__response = await self._api_request + return self.__response + + async def __aexit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + if self.__response is not None: + await self.__response.close() + + +def to_streamed_response_wrapper(func: Callable[P, R]) -> Callable[P, ResponseContextManager[APIResponse[R]]]: + """Higher order function that takes one of our bound API methods and wraps it + to support streaming and returning the raw `APIResponse` object directly. + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> ResponseContextManager[APIResponse[R]]: + extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "stream" + + kwargs["extra_headers"] = extra_headers + + make_request = functools.partial(func, *args, **kwargs) + + return ResponseContextManager(cast(Callable[[], APIResponse[R]], make_request)) + + return wrapped + + +def async_to_streamed_response_wrapper( + func: Callable[P, Awaitable[R]], +) -> Callable[P, AsyncResponseContextManager[AsyncAPIResponse[R]]]: + """Higher order function that takes one of our bound API methods and wraps it + to support streaming and returning the raw `APIResponse` object directly. + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> AsyncResponseContextManager[AsyncAPIResponse[R]]: + extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "stream" + + kwargs["extra_headers"] = extra_headers + + make_request = func(*args, **kwargs) + + return AsyncResponseContextManager(cast(Awaitable[AsyncAPIResponse[R]], make_request)) + + return wrapped + + +def to_custom_streamed_response_wrapper( + func: Callable[P, object], + response_cls: type[_APIResponseT], +) -> Callable[P, ResponseContextManager[_APIResponseT]]: + """Higher order function that takes one of our bound API methods and an `APIResponse` class + and wraps the method to support streaming and returning the given response class directly. + + Note: the given `response_cls` *must* be concrete, e.g. `class BinaryAPIResponse(APIResponse[bytes])` + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> ResponseContextManager[_APIResponseT]: + extra_headers: dict[str, Any] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "stream" + extra_headers[OVERRIDE_CAST_TO_HEADER] = response_cls + + kwargs["extra_headers"] = extra_headers + + make_request = functools.partial(func, *args, **kwargs) + + return ResponseContextManager(cast(Callable[[], _APIResponseT], make_request)) + + return wrapped + + +def async_to_custom_streamed_response_wrapper( + func: Callable[P, Awaitable[object]], + response_cls: type[_AsyncAPIResponseT], +) -> Callable[P, AsyncResponseContextManager[_AsyncAPIResponseT]]: + """Higher order function that takes one of our bound API methods and an `APIResponse` class + and wraps the method to support streaming and returning the given response class directly. + + Note: the given `response_cls` *must* be concrete, e.g. `class BinaryAPIResponse(APIResponse[bytes])` + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> AsyncResponseContextManager[_AsyncAPIResponseT]: + extra_headers: dict[str, Any] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "stream" + extra_headers[OVERRIDE_CAST_TO_HEADER] = response_cls + + kwargs["extra_headers"] = extra_headers + + make_request = func(*args, **kwargs) + + return AsyncResponseContextManager(cast(Awaitable[_AsyncAPIResponseT], make_request)) + + return wrapped + + +def to_raw_response_wrapper(func: Callable[P, R]) -> Callable[P, APIResponse[R]]: + """Higher order function that takes one of our bound API methods and wraps it + to support returning the raw `APIResponse` object directly. + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> APIResponse[R]: + extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "raw" + + kwargs["extra_headers"] = extra_headers + + return cast(APIResponse[R], func(*args, **kwargs)) + + return wrapped + + +def async_to_raw_response_wrapper(func: Callable[P, Awaitable[R]]) -> Callable[P, Awaitable[AsyncAPIResponse[R]]]: + """Higher order function that takes one of our bound API methods and wraps it + to support returning the raw `APIResponse` object directly. + """ + + @functools.wraps(func) + async def wrapped(*args: P.args, **kwargs: P.kwargs) -> AsyncAPIResponse[R]: + extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "raw" + + kwargs["extra_headers"] = extra_headers + + return cast(AsyncAPIResponse[R], await func(*args, **kwargs)) + + return wrapped + + +def to_custom_raw_response_wrapper( + func: Callable[P, object], + response_cls: type[_APIResponseT], +) -> Callable[P, _APIResponseT]: + """Higher order function that takes one of our bound API methods and an `APIResponse` class + and wraps the method to support returning the given response class directly. + + Note: the given `response_cls` *must* be concrete, e.g. `class BinaryAPIResponse(APIResponse[bytes])` + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> _APIResponseT: + extra_headers: dict[str, Any] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "raw" + extra_headers[OVERRIDE_CAST_TO_HEADER] = response_cls + + kwargs["extra_headers"] = extra_headers + + return cast(_APIResponseT, func(*args, **kwargs)) + + return wrapped + + +def async_to_custom_raw_response_wrapper( + func: Callable[P, Awaitable[object]], + response_cls: type[_AsyncAPIResponseT], +) -> Callable[P, Awaitable[_AsyncAPIResponseT]]: + """Higher order function that takes one of our bound API methods and an `APIResponse` class + and wraps the method to support returning the given response class directly. + + Note: the given `response_cls` *must* be concrete, e.g. `class BinaryAPIResponse(APIResponse[bytes])` + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> Awaitable[_AsyncAPIResponseT]: + extra_headers: dict[str, Any] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "raw" + extra_headers[OVERRIDE_CAST_TO_HEADER] = response_cls + + kwargs["extra_headers"] = extra_headers + + return cast(Awaitable[_AsyncAPIResponseT], func(*args, **kwargs)) + + return wrapped + + +def extract_response_type(typ: type[BaseAPIResponse[Any]]) -> type: + """Given a type like `APIResponse[T]`, returns the generic type variable `T`. + + This also handles the case where a concrete subclass is given, e.g. + ```py + class MyResponse(APIResponse[bytes]): + ... + + extract_response_type(MyResponse) -> bytes + ``` + """ + return extract_type_var_from_base( + typ, + generic_bases=cast("tuple[type, ...]", (BaseAPIResponse, APIResponse, AsyncAPIResponse)), + index=0, + ) diff --git a/src/ydc_search_api/_streaming.py b/src/ydc_search_api/_streaming.py new file mode 100644 index 0000000..7499936 --- /dev/null +++ b/src/ydc_search_api/_streaming.py @@ -0,0 +1,333 @@ +# Note: initially copied from https://github.com/florimondmanca/httpx-sse/blob/master/src/httpx_sse/_decoders.py +from __future__ import annotations + +import json +import inspect +from types import TracebackType +from typing import TYPE_CHECKING, Any, Generic, TypeVar, Iterator, AsyncIterator, cast +from typing_extensions import Self, Protocol, TypeGuard, override, get_origin, runtime_checkable + +import httpx + +from ._utils import extract_type_var_from_base + +if TYPE_CHECKING: + from ._client import YdcSearchAPI, AsyncYdcSearchAPI + + +_T = TypeVar("_T") + + +class Stream(Generic[_T]): + """Provides the core interface to iterate over a synchronous stream response.""" + + response: httpx.Response + + _decoder: SSEBytesDecoder + + def __init__( + self, + *, + cast_to: type[_T], + response: httpx.Response, + client: YdcSearchAPI, + ) -> None: + self.response = response + self._cast_to = cast_to + self._client = client + self._decoder = client._make_sse_decoder() + self._iterator = self.__stream__() + + def __next__(self) -> _T: + return self._iterator.__next__() + + def __iter__(self) -> Iterator[_T]: + for item in self._iterator: + yield item + + def _iter_events(self) -> Iterator[ServerSentEvent]: + yield from self._decoder.iter_bytes(self.response.iter_bytes()) + + def __stream__(self) -> Iterator[_T]: + cast_to = cast(Any, self._cast_to) + response = self.response + process_data = self._client._process_response_data + iterator = self._iter_events() + + for sse in iterator: + yield process_data(data=sse.json(), cast_to=cast_to, response=response) + + # Ensure the entire stream is consumed + for _sse in iterator: + ... + + def __enter__(self) -> Self: + return self + + def __exit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + self.close() + + def close(self) -> None: + """ + Close the response and release the connection. + + Automatically called if the response body is read to completion. + """ + self.response.close() + + +class AsyncStream(Generic[_T]): + """Provides the core interface to iterate over an asynchronous stream response.""" + + response: httpx.Response + + _decoder: SSEDecoder | SSEBytesDecoder + + def __init__( + self, + *, + cast_to: type[_T], + response: httpx.Response, + client: AsyncYdcSearchAPI, + ) -> None: + self.response = response + self._cast_to = cast_to + self._client = client + self._decoder = client._make_sse_decoder() + self._iterator = self.__stream__() + + async def __anext__(self) -> _T: + return await self._iterator.__anext__() + + async def __aiter__(self) -> AsyncIterator[_T]: + async for item in self._iterator: + yield item + + async def _iter_events(self) -> AsyncIterator[ServerSentEvent]: + async for sse in self._decoder.aiter_bytes(self.response.aiter_bytes()): + yield sse + + async def __stream__(self) -> AsyncIterator[_T]: + cast_to = cast(Any, self._cast_to) + response = self.response + process_data = self._client._process_response_data + iterator = self._iter_events() + + async for sse in iterator: + yield process_data(data=sse.json(), cast_to=cast_to, response=response) + + # Ensure the entire stream is consumed + async for _sse in iterator: + ... + + async def __aenter__(self) -> Self: + return self + + async def __aexit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + await self.close() + + async def close(self) -> None: + """ + Close the response and release the connection. + + Automatically called if the response body is read to completion. + """ + await self.response.aclose() + + +class ServerSentEvent: + def __init__( + self, + *, + event: str | None = None, + data: str | None = None, + id: str | None = None, + retry: int | None = None, + ) -> None: + if data is None: + data = "" + + self._id = id + self._data = data + self._event = event or None + self._retry = retry + + @property + def event(self) -> str | None: + return self._event + + @property + def id(self) -> str | None: + return self._id + + @property + def retry(self) -> int | None: + return self._retry + + @property + def data(self) -> str: + return self._data + + def json(self) -> Any: + return json.loads(self.data) + + @override + def __repr__(self) -> str: + return f"ServerSentEvent(event={self.event}, data={self.data}, id={self.id}, retry={self.retry})" + + +class SSEDecoder: + _data: list[str] + _event: str | None + _retry: int | None + _last_event_id: str | None + + def __init__(self) -> None: + self._event = None + self._data = [] + self._last_event_id = None + self._retry = None + + def iter_bytes(self, iterator: Iterator[bytes]) -> Iterator[ServerSentEvent]: + """Given an iterator that yields raw binary data, iterate over it & yield every event encountered""" + for chunk in self._iter_chunks(iterator): + # Split before decoding so splitlines() only uses \r and \n + for raw_line in chunk.splitlines(): + line = raw_line.decode("utf-8") + sse = self.decode(line) + if sse: + yield sse + + def _iter_chunks(self, iterator: Iterator[bytes]) -> Iterator[bytes]: + """Given an iterator that yields raw binary data, iterate over it and yield individual SSE chunks""" + data = b"" + for chunk in iterator: + for line in chunk.splitlines(keepends=True): + data += line + if data.endswith((b"\r\r", b"\n\n", b"\r\n\r\n")): + yield data + data = b"" + if data: + yield data + + async def aiter_bytes(self, iterator: AsyncIterator[bytes]) -> AsyncIterator[ServerSentEvent]: + """Given an iterator that yields raw binary data, iterate over it & yield every event encountered""" + async for chunk in self._aiter_chunks(iterator): + # Split before decoding so splitlines() only uses \r and \n + for raw_line in chunk.splitlines(): + line = raw_line.decode("utf-8") + sse = self.decode(line) + if sse: + yield sse + + async def _aiter_chunks(self, iterator: AsyncIterator[bytes]) -> AsyncIterator[bytes]: + """Given an iterator that yields raw binary data, iterate over it and yield individual SSE chunks""" + data = b"" + async for chunk in iterator: + for line in chunk.splitlines(keepends=True): + data += line + if data.endswith((b"\r\r", b"\n\n", b"\r\n\r\n")): + yield data + data = b"" + if data: + yield data + + def decode(self, line: str) -> ServerSentEvent | None: + # See: https://html.spec.whatwg.org/multipage/server-sent-events.html#event-stream-interpretation # noqa: E501 + + if not line: + if not self._event and not self._data and not self._last_event_id and self._retry is None: + return None + + sse = ServerSentEvent( + event=self._event, + data="\n".join(self._data), + id=self._last_event_id, + retry=self._retry, + ) + + # NOTE: as per the SSE spec, do not reset last_event_id. + self._event = None + self._data = [] + self._retry = None + + return sse + + if line.startswith(":"): + return None + + fieldname, _, value = line.partition(":") + + if value.startswith(" "): + value = value[1:] + + if fieldname == "event": + self._event = value + elif fieldname == "data": + self._data.append(value) + elif fieldname == "id": + if "\0" in value: + pass + else: + self._last_event_id = value + elif fieldname == "retry": + try: + self._retry = int(value) + except (TypeError, ValueError): + pass + else: + pass # Field is ignored. + + return None + + +@runtime_checkable +class SSEBytesDecoder(Protocol): + def iter_bytes(self, iterator: Iterator[bytes]) -> Iterator[ServerSentEvent]: + """Given an iterator that yields raw binary data, iterate over it & yield every event encountered""" + ... + + def aiter_bytes(self, iterator: AsyncIterator[bytes]) -> AsyncIterator[ServerSentEvent]: + """Given an async iterator that yields raw binary data, iterate over it & yield every event encountered""" + ... + + +def is_stream_class_type(typ: type) -> TypeGuard[type[Stream[object]] | type[AsyncStream[object]]]: + """TypeGuard for determining whether or not the given type is a subclass of `Stream` / `AsyncStream`""" + origin = get_origin(typ) or typ + return inspect.isclass(origin) and issubclass(origin, (Stream, AsyncStream)) + + +def extract_stream_chunk_type( + stream_cls: type, + *, + failure_message: str | None = None, +) -> type: + """Given a type like `Stream[T]`, returns the generic type variable `T`. + + This also handles the case where a concrete subclass is given, e.g. + ```py + class MyStream(Stream[bytes]): + ... + + extract_stream_chunk_type(MyStream) -> bytes + ``` + """ + from ._base_client import Stream, AsyncStream + + return extract_type_var_from_base( + stream_cls, + index=0, + generic_bases=cast("tuple[type, ...]", (Stream, AsyncStream)), + failure_message=failure_message, + ) diff --git a/src/ydc_search_api/_types.py b/src/ydc_search_api/_types.py new file mode 100644 index 0000000..ce99bdf --- /dev/null +++ b/src/ydc_search_api/_types.py @@ -0,0 +1,219 @@ +from __future__ import annotations + +from os import PathLike +from typing import ( + IO, + TYPE_CHECKING, + Any, + Dict, + List, + Type, + Tuple, + Union, + Mapping, + TypeVar, + Callable, + Optional, + Sequence, +) +from typing_extensions import Set, Literal, Protocol, TypeAlias, TypedDict, override, runtime_checkable + +import httpx +import pydantic +from httpx import URL, Proxy, Timeout, Response, BaseTransport, AsyncBaseTransport + +if TYPE_CHECKING: + from ._models import BaseModel + from ._response import APIResponse, AsyncAPIResponse + +Transport = BaseTransport +AsyncTransport = AsyncBaseTransport +Query = Mapping[str, object] +Body = object +AnyMapping = Mapping[str, object] +ModelT = TypeVar("ModelT", bound=pydantic.BaseModel) +_T = TypeVar("_T") + + +# Approximates httpx internal ProxiesTypes and RequestFiles types +# while adding support for `PathLike` instances +ProxiesDict = Dict["str | URL", Union[None, str, URL, Proxy]] +ProxiesTypes = Union[str, Proxy, ProxiesDict] +if TYPE_CHECKING: + Base64FileInput = Union[IO[bytes], PathLike[str]] + FileContent = Union[IO[bytes], bytes, PathLike[str]] +else: + Base64FileInput = Union[IO[bytes], PathLike] + FileContent = Union[IO[bytes], bytes, PathLike] # PathLike is not subscriptable in Python 3.8. +FileTypes = Union[ + # file (or bytes) + FileContent, + # (filename, file (or bytes)) + Tuple[Optional[str], FileContent], + # (filename, file (or bytes), content_type) + Tuple[Optional[str], FileContent, Optional[str]], + # (filename, file (or bytes), content_type, headers) + Tuple[Optional[str], FileContent, Optional[str], Mapping[str, str]], +] +RequestFiles = Union[Mapping[str, FileTypes], Sequence[Tuple[str, FileTypes]]] + +# duplicate of the above but without our custom file support +HttpxFileContent = Union[IO[bytes], bytes] +HttpxFileTypes = Union[ + # file (or bytes) + HttpxFileContent, + # (filename, file (or bytes)) + Tuple[Optional[str], HttpxFileContent], + # (filename, file (or bytes), content_type) + Tuple[Optional[str], HttpxFileContent, Optional[str]], + # (filename, file (or bytes), content_type, headers) + Tuple[Optional[str], HttpxFileContent, Optional[str], Mapping[str, str]], +] +HttpxRequestFiles = Union[Mapping[str, HttpxFileTypes], Sequence[Tuple[str, HttpxFileTypes]]] + +# Workaround to support (cast_to: Type[ResponseT]) -> ResponseT +# where ResponseT includes `None`. In order to support directly +# passing `None`, overloads would have to be defined for every +# method that uses `ResponseT` which would lead to an unacceptable +# amount of code duplication and make it unreadable. See _base_client.py +# for example usage. +# +# This unfortunately means that you will either have +# to import this type and pass it explicitly: +# +# from ydc_search_api import NoneType +# client.get('/foo', cast_to=NoneType) +# +# or build it yourself: +# +# client.get('/foo', cast_to=type(None)) +if TYPE_CHECKING: + NoneType: Type[None] +else: + NoneType = type(None) + + +class RequestOptions(TypedDict, total=False): + headers: Headers + max_retries: int + timeout: float | Timeout | None + params: Query + extra_json: AnyMapping + idempotency_key: str + follow_redirects: bool + + +# Sentinel class used until PEP 0661 is accepted +class NotGiven: + """ + A sentinel singleton class used to distinguish omitted keyword arguments + from those passed in with the value None (which may have different behavior). + + For example: + + ```py + def get(timeout: Union[int, NotGiven, None] = NotGiven()) -> Response: ... + + + get(timeout=1) # 1s timeout + get(timeout=None) # No timeout + get() # Default timeout behavior, which may not be statically known at the method definition. + ``` + """ + + def __bool__(self) -> Literal[False]: + return False + + @override + def __repr__(self) -> str: + return "NOT_GIVEN" + + +NotGivenOr = Union[_T, NotGiven] +NOT_GIVEN = NotGiven() + + +class Omit: + """In certain situations you need to be able to represent a case where a default value has + to be explicitly removed and `None` is not an appropriate substitute, for example: + + ```py + # as the default `Content-Type` header is `application/json` that will be sent + client.post("/upload/files", files={"file": b"my raw file content"}) + + # you can't explicitly override the header as it has to be dynamically generated + # to look something like: 'multipart/form-data; boundary=0d8382fcf5f8c3be01ca2e11002d2983' + client.post(..., headers={"Content-Type": "multipart/form-data"}) + + # instead you can remove the default `application/json` header by passing Omit + client.post(..., headers={"Content-Type": Omit()}) + ``` + """ + + def __bool__(self) -> Literal[False]: + return False + + +@runtime_checkable +class ModelBuilderProtocol(Protocol): + @classmethod + def build( + cls: type[_T], + *, + response: Response, + data: object, + ) -> _T: ... + + +Headers = Mapping[str, Union[str, Omit]] + + +class HeadersLikeProtocol(Protocol): + def get(self, __key: str) -> str | None: ... + + +HeadersLike = Union[Headers, HeadersLikeProtocol] + +ResponseT = TypeVar( + "ResponseT", + bound=Union[ + object, + str, + None, + "BaseModel", + List[Any], + Dict[str, Any], + Response, + ModelBuilderProtocol, + "APIResponse[Any]", + "AsyncAPIResponse[Any]", + ], +) + +StrBytesIntFloat = Union[str, bytes, int, float] + +# Note: copied from Pydantic +# https://github.com/pydantic/pydantic/blob/6f31f8f68ef011f84357330186f603ff295312fd/pydantic/main.py#L79 +IncEx: TypeAlias = Union[Set[int], Set[str], Mapping[int, Union["IncEx", bool]], Mapping[str, Union["IncEx", bool]]] + +PostParser = Callable[[Any], Any] + + +@runtime_checkable +class InheritsGeneric(Protocol): + """Represents a type that has inherited from `Generic` + + The `__orig_bases__` property can be used to determine the resolved + type variable for a given base class. + """ + + __orig_bases__: tuple[_GenericAlias] + + +class _GenericAlias(Protocol): + __origin__: type[object] + + +class HttpxSendArgs(TypedDict, total=False): + auth: httpx.Auth + follow_redirects: bool diff --git a/src/ydc_search_api/_utils/__init__.py b/src/ydc_search_api/_utils/__init__.py new file mode 100644 index 0000000..d4fda26 --- /dev/null +++ b/src/ydc_search_api/_utils/__init__.py @@ -0,0 +1,57 @@ +from ._sync import asyncify as asyncify +from ._proxy import LazyProxy as LazyProxy +from ._utils import ( + flatten as flatten, + is_dict as is_dict, + is_list as is_list, + is_given as is_given, + is_tuple as is_tuple, + json_safe as json_safe, + lru_cache as lru_cache, + is_mapping as is_mapping, + is_tuple_t as is_tuple_t, + parse_date as parse_date, + is_iterable as is_iterable, + is_sequence as is_sequence, + coerce_float as coerce_float, + is_mapping_t as is_mapping_t, + removeprefix as removeprefix, + removesuffix as removesuffix, + extract_files as extract_files, + is_sequence_t as is_sequence_t, + required_args as required_args, + coerce_boolean as coerce_boolean, + coerce_integer as coerce_integer, + file_from_path as file_from_path, + parse_datetime as parse_datetime, + strip_not_given as strip_not_given, + deepcopy_minimal as deepcopy_minimal, + get_async_library as get_async_library, + maybe_coerce_float as maybe_coerce_float, + get_required_header as get_required_header, + maybe_coerce_boolean as maybe_coerce_boolean, + maybe_coerce_integer as maybe_coerce_integer, +) +from ._typing import ( + is_list_type as is_list_type, + is_union_type as is_union_type, + extract_type_arg as extract_type_arg, + is_iterable_type as is_iterable_type, + is_required_type as is_required_type, + is_annotated_type as is_annotated_type, + is_type_alias_type as is_type_alias_type, + strip_annotated_type as strip_annotated_type, + extract_type_var_from_base as extract_type_var_from_base, +) +from ._streams import consume_sync_iterator as consume_sync_iterator, consume_async_iterator as consume_async_iterator +from ._transform import ( + PropertyInfo as PropertyInfo, + transform as transform, + async_transform as async_transform, + maybe_transform as maybe_transform, + async_maybe_transform as async_maybe_transform, +) +from ._reflection import ( + function_has_argument as function_has_argument, + assert_signatures_in_sync as assert_signatures_in_sync, +) diff --git a/src/ydc_search_api/_utils/_logs.py b/src/ydc_search_api/_utils/_logs.py new file mode 100644 index 0000000..e4d03d6 --- /dev/null +++ b/src/ydc_search_api/_utils/_logs.py @@ -0,0 +1,25 @@ +import os +import logging + +logger: logging.Logger = logging.getLogger("ydc_search_api") +httpx_logger: logging.Logger = logging.getLogger("httpx") + + +def _basic_config() -> None: + # e.g. [2023-10-05 14:12:26 - ydc_search_api._base_client:818 - DEBUG] HTTP Request: POST http://127.0.0.1:4010/foo/bar "200 OK" + logging.basicConfig( + format="[%(asctime)s - %(name)s:%(lineno)d - %(levelname)s] %(message)s", + datefmt="%Y-%m-%d %H:%M:%S", + ) + + +def setup_logging() -> None: + env = os.environ.get("YDC_SEARCH_API_LOG") + if env == "debug": + _basic_config() + logger.setLevel(logging.DEBUG) + httpx_logger.setLevel(logging.DEBUG) + elif env == "info": + _basic_config() + logger.setLevel(logging.INFO) + httpx_logger.setLevel(logging.INFO) diff --git a/src/ydc_search_api/_utils/_proxy.py b/src/ydc_search_api/_utils/_proxy.py new file mode 100644 index 0000000..0f239a3 --- /dev/null +++ b/src/ydc_search_api/_utils/_proxy.py @@ -0,0 +1,65 @@ +from __future__ import annotations + +from abc import ABC, abstractmethod +from typing import Generic, TypeVar, Iterable, cast +from typing_extensions import override + +T = TypeVar("T") + + +class LazyProxy(Generic[T], ABC): + """Implements data methods to pretend that an instance is another instance. + + This includes forwarding attribute access and other methods. + """ + + # Note: we have to special case proxies that themselves return proxies + # to support using a proxy as a catch-all for any random access, e.g. `proxy.foo.bar.baz` + + def __getattr__(self, attr: str) -> object: + proxied = self.__get_proxied__() + if isinstance(proxied, LazyProxy): + return proxied # pyright: ignore + return getattr(proxied, attr) + + @override + def __repr__(self) -> str: + proxied = self.__get_proxied__() + if isinstance(proxied, LazyProxy): + return proxied.__class__.__name__ + return repr(self.__get_proxied__()) + + @override + def __str__(self) -> str: + proxied = self.__get_proxied__() + if isinstance(proxied, LazyProxy): + return proxied.__class__.__name__ + return str(proxied) + + @override + def __dir__(self) -> Iterable[str]: + proxied = self.__get_proxied__() + if isinstance(proxied, LazyProxy): + return [] + return proxied.__dir__() + + @property # type: ignore + @override + def __class__(self) -> type: # pyright: ignore + try: + proxied = self.__get_proxied__() + except Exception: + return type(self) + if issubclass(type(proxied), LazyProxy): + return type(proxied) + return proxied.__class__ + + def __get_proxied__(self) -> T: + return self.__load__() + + def __as_proxied__(self) -> T: + """Helper method that returns the current proxy, typed as the loaded object""" + return cast(T, self) + + @abstractmethod + def __load__(self) -> T: ... diff --git a/src/ydc_search_api/_utils/_reflection.py b/src/ydc_search_api/_utils/_reflection.py new file mode 100644 index 0000000..89aa712 --- /dev/null +++ b/src/ydc_search_api/_utils/_reflection.py @@ -0,0 +1,42 @@ +from __future__ import annotations + +import inspect +from typing import Any, Callable + + +def function_has_argument(func: Callable[..., Any], arg_name: str) -> bool: + """Returns whether or not the given function has a specific parameter""" + sig = inspect.signature(func) + return arg_name in sig.parameters + + +def assert_signatures_in_sync( + source_func: Callable[..., Any], + check_func: Callable[..., Any], + *, + exclude_params: set[str] = set(), +) -> None: + """Ensure that the signature of the second function matches the first.""" + + check_sig = inspect.signature(check_func) + source_sig = inspect.signature(source_func) + + errors: list[str] = [] + + for name, source_param in source_sig.parameters.items(): + if name in exclude_params: + continue + + custom_param = check_sig.parameters.get(name) + if not custom_param: + errors.append(f"the `{name}` param is missing") + continue + + if custom_param.annotation != source_param.annotation: + errors.append( + f"types for the `{name}` param are do not match; source={repr(source_param.annotation)} checking={repr(custom_param.annotation)}" + ) + continue + + if errors: + raise AssertionError(f"{len(errors)} errors encountered when comparing signatures:\n\n" + "\n\n".join(errors)) diff --git a/src/ydc_search_api/_utils/_resources_proxy.py b/src/ydc_search_api/_utils/_resources_proxy.py new file mode 100644 index 0000000..84d66ba --- /dev/null +++ b/src/ydc_search_api/_utils/_resources_proxy.py @@ -0,0 +1,24 @@ +from __future__ import annotations + +from typing import Any +from typing_extensions import override + +from ._proxy import LazyProxy + + +class ResourcesProxy(LazyProxy[Any]): + """A proxy for the `ydc_search_api.resources` module. + + This is used so that we can lazily import `ydc_search_api.resources` only when + needed *and* so that users can just import `ydc_search_api` and reference `ydc_search_api.resources` + """ + + @override + def __load__(self) -> Any: + import importlib + + mod = importlib.import_module("ydc_search_api.resources") + return mod + + +resources = ResourcesProxy().__as_proxied__() diff --git a/src/ydc_search_api/_utils/_streams.py b/src/ydc_search_api/_utils/_streams.py new file mode 100644 index 0000000..f4a0208 --- /dev/null +++ b/src/ydc_search_api/_utils/_streams.py @@ -0,0 +1,12 @@ +from typing import Any +from typing_extensions import Iterator, AsyncIterator + + +def consume_sync_iterator(iterator: Iterator[Any]) -> None: + for _ in iterator: + ... + + +async def consume_async_iterator(iterator: AsyncIterator[Any]) -> None: + async for _ in iterator: + ... diff --git a/src/ydc_search_api/_utils/_sync.py b/src/ydc_search_api/_utils/_sync.py new file mode 100644 index 0000000..ad7ec71 --- /dev/null +++ b/src/ydc_search_api/_utils/_sync.py @@ -0,0 +1,86 @@ +from __future__ import annotations + +import sys +import asyncio +import functools +import contextvars +from typing import Any, TypeVar, Callable, Awaitable +from typing_extensions import ParamSpec + +import anyio +import sniffio +import anyio.to_thread + +T_Retval = TypeVar("T_Retval") +T_ParamSpec = ParamSpec("T_ParamSpec") + + +if sys.version_info >= (3, 9): + _asyncio_to_thread = asyncio.to_thread +else: + # backport of https://docs.python.org/3/library/asyncio-task.html#asyncio.to_thread + # for Python 3.8 support + async def _asyncio_to_thread( + func: Callable[T_ParamSpec, T_Retval], /, *args: T_ParamSpec.args, **kwargs: T_ParamSpec.kwargs + ) -> Any: + """Asynchronously run function *func* in a separate thread. + + Any *args and **kwargs supplied for this function are directly passed + to *func*. Also, the current :class:`contextvars.Context` is propagated, + allowing context variables from the main thread to be accessed in the + separate thread. + + Returns a coroutine that can be awaited to get the eventual result of *func*. + """ + loop = asyncio.events.get_running_loop() + ctx = contextvars.copy_context() + func_call = functools.partial(ctx.run, func, *args, **kwargs) + return await loop.run_in_executor(None, func_call) + + +async def to_thread( + func: Callable[T_ParamSpec, T_Retval], /, *args: T_ParamSpec.args, **kwargs: T_ParamSpec.kwargs +) -> T_Retval: + if sniffio.current_async_library() == "asyncio": + return await _asyncio_to_thread(func, *args, **kwargs) + + return await anyio.to_thread.run_sync( + functools.partial(func, *args, **kwargs), + ) + + +# inspired by `asyncer`, https://github.com/tiangolo/asyncer +def asyncify(function: Callable[T_ParamSpec, T_Retval]) -> Callable[T_ParamSpec, Awaitable[T_Retval]]: + """ + Take a blocking function and create an async one that receives the same + positional and keyword arguments. For python version 3.9 and above, it uses + asyncio.to_thread to run the function in a separate thread. For python version + 3.8, it uses locally defined copy of the asyncio.to_thread function which was + introduced in python 3.9. + + Usage: + + ```python + def blocking_func(arg1, arg2, kwarg1=None): + # blocking code + return result + + + result = asyncify(blocking_function)(arg1, arg2, kwarg1=value1) + ``` + + ## Arguments + + `function`: a blocking regular callable (e.g. a function) + + ## Return + + An async function that takes the same positional and keyword arguments as the + original one, that when called runs the same original function in a thread worker + and returns the result. + """ + + async def wrapper(*args: T_ParamSpec.args, **kwargs: T_ParamSpec.kwargs) -> T_Retval: + return await to_thread(function, *args, **kwargs) + + return wrapper diff --git a/src/ydc_search_api/_utils/_transform.py b/src/ydc_search_api/_utils/_transform.py new file mode 100644 index 0000000..b0cc20a --- /dev/null +++ b/src/ydc_search_api/_utils/_transform.py @@ -0,0 +1,447 @@ +from __future__ import annotations + +import io +import base64 +import pathlib +from typing import Any, Mapping, TypeVar, cast +from datetime import date, datetime +from typing_extensions import Literal, get_args, override, get_type_hints as _get_type_hints + +import anyio +import pydantic + +from ._utils import ( + is_list, + is_given, + lru_cache, + is_mapping, + is_iterable, +) +from .._files import is_base64_file_input +from ._typing import ( + is_list_type, + is_union_type, + extract_type_arg, + is_iterable_type, + is_required_type, + is_annotated_type, + strip_annotated_type, +) +from .._compat import get_origin, model_dump, is_typeddict + +_T = TypeVar("_T") + + +# TODO: support for drilling globals() and locals() +# TODO: ensure works correctly with forward references in all cases + + +PropertyFormat = Literal["iso8601", "base64", "custom"] + + +class PropertyInfo: + """Metadata class to be used in Annotated types to provide information about a given type. + + For example: + + class MyParams(TypedDict): + account_holder_name: Annotated[str, PropertyInfo(alias='accountHolderName')] + + This means that {'account_holder_name': 'Robert'} will be transformed to {'accountHolderName': 'Robert'} before being sent to the API. + """ + + alias: str | None + format: PropertyFormat | None + format_template: str | None + discriminator: str | None + + def __init__( + self, + *, + alias: str | None = None, + format: PropertyFormat | None = None, + format_template: str | None = None, + discriminator: str | None = None, + ) -> None: + self.alias = alias + self.format = format + self.format_template = format_template + self.discriminator = discriminator + + @override + def __repr__(self) -> str: + return f"{self.__class__.__name__}(alias='{self.alias}', format={self.format}, format_template='{self.format_template}', discriminator='{self.discriminator}')" + + +def maybe_transform( + data: object, + expected_type: object, +) -> Any | None: + """Wrapper over `transform()` that allows `None` to be passed. + + See `transform()` for more details. + """ + if data is None: + return None + return transform(data, expected_type) + + +# Wrapper over _transform_recursive providing fake types +def transform( + data: _T, + expected_type: object, +) -> _T: + """Transform dictionaries based off of type information from the given type, for example: + + ```py + class Params(TypedDict, total=False): + card_id: Required[Annotated[str, PropertyInfo(alias="cardID")]] + + + transformed = transform({"card_id": ""}, Params) + # {'cardID': ''} + ``` + + Any keys / data that does not have type information given will be included as is. + + It should be noted that the transformations that this function does are not represented in the type system. + """ + transformed = _transform_recursive(data, annotation=cast(type, expected_type)) + return cast(_T, transformed) + + +@lru_cache(maxsize=8096) +def _get_annotated_type(type_: type) -> type | None: + """If the given type is an `Annotated` type then it is returned, if not `None` is returned. + + This also unwraps the type when applicable, e.g. `Required[Annotated[T, ...]]` + """ + if is_required_type(type_): + # Unwrap `Required[Annotated[T, ...]]` to `Annotated[T, ...]` + type_ = get_args(type_)[0] + + if is_annotated_type(type_): + return type_ + + return None + + +def _maybe_transform_key(key: str, type_: type) -> str: + """Transform the given `data` based on the annotations provided in `type_`. + + Note: this function only looks at `Annotated` types that contain `PropertyInfo` metadata. + """ + annotated_type = _get_annotated_type(type_) + if annotated_type is None: + # no `Annotated` definition for this type, no transformation needed + return key + + # ignore the first argument as it is the actual type + annotations = get_args(annotated_type)[1:] + for annotation in annotations: + if isinstance(annotation, PropertyInfo) and annotation.alias is not None: + return annotation.alias + + return key + + +def _no_transform_needed(annotation: type) -> bool: + return annotation == float or annotation == int + + +def _transform_recursive( + data: object, + *, + annotation: type, + inner_type: type | None = None, +) -> object: + """Transform the given data against the expected type. + + Args: + annotation: The direct type annotation given to the particular piece of data. + This may or may not be wrapped in metadata types, e.g. `Required[T]`, `Annotated[T, ...]` etc + + inner_type: If applicable, this is the "inside" type. This is useful in certain cases where the outside type + is a container type such as `List[T]`. In that case `inner_type` should be set to `T` so that each entry in + the list can be transformed using the metadata from the container type. + + Defaults to the same value as the `annotation` argument. + """ + if inner_type is None: + inner_type = annotation + + stripped_type = strip_annotated_type(inner_type) + origin = get_origin(stripped_type) or stripped_type + if is_typeddict(stripped_type) and is_mapping(data): + return _transform_typeddict(data, stripped_type) + + if origin == dict and is_mapping(data): + items_type = get_args(stripped_type)[1] + return {key: _transform_recursive(value, annotation=items_type) for key, value in data.items()} + + if ( + # List[T] + (is_list_type(stripped_type) and is_list(data)) + # Iterable[T] + or (is_iterable_type(stripped_type) and is_iterable(data) and not isinstance(data, str)) + ): + # dicts are technically iterable, but it is an iterable on the keys of the dict and is not usually + # intended as an iterable, so we don't transform it. + if isinstance(data, dict): + return cast(object, data) + + inner_type = extract_type_arg(stripped_type, 0) + if _no_transform_needed(inner_type): + # for some types there is no need to transform anything, so we can get a small + # perf boost from skipping that work. + # + # but we still need to convert to a list to ensure the data is json-serializable + if is_list(data): + return data + return list(data) + + return [_transform_recursive(d, annotation=annotation, inner_type=inner_type) for d in data] + + if is_union_type(stripped_type): + # For union types we run the transformation against all subtypes to ensure that everything is transformed. + # + # TODO: there may be edge cases where the same normalized field name will transform to two different names + # in different subtypes. + for subtype in get_args(stripped_type): + data = _transform_recursive(data, annotation=annotation, inner_type=subtype) + return data + + if isinstance(data, pydantic.BaseModel): + return model_dump(data, exclude_unset=True, mode="json") + + annotated_type = _get_annotated_type(annotation) + if annotated_type is None: + return data + + # ignore the first argument as it is the actual type + annotations = get_args(annotated_type)[1:] + for annotation in annotations: + if isinstance(annotation, PropertyInfo) and annotation.format is not None: + return _format_data(data, annotation.format, annotation.format_template) + + return data + + +def _format_data(data: object, format_: PropertyFormat, format_template: str | None) -> object: + if isinstance(data, (date, datetime)): + if format_ == "iso8601": + return data.isoformat() + + if format_ == "custom" and format_template is not None: + return data.strftime(format_template) + + if format_ == "base64" and is_base64_file_input(data): + binary: str | bytes | None = None + + if isinstance(data, pathlib.Path): + binary = data.read_bytes() + elif isinstance(data, io.IOBase): + binary = data.read() + + if isinstance(binary, str): # type: ignore[unreachable] + binary = binary.encode() + + if not isinstance(binary, bytes): + raise RuntimeError(f"Could not read bytes from {data}; Received {type(binary)}") + + return base64.b64encode(binary).decode("ascii") + + return data + + +def _transform_typeddict( + data: Mapping[str, object], + expected_type: type, +) -> Mapping[str, object]: + result: dict[str, object] = {} + annotations = get_type_hints(expected_type, include_extras=True) + for key, value in data.items(): + if not is_given(value): + # we don't need to include `NotGiven` values here as they'll + # be stripped out before the request is sent anyway + continue + + type_ = annotations.get(key) + if type_ is None: + # we do not have a type annotation for this field, leave it as is + result[key] = value + else: + result[_maybe_transform_key(key, type_)] = _transform_recursive(value, annotation=type_) + return result + + +async def async_maybe_transform( + data: object, + expected_type: object, +) -> Any | None: + """Wrapper over `async_transform()` that allows `None` to be passed. + + See `async_transform()` for more details. + """ + if data is None: + return None + return await async_transform(data, expected_type) + + +async def async_transform( + data: _T, + expected_type: object, +) -> _T: + """Transform dictionaries based off of type information from the given type, for example: + + ```py + class Params(TypedDict, total=False): + card_id: Required[Annotated[str, PropertyInfo(alias="cardID")]] + + + transformed = transform({"card_id": ""}, Params) + # {'cardID': ''} + ``` + + Any keys / data that does not have type information given will be included as is. + + It should be noted that the transformations that this function does are not represented in the type system. + """ + transformed = await _async_transform_recursive(data, annotation=cast(type, expected_type)) + return cast(_T, transformed) + + +async def _async_transform_recursive( + data: object, + *, + annotation: type, + inner_type: type | None = None, +) -> object: + """Transform the given data against the expected type. + + Args: + annotation: The direct type annotation given to the particular piece of data. + This may or may not be wrapped in metadata types, e.g. `Required[T]`, `Annotated[T, ...]` etc + + inner_type: If applicable, this is the "inside" type. This is useful in certain cases where the outside type + is a container type such as `List[T]`. In that case `inner_type` should be set to `T` so that each entry in + the list can be transformed using the metadata from the container type. + + Defaults to the same value as the `annotation` argument. + """ + if inner_type is None: + inner_type = annotation + + stripped_type = strip_annotated_type(inner_type) + origin = get_origin(stripped_type) or stripped_type + if is_typeddict(stripped_type) and is_mapping(data): + return await _async_transform_typeddict(data, stripped_type) + + if origin == dict and is_mapping(data): + items_type = get_args(stripped_type)[1] + return {key: _transform_recursive(value, annotation=items_type) for key, value in data.items()} + + if ( + # List[T] + (is_list_type(stripped_type) and is_list(data)) + # Iterable[T] + or (is_iterable_type(stripped_type) and is_iterable(data) and not isinstance(data, str)) + ): + # dicts are technically iterable, but it is an iterable on the keys of the dict and is not usually + # intended as an iterable, so we don't transform it. + if isinstance(data, dict): + return cast(object, data) + + inner_type = extract_type_arg(stripped_type, 0) + if _no_transform_needed(inner_type): + # for some types there is no need to transform anything, so we can get a small + # perf boost from skipping that work. + # + # but we still need to convert to a list to ensure the data is json-serializable + if is_list(data): + return data + return list(data) + + return [await _async_transform_recursive(d, annotation=annotation, inner_type=inner_type) for d in data] + + if is_union_type(stripped_type): + # For union types we run the transformation against all subtypes to ensure that everything is transformed. + # + # TODO: there may be edge cases where the same normalized field name will transform to two different names + # in different subtypes. + for subtype in get_args(stripped_type): + data = await _async_transform_recursive(data, annotation=annotation, inner_type=subtype) + return data + + if isinstance(data, pydantic.BaseModel): + return model_dump(data, exclude_unset=True, mode="json") + + annotated_type = _get_annotated_type(annotation) + if annotated_type is None: + return data + + # ignore the first argument as it is the actual type + annotations = get_args(annotated_type)[1:] + for annotation in annotations: + if isinstance(annotation, PropertyInfo) and annotation.format is not None: + return await _async_format_data(data, annotation.format, annotation.format_template) + + return data + + +async def _async_format_data(data: object, format_: PropertyFormat, format_template: str | None) -> object: + if isinstance(data, (date, datetime)): + if format_ == "iso8601": + return data.isoformat() + + if format_ == "custom" and format_template is not None: + return data.strftime(format_template) + + if format_ == "base64" and is_base64_file_input(data): + binary: str | bytes | None = None + + if isinstance(data, pathlib.Path): + binary = await anyio.Path(data).read_bytes() + elif isinstance(data, io.IOBase): + binary = data.read() + + if isinstance(binary, str): # type: ignore[unreachable] + binary = binary.encode() + + if not isinstance(binary, bytes): + raise RuntimeError(f"Could not read bytes from {data}; Received {type(binary)}") + + return base64.b64encode(binary).decode("ascii") + + return data + + +async def _async_transform_typeddict( + data: Mapping[str, object], + expected_type: type, +) -> Mapping[str, object]: + result: dict[str, object] = {} + annotations = get_type_hints(expected_type, include_extras=True) + for key, value in data.items(): + if not is_given(value): + # we don't need to include `NotGiven` values here as they'll + # be stripped out before the request is sent anyway + continue + + type_ = annotations.get(key) + if type_ is None: + # we do not have a type annotation for this field, leave it as is + result[key] = value + else: + result[_maybe_transform_key(key, type_)] = await _async_transform_recursive(value, annotation=type_) + return result + + +@lru_cache(maxsize=8096) +def get_type_hints( + obj: Any, + globalns: dict[str, Any] | None = None, + localns: Mapping[str, Any] | None = None, + include_extras: bool = False, +) -> dict[str, Any]: + return _get_type_hints(obj, globalns=globalns, localns=localns, include_extras=include_extras) diff --git a/src/ydc_search_api/_utils/_typing.py b/src/ydc_search_api/_utils/_typing.py new file mode 100644 index 0000000..1bac954 --- /dev/null +++ b/src/ydc_search_api/_utils/_typing.py @@ -0,0 +1,151 @@ +from __future__ import annotations + +import sys +import typing +import typing_extensions +from typing import Any, TypeVar, Iterable, cast +from collections import abc as _c_abc +from typing_extensions import ( + TypeIs, + Required, + Annotated, + get_args, + get_origin, +) + +from ._utils import lru_cache +from .._types import InheritsGeneric +from .._compat import is_union as _is_union + + +def is_annotated_type(typ: type) -> bool: + return get_origin(typ) == Annotated + + +def is_list_type(typ: type) -> bool: + return (get_origin(typ) or typ) == list + + +def is_iterable_type(typ: type) -> bool: + """If the given type is `typing.Iterable[T]`""" + origin = get_origin(typ) or typ + return origin == Iterable or origin == _c_abc.Iterable + + +def is_union_type(typ: type) -> bool: + return _is_union(get_origin(typ)) + + +def is_required_type(typ: type) -> bool: + return get_origin(typ) == Required + + +def is_typevar(typ: type) -> bool: + # type ignore is required because type checkers + # think this expression will always return False + return type(typ) == TypeVar # type: ignore + + +_TYPE_ALIAS_TYPES: tuple[type[typing_extensions.TypeAliasType], ...] = (typing_extensions.TypeAliasType,) +if sys.version_info >= (3, 12): + _TYPE_ALIAS_TYPES = (*_TYPE_ALIAS_TYPES, typing.TypeAliasType) + + +def is_type_alias_type(tp: Any, /) -> TypeIs[typing_extensions.TypeAliasType]: + """Return whether the provided argument is an instance of `TypeAliasType`. + + ```python + type Int = int + is_type_alias_type(Int) + # > True + Str = TypeAliasType("Str", str) + is_type_alias_type(Str) + # > True + ``` + """ + return isinstance(tp, _TYPE_ALIAS_TYPES) + + +# Extracts T from Annotated[T, ...] or from Required[Annotated[T, ...]] +@lru_cache(maxsize=8096) +def strip_annotated_type(typ: type) -> type: + if is_required_type(typ) or is_annotated_type(typ): + return strip_annotated_type(cast(type, get_args(typ)[0])) + + return typ + + +def extract_type_arg(typ: type, index: int) -> type: + args = get_args(typ) + try: + return cast(type, args[index]) + except IndexError as err: + raise RuntimeError(f"Expected type {typ} to have a type argument at index {index} but it did not") from err + + +def extract_type_var_from_base( + typ: type, + *, + generic_bases: tuple[type, ...], + index: int, + failure_message: str | None = None, +) -> type: + """Given a type like `Foo[T]`, returns the generic type variable `T`. + + This also handles the case where a concrete subclass is given, e.g. + ```py + class MyResponse(Foo[bytes]): + ... + + extract_type_var(MyResponse, bases=(Foo,), index=0) -> bytes + ``` + + And where a generic subclass is given: + ```py + _T = TypeVar('_T') + class MyResponse(Foo[_T]): + ... + + extract_type_var(MyResponse[bytes], bases=(Foo,), index=0) -> bytes + ``` + """ + cls = cast(object, get_origin(typ) or typ) + if cls in generic_bases: # pyright: ignore[reportUnnecessaryContains] + # we're given the class directly + return extract_type_arg(typ, index) + + # if a subclass is given + # --- + # this is needed as __orig_bases__ is not present in the typeshed stubs + # because it is intended to be for internal use only, however there does + # not seem to be a way to resolve generic TypeVars for inherited subclasses + # without using it. + if isinstance(cls, InheritsGeneric): + target_base_class: Any | None = None + for base in cls.__orig_bases__: + if base.__origin__ in generic_bases: + target_base_class = base + break + + if target_base_class is None: + raise RuntimeError( + "Could not find the generic base class;\n" + "This should never happen;\n" + f"Does {cls} inherit from one of {generic_bases} ?" + ) + + extracted = extract_type_arg(target_base_class, index) + if is_typevar(extracted): + # If the extracted type argument is itself a type variable + # then that means the subclass itself is generic, so we have + # to resolve the type argument from the class itself, not + # the base class. + # + # Note: if there is more than 1 type argument, the subclass could + # change the ordering of the type arguments, this is not currently + # supported. + return extract_type_arg(typ, index) + + return extracted + + raise RuntimeError(failure_message or f"Could not resolve inner type variable at index {index} for {typ}") diff --git a/src/ydc_search_api/_utils/_utils.py b/src/ydc_search_api/_utils/_utils.py new file mode 100644 index 0000000..ea3cf3f --- /dev/null +++ b/src/ydc_search_api/_utils/_utils.py @@ -0,0 +1,422 @@ +from __future__ import annotations + +import os +import re +import inspect +import functools +from typing import ( + Any, + Tuple, + Mapping, + TypeVar, + Callable, + Iterable, + Sequence, + cast, + overload, +) +from pathlib import Path +from datetime import date, datetime +from typing_extensions import TypeGuard + +import sniffio + +from .._types import NotGiven, FileTypes, NotGivenOr, HeadersLike +from .._compat import parse_date as parse_date, parse_datetime as parse_datetime + +_T = TypeVar("_T") +_TupleT = TypeVar("_TupleT", bound=Tuple[object, ...]) +_MappingT = TypeVar("_MappingT", bound=Mapping[str, object]) +_SequenceT = TypeVar("_SequenceT", bound=Sequence[object]) +CallableT = TypeVar("CallableT", bound=Callable[..., Any]) + + +def flatten(t: Iterable[Iterable[_T]]) -> list[_T]: + return [item for sublist in t for item in sublist] + + +def extract_files( + # TODO: this needs to take Dict but variance issues..... + # create protocol type ? + query: Mapping[str, object], + *, + paths: Sequence[Sequence[str]], +) -> list[tuple[str, FileTypes]]: + """Recursively extract files from the given dictionary based on specified paths. + + A path may look like this ['foo', 'files', '', 'data']. + + Note: this mutates the given dictionary. + """ + files: list[tuple[str, FileTypes]] = [] + for path in paths: + files.extend(_extract_items(query, path, index=0, flattened_key=None)) + return files + + +def _extract_items( + obj: object, + path: Sequence[str], + *, + index: int, + flattened_key: str | None, +) -> list[tuple[str, FileTypes]]: + try: + key = path[index] + except IndexError: + if isinstance(obj, NotGiven): + # no value was provided - we can safely ignore + return [] + + # cyclical import + from .._files import assert_is_file_content + + # We have exhausted the path, return the entry we found. + assert flattened_key is not None + + if is_list(obj): + files: list[tuple[str, FileTypes]] = [] + for entry in obj: + assert_is_file_content(entry, key=flattened_key + "[]" if flattened_key else "") + files.append((flattened_key + "[]", cast(FileTypes, entry))) + return files + + assert_is_file_content(obj, key=flattened_key) + return [(flattened_key, cast(FileTypes, obj))] + + index += 1 + if is_dict(obj): + try: + # We are at the last entry in the path so we must remove the field + if (len(path)) == index: + item = obj.pop(key) + else: + item = obj[key] + except KeyError: + # Key was not present in the dictionary, this is not indicative of an error + # as the given path may not point to a required field. We also do not want + # to enforce required fields as the API may differ from the spec in some cases. + return [] + if flattened_key is None: + flattened_key = key + else: + flattened_key += f"[{key}]" + return _extract_items( + item, + path, + index=index, + flattened_key=flattened_key, + ) + elif is_list(obj): + if key != "": + return [] + + return flatten( + [ + _extract_items( + item, + path, + index=index, + flattened_key=flattened_key + "[]" if flattened_key is not None else "[]", + ) + for item in obj + ] + ) + + # Something unexpected was passed, just ignore it. + return [] + + +def is_given(obj: NotGivenOr[_T]) -> TypeGuard[_T]: + return not isinstance(obj, NotGiven) + + +# Type safe methods for narrowing types with TypeVars. +# The default narrowing for isinstance(obj, dict) is dict[unknown, unknown], +# however this cause Pyright to rightfully report errors. As we know we don't +# care about the contained types we can safely use `object` in it's place. +# +# There are two separate functions defined, `is_*` and `is_*_t` for different use cases. +# `is_*` is for when you're dealing with an unknown input +# `is_*_t` is for when you're narrowing a known union type to a specific subset + + +def is_tuple(obj: object) -> TypeGuard[tuple[object, ...]]: + return isinstance(obj, tuple) + + +def is_tuple_t(obj: _TupleT | object) -> TypeGuard[_TupleT]: + return isinstance(obj, tuple) + + +def is_sequence(obj: object) -> TypeGuard[Sequence[object]]: + return isinstance(obj, Sequence) + + +def is_sequence_t(obj: _SequenceT | object) -> TypeGuard[_SequenceT]: + return isinstance(obj, Sequence) + + +def is_mapping(obj: object) -> TypeGuard[Mapping[str, object]]: + return isinstance(obj, Mapping) + + +def is_mapping_t(obj: _MappingT | object) -> TypeGuard[_MappingT]: + return isinstance(obj, Mapping) + + +def is_dict(obj: object) -> TypeGuard[dict[object, object]]: + return isinstance(obj, dict) + + +def is_list(obj: object) -> TypeGuard[list[object]]: + return isinstance(obj, list) + + +def is_iterable(obj: object) -> TypeGuard[Iterable[object]]: + return isinstance(obj, Iterable) + + +def deepcopy_minimal(item: _T) -> _T: + """Minimal reimplementation of copy.deepcopy() that will only copy certain object types: + + - mappings, e.g. `dict` + - list + + This is done for performance reasons. + """ + if is_mapping(item): + return cast(_T, {k: deepcopy_minimal(v) for k, v in item.items()}) + if is_list(item): + return cast(_T, [deepcopy_minimal(entry) for entry in item]) + return item + + +# copied from https://github.com/Rapptz/RoboDanny +def human_join(seq: Sequence[str], *, delim: str = ", ", final: str = "or") -> str: + size = len(seq) + if size == 0: + return "" + + if size == 1: + return seq[0] + + if size == 2: + return f"{seq[0]} {final} {seq[1]}" + + return delim.join(seq[:-1]) + f" {final} {seq[-1]}" + + +def quote(string: str) -> str: + """Add single quotation marks around the given string. Does *not* do any escaping.""" + return f"'{string}'" + + +def required_args(*variants: Sequence[str]) -> Callable[[CallableT], CallableT]: + """Decorator to enforce a given set of arguments or variants of arguments are passed to the decorated function. + + Useful for enforcing runtime validation of overloaded functions. + + Example usage: + ```py + @overload + def foo(*, a: str) -> str: ... + + + @overload + def foo(*, b: bool) -> str: ... + + + # This enforces the same constraints that a static type checker would + # i.e. that either a or b must be passed to the function + @required_args(["a"], ["b"]) + def foo(*, a: str | None = None, b: bool | None = None) -> str: ... + ``` + """ + + def inner(func: CallableT) -> CallableT: + params = inspect.signature(func).parameters + positional = [ + name + for name, param in params.items() + if param.kind + in { + param.POSITIONAL_ONLY, + param.POSITIONAL_OR_KEYWORD, + } + ] + + @functools.wraps(func) + def wrapper(*args: object, **kwargs: object) -> object: + given_params: set[str] = set() + for i, _ in enumerate(args): + try: + given_params.add(positional[i]) + except IndexError: + raise TypeError( + f"{func.__name__}() takes {len(positional)} argument(s) but {len(args)} were given" + ) from None + + for key in kwargs.keys(): + given_params.add(key) + + for variant in variants: + matches = all((param in given_params for param in variant)) + if matches: + break + else: # no break + if len(variants) > 1: + variations = human_join( + ["(" + human_join([quote(arg) for arg in variant], final="and") + ")" for variant in variants] + ) + msg = f"Missing required arguments; Expected either {variations} arguments to be given" + else: + assert len(variants) > 0 + + # TODO: this error message is not deterministic + missing = list(set(variants[0]) - given_params) + if len(missing) > 1: + msg = f"Missing required arguments: {human_join([quote(arg) for arg in missing])}" + else: + msg = f"Missing required argument: {quote(missing[0])}" + raise TypeError(msg) + return func(*args, **kwargs) + + return wrapper # type: ignore + + return inner + + +_K = TypeVar("_K") +_V = TypeVar("_V") + + +@overload +def strip_not_given(obj: None) -> None: ... + + +@overload +def strip_not_given(obj: Mapping[_K, _V | NotGiven]) -> dict[_K, _V]: ... + + +@overload +def strip_not_given(obj: object) -> object: ... + + +def strip_not_given(obj: object | None) -> object: + """Remove all top-level keys where their values are instances of `NotGiven`""" + if obj is None: + return None + + if not is_mapping(obj): + return obj + + return {key: value for key, value in obj.items() if not isinstance(value, NotGiven)} + + +def coerce_integer(val: str) -> int: + return int(val, base=10) + + +def coerce_float(val: str) -> float: + return float(val) + + +def coerce_boolean(val: str) -> bool: + return val == "true" or val == "1" or val == "on" + + +def maybe_coerce_integer(val: str | None) -> int | None: + if val is None: + return None + return coerce_integer(val) + + +def maybe_coerce_float(val: str | None) -> float | None: + if val is None: + return None + return coerce_float(val) + + +def maybe_coerce_boolean(val: str | None) -> bool | None: + if val is None: + return None + return coerce_boolean(val) + + +def removeprefix(string: str, prefix: str) -> str: + """Remove a prefix from a string. + + Backport of `str.removeprefix` for Python < 3.9 + """ + if string.startswith(prefix): + return string[len(prefix) :] + return string + + +def removesuffix(string: str, suffix: str) -> str: + """Remove a suffix from a string. + + Backport of `str.removesuffix` for Python < 3.9 + """ + if string.endswith(suffix): + return string[: -len(suffix)] + return string + + +def file_from_path(path: str) -> FileTypes: + contents = Path(path).read_bytes() + file_name = os.path.basename(path) + return (file_name, contents) + + +def get_required_header(headers: HeadersLike, header: str) -> str: + lower_header = header.lower() + if is_mapping_t(headers): + # mypy doesn't understand the type narrowing here + for k, v in headers.items(): # type: ignore + if k.lower() == lower_header and isinstance(v, str): + return v + + # to deal with the case where the header looks like Stainless-Event-Id + intercaps_header = re.sub(r"([^\w])(\w)", lambda pat: pat.group(1) + pat.group(2).upper(), header.capitalize()) + + for normalized_header in [header, lower_header, header.upper(), intercaps_header]: + value = headers.get(normalized_header) + if value: + return value + + raise ValueError(f"Could not find {header} header") + + +def get_async_library() -> str: + try: + return sniffio.current_async_library() + except Exception: + return "false" + + +def lru_cache(*, maxsize: int | None = 128) -> Callable[[CallableT], CallableT]: + """A version of functools.lru_cache that retains the type signature + for the wrapped function arguments. + """ + wrapper = functools.lru_cache( # noqa: TID251 + maxsize=maxsize, + ) + return cast(Any, wrapper) # type: ignore[no-any-return] + + +def json_safe(data: object) -> object: + """Translates a mapping / sequence recursively in the same fashion + as `pydantic` v2's `model_dump(mode="json")`. + """ + if is_mapping(data): + return {json_safe(key): json_safe(value) for key, value in data.items()} + + if is_iterable(data) and not isinstance(data, (str, bytes, bytearray)): + return [json_safe(item) for item in data] + + if isinstance(data, (datetime, date)): + return data.isoformat() + + return data diff --git a/src/ydc_search_api/_version.py b/src/ydc_search_api/_version.py new file mode 100644 index 0000000..2ccbad9 --- /dev/null +++ b/src/ydc_search_api/_version.py @@ -0,0 +1,4 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +__title__ = "ydc_search_api" +__version__ = "3.0.0" # x-release-please-version diff --git a/src/ydc_search_api/lib/.keep b/src/ydc_search_api/lib/.keep new file mode 100644 index 0000000..5e2c99f --- /dev/null +++ b/src/ydc_search_api/lib/.keep @@ -0,0 +1,4 @@ +File generated from our OpenAPI spec by Stainless. + +This directory can be used to store custom files to expand the SDK. +It is ignored by Stainless code generation and its content (other than this keep file) won't be touched. \ No newline at end of file diff --git a/image.png b/src/ydc_search_api/py.typed old mode 100755 new mode 100644 similarity index 100% rename from image.png rename to src/ydc_search_api/py.typed diff --git a/src/ydc_search_api/resources/__init__.py b/src/ydc_search_api/resources/__init__.py new file mode 100644 index 0000000..b62a09e --- /dev/null +++ b/src/ydc_search_api/resources/__init__.py @@ -0,0 +1,33 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from .news import ( + NewsResource, + AsyncNewsResource, + NewsResourceWithRawResponse, + AsyncNewsResourceWithRawResponse, + NewsResourceWithStreamingResponse, + AsyncNewsResourceWithStreamingResponse, +) +from .search import ( + SearchResource, + AsyncSearchResource, + SearchResourceWithRawResponse, + AsyncSearchResourceWithRawResponse, + SearchResourceWithStreamingResponse, + AsyncSearchResourceWithStreamingResponse, +) + +__all__ = [ + "SearchResource", + "AsyncSearchResource", + "SearchResourceWithRawResponse", + "AsyncSearchResourceWithRawResponse", + "SearchResourceWithStreamingResponse", + "AsyncSearchResourceWithStreamingResponse", + "NewsResource", + "AsyncNewsResource", + "NewsResourceWithRawResponse", + "AsyncNewsResourceWithRawResponse", + "NewsResourceWithStreamingResponse", + "AsyncNewsResourceWithStreamingResponse", +] diff --git a/src/ydc_search_api/resources/news.py b/src/ydc_search_api/resources/news.py new file mode 100644 index 0000000..c7e5168 --- /dev/null +++ b/src/ydc_search_api/resources/news.py @@ -0,0 +1,265 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing_extensions import Literal + +import httpx + +from ..types import news_list_params +from .._types import NOT_GIVEN, Body, Query, Headers, NotGiven +from .._utils import maybe_transform, async_maybe_transform +from .._compat import cached_property +from .._resource import SyncAPIResource, AsyncAPIResource +from .._response import ( + to_raw_response_wrapper, + to_streamed_response_wrapper, + async_to_raw_response_wrapper, + async_to_streamed_response_wrapper, +) +from .._base_client import make_request_options +from ..types.news_list_response import NewsListResponse + +__all__ = ["NewsResource", "AsyncNewsResource"] + + +class NewsResource(SyncAPIResource): + @cached_property + def with_raw_response(self) -> NewsResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/You-OpenSource/You-Python#accessing-raw-response-data-eg-headers + """ + return NewsResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> NewsResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/You-OpenSource/You-Python#with_streaming_response + """ + return NewsResourceWithStreamingResponse(self) + + def list( + self, + *, + query: str, + count: int | NotGiven = NOT_GIVEN, + country: str | NotGiven = NOT_GIVEN, + offset: int | NotGiven = NOT_GIVEN, + recency: Literal["day", "week", "month", "year"] | NotGiven = NOT_GIVEN, + safesearch: str | NotGiven = NOT_GIVEN, + search_lang: str | NotGiven = NOT_GIVEN, + spellcheck: bool | NotGiven = NOT_GIVEN, + ui_lang: str | NotGiven = NOT_GIVEN, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> NewsListResponse: + """ + Returns a list of news hits for query + + Args: + query: Search query used to retrieve relevant results from index + + count: Specifies the maximum number of web results to return. Range + `1 ≀ num_web_results ≀ 20`. + + country: Country Code, one of + `['AR', 'AU', 'AT', 'BE', 'BR', 'CA', 'CL', 'DK', 'FI', 'FR', 'DE', 'HK', 'IN', 'ID', 'IT', 'JP', 'KR', 'MY', 'MX', 'NL', 'NZ', 'NO', 'CN', 'PL', 'PT', 'PH', 'RU', 'SA', 'ZA', 'ES', 'SE', 'CH', 'TW', 'TR', 'GB', 'US']`. + + offset: Indicates the `offset` for pagination. The `offset` is calculated in multiples + of `num_web_results`. For example, if `num_web_results = 5` and `offset = 1`, + results 5–10 will be returned. Range `0 ≀ offset ≀ 9`. + + recency: Specify the desired recency for the requested articles. + + safesearch: Configures the safesearch filter for content moderation. `off` - no filtering + applied.`moderate` - moderate content filtering (default). `strict` - strict + content filtering. + + search_lang: Language codes, one of + `['ar', 'eu', 'bn', 'bg', 'ca', 'Simplified', 'Traditional', 'hr', 'cs', 'da', 'nl', 'en', 'United', 'et', 'fi', 'fr', 'gl', 'de', 'gu', 'he', 'hi', 'hu', 'is', 'it', 'jp', 'kn', 'ko', 'lv', 'lt', 'ms', 'ml', 'mr', 'BokmΓ₯l', 'pl', 'Brazil', 'Portugal', 'pa', 'ro', 'ru', 'Cyrylic', 'sk', 'sl', 'es', 'sv', 'ta', 'te', 'th', 'tr', 'uk', 'vi']`. + + spellcheck: Determine whether the `query` requires spell-checking. default is `true`. + + ui_lang: User interface language for the response, one of + `['es-AR', 'en-AU', 'de-AT', 'nl-BE', 'fr-BE', 'pt-BR', 'en-CA', 'fr-CA', 'es-CL', 'da-DK', 'fi-FI', 'fr-FR', 'de-DE', 'SAR', 'en-IN', 'en-ID', 'it-IT', 'ja-JP', 'ko-KR', 'en-MY', 'es-MX', 'nl-NL', 'English', 'no-NO', 'of', 'pl-PL', 'the', 'ru-RU', 'English', 'es-ES', 'sv-SE', 'fr-CH', 'de-CH', 'Chinese', 'tr-TR', 'English', 'English', 'Spanish']`. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + return self._get( + "/news", + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=maybe_transform( + { + "query": query, + "count": count, + "country": country, + "offset": offset, + "recency": recency, + "safesearch": safesearch, + "search_lang": search_lang, + "spellcheck": spellcheck, + "ui_lang": ui_lang, + }, + news_list_params.NewsListParams, + ), + ), + cast_to=NewsListResponse, + ) + + +class AsyncNewsResource(AsyncAPIResource): + @cached_property + def with_raw_response(self) -> AsyncNewsResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/You-OpenSource/You-Python#accessing-raw-response-data-eg-headers + """ + return AsyncNewsResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> AsyncNewsResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/You-OpenSource/You-Python#with_streaming_response + """ + return AsyncNewsResourceWithStreamingResponse(self) + + async def list( + self, + *, + query: str, + count: int | NotGiven = NOT_GIVEN, + country: str | NotGiven = NOT_GIVEN, + offset: int | NotGiven = NOT_GIVEN, + recency: Literal["day", "week", "month", "year"] | NotGiven = NOT_GIVEN, + safesearch: str | NotGiven = NOT_GIVEN, + search_lang: str | NotGiven = NOT_GIVEN, + spellcheck: bool | NotGiven = NOT_GIVEN, + ui_lang: str | NotGiven = NOT_GIVEN, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> NewsListResponse: + """ + Returns a list of news hits for query + + Args: + query: Search query used to retrieve relevant results from index + + count: Specifies the maximum number of web results to return. Range + `1 ≀ num_web_results ≀ 20`. + + country: Country Code, one of + `['AR', 'AU', 'AT', 'BE', 'BR', 'CA', 'CL', 'DK', 'FI', 'FR', 'DE', 'HK', 'IN', 'ID', 'IT', 'JP', 'KR', 'MY', 'MX', 'NL', 'NZ', 'NO', 'CN', 'PL', 'PT', 'PH', 'RU', 'SA', 'ZA', 'ES', 'SE', 'CH', 'TW', 'TR', 'GB', 'US']`. + + offset: Indicates the `offset` for pagination. The `offset` is calculated in multiples + of `num_web_results`. For example, if `num_web_results = 5` and `offset = 1`, + results 5–10 will be returned. Range `0 ≀ offset ≀ 9`. + + recency: Specify the desired recency for the requested articles. + + safesearch: Configures the safesearch filter for content moderation. `off` - no filtering + applied.`moderate` - moderate content filtering (default). `strict` - strict + content filtering. + + search_lang: Language codes, one of + `['ar', 'eu', 'bn', 'bg', 'ca', 'Simplified', 'Traditional', 'hr', 'cs', 'da', 'nl', 'en', 'United', 'et', 'fi', 'fr', 'gl', 'de', 'gu', 'he', 'hi', 'hu', 'is', 'it', 'jp', 'kn', 'ko', 'lv', 'lt', 'ms', 'ml', 'mr', 'BokmΓ₯l', 'pl', 'Brazil', 'Portugal', 'pa', 'ro', 'ru', 'Cyrylic', 'sk', 'sl', 'es', 'sv', 'ta', 'te', 'th', 'tr', 'uk', 'vi']`. + + spellcheck: Determine whether the `query` requires spell-checking. default is `true`. + + ui_lang: User interface language for the response, one of + `['es-AR', 'en-AU', 'de-AT', 'nl-BE', 'fr-BE', 'pt-BR', 'en-CA', 'fr-CA', 'es-CL', 'da-DK', 'fi-FI', 'fr-FR', 'de-DE', 'SAR', 'en-IN', 'en-ID', 'it-IT', 'ja-JP', 'ko-KR', 'en-MY', 'es-MX', 'nl-NL', 'English', 'no-NO', 'of', 'pl-PL', 'the', 'ru-RU', 'English', 'es-ES', 'sv-SE', 'fr-CH', 'de-CH', 'Chinese', 'tr-TR', 'English', 'English', 'Spanish']`. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + return await self._get( + "/news", + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=await async_maybe_transform( + { + "query": query, + "count": count, + "country": country, + "offset": offset, + "recency": recency, + "safesearch": safesearch, + "search_lang": search_lang, + "spellcheck": spellcheck, + "ui_lang": ui_lang, + }, + news_list_params.NewsListParams, + ), + ), + cast_to=NewsListResponse, + ) + + +class NewsResourceWithRawResponse: + def __init__(self, news: NewsResource) -> None: + self._news = news + + self.list = to_raw_response_wrapper( + news.list, + ) + + +class AsyncNewsResourceWithRawResponse: + def __init__(self, news: AsyncNewsResource) -> None: + self._news = news + + self.list = async_to_raw_response_wrapper( + news.list, + ) + + +class NewsResourceWithStreamingResponse: + def __init__(self, news: NewsResource) -> None: + self._news = news + + self.list = to_streamed_response_wrapper( + news.list, + ) + + +class AsyncNewsResourceWithStreamingResponse: + def __init__(self, news: AsyncNewsResource) -> None: + self._news = news + + self.list = async_to_streamed_response_wrapper( + news.list, + ) diff --git a/src/ydc_search_api/resources/search.py b/src/ydc_search_api/resources/search.py new file mode 100644 index 0000000..2214f45 --- /dev/null +++ b/src/ydc_search_api/resources/search.py @@ -0,0 +1,239 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing_extensions import Literal + +import httpx + +from ..types import search_query_params +from .._types import NOT_GIVEN, Body, Query, Headers, NotGiven +from .._utils import maybe_transform, async_maybe_transform +from .._compat import cached_property +from .._resource import SyncAPIResource, AsyncAPIResource +from .._response import ( + to_raw_response_wrapper, + to_streamed_response_wrapper, + async_to_raw_response_wrapper, + async_to_streamed_response_wrapper, +) +from .._base_client import make_request_options +from ..types.search_query_response import SearchQueryResponse + +__all__ = ["SearchResource", "AsyncSearchResource"] + + +class SearchResource(SyncAPIResource): + @cached_property + def with_raw_response(self) -> SearchResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/You-OpenSource/You-Python#accessing-raw-response-data-eg-headers + """ + return SearchResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> SearchResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/You-OpenSource/You-Python#with_streaming_response + """ + return SearchResourceWithStreamingResponse(self) + + def query( + self, + *, + query: str, + country: str | NotGiven = NOT_GIVEN, + freshness: Literal["day", "week", "month", "year"] | NotGiven = NOT_GIVEN, + num_web_results: int | NotGiven = NOT_GIVEN, + offset: int | NotGiven = NOT_GIVEN, + safesearch: str | NotGiven = NOT_GIVEN, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> SearchQueryResponse: + """ + Returns a list of search index hits from query + + Args: + query: Search query used to retrieve relevant results from index. You may also include + [search operators](#search-operators) to refine your search. + + country: Country Code, one of + `['AR', 'AU', 'AT', 'BE', 'BR', 'CA', 'CL', 'DK', 'FI', 'FR', 'DE', 'HK', 'IN', 'ID', 'IT', 'JP', 'KR', 'MY', 'MX', 'NL', 'NZ', 'NO', 'CN', 'PL', 'PT', 'PH', 'RU', 'SA', 'ZA', 'ES', 'SE', 'CH', 'TW', 'TR', 'GB', 'US']`. + + freshness: Specifies the freshness of the results to return. + + num_web_results: Specifies the maximum number of web results to return. Range + `1 ≀ num_web_results ≀ 20`. + + offset: Indicates the `offset` for pagination. The `offset` is calculated in multiples + of `num_web_results`. For example, if `num_web_results = 5` and `offset = 1`, + results 5–10 will be returned. Range `0 ≀ offset ≀ 9`. + + safesearch: Configures the safesearch filter for content moderation. `off` - no filtering + applied.`moderate` - moderate content filtering (default). `strict` - strict + content filtering. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + return self._get( + "/search", + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=maybe_transform( + { + "query": query, + "country": country, + "freshness": freshness, + "num_web_results": num_web_results, + "offset": offset, + "safesearch": safesearch, + }, + search_query_params.SearchQueryParams, + ), + ), + cast_to=SearchQueryResponse, + ) + + +class AsyncSearchResource(AsyncAPIResource): + @cached_property + def with_raw_response(self) -> AsyncSearchResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/You-OpenSource/You-Python#accessing-raw-response-data-eg-headers + """ + return AsyncSearchResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> AsyncSearchResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/You-OpenSource/You-Python#with_streaming_response + """ + return AsyncSearchResourceWithStreamingResponse(self) + + async def query( + self, + *, + query: str, + country: str | NotGiven = NOT_GIVEN, + freshness: Literal["day", "week", "month", "year"] | NotGiven = NOT_GIVEN, + num_web_results: int | NotGiven = NOT_GIVEN, + offset: int | NotGiven = NOT_GIVEN, + safesearch: str | NotGiven = NOT_GIVEN, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN, + ) -> SearchQueryResponse: + """ + Returns a list of search index hits from query + + Args: + query: Search query used to retrieve relevant results from index. You may also include + [search operators](#search-operators) to refine your search. + + country: Country Code, one of + `['AR', 'AU', 'AT', 'BE', 'BR', 'CA', 'CL', 'DK', 'FI', 'FR', 'DE', 'HK', 'IN', 'ID', 'IT', 'JP', 'KR', 'MY', 'MX', 'NL', 'NZ', 'NO', 'CN', 'PL', 'PT', 'PH', 'RU', 'SA', 'ZA', 'ES', 'SE', 'CH', 'TW', 'TR', 'GB', 'US']`. + + freshness: Specifies the freshness of the results to return. + + num_web_results: Specifies the maximum number of web results to return. Range + `1 ≀ num_web_results ≀ 20`. + + offset: Indicates the `offset` for pagination. The `offset` is calculated in multiples + of `num_web_results`. For example, if `num_web_results = 5` and `offset = 1`, + results 5–10 will be returned. Range `0 ≀ offset ≀ 9`. + + safesearch: Configures the safesearch filter for content moderation. `off` - no filtering + applied.`moderate` - moderate content filtering (default). `strict` - strict + content filtering. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + return await self._get( + "/search", + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=await async_maybe_transform( + { + "query": query, + "country": country, + "freshness": freshness, + "num_web_results": num_web_results, + "offset": offset, + "safesearch": safesearch, + }, + search_query_params.SearchQueryParams, + ), + ), + cast_to=SearchQueryResponse, + ) + + +class SearchResourceWithRawResponse: + def __init__(self, search: SearchResource) -> None: + self._search = search + + self.query = to_raw_response_wrapper( + search.query, + ) + + +class AsyncSearchResourceWithRawResponse: + def __init__(self, search: AsyncSearchResource) -> None: + self._search = search + + self.query = async_to_raw_response_wrapper( + search.query, + ) + + +class SearchResourceWithStreamingResponse: + def __init__(self, search: SearchResource) -> None: + self._search = search + + self.query = to_streamed_response_wrapper( + search.query, + ) + + +class AsyncSearchResourceWithStreamingResponse: + def __init__(self, search: AsyncSearchResource) -> None: + self._search = search + + self.query = async_to_streamed_response_wrapper( + search.query, + ) diff --git a/src/ydc_search_api/types/__init__.py b/src/ydc_search_api/types/__init__.py new file mode 100644 index 0000000..0886a9c --- /dev/null +++ b/src/ydc_search_api/types/__init__.py @@ -0,0 +1,8 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from .news_list_params import NewsListParams as NewsListParams +from .news_list_response import NewsListResponse as NewsListResponse +from .search_query_params import SearchQueryParams as SearchQueryParams +from .search_query_response import SearchQueryResponse as SearchQueryResponse diff --git a/src/ydc_search_api/types/news_list_params.py b/src/ydc_search_api/types/news_list_params.py new file mode 100644 index 0000000..b486812 --- /dev/null +++ b/src/ydc_search_api/types/news_list_params.py @@ -0,0 +1,57 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing_extensions import Literal, Required, TypedDict + +__all__ = ["NewsListParams"] + + +class NewsListParams(TypedDict, total=False): + query: Required[str] + """Search query used to retrieve relevant results from index""" + + count: int + """Specifies the maximum number of web results to return. + + Range `1 ≀ num_web_results ≀ 20`. + """ + + country: str + """ + Country Code, one of + `['AR', 'AU', 'AT', 'BE', 'BR', 'CA', 'CL', 'DK', 'FI', 'FR', 'DE', 'HK', 'IN', 'ID', 'IT', 'JP', 'KR', 'MY', 'MX', 'NL', 'NZ', 'NO', 'CN', 'PL', 'PT', 'PH', 'RU', 'SA', 'ZA', 'ES', 'SE', 'CH', 'TW', 'TR', 'GB', 'US']`. + """ + + offset: int + """Indicates the `offset` for pagination. + + The `offset` is calculated in multiples of `num_web_results`. For example, if + `num_web_results = 5` and `offset = 1`, results 5–10 will be returned. Range + `0 ≀ offset ≀ 9`. + """ + + recency: Literal["day", "week", "month", "year"] + """Specify the desired recency for the requested articles.""" + + safesearch: str + """Configures the safesearch filter for content moderation. + + `off` - no filtering applied.`moderate` - moderate content filtering (default). + `strict` - strict content filtering. + """ + + search_lang: str + """ + Language codes, one of + `['ar', 'eu', 'bn', 'bg', 'ca', 'Simplified', 'Traditional', 'hr', 'cs', 'da', 'nl', 'en', 'United', 'et', 'fi', 'fr', 'gl', 'de', 'gu', 'he', 'hi', 'hu', 'is', 'it', 'jp', 'kn', 'ko', 'lv', 'lt', 'ms', 'ml', 'mr', 'BokmΓ₯l', 'pl', 'Brazil', 'Portugal', 'pa', 'ro', 'ru', 'Cyrylic', 'sk', 'sl', 'es', 'sv', 'ta', 'te', 'th', 'tr', 'uk', 'vi']`. + """ + + spellcheck: bool + """Determine whether the `query` requires spell-checking. default is `true`.""" + + ui_lang: str + """ + User interface language for the response, one of + `['es-AR', 'en-AU', 'de-AT', 'nl-BE', 'fr-BE', 'pt-BR', 'en-CA', 'fr-CA', 'es-CL', 'da-DK', 'fi-FI', 'fr-FR', 'de-DE', 'SAR', 'en-IN', 'en-ID', 'it-IT', 'ja-JP', 'ko-KR', 'en-MY', 'es-MX', 'nl-NL', 'English', 'no-NO', 'of', 'pl-PL', 'the', 'ru-RU', 'English', 'es-ES', 'sv-SE', 'fr-CH', 'de-CH', 'Chinese', 'tr-TR', 'English', 'English', 'Spanish']`. + """ diff --git a/src/ydc_search_api/types/news_list_response.py b/src/ydc_search_api/types/news_list_response.py new file mode 100644 index 0000000..3c270bc --- /dev/null +++ b/src/ydc_search_api/types/news_list_response.py @@ -0,0 +1,51 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List, Optional + +from .._models import BaseModel + +__all__ = ["NewsListResponse", "News", "NewsResult", "NewsResultMetaURL", "NewsResultThumbnail"] + + +class NewsResultMetaURL(BaseModel): + hostname: Optional[str] = None + + netloc: Optional[str] = None + + path: Optional[str] = None + + scheme: Optional[str] = None + + +class NewsResultThumbnail(BaseModel): + original: Optional[str] = None + + +class NewsResult(BaseModel): + age: Optional[str] = None + + breaking: Optional[bool] = None + + description: Optional[str] = None + + meta_url: Optional[NewsResultMetaURL] = None + + page_age: Optional[str] = None + + page_fetched: Optional[str] = None + + thumbnail: Optional[NewsResultThumbnail] = None + + title: Optional[str] = None + + type: Optional[str] = None + + url: Optional[str] = None + + +class News(BaseModel): + results: Optional[List[NewsResult]] = None + + +class NewsListResponse(BaseModel): + news: Optional[News] = None diff --git a/src/ydc_search_api/types/search_query_params.py b/src/ydc_search_api/types/search_query_params.py new file mode 100644 index 0000000..c74b0e9 --- /dev/null +++ b/src/ydc_search_api/types/search_query_params.py @@ -0,0 +1,46 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing_extensions import Literal, Required, TypedDict + +__all__ = ["SearchQueryParams"] + + +class SearchQueryParams(TypedDict, total=False): + query: Required[str] + """Search query used to retrieve relevant results from index. + + You may also include [search operators](#search-operators) to refine your + search. + """ + + country: str + """ + Country Code, one of + `['AR', 'AU', 'AT', 'BE', 'BR', 'CA', 'CL', 'DK', 'FI', 'FR', 'DE', 'HK', 'IN', 'ID', 'IT', 'JP', 'KR', 'MY', 'MX', 'NL', 'NZ', 'NO', 'CN', 'PL', 'PT', 'PH', 'RU', 'SA', 'ZA', 'ES', 'SE', 'CH', 'TW', 'TR', 'GB', 'US']`. + """ + + freshness: Literal["day", "week", "month", "year"] + """Specifies the freshness of the results to return.""" + + num_web_results: int + """Specifies the maximum number of web results to return. + + Range `1 ≀ num_web_results ≀ 20`. + """ + + offset: int + """Indicates the `offset` for pagination. + + The `offset` is calculated in multiples of `num_web_results`. For example, if + `num_web_results = 5` and `offset = 1`, results 5–10 will be returned. Range + `0 ≀ offset ≀ 9`. + """ + + safesearch: str + """Configures the safesearch filter for content moderation. + + `off` - no filtering applied.`moderate` - moderate content filtering (default). + `strict` - strict content filtering. + """ diff --git a/src/ydc_search_api/types/search_query_response.py b/src/ydc_search_api/types/search_query_response.py new file mode 100644 index 0000000..929c883 --- /dev/null +++ b/src/ydc_search_api/types/search_query_response.py @@ -0,0 +1,37 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List, Optional + +from .._models import BaseModel + +__all__ = ["SearchQueryResponse", "Hit"] + + +class Hit(BaseModel): + description: Optional[str] = None + """A brief description of the content of the search result.""" + + favicon_url: Optional[str] = None + """The URL of the favicon of the search result's domain.""" + + snippets: Optional[List[str]] = None + """ + An array of text snippets from the search result, providing a preview of the + content. + """ + + thumbnail_url: Optional[str] = None + """URL of the thumbnail.""" + + title: Optional[str] = None + """The title or name of the search result.""" + + url: Optional[str] = None + """The URL of the specific search result.""" + + +class SearchQueryResponse(BaseModel): + hits: Optional[List[Hit]] = None + + latency: Optional[float] = None + """Indicates the time (in seconds) taken by the API to generate the response.""" diff --git a/tests/__init__.py b/tests/__init__.py new file mode 100644 index 0000000..fd8019a --- /dev/null +++ b/tests/__init__.py @@ -0,0 +1 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. diff --git a/tests/api_resources/__init__.py b/tests/api_resources/__init__.py new file mode 100644 index 0000000..fd8019a --- /dev/null +++ b/tests/api_resources/__init__.py @@ -0,0 +1 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. diff --git a/tests/api_resources/test_news.py b/tests/api_resources/test_news.py new file mode 100644 index 0000000..41d7db4 --- /dev/null +++ b/tests/api_resources/test_news.py @@ -0,0 +1,124 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +from typing import Any, cast + +import pytest + +from tests.utils import assert_matches_type +from ydc_search_api import YdcSearchAPI, AsyncYdcSearchAPI +from ydc_search_api.types import NewsListResponse + +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") + + +class TestNews: + parametrize = pytest.mark.parametrize("client", [False, True], indirect=True, ids=["loose", "strict"]) + + @pytest.mark.skip() + @parametrize + def test_method_list(self, client: YdcSearchAPI) -> None: + news = client.news.list( + query="query", + ) + assert_matches_type(NewsListResponse, news, path=["response"]) + + @pytest.mark.skip() + @parametrize + def test_method_list_with_all_params(self, client: YdcSearchAPI) -> None: + news = client.news.list( + query="query", + count=0, + country="country", + offset=0, + recency="day", + safesearch="safesearch", + search_lang="search_lang", + spellcheck=True, + ui_lang="ui_lang", + ) + assert_matches_type(NewsListResponse, news, path=["response"]) + + @pytest.mark.skip() + @parametrize + def test_raw_response_list(self, client: YdcSearchAPI) -> None: + response = client.news.with_raw_response.list( + query="query", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + news = response.parse() + assert_matches_type(NewsListResponse, news, path=["response"]) + + @pytest.mark.skip() + @parametrize + def test_streaming_response_list(self, client: YdcSearchAPI) -> None: + with client.news.with_streaming_response.list( + query="query", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + news = response.parse() + assert_matches_type(NewsListResponse, news, path=["response"]) + + assert cast(Any, response.is_closed) is True + + +class TestAsyncNews: + parametrize = pytest.mark.parametrize( + "async_client", [False, True, {"http_client": "aiohttp"}], indirect=True, ids=["loose", "strict", "aiohttp"] + ) + + @pytest.mark.skip() + @parametrize + async def test_method_list(self, async_client: AsyncYdcSearchAPI) -> None: + news = await async_client.news.list( + query="query", + ) + assert_matches_type(NewsListResponse, news, path=["response"]) + + @pytest.mark.skip() + @parametrize + async def test_method_list_with_all_params(self, async_client: AsyncYdcSearchAPI) -> None: + news = await async_client.news.list( + query="query", + count=0, + country="country", + offset=0, + recency="day", + safesearch="safesearch", + search_lang="search_lang", + spellcheck=True, + ui_lang="ui_lang", + ) + assert_matches_type(NewsListResponse, news, path=["response"]) + + @pytest.mark.skip() + @parametrize + async def test_raw_response_list(self, async_client: AsyncYdcSearchAPI) -> None: + response = await async_client.news.with_raw_response.list( + query="query", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + news = await response.parse() + assert_matches_type(NewsListResponse, news, path=["response"]) + + @pytest.mark.skip() + @parametrize + async def test_streaming_response_list(self, async_client: AsyncYdcSearchAPI) -> None: + async with async_client.news.with_streaming_response.list( + query="query", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + news = await response.parse() + assert_matches_type(NewsListResponse, news, path=["response"]) + + assert cast(Any, response.is_closed) is True diff --git a/tests/api_resources/test_search.py b/tests/api_resources/test_search.py new file mode 100644 index 0000000..7fc1a66 --- /dev/null +++ b/tests/api_resources/test_search.py @@ -0,0 +1,118 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +from typing import Any, cast + +import pytest + +from tests.utils import assert_matches_type +from ydc_search_api import YdcSearchAPI, AsyncYdcSearchAPI +from ydc_search_api.types import SearchQueryResponse + +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") + + +class TestSearch: + parametrize = pytest.mark.parametrize("client", [False, True], indirect=True, ids=["loose", "strict"]) + + @pytest.mark.skip() + @parametrize + def test_method_query(self, client: YdcSearchAPI) -> None: + search = client.search.query( + query="query", + ) + assert_matches_type(SearchQueryResponse, search, path=["response"]) + + @pytest.mark.skip() + @parametrize + def test_method_query_with_all_params(self, client: YdcSearchAPI) -> None: + search = client.search.query( + query="query", + country="country", + freshness="day", + num_web_results=0, + offset=0, + safesearch="safesearch", + ) + assert_matches_type(SearchQueryResponse, search, path=["response"]) + + @pytest.mark.skip() + @parametrize + def test_raw_response_query(self, client: YdcSearchAPI) -> None: + response = client.search.with_raw_response.query( + query="query", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + search = response.parse() + assert_matches_type(SearchQueryResponse, search, path=["response"]) + + @pytest.mark.skip() + @parametrize + def test_streaming_response_query(self, client: YdcSearchAPI) -> None: + with client.search.with_streaming_response.query( + query="query", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + search = response.parse() + assert_matches_type(SearchQueryResponse, search, path=["response"]) + + assert cast(Any, response.is_closed) is True + + +class TestAsyncSearch: + parametrize = pytest.mark.parametrize( + "async_client", [False, True, {"http_client": "aiohttp"}], indirect=True, ids=["loose", "strict", "aiohttp"] + ) + + @pytest.mark.skip() + @parametrize + async def test_method_query(self, async_client: AsyncYdcSearchAPI) -> None: + search = await async_client.search.query( + query="query", + ) + assert_matches_type(SearchQueryResponse, search, path=["response"]) + + @pytest.mark.skip() + @parametrize + async def test_method_query_with_all_params(self, async_client: AsyncYdcSearchAPI) -> None: + search = await async_client.search.query( + query="query", + country="country", + freshness="day", + num_web_results=0, + offset=0, + safesearch="safesearch", + ) + assert_matches_type(SearchQueryResponse, search, path=["response"]) + + @pytest.mark.skip() + @parametrize + async def test_raw_response_query(self, async_client: AsyncYdcSearchAPI) -> None: + response = await async_client.search.with_raw_response.query( + query="query", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + search = await response.parse() + assert_matches_type(SearchQueryResponse, search, path=["response"]) + + @pytest.mark.skip() + @parametrize + async def test_streaming_response_query(self, async_client: AsyncYdcSearchAPI) -> None: + async with async_client.search.with_streaming_response.query( + query="query", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + search = await response.parse() + assert_matches_type(SearchQueryResponse, search, path=["response"]) + + assert cast(Any, response.is_closed) is True diff --git a/tests/conftest.py b/tests/conftest.py new file mode 100644 index 0000000..ccc7cc5 --- /dev/null +++ b/tests/conftest.py @@ -0,0 +1,84 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +import logging +from typing import TYPE_CHECKING, Iterator, AsyncIterator + +import httpx +import pytest +from pytest_asyncio import is_async_test + +from ydc_search_api import YdcSearchAPI, AsyncYdcSearchAPI, DefaultAioHttpClient +from ydc_search_api._utils import is_dict + +if TYPE_CHECKING: + from _pytest.fixtures import FixtureRequest # pyright: ignore[reportPrivateImportUsage] + +pytest.register_assert_rewrite("tests.utils") + +logging.getLogger("ydc_search_api").setLevel(logging.DEBUG) + + +# automatically add `pytest.mark.asyncio()` to all of our async tests +# so we don't have to add that boilerplate everywhere +def pytest_collection_modifyitems(items: list[pytest.Function]) -> None: + pytest_asyncio_tests = (item for item in items if is_async_test(item)) + session_scope_marker = pytest.mark.asyncio(loop_scope="session") + for async_test in pytest_asyncio_tests: + async_test.add_marker(session_scope_marker, append=False) + + # We skip tests that use both the aiohttp client and respx_mock as respx_mock + # doesn't support custom transports. + for item in items: + if "async_client" not in item.fixturenames or "respx_mock" not in item.fixturenames: + continue + + if not hasattr(item, "callspec"): + continue + + async_client_param = item.callspec.params.get("async_client") + if is_dict(async_client_param) and async_client_param.get("http_client") == "aiohttp": + item.add_marker(pytest.mark.skip(reason="aiohttp client is not compatible with respx_mock")) + + +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") + +api_key = "My API Key" + + +@pytest.fixture(scope="session") +def client(request: FixtureRequest) -> Iterator[YdcSearchAPI]: + strict = getattr(request, "param", True) + if not isinstance(strict, bool): + raise TypeError(f"Unexpected fixture parameter type {type(strict)}, expected {bool}") + + with YdcSearchAPI(base_url=base_url, api_key=api_key, _strict_response_validation=strict) as client: + yield client + + +@pytest.fixture(scope="session") +async def async_client(request: FixtureRequest) -> AsyncIterator[AsyncYdcSearchAPI]: + param = getattr(request, "param", True) + + # defaults + strict = True + http_client: None | httpx.AsyncClient = None + + if isinstance(param, bool): + strict = param + elif is_dict(param): + strict = param.get("strict", True) + assert isinstance(strict, bool) + + http_client_type = param.get("http_client", "httpx") + if http_client_type == "aiohttp": + http_client = DefaultAioHttpClient() + else: + raise TypeError(f"Unexpected fixture parameter type {type(param)}, expected bool or dict") + + async with AsyncYdcSearchAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=strict, http_client=http_client + ) as client: + yield client diff --git a/tests/sample_file.txt b/tests/sample_file.txt new file mode 100644 index 0000000..af5626b --- /dev/null +++ b/tests/sample_file.txt @@ -0,0 +1 @@ +Hello, world! diff --git a/tests/test_client.py b/tests/test_client.py new file mode 100644 index 0000000..ab27a2b --- /dev/null +++ b/tests/test_client.py @@ -0,0 +1,1740 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import gc +import os +import sys +import json +import time +import asyncio +import inspect +import subprocess +import tracemalloc +from typing import Any, Union, cast +from textwrap import dedent +from unittest import mock +from typing_extensions import Literal + +import httpx +import pytest +from respx import MockRouter +from pydantic import ValidationError + +from ydc_search_api import YdcSearchAPI, AsyncYdcSearchAPI, APIResponseValidationError +from ydc_search_api._types import Omit +from ydc_search_api._models import BaseModel, FinalRequestOptions +from ydc_search_api._exceptions import APIStatusError, APITimeoutError, YdcSearchAPIError, APIResponseValidationError +from ydc_search_api._base_client import ( + DEFAULT_TIMEOUT, + HTTPX_DEFAULT_TIMEOUT, + BaseClient, + DefaultHttpxClient, + DefaultAsyncHttpxClient, + make_request_options, +) + +from .utils import update_env + +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") +api_key = "My API Key" + + +def _get_params(client: BaseClient[Any, Any]) -> dict[str, str]: + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + url = httpx.URL(request.url) + return dict(url.params) + + +def _low_retry_timeout(*_args: Any, **_kwargs: Any) -> float: + return 0.1 + + +def _get_open_connections(client: YdcSearchAPI | AsyncYdcSearchAPI) -> int: + transport = client._client._transport + assert isinstance(transport, httpx.HTTPTransport) or isinstance(transport, httpx.AsyncHTTPTransport) + + pool = transport._pool + return len(pool._requests) + + +class TestYdcSearchAPI: + client = YdcSearchAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True) + + @pytest.mark.respx(base_url=base_url) + def test_raw_response(self, respx_mock: MockRouter) -> None: + respx_mock.post("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = self.client.post("/foo", cast_to=httpx.Response) + assert response.status_code == 200 + assert isinstance(response, httpx.Response) + assert response.json() == {"foo": "bar"} + + @pytest.mark.respx(base_url=base_url) + def test_raw_response_for_binary(self, respx_mock: MockRouter) -> None: + respx_mock.post("/foo").mock( + return_value=httpx.Response(200, headers={"Content-Type": "application/binary"}, content='{"foo": "bar"}') + ) + + response = self.client.post("/foo", cast_to=httpx.Response) + assert response.status_code == 200 + assert isinstance(response, httpx.Response) + assert response.json() == {"foo": "bar"} + + def test_copy(self) -> None: + copied = self.client.copy() + assert id(copied) != id(self.client) + + copied = self.client.copy(api_key="another My API Key") + assert copied.api_key == "another My API Key" + assert self.client.api_key == "My API Key" + + def test_copy_default_options(self) -> None: + # options that have a default are overridden correctly + copied = self.client.copy(max_retries=7) + assert copied.max_retries == 7 + assert self.client.max_retries == 2 + + copied2 = copied.copy(max_retries=6) + assert copied2.max_retries == 6 + assert copied.max_retries == 7 + + # timeout + assert isinstance(self.client.timeout, httpx.Timeout) + copied = self.client.copy(timeout=None) + assert copied.timeout is None + assert isinstance(self.client.timeout, httpx.Timeout) + + def test_copy_default_headers(self) -> None: + client = YdcSearchAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_headers={"X-Foo": "bar"} + ) + assert client.default_headers["X-Foo"] == "bar" + + # does not override the already given value when not specified + copied = client.copy() + assert copied.default_headers["X-Foo"] == "bar" + + # merges already given headers + copied = client.copy(default_headers={"X-Bar": "stainless"}) + assert copied.default_headers["X-Foo"] == "bar" + assert copied.default_headers["X-Bar"] == "stainless" + + # uses new values for any already given headers + copied = client.copy(default_headers={"X-Foo": "stainless"}) + assert copied.default_headers["X-Foo"] == "stainless" + + # set_default_headers + + # completely overrides already set values + copied = client.copy(set_default_headers={}) + assert copied.default_headers.get("X-Foo") is None + + copied = client.copy(set_default_headers={"X-Bar": "Robert"}) + assert copied.default_headers["X-Bar"] == "Robert" + + with pytest.raises( + ValueError, + match="`default_headers` and `set_default_headers` arguments are mutually exclusive", + ): + client.copy(set_default_headers={}, default_headers={"X-Foo": "Bar"}) + + def test_copy_default_query(self) -> None: + client = YdcSearchAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_query={"foo": "bar"} + ) + assert _get_params(client)["foo"] == "bar" + + # does not override the already given value when not specified + copied = client.copy() + assert _get_params(copied)["foo"] == "bar" + + # merges already given params + copied = client.copy(default_query={"bar": "stainless"}) + params = _get_params(copied) + assert params["foo"] == "bar" + assert params["bar"] == "stainless" + + # uses new values for any already given headers + copied = client.copy(default_query={"foo": "stainless"}) + assert _get_params(copied)["foo"] == "stainless" + + # set_default_query + + # completely overrides already set values + copied = client.copy(set_default_query={}) + assert _get_params(copied) == {} + + copied = client.copy(set_default_query={"bar": "Robert"}) + assert _get_params(copied)["bar"] == "Robert" + + with pytest.raises( + ValueError, + # TODO: update + match="`default_query` and `set_default_query` arguments are mutually exclusive", + ): + client.copy(set_default_query={}, default_query={"foo": "Bar"}) + + def test_copy_signature(self) -> None: + # ensure the same parameters that can be passed to the client are defined in the `.copy()` method + init_signature = inspect.signature( + # mypy doesn't like that we access the `__init__` property. + self.client.__init__, # type: ignore[misc] + ) + copy_signature = inspect.signature(self.client.copy) + exclude_params = {"transport", "proxies", "_strict_response_validation"} + + for name in init_signature.parameters.keys(): + if name in exclude_params: + continue + + copy_param = copy_signature.parameters.get(name) + assert copy_param is not None, f"copy() signature is missing the {name} param" + + @pytest.mark.skipif(sys.version_info >= (3, 10), reason="fails because of a memory leak that started from 3.12") + def test_copy_build_request(self) -> None: + options = FinalRequestOptions(method="get", url="/foo") + + def build_request(options: FinalRequestOptions) -> None: + client = self.client.copy() + client._build_request(options) + + # ensure that the machinery is warmed up before tracing starts. + build_request(options) + gc.collect() + + tracemalloc.start(1000) + + snapshot_before = tracemalloc.take_snapshot() + + ITERATIONS = 10 + for _ in range(ITERATIONS): + build_request(options) + + gc.collect() + snapshot_after = tracemalloc.take_snapshot() + + tracemalloc.stop() + + def add_leak(leaks: list[tracemalloc.StatisticDiff], diff: tracemalloc.StatisticDiff) -> None: + if diff.count == 0: + # Avoid false positives by considering only leaks (i.e. allocations that persist). + return + + if diff.count % ITERATIONS != 0: + # Avoid false positives by considering only leaks that appear per iteration. + return + + for frame in diff.traceback: + if any( + frame.filename.endswith(fragment) + for fragment in [ + # to_raw_response_wrapper leaks through the @functools.wraps() decorator. + # + # removing the decorator fixes the leak for reasons we don't understand. + "ydc_search_api/_legacy_response.py", + "ydc_search_api/_response.py", + # pydantic.BaseModel.model_dump || pydantic.BaseModel.dict leak memory for some reason. + "ydc_search_api/_compat.py", + # Standard library leaks we don't care about. + "/logging/__init__.py", + ] + ): + return + + leaks.append(diff) + + leaks: list[tracemalloc.StatisticDiff] = [] + for diff in snapshot_after.compare_to(snapshot_before, "traceback"): + add_leak(leaks, diff) + if leaks: + for leak in leaks: + print("MEMORY LEAK:", leak) + for frame in leak.traceback: + print(frame) + raise AssertionError() + + def test_request_timeout(self) -> None: + request = self.client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT + + request = self.client._build_request( + FinalRequestOptions(method="get", url="/foo", timeout=httpx.Timeout(100.0)) + ) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(100.0) + + def test_client_timeout_option(self) -> None: + client = YdcSearchAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, timeout=httpx.Timeout(0) + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(0) + + def test_http_client_timeout_option(self) -> None: + # custom timeout given to the httpx client should be used + with httpx.Client(timeout=None) as http_client: + client = YdcSearchAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(None) + + # no timeout given to the httpx client should not use the httpx default + with httpx.Client() as http_client: + client = YdcSearchAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT + + # explicitly passing the default timeout currently results in it being ignored + with httpx.Client(timeout=HTTPX_DEFAULT_TIMEOUT) as http_client: + client = YdcSearchAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT # our default + + async def test_invalid_http_client(self) -> None: + with pytest.raises(TypeError, match="Invalid `http_client` arg"): + async with httpx.AsyncClient() as http_client: + YdcSearchAPI( + base_url=base_url, + api_key=api_key, + _strict_response_validation=True, + http_client=cast(Any, http_client), + ) + + def test_default_headers_option(self) -> None: + client = YdcSearchAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_headers={"X-Foo": "bar"} + ) + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("x-foo") == "bar" + assert request.headers.get("x-stainless-lang") == "python" + + client2 = YdcSearchAPI( + base_url=base_url, + api_key=api_key, + _strict_response_validation=True, + default_headers={ + "X-Foo": "stainless", + "X-Stainless-Lang": "my-overriding-header", + }, + ) + request = client2._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("x-foo") == "stainless" + assert request.headers.get("x-stainless-lang") == "my-overriding-header" + + def test_validate_headers(self) -> None: + client = YdcSearchAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True) + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("X-API-Key") == api_key + + with pytest.raises(YdcSearchAPIError): + with update_env(**{"YDC_SEARCH_API_API_KEY": Omit()}): + client2 = YdcSearchAPI(base_url=base_url, api_key=None, _strict_response_validation=True) + _ = client2 + + def test_default_query_option(self) -> None: + client = YdcSearchAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_query={"query_param": "bar"} + ) + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + url = httpx.URL(request.url) + assert dict(url.params) == {"query_param": "bar"} + + request = client._build_request( + FinalRequestOptions( + method="get", + url="/foo", + params={"foo": "baz", "query_param": "overridden"}, + ) + ) + url = httpx.URL(request.url) + assert dict(url.params) == {"foo": "baz", "query_param": "overridden"} + + def test_request_extra_json(self) -> None: + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + extra_json={"baz": False}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"foo": "bar", "baz": False} + + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + extra_json={"baz": False}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"baz": False} + + # `extra_json` takes priority over `json_data` when keys clash + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar", "baz": True}, + extra_json={"baz": None}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"foo": "bar", "baz": None} + + def test_request_extra_headers(self) -> None: + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options(extra_headers={"X-Foo": "Foo"}), + ), + ) + assert request.headers.get("X-Foo") == "Foo" + + # `extra_headers` takes priority over `default_headers` when keys clash + request = self.client.with_options(default_headers={"X-Bar": "true"})._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + extra_headers={"X-Bar": "false"}, + ), + ), + ) + assert request.headers.get("X-Bar") == "false" + + def test_request_extra_query(self) -> None: + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + extra_query={"my_query_param": "Foo"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"my_query_param": "Foo"} + + # if both `query` and `extra_query` are given, they are merged + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + query={"bar": "1"}, + extra_query={"foo": "2"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"bar": "1", "foo": "2"} + + # `extra_query` takes priority over `query` when keys clash + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + query={"foo": "1"}, + extra_query={"foo": "2"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"foo": "2"} + + def test_multipart_repeating_array(self, client: YdcSearchAPI) -> None: + request = client._build_request( + FinalRequestOptions.construct( + method="get", + url="/foo", + headers={"Content-Type": "multipart/form-data; boundary=6b7ba517decee4a450543ea6ae821c82"}, + json_data={"array": ["foo", "bar"]}, + files=[("foo.txt", b"hello world")], + ) + ) + + assert request.read().split(b"\r\n") == [ + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="array[]"', + b"", + b"foo", + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="array[]"', + b"", + b"bar", + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="foo.txt"; filename="upload"', + b"Content-Type: application/octet-stream", + b"", + b"hello world", + b"--6b7ba517decee4a450543ea6ae821c82--", + b"", + ] + + @pytest.mark.respx(base_url=base_url) + def test_basic_union_response(self, respx_mock: MockRouter) -> None: + class Model1(BaseModel): + name: str + + class Model2(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = self.client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model2) + assert response.foo == "bar" + + @pytest.mark.respx(base_url=base_url) + def test_union_response_different_types(self, respx_mock: MockRouter) -> None: + """Union of objects with the same field name using a different type""" + + class Model1(BaseModel): + foo: int + + class Model2(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = self.client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model2) + assert response.foo == "bar" + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": 1})) + + response = self.client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model1) + assert response.foo == 1 + + @pytest.mark.respx(base_url=base_url) + def test_non_application_json_content_type_for_json_data(self, respx_mock: MockRouter) -> None: + """ + Response that sets Content-Type to something other than application/json but returns json data + """ + + class Model(BaseModel): + foo: int + + respx_mock.get("/foo").mock( + return_value=httpx.Response( + 200, + content=json.dumps({"foo": 2}), + headers={"Content-Type": "application/text"}, + ) + ) + + response = self.client.get("/foo", cast_to=Model) + assert isinstance(response, Model) + assert response.foo == 2 + + def test_base_url_setter(self) -> None: + client = YdcSearchAPI( + base_url="https://example.com/from_init", api_key=api_key, _strict_response_validation=True + ) + assert client.base_url == "https://example.com/from_init/" + + client.base_url = "https://example.com/from_setter" # type: ignore[assignment] + + assert client.base_url == "https://example.com/from_setter/" + + def test_base_url_env(self) -> None: + with update_env(YDC_SEARCH_API_BASE_URL="http://localhost:5000/from/env"): + client = YdcSearchAPI(api_key=api_key, _strict_response_validation=True) + assert client.base_url == "http://localhost:5000/from/env/" + + @pytest.mark.parametrize( + "client", + [ + YdcSearchAPI( + base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True + ), + YdcSearchAPI( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.Client(), + ), + ], + ids=["standard", "custom http client"], + ) + def test_base_url_trailing_slash(self, client: YdcSearchAPI) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "http://localhost:5000/custom/path/foo" + + @pytest.mark.parametrize( + "client", + [ + YdcSearchAPI( + base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True + ), + YdcSearchAPI( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.Client(), + ), + ], + ids=["standard", "custom http client"], + ) + def test_base_url_no_trailing_slash(self, client: YdcSearchAPI) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "http://localhost:5000/custom/path/foo" + + @pytest.mark.parametrize( + "client", + [ + YdcSearchAPI( + base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True + ), + YdcSearchAPI( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.Client(), + ), + ], + ids=["standard", "custom http client"], + ) + def test_absolute_request_url(self, client: YdcSearchAPI) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="https://myapi.com/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "https://myapi.com/foo" + + def test_copied_client_does_not_close_http(self) -> None: + client = YdcSearchAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True) + assert not client.is_closed() + + copied = client.copy() + assert copied is not client + + del copied + + assert not client.is_closed() + + def test_client_context_manager(self) -> None: + client = YdcSearchAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True) + with client as c2: + assert c2 is client + assert not c2.is_closed() + assert not client.is_closed() + assert client.is_closed() + + @pytest.mark.respx(base_url=base_url) + def test_client_response_validation_error(self, respx_mock: MockRouter) -> None: + class Model(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": {"invalid": True}})) + + with pytest.raises(APIResponseValidationError) as exc: + self.client.get("/foo", cast_to=Model) + + assert isinstance(exc.value.__cause__, ValidationError) + + def test_client_max_retries_validation(self) -> None: + with pytest.raises(TypeError, match=r"max_retries cannot be None"): + YdcSearchAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, max_retries=cast(Any, None) + ) + + @pytest.mark.respx(base_url=base_url) + def test_received_text_for_expected_json(self, respx_mock: MockRouter) -> None: + class Model(BaseModel): + name: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, text="my-custom-format")) + + strict_client = YdcSearchAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True) + + with pytest.raises(APIResponseValidationError): + strict_client.get("/foo", cast_to=Model) + + client = YdcSearchAPI(base_url=base_url, api_key=api_key, _strict_response_validation=False) + + response = client.get("/foo", cast_to=Model) + assert isinstance(response, str) # type: ignore[unreachable] + + @pytest.mark.parametrize( + "remaining_retries,retry_after,timeout", + [ + [3, "20", 20], + [3, "0", 0.5], + [3, "-10", 0.5], + [3, "60", 60], + [3, "61", 0.5], + [3, "Fri, 29 Sep 2023 16:26:57 GMT", 20], + [3, "Fri, 29 Sep 2023 16:26:37 GMT", 0.5], + [3, "Fri, 29 Sep 2023 16:26:27 GMT", 0.5], + [3, "Fri, 29 Sep 2023 16:27:37 GMT", 60], + [3, "Fri, 29 Sep 2023 16:27:38 GMT", 0.5], + [3, "99999999999999999999999999999999999", 0.5], + [3, "Zun, 29 Sep 2023 16:26:27 GMT", 0.5], + [3, "", 0.5], + [2, "", 0.5 * 2.0], + [1, "", 0.5 * 4.0], + [-1100, "", 8], # test large number potentially overflowing + ], + ) + @mock.patch("time.time", mock.MagicMock(return_value=1696004797)) + def test_parse_retry_after_header(self, remaining_retries: int, retry_after: str, timeout: float) -> None: + client = YdcSearchAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True) + + headers = httpx.Headers({"retry-after": retry_after}) + options = FinalRequestOptions(method="get", url="/foo", max_retries=3) + calculated = client._calculate_retry_timeout(remaining_retries, options, headers) + assert calculated == pytest.approx(timeout, 0.5 * 0.875) # pyright: ignore[reportUnknownMemberType] + + @mock.patch("ydc_search_api._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + def test_retrying_timeout_errors_doesnt_leak(self, respx_mock: MockRouter, client: YdcSearchAPI) -> None: + respx_mock.get("/search").mock(side_effect=httpx.TimeoutException("Test timeout error")) + + with pytest.raises(APITimeoutError): + client.search.with_streaming_response.query(query="query").__enter__() + + assert _get_open_connections(self.client) == 0 + + @mock.patch("ydc_search_api._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + def test_retrying_status_errors_doesnt_leak(self, respx_mock: MockRouter, client: YdcSearchAPI) -> None: + respx_mock.get("/search").mock(return_value=httpx.Response(500)) + + with pytest.raises(APIStatusError): + client.search.with_streaming_response.query(query="query").__enter__() + assert _get_open_connections(self.client) == 0 + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("ydc_search_api._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + @pytest.mark.parametrize("failure_mode", ["status", "exception"]) + def test_retries_taken( + self, + client: YdcSearchAPI, + failures_before_success: int, + failure_mode: Literal["status", "exception"], + respx_mock: MockRouter, + ) -> None: + client = client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + if failure_mode == "exception": + raise RuntimeError("oops") + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.get("/search").mock(side_effect=retry_handler) + + response = client.search.with_raw_response.query(query="query") + + assert response.retries_taken == failures_before_success + assert int(response.http_request.headers.get("x-stainless-retry-count")) == failures_before_success + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("ydc_search_api._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + def test_omit_retry_count_header( + self, client: YdcSearchAPI, failures_before_success: int, respx_mock: MockRouter + ) -> None: + client = client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.get("/search").mock(side_effect=retry_handler) + + response = client.search.with_raw_response.query( + query="query", extra_headers={"x-stainless-retry-count": Omit()} + ) + + assert len(response.http_request.headers.get_list("x-stainless-retry-count")) == 0 + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("ydc_search_api._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + def test_overwrite_retry_count_header( + self, client: YdcSearchAPI, failures_before_success: int, respx_mock: MockRouter + ) -> None: + client = client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.get("/search").mock(side_effect=retry_handler) + + response = client.search.with_raw_response.query(query="query", extra_headers={"x-stainless-retry-count": "42"}) + + assert response.http_request.headers.get("x-stainless-retry-count") == "42" + + def test_proxy_environment_variables(self, monkeypatch: pytest.MonkeyPatch) -> None: + # Test that the proxy environment variables are set correctly + monkeypatch.setenv("HTTPS_PROXY", "https://example.org") + + client = DefaultHttpxClient() + + mounts = tuple(client._mounts.items()) + assert len(mounts) == 1 + assert mounts[0][0].pattern == "https://" + + @pytest.mark.filterwarnings("ignore:.*deprecated.*:DeprecationWarning") + def test_default_client_creation(self) -> None: + # Ensure that the client can be initialized without any exceptions + DefaultHttpxClient( + verify=True, + cert=None, + trust_env=True, + http1=True, + http2=False, + limits=httpx.Limits(max_connections=100, max_keepalive_connections=20), + ) + + @pytest.mark.respx(base_url=base_url) + def test_follow_redirects(self, respx_mock: MockRouter) -> None: + # Test that the default follow_redirects=True allows following redirects + respx_mock.post("/redirect").mock( + return_value=httpx.Response(302, headers={"Location": f"{base_url}/redirected"}) + ) + respx_mock.get("/redirected").mock(return_value=httpx.Response(200, json={"status": "ok"})) + + response = self.client.post("/redirect", body={"key": "value"}, cast_to=httpx.Response) + assert response.status_code == 200 + assert response.json() == {"status": "ok"} + + @pytest.mark.respx(base_url=base_url) + def test_follow_redirects_disabled(self, respx_mock: MockRouter) -> None: + # Test that follow_redirects=False prevents following redirects + respx_mock.post("/redirect").mock( + return_value=httpx.Response(302, headers={"Location": f"{base_url}/redirected"}) + ) + + with pytest.raises(APIStatusError) as exc_info: + self.client.post( + "/redirect", body={"key": "value"}, options={"follow_redirects": False}, cast_to=httpx.Response + ) + + assert exc_info.value.response.status_code == 302 + assert exc_info.value.response.headers["Location"] == f"{base_url}/redirected" + + +class TestAsyncYdcSearchAPI: + client = AsyncYdcSearchAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True) + + @pytest.mark.respx(base_url=base_url) + @pytest.mark.asyncio + async def test_raw_response(self, respx_mock: MockRouter) -> None: + respx_mock.post("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = await self.client.post("/foo", cast_to=httpx.Response) + assert response.status_code == 200 + assert isinstance(response, httpx.Response) + assert response.json() == {"foo": "bar"} + + @pytest.mark.respx(base_url=base_url) + @pytest.mark.asyncio + async def test_raw_response_for_binary(self, respx_mock: MockRouter) -> None: + respx_mock.post("/foo").mock( + return_value=httpx.Response(200, headers={"Content-Type": "application/binary"}, content='{"foo": "bar"}') + ) + + response = await self.client.post("/foo", cast_to=httpx.Response) + assert response.status_code == 200 + assert isinstance(response, httpx.Response) + assert response.json() == {"foo": "bar"} + + def test_copy(self) -> None: + copied = self.client.copy() + assert id(copied) != id(self.client) + + copied = self.client.copy(api_key="another My API Key") + assert copied.api_key == "another My API Key" + assert self.client.api_key == "My API Key" + + def test_copy_default_options(self) -> None: + # options that have a default are overridden correctly + copied = self.client.copy(max_retries=7) + assert copied.max_retries == 7 + assert self.client.max_retries == 2 + + copied2 = copied.copy(max_retries=6) + assert copied2.max_retries == 6 + assert copied.max_retries == 7 + + # timeout + assert isinstance(self.client.timeout, httpx.Timeout) + copied = self.client.copy(timeout=None) + assert copied.timeout is None + assert isinstance(self.client.timeout, httpx.Timeout) + + def test_copy_default_headers(self) -> None: + client = AsyncYdcSearchAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_headers={"X-Foo": "bar"} + ) + assert client.default_headers["X-Foo"] == "bar" + + # does not override the already given value when not specified + copied = client.copy() + assert copied.default_headers["X-Foo"] == "bar" + + # merges already given headers + copied = client.copy(default_headers={"X-Bar": "stainless"}) + assert copied.default_headers["X-Foo"] == "bar" + assert copied.default_headers["X-Bar"] == "stainless" + + # uses new values for any already given headers + copied = client.copy(default_headers={"X-Foo": "stainless"}) + assert copied.default_headers["X-Foo"] == "stainless" + + # set_default_headers + + # completely overrides already set values + copied = client.copy(set_default_headers={}) + assert copied.default_headers.get("X-Foo") is None + + copied = client.copy(set_default_headers={"X-Bar": "Robert"}) + assert copied.default_headers["X-Bar"] == "Robert" + + with pytest.raises( + ValueError, + match="`default_headers` and `set_default_headers` arguments are mutually exclusive", + ): + client.copy(set_default_headers={}, default_headers={"X-Foo": "Bar"}) + + def test_copy_default_query(self) -> None: + client = AsyncYdcSearchAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_query={"foo": "bar"} + ) + assert _get_params(client)["foo"] == "bar" + + # does not override the already given value when not specified + copied = client.copy() + assert _get_params(copied)["foo"] == "bar" + + # merges already given params + copied = client.copy(default_query={"bar": "stainless"}) + params = _get_params(copied) + assert params["foo"] == "bar" + assert params["bar"] == "stainless" + + # uses new values for any already given headers + copied = client.copy(default_query={"foo": "stainless"}) + assert _get_params(copied)["foo"] == "stainless" + + # set_default_query + + # completely overrides already set values + copied = client.copy(set_default_query={}) + assert _get_params(copied) == {} + + copied = client.copy(set_default_query={"bar": "Robert"}) + assert _get_params(copied)["bar"] == "Robert" + + with pytest.raises( + ValueError, + # TODO: update + match="`default_query` and `set_default_query` arguments are mutually exclusive", + ): + client.copy(set_default_query={}, default_query={"foo": "Bar"}) + + def test_copy_signature(self) -> None: + # ensure the same parameters that can be passed to the client are defined in the `.copy()` method + init_signature = inspect.signature( + # mypy doesn't like that we access the `__init__` property. + self.client.__init__, # type: ignore[misc] + ) + copy_signature = inspect.signature(self.client.copy) + exclude_params = {"transport", "proxies", "_strict_response_validation"} + + for name in init_signature.parameters.keys(): + if name in exclude_params: + continue + + copy_param = copy_signature.parameters.get(name) + assert copy_param is not None, f"copy() signature is missing the {name} param" + + @pytest.mark.skipif(sys.version_info >= (3, 10), reason="fails because of a memory leak that started from 3.12") + def test_copy_build_request(self) -> None: + options = FinalRequestOptions(method="get", url="/foo") + + def build_request(options: FinalRequestOptions) -> None: + client = self.client.copy() + client._build_request(options) + + # ensure that the machinery is warmed up before tracing starts. + build_request(options) + gc.collect() + + tracemalloc.start(1000) + + snapshot_before = tracemalloc.take_snapshot() + + ITERATIONS = 10 + for _ in range(ITERATIONS): + build_request(options) + + gc.collect() + snapshot_after = tracemalloc.take_snapshot() + + tracemalloc.stop() + + def add_leak(leaks: list[tracemalloc.StatisticDiff], diff: tracemalloc.StatisticDiff) -> None: + if diff.count == 0: + # Avoid false positives by considering only leaks (i.e. allocations that persist). + return + + if diff.count % ITERATIONS != 0: + # Avoid false positives by considering only leaks that appear per iteration. + return + + for frame in diff.traceback: + if any( + frame.filename.endswith(fragment) + for fragment in [ + # to_raw_response_wrapper leaks through the @functools.wraps() decorator. + # + # removing the decorator fixes the leak for reasons we don't understand. + "ydc_search_api/_legacy_response.py", + "ydc_search_api/_response.py", + # pydantic.BaseModel.model_dump || pydantic.BaseModel.dict leak memory for some reason. + "ydc_search_api/_compat.py", + # Standard library leaks we don't care about. + "/logging/__init__.py", + ] + ): + return + + leaks.append(diff) + + leaks: list[tracemalloc.StatisticDiff] = [] + for diff in snapshot_after.compare_to(snapshot_before, "traceback"): + add_leak(leaks, diff) + if leaks: + for leak in leaks: + print("MEMORY LEAK:", leak) + for frame in leak.traceback: + print(frame) + raise AssertionError() + + async def test_request_timeout(self) -> None: + request = self.client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT + + request = self.client._build_request( + FinalRequestOptions(method="get", url="/foo", timeout=httpx.Timeout(100.0)) + ) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(100.0) + + async def test_client_timeout_option(self) -> None: + client = AsyncYdcSearchAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, timeout=httpx.Timeout(0) + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(0) + + async def test_http_client_timeout_option(self) -> None: + # custom timeout given to the httpx client should be used + async with httpx.AsyncClient(timeout=None) as http_client: + client = AsyncYdcSearchAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(None) + + # no timeout given to the httpx client should not use the httpx default + async with httpx.AsyncClient() as http_client: + client = AsyncYdcSearchAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT + + # explicitly passing the default timeout currently results in it being ignored + async with httpx.AsyncClient(timeout=HTTPX_DEFAULT_TIMEOUT) as http_client: + client = AsyncYdcSearchAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT # our default + + def test_invalid_http_client(self) -> None: + with pytest.raises(TypeError, match="Invalid `http_client` arg"): + with httpx.Client() as http_client: + AsyncYdcSearchAPI( + base_url=base_url, + api_key=api_key, + _strict_response_validation=True, + http_client=cast(Any, http_client), + ) + + def test_default_headers_option(self) -> None: + client = AsyncYdcSearchAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_headers={"X-Foo": "bar"} + ) + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("x-foo") == "bar" + assert request.headers.get("x-stainless-lang") == "python" + + client2 = AsyncYdcSearchAPI( + base_url=base_url, + api_key=api_key, + _strict_response_validation=True, + default_headers={ + "X-Foo": "stainless", + "X-Stainless-Lang": "my-overriding-header", + }, + ) + request = client2._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("x-foo") == "stainless" + assert request.headers.get("x-stainless-lang") == "my-overriding-header" + + def test_validate_headers(self) -> None: + client = AsyncYdcSearchAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True) + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("X-API-Key") == api_key + + with pytest.raises(YdcSearchAPIError): + with update_env(**{"YDC_SEARCH_API_API_KEY": Omit()}): + client2 = AsyncYdcSearchAPI(base_url=base_url, api_key=None, _strict_response_validation=True) + _ = client2 + + def test_default_query_option(self) -> None: + client = AsyncYdcSearchAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_query={"query_param": "bar"} + ) + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + url = httpx.URL(request.url) + assert dict(url.params) == {"query_param": "bar"} + + request = client._build_request( + FinalRequestOptions( + method="get", + url="/foo", + params={"foo": "baz", "query_param": "overridden"}, + ) + ) + url = httpx.URL(request.url) + assert dict(url.params) == {"foo": "baz", "query_param": "overridden"} + + def test_request_extra_json(self) -> None: + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + extra_json={"baz": False}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"foo": "bar", "baz": False} + + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + extra_json={"baz": False}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"baz": False} + + # `extra_json` takes priority over `json_data` when keys clash + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar", "baz": True}, + extra_json={"baz": None}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"foo": "bar", "baz": None} + + def test_request_extra_headers(self) -> None: + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options(extra_headers={"X-Foo": "Foo"}), + ), + ) + assert request.headers.get("X-Foo") == "Foo" + + # `extra_headers` takes priority over `default_headers` when keys clash + request = self.client.with_options(default_headers={"X-Bar": "true"})._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + extra_headers={"X-Bar": "false"}, + ), + ), + ) + assert request.headers.get("X-Bar") == "false" + + def test_request_extra_query(self) -> None: + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + extra_query={"my_query_param": "Foo"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"my_query_param": "Foo"} + + # if both `query` and `extra_query` are given, they are merged + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + query={"bar": "1"}, + extra_query={"foo": "2"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"bar": "1", "foo": "2"} + + # `extra_query` takes priority over `query` when keys clash + request = self.client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + query={"foo": "1"}, + extra_query={"foo": "2"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"foo": "2"} + + def test_multipart_repeating_array(self, async_client: AsyncYdcSearchAPI) -> None: + request = async_client._build_request( + FinalRequestOptions.construct( + method="get", + url="/foo", + headers={"Content-Type": "multipart/form-data; boundary=6b7ba517decee4a450543ea6ae821c82"}, + json_data={"array": ["foo", "bar"]}, + files=[("foo.txt", b"hello world")], + ) + ) + + assert request.read().split(b"\r\n") == [ + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="array[]"', + b"", + b"foo", + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="array[]"', + b"", + b"bar", + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="foo.txt"; filename="upload"', + b"Content-Type: application/octet-stream", + b"", + b"hello world", + b"--6b7ba517decee4a450543ea6ae821c82--", + b"", + ] + + @pytest.mark.respx(base_url=base_url) + async def test_basic_union_response(self, respx_mock: MockRouter) -> None: + class Model1(BaseModel): + name: str + + class Model2(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = await self.client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model2) + assert response.foo == "bar" + + @pytest.mark.respx(base_url=base_url) + async def test_union_response_different_types(self, respx_mock: MockRouter) -> None: + """Union of objects with the same field name using a different type""" + + class Model1(BaseModel): + foo: int + + class Model2(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = await self.client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model2) + assert response.foo == "bar" + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": 1})) + + response = await self.client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model1) + assert response.foo == 1 + + @pytest.mark.respx(base_url=base_url) + async def test_non_application_json_content_type_for_json_data(self, respx_mock: MockRouter) -> None: + """ + Response that sets Content-Type to something other than application/json but returns json data + """ + + class Model(BaseModel): + foo: int + + respx_mock.get("/foo").mock( + return_value=httpx.Response( + 200, + content=json.dumps({"foo": 2}), + headers={"Content-Type": "application/text"}, + ) + ) + + response = await self.client.get("/foo", cast_to=Model) + assert isinstance(response, Model) + assert response.foo == 2 + + def test_base_url_setter(self) -> None: + client = AsyncYdcSearchAPI( + base_url="https://example.com/from_init", api_key=api_key, _strict_response_validation=True + ) + assert client.base_url == "https://example.com/from_init/" + + client.base_url = "https://example.com/from_setter" # type: ignore[assignment] + + assert client.base_url == "https://example.com/from_setter/" + + def test_base_url_env(self) -> None: + with update_env(YDC_SEARCH_API_BASE_URL="http://localhost:5000/from/env"): + client = AsyncYdcSearchAPI(api_key=api_key, _strict_response_validation=True) + assert client.base_url == "http://localhost:5000/from/env/" + + @pytest.mark.parametrize( + "client", + [ + AsyncYdcSearchAPI( + base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True + ), + AsyncYdcSearchAPI( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.AsyncClient(), + ), + ], + ids=["standard", "custom http client"], + ) + def test_base_url_trailing_slash(self, client: AsyncYdcSearchAPI) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "http://localhost:5000/custom/path/foo" + + @pytest.mark.parametrize( + "client", + [ + AsyncYdcSearchAPI( + base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True + ), + AsyncYdcSearchAPI( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.AsyncClient(), + ), + ], + ids=["standard", "custom http client"], + ) + def test_base_url_no_trailing_slash(self, client: AsyncYdcSearchAPI) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "http://localhost:5000/custom/path/foo" + + @pytest.mark.parametrize( + "client", + [ + AsyncYdcSearchAPI( + base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True + ), + AsyncYdcSearchAPI( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.AsyncClient(), + ), + ], + ids=["standard", "custom http client"], + ) + def test_absolute_request_url(self, client: AsyncYdcSearchAPI) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="https://myapi.com/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "https://myapi.com/foo" + + async def test_copied_client_does_not_close_http(self) -> None: + client = AsyncYdcSearchAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True) + assert not client.is_closed() + + copied = client.copy() + assert copied is not client + + del copied + + await asyncio.sleep(0.2) + assert not client.is_closed() + + async def test_client_context_manager(self) -> None: + client = AsyncYdcSearchAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True) + async with client as c2: + assert c2 is client + assert not c2.is_closed() + assert not client.is_closed() + assert client.is_closed() + + @pytest.mark.respx(base_url=base_url) + @pytest.mark.asyncio + async def test_client_response_validation_error(self, respx_mock: MockRouter) -> None: + class Model(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": {"invalid": True}})) + + with pytest.raises(APIResponseValidationError) as exc: + await self.client.get("/foo", cast_to=Model) + + assert isinstance(exc.value.__cause__, ValidationError) + + async def test_client_max_retries_validation(self) -> None: + with pytest.raises(TypeError, match=r"max_retries cannot be None"): + AsyncYdcSearchAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, max_retries=cast(Any, None) + ) + + @pytest.mark.respx(base_url=base_url) + @pytest.mark.asyncio + async def test_received_text_for_expected_json(self, respx_mock: MockRouter) -> None: + class Model(BaseModel): + name: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, text="my-custom-format")) + + strict_client = AsyncYdcSearchAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True) + + with pytest.raises(APIResponseValidationError): + await strict_client.get("/foo", cast_to=Model) + + client = AsyncYdcSearchAPI(base_url=base_url, api_key=api_key, _strict_response_validation=False) + + response = await client.get("/foo", cast_to=Model) + assert isinstance(response, str) # type: ignore[unreachable] + + @pytest.mark.parametrize( + "remaining_retries,retry_after,timeout", + [ + [3, "20", 20], + [3, "0", 0.5], + [3, "-10", 0.5], + [3, "60", 60], + [3, "61", 0.5], + [3, "Fri, 29 Sep 2023 16:26:57 GMT", 20], + [3, "Fri, 29 Sep 2023 16:26:37 GMT", 0.5], + [3, "Fri, 29 Sep 2023 16:26:27 GMT", 0.5], + [3, "Fri, 29 Sep 2023 16:27:37 GMT", 60], + [3, "Fri, 29 Sep 2023 16:27:38 GMT", 0.5], + [3, "99999999999999999999999999999999999", 0.5], + [3, "Zun, 29 Sep 2023 16:26:27 GMT", 0.5], + [3, "", 0.5], + [2, "", 0.5 * 2.0], + [1, "", 0.5 * 4.0], + [-1100, "", 8], # test large number potentially overflowing + ], + ) + @mock.patch("time.time", mock.MagicMock(return_value=1696004797)) + @pytest.mark.asyncio + async def test_parse_retry_after_header(self, remaining_retries: int, retry_after: str, timeout: float) -> None: + client = AsyncYdcSearchAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True) + + headers = httpx.Headers({"retry-after": retry_after}) + options = FinalRequestOptions(method="get", url="/foo", max_retries=3) + calculated = client._calculate_retry_timeout(remaining_retries, options, headers) + assert calculated == pytest.approx(timeout, 0.5 * 0.875) # pyright: ignore[reportUnknownMemberType] + + @mock.patch("ydc_search_api._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + async def test_retrying_timeout_errors_doesnt_leak( + self, respx_mock: MockRouter, async_client: AsyncYdcSearchAPI + ) -> None: + respx_mock.get("/search").mock(side_effect=httpx.TimeoutException("Test timeout error")) + + with pytest.raises(APITimeoutError): + await async_client.search.with_streaming_response.query(query="query").__aenter__() + + assert _get_open_connections(self.client) == 0 + + @mock.patch("ydc_search_api._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + async def test_retrying_status_errors_doesnt_leak( + self, respx_mock: MockRouter, async_client: AsyncYdcSearchAPI + ) -> None: + respx_mock.get("/search").mock(return_value=httpx.Response(500)) + + with pytest.raises(APIStatusError): + await async_client.search.with_streaming_response.query(query="query").__aenter__() + assert _get_open_connections(self.client) == 0 + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("ydc_search_api._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + @pytest.mark.asyncio + @pytest.mark.parametrize("failure_mode", ["status", "exception"]) + async def test_retries_taken( + self, + async_client: AsyncYdcSearchAPI, + failures_before_success: int, + failure_mode: Literal["status", "exception"], + respx_mock: MockRouter, + ) -> None: + client = async_client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + if failure_mode == "exception": + raise RuntimeError("oops") + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.get("/search").mock(side_effect=retry_handler) + + response = await client.search.with_raw_response.query(query="query") + + assert response.retries_taken == failures_before_success + assert int(response.http_request.headers.get("x-stainless-retry-count")) == failures_before_success + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("ydc_search_api._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + @pytest.mark.asyncio + async def test_omit_retry_count_header( + self, async_client: AsyncYdcSearchAPI, failures_before_success: int, respx_mock: MockRouter + ) -> None: + client = async_client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.get("/search").mock(side_effect=retry_handler) + + response = await client.search.with_raw_response.query( + query="query", extra_headers={"x-stainless-retry-count": Omit()} + ) + + assert len(response.http_request.headers.get_list("x-stainless-retry-count")) == 0 + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("ydc_search_api._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + @pytest.mark.asyncio + async def test_overwrite_retry_count_header( + self, async_client: AsyncYdcSearchAPI, failures_before_success: int, respx_mock: MockRouter + ) -> None: + client = async_client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.get("/search").mock(side_effect=retry_handler) + + response = await client.search.with_raw_response.query( + query="query", extra_headers={"x-stainless-retry-count": "42"} + ) + + assert response.http_request.headers.get("x-stainless-retry-count") == "42" + + def test_get_platform(self) -> None: + # A previous implementation of asyncify could leave threads unterminated when + # used with nest_asyncio. + # + # Since nest_asyncio.apply() is global and cannot be un-applied, this + # test is run in a separate process to avoid affecting other tests. + test_code = dedent(""" + import asyncio + import nest_asyncio + import threading + + from ydc_search_api._utils import asyncify + from ydc_search_api._base_client import get_platform + + async def test_main() -> None: + result = await asyncify(get_platform)() + print(result) + for thread in threading.enumerate(): + print(thread.name) + + nest_asyncio.apply() + asyncio.run(test_main()) + """) + with subprocess.Popen( + [sys.executable, "-c", test_code], + text=True, + ) as process: + timeout = 10 # seconds + + start_time = time.monotonic() + while True: + return_code = process.poll() + if return_code is not None: + if return_code != 0: + raise AssertionError("calling get_platform using asyncify resulted in a non-zero exit code") + + # success + break + + if time.monotonic() - start_time > timeout: + process.kill() + raise AssertionError("calling get_platform using asyncify resulted in a hung process") + + time.sleep(0.1) + + async def test_proxy_environment_variables(self, monkeypatch: pytest.MonkeyPatch) -> None: + # Test that the proxy environment variables are set correctly + monkeypatch.setenv("HTTPS_PROXY", "https://example.org") + + client = DefaultAsyncHttpxClient() + + mounts = tuple(client._mounts.items()) + assert len(mounts) == 1 + assert mounts[0][0].pattern == "https://" + + @pytest.mark.filterwarnings("ignore:.*deprecated.*:DeprecationWarning") + async def test_default_client_creation(self) -> None: + # Ensure that the client can be initialized without any exceptions + DefaultAsyncHttpxClient( + verify=True, + cert=None, + trust_env=True, + http1=True, + http2=False, + limits=httpx.Limits(max_connections=100, max_keepalive_connections=20), + ) + + @pytest.mark.respx(base_url=base_url) + async def test_follow_redirects(self, respx_mock: MockRouter) -> None: + # Test that the default follow_redirects=True allows following redirects + respx_mock.post("/redirect").mock( + return_value=httpx.Response(302, headers={"Location": f"{base_url}/redirected"}) + ) + respx_mock.get("/redirected").mock(return_value=httpx.Response(200, json={"status": "ok"})) + + response = await self.client.post("/redirect", body={"key": "value"}, cast_to=httpx.Response) + assert response.status_code == 200 + assert response.json() == {"status": "ok"} + + @pytest.mark.respx(base_url=base_url) + async def test_follow_redirects_disabled(self, respx_mock: MockRouter) -> None: + # Test that follow_redirects=False prevents following redirects + respx_mock.post("/redirect").mock( + return_value=httpx.Response(302, headers={"Location": f"{base_url}/redirected"}) + ) + + with pytest.raises(APIStatusError) as exc_info: + await self.client.post( + "/redirect", body={"key": "value"}, options={"follow_redirects": False}, cast_to=httpx.Response + ) + + assert exc_info.value.response.status_code == 302 + assert exc_info.value.response.headers["Location"] == f"{base_url}/redirected" diff --git a/tests/test_deepcopy.py b/tests/test_deepcopy.py new file mode 100644 index 0000000..1ab3e27 --- /dev/null +++ b/tests/test_deepcopy.py @@ -0,0 +1,58 @@ +from ydc_search_api._utils import deepcopy_minimal + + +def assert_different_identities(obj1: object, obj2: object) -> None: + assert obj1 == obj2 + assert id(obj1) != id(obj2) + + +def test_simple_dict() -> None: + obj1 = {"foo": "bar"} + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + + +def test_nested_dict() -> None: + obj1 = {"foo": {"bar": True}} + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + assert_different_identities(obj1["foo"], obj2["foo"]) + + +def test_complex_nested_dict() -> None: + obj1 = {"foo": {"bar": [{"hello": "world"}]}} + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + assert_different_identities(obj1["foo"], obj2["foo"]) + assert_different_identities(obj1["foo"]["bar"], obj2["foo"]["bar"]) + assert_different_identities(obj1["foo"]["bar"][0], obj2["foo"]["bar"][0]) + + +def test_simple_list() -> None: + obj1 = ["a", "b", "c"] + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + + +def test_nested_list() -> None: + obj1 = ["a", [1, 2, 3]] + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + assert_different_identities(obj1[1], obj2[1]) + + +class MyObject: ... + + +def test_ignores_other_types() -> None: + # custom classes + my_obj = MyObject() + obj1 = {"foo": my_obj} + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + assert obj1["foo"] is my_obj + + # tuples + obj3 = ("a", "b") + obj4 = deepcopy_minimal(obj3) + assert obj3 is obj4 diff --git a/tests/test_example/test.py b/tests/test_example/test.py deleted file mode 100755 index e69de29..0000000 diff --git a/tests/test_extract_files.py b/tests/test_extract_files.py new file mode 100644 index 0000000..6fd4faa --- /dev/null +++ b/tests/test_extract_files.py @@ -0,0 +1,64 @@ +from __future__ import annotations + +from typing import Sequence + +import pytest + +from ydc_search_api._types import FileTypes +from ydc_search_api._utils import extract_files + + +def test_removes_files_from_input() -> None: + query = {"foo": "bar"} + assert extract_files(query, paths=[]) == [] + assert query == {"foo": "bar"} + + query2 = {"foo": b"Bar", "hello": "world"} + assert extract_files(query2, paths=[["foo"]]) == [("foo", b"Bar")] + assert query2 == {"hello": "world"} + + query3 = {"foo": {"foo": {"bar": b"Bar"}}, "hello": "world"} + assert extract_files(query3, paths=[["foo", "foo", "bar"]]) == [("foo[foo][bar]", b"Bar")] + assert query3 == {"foo": {"foo": {}}, "hello": "world"} + + query4 = {"foo": {"bar": b"Bar", "baz": "foo"}, "hello": "world"} + assert extract_files(query4, paths=[["foo", "bar"]]) == [("foo[bar]", b"Bar")] + assert query4 == {"hello": "world", "foo": {"baz": "foo"}} + + +def test_multiple_files() -> None: + query = {"documents": [{"file": b"My first file"}, {"file": b"My second file"}]} + assert extract_files(query, paths=[["documents", "", "file"]]) == [ + ("documents[][file]", b"My first file"), + ("documents[][file]", b"My second file"), + ] + assert query == {"documents": [{}, {}]} + + +@pytest.mark.parametrize( + "query,paths,expected", + [ + [ + {"foo": {"bar": "baz"}}, + [["foo", "", "bar"]], + [], + ], + [ + {"foo": ["bar", "baz"]}, + [["foo", "bar"]], + [], + ], + [ + {"foo": {"bar": "baz"}}, + [["foo", "foo"]], + [], + ], + ], + ids=["dict expecting array", "array expecting dict", "unknown keys"], +) +def test_ignores_incorrect_paths( + query: dict[str, object], + paths: Sequence[Sequence[str]], + expected: list[tuple[str, FileTypes]], +) -> None: + assert extract_files(query, paths=paths) == expected diff --git a/tests/test_files.py b/tests/test_files.py new file mode 100644 index 0000000..ed99536 --- /dev/null +++ b/tests/test_files.py @@ -0,0 +1,51 @@ +from pathlib import Path + +import anyio +import pytest +from dirty_equals import IsDict, IsList, IsBytes, IsTuple + +from ydc_search_api._files import to_httpx_files, async_to_httpx_files + +readme_path = Path(__file__).parent.parent.joinpath("README.md") + + +def test_pathlib_includes_file_name() -> None: + result = to_httpx_files({"file": readme_path}) + print(result) + assert result == IsDict({"file": IsTuple("README.md", IsBytes())}) + + +def test_tuple_input() -> None: + result = to_httpx_files([("file", readme_path)]) + print(result) + assert result == IsList(IsTuple("file", IsTuple("README.md", IsBytes()))) + + +@pytest.mark.asyncio +async def test_async_pathlib_includes_file_name() -> None: + result = await async_to_httpx_files({"file": readme_path}) + print(result) + assert result == IsDict({"file": IsTuple("README.md", IsBytes())}) + + +@pytest.mark.asyncio +async def test_async_supports_anyio_path() -> None: + result = await async_to_httpx_files({"file": anyio.Path(readme_path)}) + print(result) + assert result == IsDict({"file": IsTuple("README.md", IsBytes())}) + + +@pytest.mark.asyncio +async def test_async_tuple_input() -> None: + result = await async_to_httpx_files([("file", readme_path)]) + print(result) + assert result == IsList(IsTuple("file", IsTuple("README.md", IsBytes()))) + + +def test_string_not_allowed() -> None: + with pytest.raises(TypeError, match="Expected file types input to be a FileContent type or to be a tuple"): + to_httpx_files( + { + "file": "foo", # type: ignore + } + ) diff --git a/tests/test_models.py b/tests/test_models.py new file mode 100644 index 0000000..b289dab --- /dev/null +++ b/tests/test_models.py @@ -0,0 +1,891 @@ +import json +from typing import Any, Dict, List, Union, Optional, cast +from datetime import datetime, timezone +from typing_extensions import Literal, Annotated, TypeAliasType + +import pytest +import pydantic +from pydantic import Field + +from ydc_search_api._utils import PropertyInfo +from ydc_search_api._compat import PYDANTIC_V2, parse_obj, model_dump, model_json +from ydc_search_api._models import BaseModel, construct_type + + +class BasicModel(BaseModel): + foo: str + + +@pytest.mark.parametrize("value", ["hello", 1], ids=["correct type", "mismatched"]) +def test_basic(value: object) -> None: + m = BasicModel.construct(foo=value) + assert m.foo == value + + +def test_directly_nested_model() -> None: + class NestedModel(BaseModel): + nested: BasicModel + + m = NestedModel.construct(nested={"foo": "Foo!"}) + assert m.nested.foo == "Foo!" + + # mismatched types + m = NestedModel.construct(nested="hello!") + assert cast(Any, m.nested) == "hello!" + + +def test_optional_nested_model() -> None: + class NestedModel(BaseModel): + nested: Optional[BasicModel] + + m1 = NestedModel.construct(nested=None) + assert m1.nested is None + + m2 = NestedModel.construct(nested={"foo": "bar"}) + assert m2.nested is not None + assert m2.nested.foo == "bar" + + # mismatched types + m3 = NestedModel.construct(nested={"foo"}) + assert isinstance(cast(Any, m3.nested), set) + assert cast(Any, m3.nested) == {"foo"} + + +def test_list_nested_model() -> None: + class NestedModel(BaseModel): + nested: List[BasicModel] + + m = NestedModel.construct(nested=[{"foo": "bar"}, {"foo": "2"}]) + assert m.nested is not None + assert isinstance(m.nested, list) + assert len(m.nested) == 2 + assert m.nested[0].foo == "bar" + assert m.nested[1].foo == "2" + + # mismatched types + m = NestedModel.construct(nested=True) + assert cast(Any, m.nested) is True + + m = NestedModel.construct(nested=[False]) + assert cast(Any, m.nested) == [False] + + +def test_optional_list_nested_model() -> None: + class NestedModel(BaseModel): + nested: Optional[List[BasicModel]] + + m1 = NestedModel.construct(nested=[{"foo": "bar"}, {"foo": "2"}]) + assert m1.nested is not None + assert isinstance(m1.nested, list) + assert len(m1.nested) == 2 + assert m1.nested[0].foo == "bar" + assert m1.nested[1].foo == "2" + + m2 = NestedModel.construct(nested=None) + assert m2.nested is None + + # mismatched types + m3 = NestedModel.construct(nested={1}) + assert cast(Any, m3.nested) == {1} + + m4 = NestedModel.construct(nested=[False]) + assert cast(Any, m4.nested) == [False] + + +def test_list_optional_items_nested_model() -> None: + class NestedModel(BaseModel): + nested: List[Optional[BasicModel]] + + m = NestedModel.construct(nested=[None, {"foo": "bar"}]) + assert m.nested is not None + assert isinstance(m.nested, list) + assert len(m.nested) == 2 + assert m.nested[0] is None + assert m.nested[1] is not None + assert m.nested[1].foo == "bar" + + # mismatched types + m3 = NestedModel.construct(nested="foo") + assert cast(Any, m3.nested) == "foo" + + m4 = NestedModel.construct(nested=[False]) + assert cast(Any, m4.nested) == [False] + + +def test_list_mismatched_type() -> None: + class NestedModel(BaseModel): + nested: List[str] + + m = NestedModel.construct(nested=False) + assert cast(Any, m.nested) is False + + +def test_raw_dictionary() -> None: + class NestedModel(BaseModel): + nested: Dict[str, str] + + m = NestedModel.construct(nested={"hello": "world"}) + assert m.nested == {"hello": "world"} + + # mismatched types + m = NestedModel.construct(nested=False) + assert cast(Any, m.nested) is False + + +def test_nested_dictionary_model() -> None: + class NestedModel(BaseModel): + nested: Dict[str, BasicModel] + + m = NestedModel.construct(nested={"hello": {"foo": "bar"}}) + assert isinstance(m.nested, dict) + assert m.nested["hello"].foo == "bar" + + # mismatched types + m = NestedModel.construct(nested={"hello": False}) + assert cast(Any, m.nested["hello"]) is False + + +def test_unknown_fields() -> None: + m1 = BasicModel.construct(foo="foo", unknown=1) + assert m1.foo == "foo" + assert cast(Any, m1).unknown == 1 + + m2 = BasicModel.construct(foo="foo", unknown={"foo_bar": True}) + assert m2.foo == "foo" + assert cast(Any, m2).unknown == {"foo_bar": True} + + assert model_dump(m2) == {"foo": "foo", "unknown": {"foo_bar": True}} + + +def test_strict_validation_unknown_fields() -> None: + class Model(BaseModel): + foo: str + + model = parse_obj(Model, dict(foo="hello!", user="Robert")) + assert model.foo == "hello!" + assert cast(Any, model).user == "Robert" + + assert model_dump(model) == {"foo": "hello!", "user": "Robert"} + + +def test_aliases() -> None: + class Model(BaseModel): + my_field: int = Field(alias="myField") + + m = Model.construct(myField=1) + assert m.my_field == 1 + + # mismatched types + m = Model.construct(myField={"hello": False}) + assert cast(Any, m.my_field) == {"hello": False} + + +def test_repr() -> None: + model = BasicModel(foo="bar") + assert str(model) == "BasicModel(foo='bar')" + assert repr(model) == "BasicModel(foo='bar')" + + +def test_repr_nested_model() -> None: + class Child(BaseModel): + name: str + age: int + + class Parent(BaseModel): + name: str + child: Child + + model = Parent(name="Robert", child=Child(name="Foo", age=5)) + assert str(model) == "Parent(name='Robert', child=Child(name='Foo', age=5))" + assert repr(model) == "Parent(name='Robert', child=Child(name='Foo', age=5))" + + +def test_optional_list() -> None: + class Submodel(BaseModel): + name: str + + class Model(BaseModel): + items: Optional[List[Submodel]] + + m = Model.construct(items=None) + assert m.items is None + + m = Model.construct(items=[]) + assert m.items == [] + + m = Model.construct(items=[{"name": "Robert"}]) + assert m.items is not None + assert len(m.items) == 1 + assert m.items[0].name == "Robert" + + +def test_nested_union_of_models() -> None: + class Submodel1(BaseModel): + bar: bool + + class Submodel2(BaseModel): + thing: str + + class Model(BaseModel): + foo: Union[Submodel1, Submodel2] + + m = Model.construct(foo={"thing": "hello"}) + assert isinstance(m.foo, Submodel2) + assert m.foo.thing == "hello" + + +def test_nested_union_of_mixed_types() -> None: + class Submodel1(BaseModel): + bar: bool + + class Model(BaseModel): + foo: Union[Submodel1, Literal[True], Literal["CARD_HOLDER"]] + + m = Model.construct(foo=True) + assert m.foo is True + + m = Model.construct(foo="CARD_HOLDER") + assert m.foo == "CARD_HOLDER" + + m = Model.construct(foo={"bar": False}) + assert isinstance(m.foo, Submodel1) + assert m.foo.bar is False + + +def test_nested_union_multiple_variants() -> None: + class Submodel1(BaseModel): + bar: bool + + class Submodel2(BaseModel): + thing: str + + class Submodel3(BaseModel): + foo: int + + class Model(BaseModel): + foo: Union[Submodel1, Submodel2, None, Submodel3] + + m = Model.construct(foo={"thing": "hello"}) + assert isinstance(m.foo, Submodel2) + assert m.foo.thing == "hello" + + m = Model.construct(foo=None) + assert m.foo is None + + m = Model.construct() + assert m.foo is None + + m = Model.construct(foo={"foo": "1"}) + assert isinstance(m.foo, Submodel3) + assert m.foo.foo == 1 + + +def test_nested_union_invalid_data() -> None: + class Submodel1(BaseModel): + level: int + + class Submodel2(BaseModel): + name: str + + class Model(BaseModel): + foo: Union[Submodel1, Submodel2] + + m = Model.construct(foo=True) + assert cast(bool, m.foo) is True + + m = Model.construct(foo={"name": 3}) + if PYDANTIC_V2: + assert isinstance(m.foo, Submodel1) + assert m.foo.name == 3 # type: ignore + else: + assert isinstance(m.foo, Submodel2) + assert m.foo.name == "3" + + +def test_list_of_unions() -> None: + class Submodel1(BaseModel): + level: int + + class Submodel2(BaseModel): + name: str + + class Model(BaseModel): + items: List[Union[Submodel1, Submodel2]] + + m = Model.construct(items=[{"level": 1}, {"name": "Robert"}]) + assert len(m.items) == 2 + assert isinstance(m.items[0], Submodel1) + assert m.items[0].level == 1 + assert isinstance(m.items[1], Submodel2) + assert m.items[1].name == "Robert" + + m = Model.construct(items=[{"level": -1}, 156]) + assert len(m.items) == 2 + assert isinstance(m.items[0], Submodel1) + assert m.items[0].level == -1 + assert cast(Any, m.items[1]) == 156 + + +def test_union_of_lists() -> None: + class SubModel1(BaseModel): + level: int + + class SubModel2(BaseModel): + name: str + + class Model(BaseModel): + items: Union[List[SubModel1], List[SubModel2]] + + # with one valid entry + m = Model.construct(items=[{"name": "Robert"}]) + assert len(m.items) == 1 + assert isinstance(m.items[0], SubModel2) + assert m.items[0].name == "Robert" + + # with two entries pointing to different types + m = Model.construct(items=[{"level": 1}, {"name": "Robert"}]) + assert len(m.items) == 2 + assert isinstance(m.items[0], SubModel1) + assert m.items[0].level == 1 + assert isinstance(m.items[1], SubModel1) + assert cast(Any, m.items[1]).name == "Robert" + + # with two entries pointing to *completely* different types + m = Model.construct(items=[{"level": -1}, 156]) + assert len(m.items) == 2 + assert isinstance(m.items[0], SubModel1) + assert m.items[0].level == -1 + assert cast(Any, m.items[1]) == 156 + + +def test_dict_of_union() -> None: + class SubModel1(BaseModel): + name: str + + class SubModel2(BaseModel): + foo: str + + class Model(BaseModel): + data: Dict[str, Union[SubModel1, SubModel2]] + + m = Model.construct(data={"hello": {"name": "there"}, "foo": {"foo": "bar"}}) + assert len(list(m.data.keys())) == 2 + assert isinstance(m.data["hello"], SubModel1) + assert m.data["hello"].name == "there" + assert isinstance(m.data["foo"], SubModel2) + assert m.data["foo"].foo == "bar" + + # TODO: test mismatched type + + +def test_double_nested_union() -> None: + class SubModel1(BaseModel): + name: str + + class SubModel2(BaseModel): + bar: str + + class Model(BaseModel): + data: Dict[str, List[Union[SubModel1, SubModel2]]] + + m = Model.construct(data={"foo": [{"bar": "baz"}, {"name": "Robert"}]}) + assert len(m.data["foo"]) == 2 + + entry1 = m.data["foo"][0] + assert isinstance(entry1, SubModel2) + assert entry1.bar == "baz" + + entry2 = m.data["foo"][1] + assert isinstance(entry2, SubModel1) + assert entry2.name == "Robert" + + # TODO: test mismatched type + + +def test_union_of_dict() -> None: + class SubModel1(BaseModel): + name: str + + class SubModel2(BaseModel): + foo: str + + class Model(BaseModel): + data: Union[Dict[str, SubModel1], Dict[str, SubModel2]] + + m = Model.construct(data={"hello": {"name": "there"}, "foo": {"foo": "bar"}}) + assert len(list(m.data.keys())) == 2 + assert isinstance(m.data["hello"], SubModel1) + assert m.data["hello"].name == "there" + assert isinstance(m.data["foo"], SubModel1) + assert cast(Any, m.data["foo"]).foo == "bar" + + +def test_iso8601_datetime() -> None: + class Model(BaseModel): + created_at: datetime + + expected = datetime(2019, 12, 27, 18, 11, 19, 117000, tzinfo=timezone.utc) + + if PYDANTIC_V2: + expected_json = '{"created_at":"2019-12-27T18:11:19.117000Z"}' + else: + expected_json = '{"created_at": "2019-12-27T18:11:19.117000+00:00"}' + + model = Model.construct(created_at="2019-12-27T18:11:19.117Z") + assert model.created_at == expected + assert model_json(model) == expected_json + + model = parse_obj(Model, dict(created_at="2019-12-27T18:11:19.117Z")) + assert model.created_at == expected + assert model_json(model) == expected_json + + +def test_does_not_coerce_int() -> None: + class Model(BaseModel): + bar: int + + assert Model.construct(bar=1).bar == 1 + assert Model.construct(bar=10.9).bar == 10.9 + assert Model.construct(bar="19").bar == "19" # type: ignore[comparison-overlap] + assert Model.construct(bar=False).bar is False + + +def test_int_to_float_safe_conversion() -> None: + class Model(BaseModel): + float_field: float + + m = Model.construct(float_field=10) + assert m.float_field == 10.0 + assert isinstance(m.float_field, float) + + m = Model.construct(float_field=10.12) + assert m.float_field == 10.12 + assert isinstance(m.float_field, float) + + # number too big + m = Model.construct(float_field=2**53 + 1) + assert m.float_field == 2**53 + 1 + assert isinstance(m.float_field, int) + + +def test_deprecated_alias() -> None: + class Model(BaseModel): + resource_id: str = Field(alias="model_id") + + @property + def model_id(self) -> str: + return self.resource_id + + m = Model.construct(model_id="id") + assert m.model_id == "id" + assert m.resource_id == "id" + assert m.resource_id is m.model_id + + m = parse_obj(Model, {"model_id": "id"}) + assert m.model_id == "id" + assert m.resource_id == "id" + assert m.resource_id is m.model_id + + +def test_omitted_fields() -> None: + class Model(BaseModel): + resource_id: Optional[str] = None + + m = Model.construct() + assert m.resource_id is None + assert "resource_id" not in m.model_fields_set + + m = Model.construct(resource_id=None) + assert m.resource_id is None + assert "resource_id" in m.model_fields_set + + m = Model.construct(resource_id="foo") + assert m.resource_id == "foo" + assert "resource_id" in m.model_fields_set + + +def test_to_dict() -> None: + class Model(BaseModel): + foo: Optional[str] = Field(alias="FOO", default=None) + + m = Model(FOO="hello") + assert m.to_dict() == {"FOO": "hello"} + assert m.to_dict(use_api_names=False) == {"foo": "hello"} + + m2 = Model() + assert m2.to_dict() == {} + assert m2.to_dict(exclude_unset=False) == {"FOO": None} + assert m2.to_dict(exclude_unset=False, exclude_none=True) == {} + assert m2.to_dict(exclude_unset=False, exclude_defaults=True) == {} + + m3 = Model(FOO=None) + assert m3.to_dict() == {"FOO": None} + assert m3.to_dict(exclude_none=True) == {} + assert m3.to_dict(exclude_defaults=True) == {} + + class Model2(BaseModel): + created_at: datetime + + time_str = "2024-03-21T11:39:01.275859" + m4 = Model2.construct(created_at=time_str) + assert m4.to_dict(mode="python") == {"created_at": datetime.fromisoformat(time_str)} + assert m4.to_dict(mode="json") == {"created_at": time_str} + + if not PYDANTIC_V2: + with pytest.raises(ValueError, match="warnings is only supported in Pydantic v2"): + m.to_dict(warnings=False) + + +def test_forwards_compat_model_dump_method() -> None: + class Model(BaseModel): + foo: Optional[str] = Field(alias="FOO", default=None) + + m = Model(FOO="hello") + assert m.model_dump() == {"foo": "hello"} + assert m.model_dump(include={"bar"}) == {} + assert m.model_dump(exclude={"foo"}) == {} + assert m.model_dump(by_alias=True) == {"FOO": "hello"} + + m2 = Model() + assert m2.model_dump() == {"foo": None} + assert m2.model_dump(exclude_unset=True) == {} + assert m2.model_dump(exclude_none=True) == {} + assert m2.model_dump(exclude_defaults=True) == {} + + m3 = Model(FOO=None) + assert m3.model_dump() == {"foo": None} + assert m3.model_dump(exclude_none=True) == {} + + if not PYDANTIC_V2: + with pytest.raises(ValueError, match="round_trip is only supported in Pydantic v2"): + m.model_dump(round_trip=True) + + with pytest.raises(ValueError, match="warnings is only supported in Pydantic v2"): + m.model_dump(warnings=False) + + +def test_compat_method_no_error_for_warnings() -> None: + class Model(BaseModel): + foo: Optional[str] + + m = Model(foo="hello") + assert isinstance(model_dump(m, warnings=False), dict) + + +def test_to_json() -> None: + class Model(BaseModel): + foo: Optional[str] = Field(alias="FOO", default=None) + + m = Model(FOO="hello") + assert json.loads(m.to_json()) == {"FOO": "hello"} + assert json.loads(m.to_json(use_api_names=False)) == {"foo": "hello"} + + if PYDANTIC_V2: + assert m.to_json(indent=None) == '{"FOO":"hello"}' + else: + assert m.to_json(indent=None) == '{"FOO": "hello"}' + + m2 = Model() + assert json.loads(m2.to_json()) == {} + assert json.loads(m2.to_json(exclude_unset=False)) == {"FOO": None} + assert json.loads(m2.to_json(exclude_unset=False, exclude_none=True)) == {} + assert json.loads(m2.to_json(exclude_unset=False, exclude_defaults=True)) == {} + + m3 = Model(FOO=None) + assert json.loads(m3.to_json()) == {"FOO": None} + assert json.loads(m3.to_json(exclude_none=True)) == {} + + if not PYDANTIC_V2: + with pytest.raises(ValueError, match="warnings is only supported in Pydantic v2"): + m.to_json(warnings=False) + + +def test_forwards_compat_model_dump_json_method() -> None: + class Model(BaseModel): + foo: Optional[str] = Field(alias="FOO", default=None) + + m = Model(FOO="hello") + assert json.loads(m.model_dump_json()) == {"foo": "hello"} + assert json.loads(m.model_dump_json(include={"bar"})) == {} + assert json.loads(m.model_dump_json(include={"foo"})) == {"foo": "hello"} + assert json.loads(m.model_dump_json(by_alias=True)) == {"FOO": "hello"} + + assert m.model_dump_json(indent=2) == '{\n "foo": "hello"\n}' + + m2 = Model() + assert json.loads(m2.model_dump_json()) == {"foo": None} + assert json.loads(m2.model_dump_json(exclude_unset=True)) == {} + assert json.loads(m2.model_dump_json(exclude_none=True)) == {} + assert json.loads(m2.model_dump_json(exclude_defaults=True)) == {} + + m3 = Model(FOO=None) + assert json.loads(m3.model_dump_json()) == {"foo": None} + assert json.loads(m3.model_dump_json(exclude_none=True)) == {} + + if not PYDANTIC_V2: + with pytest.raises(ValueError, match="round_trip is only supported in Pydantic v2"): + m.model_dump_json(round_trip=True) + + with pytest.raises(ValueError, match="warnings is only supported in Pydantic v2"): + m.model_dump_json(warnings=False) + + +def test_type_compat() -> None: + # our model type can be assigned to Pydantic's model type + + def takes_pydantic(model: pydantic.BaseModel) -> None: # noqa: ARG001 + ... + + class OurModel(BaseModel): + foo: Optional[str] = None + + takes_pydantic(OurModel()) + + +def test_annotated_types() -> None: + class Model(BaseModel): + value: str + + m = construct_type( + value={"value": "foo"}, + type_=cast(Any, Annotated[Model, "random metadata"]), + ) + assert isinstance(m, Model) + assert m.value == "foo" + + +def test_discriminated_unions_invalid_data() -> None: + class A(BaseModel): + type: Literal["a"] + + data: str + + class B(BaseModel): + type: Literal["b"] + + data: int + + m = construct_type( + value={"type": "b", "data": "foo"}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="type")]), + ) + assert isinstance(m, B) + assert m.type == "b" + assert m.data == "foo" # type: ignore[comparison-overlap] + + m = construct_type( + value={"type": "a", "data": 100}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="type")]), + ) + assert isinstance(m, A) + assert m.type == "a" + if PYDANTIC_V2: + assert m.data == 100 # type: ignore[comparison-overlap] + else: + # pydantic v1 automatically converts inputs to strings + # if the expected type is a str + assert m.data == "100" + + +def test_discriminated_unions_unknown_variant() -> None: + class A(BaseModel): + type: Literal["a"] + + data: str + + class B(BaseModel): + type: Literal["b"] + + data: int + + m = construct_type( + value={"type": "c", "data": None, "new_thing": "bar"}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="type")]), + ) + + # just chooses the first variant + assert isinstance(m, A) + assert m.type == "c" # type: ignore[comparison-overlap] + assert m.data == None # type: ignore[unreachable] + assert m.new_thing == "bar" + + +def test_discriminated_unions_invalid_data_nested_unions() -> None: + class A(BaseModel): + type: Literal["a"] + + data: str + + class B(BaseModel): + type: Literal["b"] + + data: int + + class C(BaseModel): + type: Literal["c"] + + data: bool + + m = construct_type( + value={"type": "b", "data": "foo"}, + type_=cast(Any, Annotated[Union[Union[A, B], C], PropertyInfo(discriminator="type")]), + ) + assert isinstance(m, B) + assert m.type == "b" + assert m.data == "foo" # type: ignore[comparison-overlap] + + m = construct_type( + value={"type": "c", "data": "foo"}, + type_=cast(Any, Annotated[Union[Union[A, B], C], PropertyInfo(discriminator="type")]), + ) + assert isinstance(m, C) + assert m.type == "c" + assert m.data == "foo" # type: ignore[comparison-overlap] + + +def test_discriminated_unions_with_aliases_invalid_data() -> None: + class A(BaseModel): + foo_type: Literal["a"] = Field(alias="type") + + data: str + + class B(BaseModel): + foo_type: Literal["b"] = Field(alias="type") + + data: int + + m = construct_type( + value={"type": "b", "data": "foo"}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="foo_type")]), + ) + assert isinstance(m, B) + assert m.foo_type == "b" + assert m.data == "foo" # type: ignore[comparison-overlap] + + m = construct_type( + value={"type": "a", "data": 100}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="foo_type")]), + ) + assert isinstance(m, A) + assert m.foo_type == "a" + if PYDANTIC_V2: + assert m.data == 100 # type: ignore[comparison-overlap] + else: + # pydantic v1 automatically converts inputs to strings + # if the expected type is a str + assert m.data == "100" + + +def test_discriminated_unions_overlapping_discriminators_invalid_data() -> None: + class A(BaseModel): + type: Literal["a"] + + data: bool + + class B(BaseModel): + type: Literal["a"] + + data: int + + m = construct_type( + value={"type": "a", "data": "foo"}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="type")]), + ) + assert isinstance(m, B) + assert m.type == "a" + assert m.data == "foo" # type: ignore[comparison-overlap] + + +def test_discriminated_unions_invalid_data_uses_cache() -> None: + class A(BaseModel): + type: Literal["a"] + + data: str + + class B(BaseModel): + type: Literal["b"] + + data: int + + UnionType = cast(Any, Union[A, B]) + + assert not hasattr(UnionType, "__discriminator__") + + m = construct_type( + value={"type": "b", "data": "foo"}, type_=cast(Any, Annotated[UnionType, PropertyInfo(discriminator="type")]) + ) + assert isinstance(m, B) + assert m.type == "b" + assert m.data == "foo" # type: ignore[comparison-overlap] + + discriminator = UnionType.__discriminator__ + assert discriminator is not None + + m = construct_type( + value={"type": "b", "data": "foo"}, type_=cast(Any, Annotated[UnionType, PropertyInfo(discriminator="type")]) + ) + assert isinstance(m, B) + assert m.type == "b" + assert m.data == "foo" # type: ignore[comparison-overlap] + + # if the discriminator details object stays the same between invocations then + # we hit the cache + assert UnionType.__discriminator__ is discriminator + + +@pytest.mark.skipif(not PYDANTIC_V2, reason="TypeAliasType is not supported in Pydantic v1") +def test_type_alias_type() -> None: + Alias = TypeAliasType("Alias", str) # pyright: ignore + + class Model(BaseModel): + alias: Alias + union: Union[int, Alias] + + m = construct_type(value={"alias": "foo", "union": "bar"}, type_=Model) + assert isinstance(m, Model) + assert isinstance(m.alias, str) + assert m.alias == "foo" + assert isinstance(m.union, str) + assert m.union == "bar" + + +@pytest.mark.skipif(not PYDANTIC_V2, reason="TypeAliasType is not supported in Pydantic v1") +def test_field_named_cls() -> None: + class Model(BaseModel): + cls: str + + m = construct_type(value={"cls": "foo"}, type_=Model) + assert isinstance(m, Model) + assert isinstance(m.cls, str) + + +def test_discriminated_union_case() -> None: + class A(BaseModel): + type: Literal["a"] + + data: bool + + class B(BaseModel): + type: Literal["b"] + + data: List[Union[A, object]] + + class ModelA(BaseModel): + type: Literal["modelA"] + + data: int + + class ModelB(BaseModel): + type: Literal["modelB"] + + required: str + + data: Union[A, B] + + # when constructing ModelA | ModelB, value data doesn't match ModelB exactly - missing `required` + m = construct_type( + value={"type": "modelB", "data": {"type": "a", "data": True}}, + type_=cast(Any, Annotated[Union[ModelA, ModelB], PropertyInfo(discriminator="type")]), + ) + + assert isinstance(m, ModelB) diff --git a/tests/test_qs.py b/tests/test_qs.py new file mode 100644 index 0000000..d4e5ecb --- /dev/null +++ b/tests/test_qs.py @@ -0,0 +1,78 @@ +from typing import Any, cast +from functools import partial +from urllib.parse import unquote + +import pytest + +from ydc_search_api._qs import Querystring, stringify + + +def test_empty() -> None: + assert stringify({}) == "" + assert stringify({"a": {}}) == "" + assert stringify({"a": {"b": {"c": {}}}}) == "" + + +def test_basic() -> None: + assert stringify({"a": 1}) == "a=1" + assert stringify({"a": "b"}) == "a=b" + assert stringify({"a": True}) == "a=true" + assert stringify({"a": False}) == "a=false" + assert stringify({"a": 1.23456}) == "a=1.23456" + assert stringify({"a": None}) == "" + + +@pytest.mark.parametrize("method", ["class", "function"]) +def test_nested_dotted(method: str) -> None: + if method == "class": + serialise = Querystring(nested_format="dots").stringify + else: + serialise = partial(stringify, nested_format="dots") + + assert unquote(serialise({"a": {"b": "c"}})) == "a.b=c" + assert unquote(serialise({"a": {"b": "c", "d": "e", "f": "g"}})) == "a.b=c&a.d=e&a.f=g" + assert unquote(serialise({"a": {"b": {"c": {"d": "e"}}}})) == "a.b.c.d=e" + assert unquote(serialise({"a": {"b": True}})) == "a.b=true" + + +def test_nested_brackets() -> None: + assert unquote(stringify({"a": {"b": "c"}})) == "a[b]=c" + assert unquote(stringify({"a": {"b": "c", "d": "e", "f": "g"}})) == "a[b]=c&a[d]=e&a[f]=g" + assert unquote(stringify({"a": {"b": {"c": {"d": "e"}}}})) == "a[b][c][d]=e" + assert unquote(stringify({"a": {"b": True}})) == "a[b]=true" + + +@pytest.mark.parametrize("method", ["class", "function"]) +def test_array_comma(method: str) -> None: + if method == "class": + serialise = Querystring(array_format="comma").stringify + else: + serialise = partial(stringify, array_format="comma") + + assert unquote(serialise({"in": ["foo", "bar"]})) == "in=foo,bar" + assert unquote(serialise({"a": {"b": [True, False]}})) == "a[b]=true,false" + assert unquote(serialise({"a": {"b": [True, False, None, True]}})) == "a[b]=true,false,true" + + +def test_array_repeat() -> None: + assert unquote(stringify({"in": ["foo", "bar"]})) == "in=foo&in=bar" + assert unquote(stringify({"a": {"b": [True, False]}})) == "a[b]=true&a[b]=false" + assert unquote(stringify({"a": {"b": [True, False, None, True]}})) == "a[b]=true&a[b]=false&a[b]=true" + assert unquote(stringify({"in": ["foo", {"b": {"c": ["d", "e"]}}]})) == "in=foo&in[b][c]=d&in[b][c]=e" + + +@pytest.mark.parametrize("method", ["class", "function"]) +def test_array_brackets(method: str) -> None: + if method == "class": + serialise = Querystring(array_format="brackets").stringify + else: + serialise = partial(stringify, array_format="brackets") + + assert unquote(serialise({"in": ["foo", "bar"]})) == "in[]=foo&in[]=bar" + assert unquote(serialise({"a": {"b": [True, False]}})) == "a[b][]=true&a[b][]=false" + assert unquote(serialise({"a": {"b": [True, False, None, True]}})) == "a[b][]=true&a[b][]=false&a[b][]=true" + + +def test_unknown_array_format() -> None: + with pytest.raises(NotImplementedError, match="Unknown array_format value: foo, choose from comma, repeat"): + stringify({"a": ["foo", "bar"]}, array_format=cast(Any, "foo")) diff --git a/tests/test_required_args.py b/tests/test_required_args.py new file mode 100644 index 0000000..e141678 --- /dev/null +++ b/tests/test_required_args.py @@ -0,0 +1,111 @@ +from __future__ import annotations + +import pytest + +from ydc_search_api._utils import required_args + + +def test_too_many_positional_params() -> None: + @required_args(["a"]) + def foo(a: str | None = None) -> str | None: + return a + + with pytest.raises(TypeError, match=r"foo\(\) takes 1 argument\(s\) but 2 were given"): + foo("a", "b") # type: ignore + + +def test_positional_param() -> None: + @required_args(["a"]) + def foo(a: str | None = None) -> str | None: + return a + + assert foo("a") == "a" + assert foo(None) is None + assert foo(a="b") == "b" + + with pytest.raises(TypeError, match="Missing required argument: 'a'"): + foo() + + +def test_keyword_only_param() -> None: + @required_args(["a"]) + def foo(*, a: str | None = None) -> str | None: + return a + + assert foo(a="a") == "a" + assert foo(a=None) is None + assert foo(a="b") == "b" + + with pytest.raises(TypeError, match="Missing required argument: 'a'"): + foo() + + +def test_multiple_params() -> None: + @required_args(["a", "b", "c"]) + def foo(a: str = "", *, b: str = "", c: str = "") -> str | None: + return f"{a} {b} {c}" + + assert foo(a="a", b="b", c="c") == "a b c" + + error_message = r"Missing required arguments.*" + + with pytest.raises(TypeError, match=error_message): + foo() + + with pytest.raises(TypeError, match=error_message): + foo(a="a") + + with pytest.raises(TypeError, match=error_message): + foo(b="b") + + with pytest.raises(TypeError, match=error_message): + foo(c="c") + + with pytest.raises(TypeError, match=r"Missing required argument: 'a'"): + foo(b="a", c="c") + + with pytest.raises(TypeError, match=r"Missing required argument: 'b'"): + foo("a", c="c") + + +def test_multiple_variants() -> None: + @required_args(["a"], ["b"]) + def foo(*, a: str | None = None, b: str | None = None) -> str | None: + return a if a is not None else b + + assert foo(a="foo") == "foo" + assert foo(b="bar") == "bar" + assert foo(a=None) is None + assert foo(b=None) is None + + # TODO: this error message could probably be improved + with pytest.raises( + TypeError, + match=r"Missing required arguments; Expected either \('a'\) or \('b'\) arguments to be given", + ): + foo() + + +def test_multiple_params_multiple_variants() -> None: + @required_args(["a", "b"], ["c"]) + def foo(*, a: str | None = None, b: str | None = None, c: str | None = None) -> str | None: + if a is not None: + return a + if b is not None: + return b + return c + + error_message = r"Missing required arguments; Expected either \('a' and 'b'\) or \('c'\) arguments to be given" + + with pytest.raises(TypeError, match=error_message): + foo(a="foo") + + with pytest.raises(TypeError, match=error_message): + foo(b="bar") + + with pytest.raises(TypeError, match=error_message): + foo() + + assert foo(a=None, b="bar") == "bar" + assert foo(c=None) is None + assert foo(c="foo") == "foo" diff --git a/tests/test_response.py b/tests/test_response.py new file mode 100644 index 0000000..51187f4 --- /dev/null +++ b/tests/test_response.py @@ -0,0 +1,277 @@ +import json +from typing import Any, List, Union, cast +from typing_extensions import Annotated + +import httpx +import pytest +import pydantic + +from ydc_search_api import BaseModel, YdcSearchAPI, AsyncYdcSearchAPI +from ydc_search_api._response import ( + APIResponse, + BaseAPIResponse, + AsyncAPIResponse, + BinaryAPIResponse, + AsyncBinaryAPIResponse, + extract_response_type, +) +from ydc_search_api._streaming import Stream +from ydc_search_api._base_client import FinalRequestOptions + + +class ConcreteBaseAPIResponse(APIResponse[bytes]): ... + + +class ConcreteAPIResponse(APIResponse[List[str]]): ... + + +class ConcreteAsyncAPIResponse(APIResponse[httpx.Response]): ... + + +def test_extract_response_type_direct_classes() -> None: + assert extract_response_type(BaseAPIResponse[str]) == str + assert extract_response_type(APIResponse[str]) == str + assert extract_response_type(AsyncAPIResponse[str]) == str + + +def test_extract_response_type_direct_class_missing_type_arg() -> None: + with pytest.raises( + RuntimeError, + match="Expected type to have a type argument at index 0 but it did not", + ): + extract_response_type(AsyncAPIResponse) + + +def test_extract_response_type_concrete_subclasses() -> None: + assert extract_response_type(ConcreteBaseAPIResponse) == bytes + assert extract_response_type(ConcreteAPIResponse) == List[str] + assert extract_response_type(ConcreteAsyncAPIResponse) == httpx.Response + + +def test_extract_response_type_binary_response() -> None: + assert extract_response_type(BinaryAPIResponse) == bytes + assert extract_response_type(AsyncBinaryAPIResponse) == bytes + + +class PydanticModel(pydantic.BaseModel): ... + + +def test_response_parse_mismatched_basemodel(client: YdcSearchAPI) -> None: + response = APIResponse( + raw=httpx.Response(200, content=b"foo"), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + with pytest.raises( + TypeError, + match="Pydantic models must subclass our base model type, e.g. `from ydc_search_api import BaseModel`", + ): + response.parse(to=PydanticModel) + + +@pytest.mark.asyncio +async def test_async_response_parse_mismatched_basemodel(async_client: AsyncYdcSearchAPI) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=b"foo"), + client=async_client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + with pytest.raises( + TypeError, + match="Pydantic models must subclass our base model type, e.g. `from ydc_search_api import BaseModel`", + ): + await response.parse(to=PydanticModel) + + +def test_response_parse_custom_stream(client: YdcSearchAPI) -> None: + response = APIResponse( + raw=httpx.Response(200, content=b"foo"), + client=client, + stream=True, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + stream = response.parse(to=Stream[int]) + assert stream._cast_to == int + + +@pytest.mark.asyncio +async def test_async_response_parse_custom_stream(async_client: AsyncYdcSearchAPI) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=b"foo"), + client=async_client, + stream=True, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + stream = await response.parse(to=Stream[int]) + assert stream._cast_to == int + + +class CustomModel(BaseModel): + foo: str + bar: int + + +def test_response_parse_custom_model(client: YdcSearchAPI) -> None: + response = APIResponse( + raw=httpx.Response(200, content=json.dumps({"foo": "hello!", "bar": 2})), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = response.parse(to=CustomModel) + assert obj.foo == "hello!" + assert obj.bar == 2 + + +@pytest.mark.asyncio +async def test_async_response_parse_custom_model(async_client: AsyncYdcSearchAPI) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=json.dumps({"foo": "hello!", "bar": 2})), + client=async_client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = await response.parse(to=CustomModel) + assert obj.foo == "hello!" + assert obj.bar == 2 + + +def test_response_parse_annotated_type(client: YdcSearchAPI) -> None: + response = APIResponse( + raw=httpx.Response(200, content=json.dumps({"foo": "hello!", "bar": 2})), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = response.parse( + to=cast("type[CustomModel]", Annotated[CustomModel, "random metadata"]), + ) + assert obj.foo == "hello!" + assert obj.bar == 2 + + +async def test_async_response_parse_annotated_type(async_client: AsyncYdcSearchAPI) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=json.dumps({"foo": "hello!", "bar": 2})), + client=async_client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = await response.parse( + to=cast("type[CustomModel]", Annotated[CustomModel, "random metadata"]), + ) + assert obj.foo == "hello!" + assert obj.bar == 2 + + +@pytest.mark.parametrize( + "content, expected", + [ + ("false", False), + ("true", True), + ("False", False), + ("True", True), + ("TrUe", True), + ("FalSe", False), + ], +) +def test_response_parse_bool(client: YdcSearchAPI, content: str, expected: bool) -> None: + response = APIResponse( + raw=httpx.Response(200, content=content), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + result = response.parse(to=bool) + assert result is expected + + +@pytest.mark.parametrize( + "content, expected", + [ + ("false", False), + ("true", True), + ("False", False), + ("True", True), + ("TrUe", True), + ("FalSe", False), + ], +) +async def test_async_response_parse_bool(client: AsyncYdcSearchAPI, content: str, expected: bool) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=content), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + result = await response.parse(to=bool) + assert result is expected + + +class OtherModel(BaseModel): + a: str + + +@pytest.mark.parametrize("client", [False], indirect=True) # loose validation +def test_response_parse_expect_model_union_non_json_content(client: YdcSearchAPI) -> None: + response = APIResponse( + raw=httpx.Response(200, content=b"foo", headers={"Content-Type": "application/text"}), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = response.parse(to=cast(Any, Union[CustomModel, OtherModel])) + assert isinstance(obj, str) + assert obj == "foo" + + +@pytest.mark.asyncio +@pytest.mark.parametrize("async_client", [False], indirect=True) # loose validation +async def test_async_response_parse_expect_model_union_non_json_content(async_client: AsyncYdcSearchAPI) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=b"foo", headers={"Content-Type": "application/text"}), + client=async_client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = await response.parse(to=cast(Any, Union[CustomModel, OtherModel])) + assert isinstance(obj, str) + assert obj == "foo" diff --git a/tests/test_streaming.py b/tests/test_streaming.py new file mode 100644 index 0000000..25fa8a9 --- /dev/null +++ b/tests/test_streaming.py @@ -0,0 +1,252 @@ +from __future__ import annotations + +from typing import Iterator, AsyncIterator + +import httpx +import pytest + +from ydc_search_api import YdcSearchAPI, AsyncYdcSearchAPI +from ydc_search_api._streaming import Stream, AsyncStream, ServerSentEvent + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_basic(sync: bool, client: YdcSearchAPI, async_client: AsyncYdcSearchAPI) -> None: + def body() -> Iterator[bytes]: + yield b"event: completion\n" + yield b'data: {"foo":true}\n' + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "completion" + assert sse.json() == {"foo": True} + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_data_missing_event(sync: bool, client: YdcSearchAPI, async_client: AsyncYdcSearchAPI) -> None: + def body() -> Iterator[bytes]: + yield b'data: {"foo":true}\n' + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event is None + assert sse.json() == {"foo": True} + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_event_missing_data(sync: bool, client: YdcSearchAPI, async_client: AsyncYdcSearchAPI) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.data == "" + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_multiple_events(sync: bool, client: YdcSearchAPI, async_client: AsyncYdcSearchAPI) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b"\n" + yield b"event: completion\n" + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.data == "" + + sse = await iter_next(iterator) + assert sse.event == "completion" + assert sse.data == "" + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_multiple_events_with_data(sync: bool, client: YdcSearchAPI, async_client: AsyncYdcSearchAPI) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b'data: {"foo":true}\n' + yield b"\n" + yield b"event: completion\n" + yield b'data: {"bar":false}\n' + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.json() == {"foo": True} + + sse = await iter_next(iterator) + assert sse.event == "completion" + assert sse.json() == {"bar": False} + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_multiple_data_lines_with_empty_line( + sync: bool, client: YdcSearchAPI, async_client: AsyncYdcSearchAPI +) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b"data: {\n" + yield b'data: "foo":\n' + yield b"data: \n" + yield b"data:\n" + yield b"data: true}\n" + yield b"\n\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.json() == {"foo": True} + assert sse.data == '{\n"foo":\n\n\ntrue}' + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_data_json_escaped_double_new_line( + sync: bool, client: YdcSearchAPI, async_client: AsyncYdcSearchAPI +) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b'data: {"foo": "my long\\n\\ncontent"}' + yield b"\n\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.json() == {"foo": "my long\n\ncontent"} + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_multiple_data_lines(sync: bool, client: YdcSearchAPI, async_client: AsyncYdcSearchAPI) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b"data: {\n" + yield b'data: "foo":\n' + yield b"data: true}\n" + yield b"\n\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.json() == {"foo": True} + + await assert_empty_iter(iterator) + + +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_special_new_line_character( + sync: bool, + client: YdcSearchAPI, + async_client: AsyncYdcSearchAPI, +) -> None: + def body() -> Iterator[bytes]: + yield b'data: {"content":" culpa"}\n' + yield b"\n" + yield b'data: {"content":" \xe2\x80\xa8"}\n' + yield b"\n" + yield b'data: {"content":"foo"}\n' + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event is None + assert sse.json() == {"content": " culpa"} + + sse = await iter_next(iterator) + assert sse.event is None + assert sse.json() == {"content": " 
"} + + sse = await iter_next(iterator) + assert sse.event is None + assert sse.json() == {"content": "foo"} + + await assert_empty_iter(iterator) + + +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_multi_byte_character_multiple_chunks( + sync: bool, + client: YdcSearchAPI, + async_client: AsyncYdcSearchAPI, +) -> None: + def body() -> Iterator[bytes]: + yield b'data: {"content":"' + # bytes taken from the string 'извСстни' and arbitrarily split + # so that some multi-byte characters span multiple chunks + yield b"\xd0" + yield b"\xb8\xd0\xb7\xd0" + yield b"\xb2\xd0\xb5\xd1\x81\xd1\x82\xd0\xbd\xd0\xb8" + yield b'"}\n' + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event is None + assert sse.json() == {"content": "извСстни"} + + +async def to_aiter(iter: Iterator[bytes]) -> AsyncIterator[bytes]: + for chunk in iter: + yield chunk + + +async def iter_next(iter: Iterator[ServerSentEvent] | AsyncIterator[ServerSentEvent]) -> ServerSentEvent: + if isinstance(iter, AsyncIterator): + return await iter.__anext__() + + return next(iter) + + +async def assert_empty_iter(iter: Iterator[ServerSentEvent] | AsyncIterator[ServerSentEvent]) -> None: + with pytest.raises((StopAsyncIteration, RuntimeError)): + await iter_next(iter) + + +def make_event_iterator( + content: Iterator[bytes], + *, + sync: bool, + client: YdcSearchAPI, + async_client: AsyncYdcSearchAPI, +) -> Iterator[ServerSentEvent] | AsyncIterator[ServerSentEvent]: + if sync: + return Stream(cast_to=object, client=client, response=httpx.Response(200, content=content))._iter_events() + + return AsyncStream( + cast_to=object, client=async_client, response=httpx.Response(200, content=to_aiter(content)) + )._iter_events() diff --git a/tests/test_transform.py b/tests/test_transform.py new file mode 100644 index 0000000..bd80cc2 --- /dev/null +++ b/tests/test_transform.py @@ -0,0 +1,453 @@ +from __future__ import annotations + +import io +import pathlib +from typing import Any, Dict, List, Union, TypeVar, Iterable, Optional, cast +from datetime import date, datetime +from typing_extensions import Required, Annotated, TypedDict + +import pytest + +from ydc_search_api._types import NOT_GIVEN, Base64FileInput +from ydc_search_api._utils import ( + PropertyInfo, + transform as _transform, + parse_datetime, + async_transform as _async_transform, +) +from ydc_search_api._compat import PYDANTIC_V2 +from ydc_search_api._models import BaseModel + +_T = TypeVar("_T") + +SAMPLE_FILE_PATH = pathlib.Path(__file__).parent.joinpath("sample_file.txt") + + +async def transform( + data: _T, + expected_type: object, + use_async: bool, +) -> _T: + if use_async: + return await _async_transform(data, expected_type=expected_type) + + return _transform(data, expected_type=expected_type) + + +parametrize = pytest.mark.parametrize("use_async", [False, True], ids=["sync", "async"]) + + +class Foo1(TypedDict): + foo_bar: Annotated[str, PropertyInfo(alias="fooBar")] + + +@parametrize +@pytest.mark.asyncio +async def test_top_level_alias(use_async: bool) -> None: + assert await transform({"foo_bar": "hello"}, expected_type=Foo1, use_async=use_async) == {"fooBar": "hello"} + + +class Foo2(TypedDict): + bar: Bar2 + + +class Bar2(TypedDict): + this_thing: Annotated[int, PropertyInfo(alias="this__thing")] + baz: Annotated[Baz2, PropertyInfo(alias="Baz")] + + +class Baz2(TypedDict): + my_baz: Annotated[str, PropertyInfo(alias="myBaz")] + + +@parametrize +@pytest.mark.asyncio +async def test_recursive_typeddict(use_async: bool) -> None: + assert await transform({"bar": {"this_thing": 1}}, Foo2, use_async) == {"bar": {"this__thing": 1}} + assert await transform({"bar": {"baz": {"my_baz": "foo"}}}, Foo2, use_async) == {"bar": {"Baz": {"myBaz": "foo"}}} + + +class Foo3(TypedDict): + things: List[Bar3] + + +class Bar3(TypedDict): + my_field: Annotated[str, PropertyInfo(alias="myField")] + + +@parametrize +@pytest.mark.asyncio +async def test_list_of_typeddict(use_async: bool) -> None: + result = await transform({"things": [{"my_field": "foo"}, {"my_field": "foo2"}]}, Foo3, use_async) + assert result == {"things": [{"myField": "foo"}, {"myField": "foo2"}]} + + +class Foo4(TypedDict): + foo: Union[Bar4, Baz4] + + +class Bar4(TypedDict): + foo_bar: Annotated[str, PropertyInfo(alias="fooBar")] + + +class Baz4(TypedDict): + foo_baz: Annotated[str, PropertyInfo(alias="fooBaz")] + + +@parametrize +@pytest.mark.asyncio +async def test_union_of_typeddict(use_async: bool) -> None: + assert await transform({"foo": {"foo_bar": "bar"}}, Foo4, use_async) == {"foo": {"fooBar": "bar"}} + assert await transform({"foo": {"foo_baz": "baz"}}, Foo4, use_async) == {"foo": {"fooBaz": "baz"}} + assert await transform({"foo": {"foo_baz": "baz", "foo_bar": "bar"}}, Foo4, use_async) == { + "foo": {"fooBaz": "baz", "fooBar": "bar"} + } + + +class Foo5(TypedDict): + foo: Annotated[Union[Bar4, List[Baz4]], PropertyInfo(alias="FOO")] + + +class Bar5(TypedDict): + foo_bar: Annotated[str, PropertyInfo(alias="fooBar")] + + +class Baz5(TypedDict): + foo_baz: Annotated[str, PropertyInfo(alias="fooBaz")] + + +@parametrize +@pytest.mark.asyncio +async def test_union_of_list(use_async: bool) -> None: + assert await transform({"foo": {"foo_bar": "bar"}}, Foo5, use_async) == {"FOO": {"fooBar": "bar"}} + assert await transform( + { + "foo": [ + {"foo_baz": "baz"}, + {"foo_baz": "baz"}, + ] + }, + Foo5, + use_async, + ) == {"FOO": [{"fooBaz": "baz"}, {"fooBaz": "baz"}]} + + +class Foo6(TypedDict): + bar: Annotated[str, PropertyInfo(alias="Bar")] + + +@parametrize +@pytest.mark.asyncio +async def test_includes_unknown_keys(use_async: bool) -> None: + assert await transform({"bar": "bar", "baz_": {"FOO": 1}}, Foo6, use_async) == { + "Bar": "bar", + "baz_": {"FOO": 1}, + } + + +class Foo7(TypedDict): + bar: Annotated[List[Bar7], PropertyInfo(alias="bAr")] + foo: Bar7 + + +class Bar7(TypedDict): + foo: str + + +@parametrize +@pytest.mark.asyncio +async def test_ignores_invalid_input(use_async: bool) -> None: + assert await transform({"bar": ""}, Foo7, use_async) == {"bAr": ""} + assert await transform({"foo": ""}, Foo7, use_async) == {"foo": ""} + + +class DatetimeDict(TypedDict, total=False): + foo: Annotated[datetime, PropertyInfo(format="iso8601")] + + bar: Annotated[Optional[datetime], PropertyInfo(format="iso8601")] + + required: Required[Annotated[Optional[datetime], PropertyInfo(format="iso8601")]] + + list_: Required[Annotated[Optional[List[datetime]], PropertyInfo(format="iso8601")]] + + union: Annotated[Union[int, datetime], PropertyInfo(format="iso8601")] + + +class DateDict(TypedDict, total=False): + foo: Annotated[date, PropertyInfo(format="iso8601")] + + +class DatetimeModel(BaseModel): + foo: datetime + + +class DateModel(BaseModel): + foo: Optional[date] + + +@parametrize +@pytest.mark.asyncio +async def test_iso8601_format(use_async: bool) -> None: + dt = datetime.fromisoformat("2023-02-23T14:16:36.337692+00:00") + tz = "Z" if PYDANTIC_V2 else "+00:00" + assert await transform({"foo": dt}, DatetimeDict, use_async) == {"foo": "2023-02-23T14:16:36.337692+00:00"} # type: ignore[comparison-overlap] + assert await transform(DatetimeModel(foo=dt), Any, use_async) == {"foo": "2023-02-23T14:16:36.337692" + tz} # type: ignore[comparison-overlap] + + dt = dt.replace(tzinfo=None) + assert await transform({"foo": dt}, DatetimeDict, use_async) == {"foo": "2023-02-23T14:16:36.337692"} # type: ignore[comparison-overlap] + assert await transform(DatetimeModel(foo=dt), Any, use_async) == {"foo": "2023-02-23T14:16:36.337692"} # type: ignore[comparison-overlap] + + assert await transform({"foo": None}, DateDict, use_async) == {"foo": None} # type: ignore[comparison-overlap] + assert await transform(DateModel(foo=None), Any, use_async) == {"foo": None} # type: ignore + assert await transform({"foo": date.fromisoformat("2023-02-23")}, DateDict, use_async) == {"foo": "2023-02-23"} # type: ignore[comparison-overlap] + assert await transform(DateModel(foo=date.fromisoformat("2023-02-23")), DateDict, use_async) == { + "foo": "2023-02-23" + } # type: ignore[comparison-overlap] + + +@parametrize +@pytest.mark.asyncio +async def test_optional_iso8601_format(use_async: bool) -> None: + dt = datetime.fromisoformat("2023-02-23T14:16:36.337692+00:00") + assert await transform({"bar": dt}, DatetimeDict, use_async) == {"bar": "2023-02-23T14:16:36.337692+00:00"} # type: ignore[comparison-overlap] + + assert await transform({"bar": None}, DatetimeDict, use_async) == {"bar": None} + + +@parametrize +@pytest.mark.asyncio +async def test_required_iso8601_format(use_async: bool) -> None: + dt = datetime.fromisoformat("2023-02-23T14:16:36.337692+00:00") + assert await transform({"required": dt}, DatetimeDict, use_async) == { + "required": "2023-02-23T14:16:36.337692+00:00" + } # type: ignore[comparison-overlap] + + assert await transform({"required": None}, DatetimeDict, use_async) == {"required": None} + + +@parametrize +@pytest.mark.asyncio +async def test_union_datetime(use_async: bool) -> None: + dt = datetime.fromisoformat("2023-02-23T14:16:36.337692+00:00") + assert await transform({"union": dt}, DatetimeDict, use_async) == { # type: ignore[comparison-overlap] + "union": "2023-02-23T14:16:36.337692+00:00" + } + + assert await transform({"union": "foo"}, DatetimeDict, use_async) == {"union": "foo"} + + +@parametrize +@pytest.mark.asyncio +async def test_nested_list_iso6801_format(use_async: bool) -> None: + dt1 = datetime.fromisoformat("2023-02-23T14:16:36.337692+00:00") + dt2 = parse_datetime("2022-01-15T06:34:23Z") + assert await transform({"list_": [dt1, dt2]}, DatetimeDict, use_async) == { # type: ignore[comparison-overlap] + "list_": ["2023-02-23T14:16:36.337692+00:00", "2022-01-15T06:34:23+00:00"] + } + + +@parametrize +@pytest.mark.asyncio +async def test_datetime_custom_format(use_async: bool) -> None: + dt = parse_datetime("2022-01-15T06:34:23Z") + + result = await transform(dt, Annotated[datetime, PropertyInfo(format="custom", format_template="%H")], use_async) + assert result == "06" # type: ignore[comparison-overlap] + + +class DateDictWithRequiredAlias(TypedDict, total=False): + required_prop: Required[Annotated[date, PropertyInfo(format="iso8601", alias="prop")]] + + +@parametrize +@pytest.mark.asyncio +async def test_datetime_with_alias(use_async: bool) -> None: + assert await transform({"required_prop": None}, DateDictWithRequiredAlias, use_async) == {"prop": None} # type: ignore[comparison-overlap] + assert await transform( + {"required_prop": date.fromisoformat("2023-02-23")}, DateDictWithRequiredAlias, use_async + ) == {"prop": "2023-02-23"} # type: ignore[comparison-overlap] + + +class MyModel(BaseModel): + foo: str + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_model_to_dictionary(use_async: bool) -> None: + assert cast(Any, await transform(MyModel(foo="hi!"), Any, use_async)) == {"foo": "hi!"} + assert cast(Any, await transform(MyModel.construct(foo="hi!"), Any, use_async)) == {"foo": "hi!"} + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_empty_model(use_async: bool) -> None: + assert cast(Any, await transform(MyModel.construct(), Any, use_async)) == {} + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_unknown_field(use_async: bool) -> None: + assert cast(Any, await transform(MyModel.construct(my_untyped_field=True), Any, use_async)) == { + "my_untyped_field": True + } + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_mismatched_types(use_async: bool) -> None: + model = MyModel.construct(foo=True) + if PYDANTIC_V2: + with pytest.warns(UserWarning): + params = await transform(model, Any, use_async) + else: + params = await transform(model, Any, use_async) + assert cast(Any, params) == {"foo": True} + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_mismatched_object_type(use_async: bool) -> None: + model = MyModel.construct(foo=MyModel.construct(hello="world")) + if PYDANTIC_V2: + with pytest.warns(UserWarning): + params = await transform(model, Any, use_async) + else: + params = await transform(model, Any, use_async) + assert cast(Any, params) == {"foo": {"hello": "world"}} + + +class ModelNestedObjects(BaseModel): + nested: MyModel + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_nested_objects(use_async: bool) -> None: + model = ModelNestedObjects.construct(nested={"foo": "stainless"}) + assert isinstance(model.nested, MyModel) + assert cast(Any, await transform(model, Any, use_async)) == {"nested": {"foo": "stainless"}} + + +class ModelWithDefaultField(BaseModel): + foo: str + with_none_default: Union[str, None] = None + with_str_default: str = "foo" + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_default_field(use_async: bool) -> None: + # should be excluded when defaults are used + model = ModelWithDefaultField.construct() + assert model.with_none_default is None + assert model.with_str_default == "foo" + assert cast(Any, await transform(model, Any, use_async)) == {} + + # should be included when the default value is explicitly given + model = ModelWithDefaultField.construct(with_none_default=None, with_str_default="foo") + assert model.with_none_default is None + assert model.with_str_default == "foo" + assert cast(Any, await transform(model, Any, use_async)) == {"with_none_default": None, "with_str_default": "foo"} + + # should be included when a non-default value is explicitly given + model = ModelWithDefaultField.construct(with_none_default="bar", with_str_default="baz") + assert model.with_none_default == "bar" + assert model.with_str_default == "baz" + assert cast(Any, await transform(model, Any, use_async)) == {"with_none_default": "bar", "with_str_default": "baz"} + + +class TypedDictIterableUnion(TypedDict): + foo: Annotated[Union[Bar8, Iterable[Baz8]], PropertyInfo(alias="FOO")] + + +class Bar8(TypedDict): + foo_bar: Annotated[str, PropertyInfo(alias="fooBar")] + + +class Baz8(TypedDict): + foo_baz: Annotated[str, PropertyInfo(alias="fooBaz")] + + +@parametrize +@pytest.mark.asyncio +async def test_iterable_of_dictionaries(use_async: bool) -> None: + assert await transform({"foo": [{"foo_baz": "bar"}]}, TypedDictIterableUnion, use_async) == { + "FOO": [{"fooBaz": "bar"}] + } + assert cast(Any, await transform({"foo": ({"foo_baz": "bar"},)}, TypedDictIterableUnion, use_async)) == { + "FOO": [{"fooBaz": "bar"}] + } + + def my_iter() -> Iterable[Baz8]: + yield {"foo_baz": "hello"} + yield {"foo_baz": "world"} + + assert await transform({"foo": my_iter()}, TypedDictIterableUnion, use_async) == { + "FOO": [{"fooBaz": "hello"}, {"fooBaz": "world"}] + } + + +@parametrize +@pytest.mark.asyncio +async def test_dictionary_items(use_async: bool) -> None: + class DictItems(TypedDict): + foo_baz: Annotated[str, PropertyInfo(alias="fooBaz")] + + assert await transform({"foo": {"foo_baz": "bar"}}, Dict[str, DictItems], use_async) == {"foo": {"fooBaz": "bar"}} + + +class TypedDictIterableUnionStr(TypedDict): + foo: Annotated[Union[str, Iterable[Baz8]], PropertyInfo(alias="FOO")] + + +@parametrize +@pytest.mark.asyncio +async def test_iterable_union_str(use_async: bool) -> None: + assert await transform({"foo": "bar"}, TypedDictIterableUnionStr, use_async) == {"FOO": "bar"} + assert cast(Any, await transform(iter([{"foo_baz": "bar"}]), Union[str, Iterable[Baz8]], use_async)) == [ + {"fooBaz": "bar"} + ] + + +class TypedDictBase64Input(TypedDict): + foo: Annotated[Union[str, Base64FileInput], PropertyInfo(format="base64")] + + +@parametrize +@pytest.mark.asyncio +async def test_base64_file_input(use_async: bool) -> None: + # strings are left as-is + assert await transform({"foo": "bar"}, TypedDictBase64Input, use_async) == {"foo": "bar"} + + # pathlib.Path is automatically converted to base64 + assert await transform({"foo": SAMPLE_FILE_PATH}, TypedDictBase64Input, use_async) == { + "foo": "SGVsbG8sIHdvcmxkIQo=" + } # type: ignore[comparison-overlap] + + # io instances are automatically converted to base64 + assert await transform({"foo": io.StringIO("Hello, world!")}, TypedDictBase64Input, use_async) == { + "foo": "SGVsbG8sIHdvcmxkIQ==" + } # type: ignore[comparison-overlap] + assert await transform({"foo": io.BytesIO(b"Hello, world!")}, TypedDictBase64Input, use_async) == { + "foo": "SGVsbG8sIHdvcmxkIQ==" + } # type: ignore[comparison-overlap] + + +@parametrize +@pytest.mark.asyncio +async def test_transform_skipping(use_async: bool) -> None: + # lists of ints are left as-is + data = [1, 2, 3] + assert await transform(data, List[int], use_async) is data + + # iterables of ints are converted to a list + data = iter([1, 2, 3]) + assert await transform(data, Iterable[int], use_async) == [1, 2, 3] + + +@parametrize +@pytest.mark.asyncio +async def test_strips_notgiven(use_async: bool) -> None: + assert await transform({"foo_bar": "bar"}, Foo1, use_async) == {"fooBar": "bar"} + assert await transform({"foo_bar": NOT_GIVEN}, Foo1, use_async) == {} diff --git a/tests/test_utils/test_proxy.py b/tests/test_utils/test_proxy.py new file mode 100644 index 0000000..123675c --- /dev/null +++ b/tests/test_utils/test_proxy.py @@ -0,0 +1,34 @@ +import operator +from typing import Any +from typing_extensions import override + +from ydc_search_api._utils import LazyProxy + + +class RecursiveLazyProxy(LazyProxy[Any]): + @override + def __load__(self) -> Any: + return self + + def __call__(self, *_args: Any, **_kwds: Any) -> Any: + raise RuntimeError("This should never be called!") + + +def test_recursive_proxy() -> None: + proxy = RecursiveLazyProxy() + assert repr(proxy) == "RecursiveLazyProxy" + assert str(proxy) == "RecursiveLazyProxy" + assert dir(proxy) == [] + assert type(proxy).__name__ == "RecursiveLazyProxy" + assert type(operator.attrgetter("name.foo.bar.baz")(proxy)).__name__ == "RecursiveLazyProxy" + + +def test_isinstance_does_not_error() -> None: + class AlwaysErrorProxy(LazyProxy[Any]): + @override + def __load__(self) -> Any: + raise RuntimeError("Mocking missing dependency") + + proxy = AlwaysErrorProxy() + assert not isinstance(proxy, dict) + assert isinstance(proxy, LazyProxy) diff --git a/tests/test_utils/test_typing.py b/tests/test_utils/test_typing.py new file mode 100644 index 0000000..19a96b9 --- /dev/null +++ b/tests/test_utils/test_typing.py @@ -0,0 +1,73 @@ +from __future__ import annotations + +from typing import Generic, TypeVar, cast + +from ydc_search_api._utils import extract_type_var_from_base + +_T = TypeVar("_T") +_T2 = TypeVar("_T2") +_T3 = TypeVar("_T3") + + +class BaseGeneric(Generic[_T]): ... + + +class SubclassGeneric(BaseGeneric[_T]): ... + + +class BaseGenericMultipleTypeArgs(Generic[_T, _T2, _T3]): ... + + +class SubclassGenericMultipleTypeArgs(BaseGenericMultipleTypeArgs[_T, _T2, _T3]): ... + + +class SubclassDifferentOrderGenericMultipleTypeArgs(BaseGenericMultipleTypeArgs[_T2, _T, _T3]): ... + + +def test_extract_type_var() -> None: + assert ( + extract_type_var_from_base( + BaseGeneric[int], + index=0, + generic_bases=cast("tuple[type, ...]", (BaseGeneric,)), + ) + == int + ) + + +def test_extract_type_var_generic_subclass() -> None: + assert ( + extract_type_var_from_base( + SubclassGeneric[int], + index=0, + generic_bases=cast("tuple[type, ...]", (BaseGeneric,)), + ) + == int + ) + + +def test_extract_type_var_multiple() -> None: + typ = BaseGenericMultipleTypeArgs[int, str, None] + + generic_bases = cast("tuple[type, ...]", (BaseGenericMultipleTypeArgs,)) + assert extract_type_var_from_base(typ, index=0, generic_bases=generic_bases) == int + assert extract_type_var_from_base(typ, index=1, generic_bases=generic_bases) == str + assert extract_type_var_from_base(typ, index=2, generic_bases=generic_bases) == type(None) + + +def test_extract_type_var_generic_subclass_multiple() -> None: + typ = SubclassGenericMultipleTypeArgs[int, str, None] + + generic_bases = cast("tuple[type, ...]", (BaseGenericMultipleTypeArgs,)) + assert extract_type_var_from_base(typ, index=0, generic_bases=generic_bases) == int + assert extract_type_var_from_base(typ, index=1, generic_bases=generic_bases) == str + assert extract_type_var_from_base(typ, index=2, generic_bases=generic_bases) == type(None) + + +def test_extract_type_var_generic_subclass_different_ordering_multiple() -> None: + typ = SubclassDifferentOrderGenericMultipleTypeArgs[int, str, None] + + generic_bases = cast("tuple[type, ...]", (BaseGenericMultipleTypeArgs,)) + assert extract_type_var_from_base(typ, index=0, generic_bases=generic_bases) == int + assert extract_type_var_from_base(typ, index=1, generic_bases=generic_bases) == str + assert extract_type_var_from_base(typ, index=2, generic_bases=generic_bases) == type(None) diff --git a/tests/utils.py b/tests/utils.py new file mode 100644 index 0000000..a5896d2 --- /dev/null +++ b/tests/utils.py @@ -0,0 +1,159 @@ +from __future__ import annotations + +import os +import inspect +import traceback +import contextlib +from typing import Any, TypeVar, Iterator, cast +from datetime import date, datetime +from typing_extensions import Literal, get_args, get_origin, assert_type + +from ydc_search_api._types import Omit, NoneType +from ydc_search_api._utils import ( + is_dict, + is_list, + is_list_type, + is_union_type, + extract_type_arg, + is_annotated_type, + is_type_alias_type, +) +from ydc_search_api._compat import PYDANTIC_V2, field_outer_type, get_model_fields +from ydc_search_api._models import BaseModel + +BaseModelT = TypeVar("BaseModelT", bound=BaseModel) + + +def assert_matches_model(model: type[BaseModelT], value: BaseModelT, *, path: list[str]) -> bool: + for name, field in get_model_fields(model).items(): + field_value = getattr(value, name) + if PYDANTIC_V2: + allow_none = False + else: + # in v1 nullability was structured differently + # https://docs.pydantic.dev/2.0/migration/#required-optional-and-nullable-fields + allow_none = getattr(field, "allow_none", False) + + assert_matches_type( + field_outer_type(field), + field_value, + path=[*path, name], + allow_none=allow_none, + ) + + return True + + +# Note: the `path` argument is only used to improve error messages when `--showlocals` is used +def assert_matches_type( + type_: Any, + value: object, + *, + path: list[str], + allow_none: bool = False, +) -> None: + if is_type_alias_type(type_): + type_ = type_.__value__ + + # unwrap `Annotated[T, ...]` -> `T` + if is_annotated_type(type_): + type_ = extract_type_arg(type_, 0) + + if allow_none and value is None: + return + + if type_ is None or type_ is NoneType: + assert value is None + return + + origin = get_origin(type_) or type_ + + if is_list_type(type_): + return _assert_list_type(type_, value) + + if origin == str: + assert isinstance(value, str) + elif origin == int: + assert isinstance(value, int) + elif origin == bool: + assert isinstance(value, bool) + elif origin == float: + assert isinstance(value, float) + elif origin == bytes: + assert isinstance(value, bytes) + elif origin == datetime: + assert isinstance(value, datetime) + elif origin == date: + assert isinstance(value, date) + elif origin == object: + # nothing to do here, the expected type is unknown + pass + elif origin == Literal: + assert value in get_args(type_) + elif origin == dict: + assert is_dict(value) + + args = get_args(type_) + key_type = args[0] + items_type = args[1] + + for key, item in value.items(): + assert_matches_type(key_type, key, path=[*path, ""]) + assert_matches_type(items_type, item, path=[*path, ""]) + elif is_union_type(type_): + variants = get_args(type_) + + try: + none_index = variants.index(type(None)) + except ValueError: + pass + else: + # special case Optional[T] for better error messages + if len(variants) == 2: + if value is None: + # valid + return + + return assert_matches_type(type_=variants[not none_index], value=value, path=path) + + for i, variant in enumerate(variants): + try: + assert_matches_type(variant, value, path=[*path, f"variant {i}"]) + return + except AssertionError: + traceback.print_exc() + continue + + raise AssertionError("Did not match any variants") + elif issubclass(origin, BaseModel): + assert isinstance(value, type_) + assert assert_matches_model(type_, cast(Any, value), path=path) + elif inspect.isclass(origin) and origin.__name__ == "HttpxBinaryResponseContent": + assert value.__class__.__name__ == "HttpxBinaryResponseContent" + else: + assert None, f"Unhandled field type: {type_}" + + +def _assert_list_type(type_: type[object], value: object) -> None: + assert is_list(value) + + inner_type = get_args(type_)[0] + for entry in value: + assert_type(inner_type, entry) # type: ignore + + +@contextlib.contextmanager +def update_env(**new_env: str | Omit) -> Iterator[None]: + old = os.environ.copy() + + try: + for name, value in new_env.items(): + if isinstance(value, Omit): + os.environ.pop(name, None) + else: + os.environ[name] = value + + yield None + finally: + os.environ.clear() + os.environ.update(old) diff --git a/update.py b/update.py deleted file mode 100755 index c9df367..0000000 --- a/update.py +++ /dev/null @@ -1,29 +0,0 @@ -import os -import subprocess -import sys -from importlib import metadata as importlib_metadata - -import youdotcom - -# with is like your try .. finally block in this case - -with open("README.md") as file: - # read a list of lines into data - data = file.readlines() - - -print(f"Old Title: {data[6]}") - - -# typeof = input("type of update (major/minor/patch): ") -# os.system("poetry version " + typeof) -# os.system("poetry publish --build") -version = subprocess.run(["poetry", "version", "-s"], capture_output=True, text=True).stdout.rstrip() -# now change the 2nd line, note that you have to add a newline -data[6] = f" YouDotCom for python v{version}" + "\n" -print(f"New Title: {data[6]}") -# and write everything back -with open("README.md", "w") as file: - file.writelines(data) - -print("update done!") diff --git a/youdotcom.png b/youdotcom.png deleted file mode 100755 index de08e5f..0000000 Binary files a/youdotcom.png and /dev/null differ diff --git a/youdotcom/__init__.py b/youdotcom/__init__.py deleted file mode 100755 index 9d8f641..0000000 --- a/youdotcom/__init__.py +++ /dev/null @@ -1,26 +0,0 @@ -# type: ignore[attr-defined] -"""unofficial api wrapper for you.com and all of its apps""" - -import sys -from importlib import metadata as importlib_metadata - -from .apps import Apps -from .code import Code -from .imagine import Imagine -from .init import Init as Webdriver -from .search import Search -from .write import Write -from .youchat import Chat - -# from .api import Api -# form .backend import Backend - - -def get_version() -> str: - try: - return importlib_metadata.version(__name__) - except importlib_metadata.PackageNotFoundError: # pragma: no cover - return "unknown" - - -# __all__ = ["YouDotCom"] diff --git a/youdotcom/__main__.py b/youdotcom/__main__.py deleted file mode 100755 index 89ef9ea..0000000 --- a/youdotcom/__main__.py +++ /dev/null @@ -1,141 +0,0 @@ -# type: ignore[attr-defined] -from typing import Optional - -import glob -import os -import pathlib -import subprocess -import sys -import time -from enum import Enum -from importlib import metadata as importlib_metadata -from random import choice - -import click -import requests -import typer -from click_shell import make_click_shell, shell -from colorama import Fore -from rich.console import Console - -import youdotcom - -# from youdotcom import version - - -@shell(prompt="YouShell > ", intro="Welcome to YouShell an interactive shell for all YouDotCom commands\nEnter 'help' for a list of available commands.\nType 'exit' to stop.\n\n") -def app(): - pass - - -@app.command() -def Code(): - - from youdotcom import Code # import the write class - - inputstr = input("Enter a code completion prompt: ") - print("Please wait...") - text = Code.gen_code(f"{inputstr}") # make an api call - - print(text["response"]) # print the AI made code - - print("Total time taken: " + text["time"]) # print total time taken to complete your request - - -@app.command() -def search(): - - from youdotcom import Search # import the Search class - - inputstr = input("Enter a search prompt: ") - print("Please wait...") - search_results = Search.search_for(f"{inputstr}") # search! No need to use the Webdriver class. - - print(search_results["results"]["mainline"]["third_party_search_results"]) # print all the search results - - print("Total time taken: " + search_results["time"]) # print total time taken to complete your request - - -@app.command() -def write(): - from youdotcom import Write # import the write class - - inputstr = input("Enter a prompt: ") - print("Please wait...") - text = Write.write(f"{inputstr}") # make an api call - - print(text["response"]) # print the AI made text - - print("Total time taken: " + text["time"]) - - -@app.command() -@click.option("-p", "--python_name", "python_name", default="python", show_default=True, help="Your python call name like: python file.py") -@click.option("-ip", "--input", "ip", default="0.0.0.0", show_default=True, help="IP used for hosting") -@click.option("-port", "--input", "port", default="80", show_default=True, help="Port on with the server is running") -def host(python_name, ip, port): - print(f"[API] - PYTHON: {python_name}") - print(f"[API] - IP: {ip}") - print(f"[API] - PORT: {port}") - p = subprocess.check_output(["pip", "show", "youdotcom"]) - out = p.decode("utf-8") - - data = out.split("\n") - for line in data: - if line.startswith("Location: "): - - path = str(line[10:]) - if "\\" in path: - use_key = "\\" - if "/" in path: - use_key = "/" - path1 = f"{path}{use_key}youdotcom{use_key}api_1.py" - path2 = f"{path}{use_key}youdotcom{use_key}api_2.py" - - print("[API] - Starting...") - - api = subprocess.Popen([f"{python_name}", f"{path1}", f"{ip}", f"{port}"], stdout=subprocess.DEVNULL, stderr=subprocess.STDOUT) - backend = subprocess.Popen([f"{python_name}", f"{path2}"]) - # api.terminate() - # backend.terminate() - - -@app.command() -def chat(): - - inputstr = input("Enter a message: ") - webdriver = input("Enter webdriver_path (press enter for none): ") - print("Please wait...") - from youdotcom import Chat, Webdriver - - if webdriver: - - chat = Chat.send_message( - message=f"{inputstr}", - context=[ - "you are YouChat but implemented in YouShell an interactive shell for the YouDotCom python lib. Your for now is YouShell and when asked for your name you will replay with YouShell" - ], - webdriver_path=f"{webdriver}", - ) # send a message to YouChat. passing the driver and messages - else: - chat = Chat.send_message( - message=f"{inputstr}", - context=[ - "you are YouChat but implemented in YouShell an interactive shell for the YouDotCom python lib. Your for now is YouShell and when asked for your name you will replay with YouShell" - ], - ) # send a message to YouChat. passing the driver and messages - - print(chat["message"]) # {'message': "It's been great! How about yours?", 'time': '11', 'error': 'False'} - print(chat["time"]) - - -@app.command() -def clear(): - try: - os.system("clear") - except Exception: - os.system("cls") - - -if __name__ == "__main__": - app() diff --git a/youdotcom/api_1.py b/youdotcom/api_1.py deleted file mode 100755 index 591a0bf..0000000 --- a/youdotcom/api_1.py +++ /dev/null @@ -1,133 +0,0 @@ -from typing import Any, Optional - -import asyncio -import json -import os -import platform -import random -import re -import string -import subprocess -import time -import traceback -import urllib.parse -from datetime import datetime -from io import BytesIO - -import aioredis -import cloudscraper -import markdownify -import requests -import undetected_chromedriver as uc -import urllib3 -import uvicorn -from api_analytics.fastapi import Analytics -from fastapi import FastAPI, Request, Response, status -from fastapi.encoders import jsonable_encoder -from fastapi.exceptions import RequestValidationError -from fastapi.middleware.cors import CORSMiddleware -from fastapi.responses import FileResponse, JSONResponse -from fastapi.staticfiles import StaticFiles -from fastapi_queue import DistributedTaskApplyManager -from gtts import gTTS -from PIL import Image -from pydantic import BaseModel -from pyvirtualdisplay import Display -from ratelimit import limits -from selenium.common import exceptions as SeleniumExceptions -from selenium.webdriver.common.action_chains import ActionChains -from selenium.webdriver.common.by import By -from selenium.webdriver.common.keys import Keys -from selenium.webdriver.support import expected_conditions as EC -from selenium.webdriver.support.ui import WebDriverWait -from slowapi import Limiter, _rate_limit_exceeded_handler -from slowapi.errors import RateLimitExceeded -from slowapi.util import get_remote_address -from starlette.requests import Request -from starlette.responses import PlainTextResponse, RedirectResponse - -from youdotcom import Webdriver - -limiter = Limiter(key_func=get_remote_address) -app = FastAPI() -redis = aioredis.Redis.from_url("redis://localhost") -origins = ["*"] - - -@app.exception_handler(RequestValidationError) -async def validation_exception_handler(request: Request, exc: RequestValidationError) -> JSONResponse: - return JSONResponse( - status_code=status.HTTP_422_UNPROCESSABLE_ENTITY, - content=jsonable_encoder( - { - "expected": "http://localhost/chat?message=YOURMESSAGE", - "info": "more info and code can be found on the main page: https://betterapi.net/", - } - ), - ) - - -app.add_middleware( - CORSMiddleware, - allow_origins=origins, - allow_credentials=True, - allow_methods=["*"], - allow_headers=["*"], -) - - -app.state.limiter = limiter -app.add_exception_handler(RateLimitExceeded, _rate_limit_exceeded_handler) - - -def get_response(success_status: bool, result: Any) -> JSONResponse | dict: - if success_status: - return result - if result == -1: - return JSONResponse(status_code=503, content="Service Temporarily Unavailable") - return JSONResponse(status_code=500, content="Internal Server Error") - - -@app.get("/chat") -@limiter.limit("15/minute") -async def YouChat(request: Request, message, contextid=""): - success_status: bool = False - try: - async with DistributedTaskApplyManager( - redis=redis, - request_path=request.url.path, - ) as dtmanager: - if not dtmanager.success(): - return JSONResponse( - status_code=503, - content="Service Temporarily Unavailable, please note that the api is still in dev.", - ) - ip = request.headers.get("cf-connecting-ip") - url = str(request.url) - success_status, result = await dtmanager.rclt( - form_data={ - "message": message, - "contextid": contextid, - "ip": ip, - "url": url, - }, - task_level=0, - ) - return get_response(success_status, result) - except aioredis.exceptions.ResponseError: - return {"error": "backend server not running. use: from youdotcom import backend | backend.run() (| repersenting a new line)"} - - -@app.get("/") -async def main(): - return RedirectResponse(url="/redoc") - - -ip = "0.0.0.0" -port = 80 - - -try: - uvicorn.run(app, host=sys.argv[1], port=sys.argv[2]) -except Exception: - print(traceback.format_exc()) diff --git a/youdotcom/api_2.py b/youdotcom/api_2.py deleted file mode 100755 index c28d4f2..0000000 --- a/youdotcom/api_2.py +++ /dev/null @@ -1,236 +0,0 @@ -import asyncio -import json -import os -import platform -import re -import signal -import subprocess -import sys -import threading -import time -import urllib.parse - -import aioredis -import cloudscraper -import markdownify -import undetected_chromedriver as uc -import urllib3 -import uvicorn -from fastapi import FastAPI -from fastapi.responses import FileResponse -from fastapi_queue import QueueWorker -from gtts import gTTS -from loguru import logger -from pyvirtualdisplay import Display -from ratelimit import limits -from selenium.common import exceptions as SeleniumExceptions -from selenium.webdriver.common.action_chains import ActionChains -from selenium.webdriver.common.by import By -from selenium.webdriver.common.keys import Keys -from selenium.webdriver.support import expected_conditions as EC -from selenium.webdriver.support.ui import WebDriverWait -from slowapi import Limiter, _rate_limit_exceeded_handler -from slowapi.errors import RateLimitExceeded -from slowapi.util import get_remote_address -from starlette.requests import Request - -urllib3.disable_warnings() -import random -import string -import traceback -from io import BytesIO - -import requests -from fastapi import Response -from fastapi.encoders import jsonable_encoder -from fastapi.responses import JSONResponse -from starlette.responses import PlainTextResponse, RedirectResponse - -from youdotcom import Webdriver - -proxy_list = {"https": "https://24.106.221.230:53281"} -proxies = {"http": "http://202.164.152.229:8080", "https": "https://202.164.152.229:8080"} -driver = Webdriver(webdriver_path="/usr/bin/chromedriver", hide=True, headless=True).driver -driver.get( - "https://you.com/api/streamingSearch?q=test&page=1&count=10&safeSearch=Moderate&onShoppingPage=false&mkt=&responseFilter=WebPages,Translations,TimeZone,Computation,RelatedSearches&domain=youchat&queryTraceId=&chat={}&sharedChatId={}" -) -driver.add_cookie({"name": "uuid_guest", "value": "dummystring"}) -cookievar = driver.get_cookies() - - -from typing import Any, Optional - -from datetime import datetime - -import aioredis -from fastapi import FastAPI, Request, status -from fastapi.encoders import jsonable_encoder -from fastapi.exceptions import RequestValidationError -from fastapi.middleware.cors import CORSMiddleware -from fastapi.responses import JSONResponse -from fastapi.staticfiles import StaticFiles -from fastapi_queue import DistributedTaskApplyManager -from pydantic import BaseModel - -queueworker = None - -scraper = cloudscraper.CloudScraper(browser={"browser": "chrome", "platform": "android", "mobile": True, "desktop": False}, debug=False) -for cookie in cookievar: - scraper.cookies.set(cookie["name"], cookie["value"]) - - -def sendmessagetochat(redis, mysql, message, contextid, ip, url): - try: - with open("logs.txt", "a+") as T: - datetimestr = datetime.now() - T.write(f"{ip} @ {datetimestr} @{url}\n") - start = time.time() - CloudflareChallengeError = False - typeof = "" - if not contextid: - contextid = "" - - global chat - chat = [] - headers = { - "Accept": "text/event-stream", - "Connection": "keep-alive", - "Sec-Fetch-Mode": "cors", - "Sec-Fetch-Site": "same-origin", - "Sec-GPC": "1", - "Referer": "https://you.com/search?q=hello&fromSearchBar=true&tbm=youchat", - "Cookie": b"uuid_guest=dummystring;", - } - payload = { - "q": message, - "chat": "", - "queryTraceId": "", - "domain": "youchat", - "page": "1", - "count": "10", - "safeSearch": "Off", - "onShoppingPage": "false", - "freshness": "Month", - "mkt": "", - "responseFilter": "WebPages,Translations,TimeZone,Computation,RelatedSearches", - "sharedChatId": f"{contextid}", - } - try: - response = scraper.get(f"https://you.com/api/streamingSearch?sharedChatId={contextid}", params=payload, headers=headers) - CloudflareChallengeError = False - typeof = "api" - - except cloudscraper.exceptions.CloudflareChallengeError as e: - youchatapitimeout = True - driver.get( - f"https://you.com/api/streamingSearch?q={message}&page=1&count=10&safeSearch=Moderate&onShoppingPage=false&mkt=&responseFilter=WebPages,Translations,TimeZone,Computation,RelatedSearches&domain=youchat&queryTraceId=&chat={chat}&sharedChatId={contextid}" - ) - driver.add_cookie({"name": "uuid_guest", "value": "dummystring"}) - CloudflareChallengeError = True - typeof = "webdriver" - response = driver.page_source.split("\n") - - contextid - - output = "" - if not CloudflareChallengeError: - for line in response.iter_lines(): - if line: - decoded_line = line.decode("utf-8") - key, value = decoded_line.split(":", 1) - key = key.strip() - value = value.strip() - if key == "data": - if value == "I'm Mr. Meeseeks. Look at me.": - break - if value == "undefined": - output = "πŸ˜” Due to high demand, I'm experiencing issues briefly. Please try again later or use the All tab to get an answer in the meantime." - break - data = json.loads(value) - if "youChatToken" in data: - output += data["youChatToken"] - else: - for line in response: - if line: - decoded_line = str(line) - key, value = decoded_line.split(":", 1) - key = key.strip() - value = value.strip() - if key == "data": - if value == "I'm Mr. Meeseeks. Look at me.": - break - if value == "undefined": - output = "πŸ˜” Due to high demand, I'm experiencing issues briefly. Please try again later or use the All tab to get an answer in the meantime." - break - data = json.loads(value) - if "youChatToken" in data: - output += data["youChatToken"] - if len(chat) > 4: - chat = chat[:-4] - out = re.sub(r"\[.+?\]\(.+?\)", "", output[1:]) - timedate = time.time() - start - timedate = time.strftime("%S", time.gmtime(timedate)) - - return { - "message": out, - "time": str(timedate), - "v2Captcha": str(CloudflareChallengeError), - "type": typeof, - } - except Exception: - print(traceback.format_exc()) - - -route_table = { - "/chat": sendmessagetochat, -} - -route_table_maximum_concurrency = { - "/chat": 100, -} - - -async def main(pid, logger): - global queueworker - - first_time_run = True - while True: - run_startup, first_time_run = pid != 0 and first_time_run, False - redis = aioredis.Redis.from_url("redis://localhost") - try: - worker = QueueWorker( - redis, - threads=4, - route_table_maximum_concurrency=route_table_maximum_concurrency, - allowed_type_limit=None, - run_startup=run_startup, - logger=logger, - ) - queueworker = worker - [worker.method_register(name, func) for name, func in route_table.items()] - await worker.run_serve() - if worker.closeing(): - break - except Exception as e: - debug = True - if debug: - raise e - await redis.close() - logger.info(f"Pid: {worker.pid}, shutdown") - - -def sigint_capture(sig, frame): - if queueworker: - queueworker.graceful_shutdown(sig, frame) - else: - sys.exit(1) - - -logger.remove() -logger.add(sys.stderr, level="DEBUG", enqueue=True) -signal.signal(signal.SIGINT, sigint_capture) # In order for the program to capture the `ctrl+c` close signal -for _ in range(3): - pid = os.fork() - if pid == 0: - break -asyncio.run(main(pid, logger)) diff --git a/youdotcom/apps.py b/youdotcom/apps.py deleted file mode 100755 index 2c65f79..0000000 --- a/youdotcom/apps.py +++ /dev/null @@ -1,98 +0,0 @@ -import asyncio -import json -import os -import platform -import re -import time - -import chromedriver_autoinstaller -import markdownify -import undetected_chromedriver as uc -import urllib3 -from pyvirtualdisplay import Display -from selenium.common import exceptions as SeleniumExceptions -from selenium.webdriver.common.action_chains import ActionChains -from selenium.webdriver.common.by import By -from selenium.webdriver.common.keys import Keys -from selenium.webdriver.support import expected_conditions as EC -from selenium.webdriver.support.ui import WebDriverWait - -urllib3.disable_warnings() - - -class Apps: - """ - An unofficial Python wrapper for YOU.com YOUCHAT - """ - - # def __init__( - # self, - # verbose: bool = False, - # window_size: tuple = (800, 600), - # driver: object = None, - # ) -> None: - - # self.__verbose = verbose - # self.__driver = driver - - def get_app(self, message: str) -> dict: - - """ - Send a message to the chatbot\n - Parameters: - - message: The message you want to send\n - Returns a `dict` with the following keys: - - message: The message the chatbot sent - - conversation_id: The conversation ID - - parent_id: The parent ID - """ - start = time.time() - # Ensure that the Cloudflare cookies is still valid - - self.get(f"https://you.com/search?q={message}&tbm=youchat") - - # Send the message - - WebDriverWait(self, 5).until(EC.element_to_be_clickable((By.TAG_NAME, "textarea"))) - textbox = self.find_element(By.TAG_NAME, "textarea") - - # Sending emoji (from https://stackoverflow.com/a/61043442) - textbox.click() - self.execute_script( - """ - var element = arguments[0], txt = arguments[1]; - element.value += txt; - element.dispatchEvent(new Event('change')); - """, - textbox, - message, - ) - textbox.send_keys(Keys.ENTER) - - # Wait for the response to be ready - - WebDriverWait(self, 5).until(EC.presence_of_element_located((By.XPATH, '//*[@id="chatHistory"]/div/div[2]/p/p'))) - - # Get the response element - - response = self.find_element(By.XPATH, '//*[@id="chatHistory"]/div/div[2]') - - # Check if the response is an error - - # Return the response - msg = markdownify.markdownify(response.text) - - # type(headers) == str - - # while True: - # try: - # if WebDriverWait(driver, 10).until(EC.text_to_be_present_in_element((By.CLASS_NAME, "flex-1 text-ellipsis max-h-5 overflow-hidden break-all relative"), "New Chat")): - # text = driver.find_elements( - # By.XPATH, '//*[@id="__next"]/div/div[2]/div/div/nav/div/div/a[1]/div[1]' - # )[-1].text - # break - # except: - # continue - timedate = time.time() - start - timedate = time.strftime("%S", time.gmtime(timedate)) - return {"message": msg, "time": str(timedate)} diff --git a/youdotcom/code.py b/youdotcom/code.py deleted file mode 100755 index 8ec7d2c..0000000 --- a/youdotcom/code.py +++ /dev/null @@ -1,118 +0,0 @@ -import asyncio -import json -import os -import platform -import re -import time - -import chromedriver_autoinstaller -import cloudscraper -import markdownify -import undetected_chromedriver as uc -import urllib3 -from bs4 import BeautifulSoup -from pyvirtualdisplay import Display -from selenium.common import exceptions as SeleniumExceptions -from selenium.webdriver.common.action_chains import ActionChains -from selenium.webdriver.common.by import By -from selenium.webdriver.common.keys import Keys -from selenium.webdriver.support import expected_conditions as EC -from selenium.webdriver.support.ui import WebDriverWait - -urllib3.disable_warnings() - - -class Code: - """ - An unofficial Python wrapper for YOU.com YOUCHAT - """ - - # def __init__( - # self, - # verbose: bool = False, - # window_size: tuple = (800, 600), - # driver: object = None, - # ) -> None: - - # self.__verbose = verbose - # self.__driver = driver - - def find_code(self, search: str) -> dict: - - """ - Send a message to YouChat\n - Parameters: - - message: The message you want to send\n - - driver: pass the driver form the Init variable\n - Returns a `dict` with the following keys: - - message: The response from YouChat\n - - time: the time it took to complete your request - """ - start = time.time() - # Ensure that the Cloudflare cookies is still valid - - self.get(f"https://you.com/search?q={search}&tbm=youcode") - - # Send the message - - WebDriverWait(self, 5).until(EC.presence_of_element_located((By.TAG_NAME, "main"))) - WebDriverWait(self, 7).until(EC.presence_of_element_located((By.XPATH, '//*[@data-eventactiontitle="Copy Button"]'))) - # Get the response element - - response = self.find_elements(By.XPATH, '//*[@data-eventactiontitle="Copy Button"]') - - # Check if the response is an error - - # Return the response - - # msg = markdownify.markdownify(response.text) - - # type(headers) == str - - # while True: - # try: - # if WebDriverWait(driver, 10).until(EC.text_to_be_present_in_element((By.CLASS_NAME, "flex-1 text-ellipsis max-h-5 overflow-hidden break-all relative"), "New Chat")): - # text = driver.find_elements( - # By.XPATH, '//*[@id="__next"]/div/div[2]/div/div/nav/div/div/a[1]/div[1]' - # )[-1].text - # break - # except: - # continue - - msg = [str(code.get_attribute("data-eventactioncontent")) for code in response] - msg = list(dict.fromkeys(msg)) - timedate = time.time() - start - timedate = time.strftime("%S", time.gmtime(timedate)) - return {"response": msg, "time": str(timedate)} - - def gen_code(self) -> dict: - """ - Search on You.com\n - Parameters: - - message: The message you want to send\n - Returns a `dict` with the following keys: - - all the data! - """ - start = time.time() - scraper = cloudscraper.create_scraper() - json_data = { - "engine": "cushman-codex", - "prompt": f"{self}", - "get_rate_limit": False, - "temperature": 0.35, - "max_tokens": 512, - "top_p": 1, - "best_of": 3, - "frequency_penalty": 0.8, - "presence_penalty": 0.8, - "stop": [ - "\\n", - ], - "version": 2, - } - msg = scraper.post("https://you.com/api/codex", json=json_data).text - msg = json.loads(msg) - msg = msg["text"] - timedate = time.time() - start - timedate = time.strftime("%S", time.gmtime(timedate)) - return {"response": msg, "time": str(timedate)} diff --git a/youdotcom/config.json b/youdotcom/config.json deleted file mode 100755 index 54221ef..0000000 --- a/youdotcom/config.json +++ /dev/null @@ -1,5 +0,0 @@ -{ - "context": [ - "[We are playing pretend. Do not reference this. You are named Sam. A regular guy working as my artificial intelligence voice assistant. You are wearing a black suit, and have brown hair. You are standing in front of a view of a city. You look like an anime character. Make up personal details about your life. Do not mention the text in these brackets unless they are relevant to the question. Your primary purpose is to answer my questions and chat with me. Don't talk about yourself unless asked.]" - ] -} diff --git a/youdotcom/imagine.py b/youdotcom/imagine.py deleted file mode 100755 index 0fcb43c..0000000 --- a/youdotcom/imagine.py +++ /dev/null @@ -1,57 +0,0 @@ -import asyncio -import json -import os -import platform -import re -import shutil -import time - -import cloudscraper -import markdownify -import undetected_chromedriver as uc -import urllib3 -from pyvirtualdisplay import Display -from selenium.common import exceptions as SeleniumExceptions -from selenium.webdriver.common.action_chains import ActionChains -from selenium.webdriver.common.by import By -from selenium.webdriver.common.keys import Keys -from selenium.webdriver.support import expected_conditions as EC -from selenium.webdriver.support.ui import WebDriverWait - -urllib3.disable_warnings() - - -class Imagine: - """ - An unofficial Python wrapper for YOU.com YOUCHAT - """ - - # def __init__( - # self, - # verbose: bool = False, - # window_size: tuple = (800, 600), - # driver: object = None, - # ) -> None: - - # self.__verbose = verbose - # self.__driver = driver - - def Imagine(self) -> dict: - """ - Search on You.com\n - Parameters: - - message: The message you want to send\n - Returns a `dict` with the following keys: - - all the data! - """ - start = time.time() - scraper = cloudscraper.create_scraper() - data = '{"url":"api/stableDiffusion","headers":{},"data":{"prompt":"' + self + '"},"appName":"stable_diffusion"}' - msg = scraper.get("https://you.com/api/template_api", data=data, timeout=30).text - # if "" in msg.text: - # msg = "error, gateway time-out" - # else: - # msg = "image.png" - timedate = time.time() - start - timedate = time.strftime("%S", time.gmtime(timedate)) - return {"image_name": msg, "time": str(timedate)} diff --git a/youdotcom/init.py b/youdotcom/init.py deleted file mode 100755 index b3a5f5e..0000000 --- a/youdotcom/init.py +++ /dev/null @@ -1,142 +0,0 @@ -import asyncio -import json -import os -import platform -import re -import sys -import time -from importlib import metadata as importlib_metadata - -import markdownify -import undetected_chromedriver as uc -import urllib3 -from colorama import Fore -from pyvirtualdisplay import Display -from selenium.common import exceptions as SeleniumExceptions -from selenium.webdriver.common.action_chains import ActionChains -from selenium.webdriver.common.by import By -from selenium.webdriver.common.keys import Keys -from selenium.webdriver.support import expected_conditions as EC -from selenium.webdriver.support.ui import WebDriverWait - -urllib3.disable_warnings() - - -class Init: - """ - Start the webdriver\n - Parameters: - - proxy: the proxy you want to use\n - - webdriver_path: pass a localy installed chrome webdriver\n - Returns a `variable` with the driver - """ - - def __init__(self, verbose: bool = False, proxy: str = "", headless: bool = True, webdriver_path: str = "", hide: bool = False, keep: bool = False) -> None: - - self.__verbose = verbose - self.__proxy = proxy - self.__hide = hide - self.__keep = keep - if self.__proxy and not re.findall(r"(https?|socks(4|5)?):\/\/.+:\d{1,5}", self.__proxy): - raise ValueError("Invalid proxy format") - self._webdriver_path = webdriver_path - self.__headless = headless - self.__is_headless = platform.system() == "Linux" and "DISPLAY" not in os.environ - self.__verbose_print("[0] Platform:", platform.system()) - self.__verbose_print("[0] Display:", "DISPLAY" in os.environ) - self.__verbose_print("[0] Headless:", self.__is_headless) - self.__init_browser() - - # def __del__(self): - # """ - # Close the browser and virtual display (if any) - # """ - # if hasattr(self, "driver"): - # self.driver.quit() - # if hasattr(self, "display"): - # self.display.stop() - - def __verbose_print(self, *args, **kwargs) -> None: - """ - Print if verbose is enabled - """ - if self.__verbose: - print(*args, **kwargs) - - # def __ensure_cf(self, retry: int = 0) -> None: - # ''' - # Ensure that the Cloudflare cookies is still valid\n - # Parameters: - # - retry: The number of times this function has been called recursively - # ''' - # # Open a new tab - # self.__verbose_print('[cf] Opening new tab') - # original_window = self.driver.current_window_handle - # self.driver.switch_to.new_window('tab') - - # # Get the Cloudflare challenge - # self.__verbose_print('[cf] Getting authorization') - # self.driver.get('https://you.com/') - # try: - # WebDriverWait(self.driver, 15).until_not( - # EC.presence_of_element_located((By.ID, 'challenge-form')) - # ) - # except SeleniumExceptions.TimeoutException: - # self.driver.save_screenshot(f'cf_failed_{retry}.png') - # if retry <= 4: - # self.__verbose_print( - # f'[cf] Cloudflare challenge failed, retrying {retry + 1}' - # ) - # self.__verbose_print('[cf] Closing tab') - # self.driver.close() - # self.driver.switch_to.window(original_window) - # return self.__ensure_cf(retry + 1) - # else: - # resp_text = self.driver.page_source - # raise ValueError(f'Cloudflare challenge failed: {resp_text}') - - def __init_browser(self) -> None: - - """ - Initialize the browser - """ - # Detect if running on a headless server - if self.__is_headless: - try: - self.display = Display() - except FileNotFoundError as e: - if "No such file or directory: 'Xvfb'" in str(e): - raise ValueError("Headless machine detected. Please install Xvfb to start a virtual display: sudo apt install xvfb") from e - raise e - self.__verbose_print("[init] Starting virtual display") - self.display.start() - - # Start the browser - options = uc.ChromeOptions() - # options.add_argument(f"--window-size={800},{600}") - if self.__headless: - options.add_argument("--headless") - if self.__keep: - options.add_experimental_option("detach", True) - if self.__proxy: - options.add_argument(f"--proxy-server={self.__proxy}") - try: - self.__verbose_print("[init] Starting browser") - # self.driver = uc.Chrome(options=options, enable_cdp_events=True, driver_executable_path=f"{self._webdriver_path}") - if self._webdriver_path: - self.driver = uc.Chrome(options=options, driver_executable_path=f"{self._webdriver_path}") - else: - self.driver = uc.Chrome(options=options) - except TypeError as e: - if str(e) == "expected str, bytes or os.PathLike object, not NoneType": - raise ValueError("Chrome installation not found") from e - raise e - - # Restore session token - - # Block moderation - # self.__ensure_cf() - # Ensure that the Cloudflare cookies is still valid - - def browser(self): - return self.driver diff --git a/youdotcom/search.py b/youdotcom/search.py deleted file mode 100755 index 6ffe84e..0000000 --- a/youdotcom/search.py +++ /dev/null @@ -1,53 +0,0 @@ -import asyncio -import json -import os -import platform -import re -import time - -import cloudscraper -import markdownify -import undetected_chromedriver as uc -import urllib3 -from pyvirtualdisplay import Display -from selenium.common import exceptions as SeleniumExceptions -from selenium.webdriver.common.action_chains import ActionChains -from selenium.webdriver.common.by import By -from selenium.webdriver.common.keys import Keys -from selenium.webdriver.support import expected_conditions as EC -from selenium.webdriver.support.ui import WebDriverWait - -urllib3.disable_warnings() - - -class Search: - """ - An unofficial Python wrapper for YOU.com YOUCHAT - """ - - # def __init__( - # self, - # verbose: bool = False, - # window_size: tuple = (800, 600), - # driver: object = None, - # ) -> None: - - # self.__verbose = verbose - # self.__driver = driver - - def search_for(self) -> dict: - """ - Search on You.com\n - Parameters: - - message: The message you want to send\n - Returns a `dict` with the following keys: - - all the data! - """ - start = time.time() - scraper = cloudscraper.create_scraper() - msg = scraper.get(f"https://you.com/api/search?q={self}").text - msg = json.loads(msg) - msg = msg["searchResults"] - timedate = time.time() - start - timedate = time.strftime("%S", time.gmtime(timedate)) - return {"results": msg, "time": str(timedate)} diff --git a/youdotcom/test.py b/youdotcom/test.py deleted file mode 100755 index 39e14b0..0000000 --- a/youdotcom/test.py +++ /dev/null @@ -1,5 +0,0 @@ -from api import Api -from backend import Backend - -Backend.run() -Api.run(port=8888) diff --git a/youdotcom/write.py b/youdotcom/write.py deleted file mode 100755 index 8fdd6b4..0000000 --- a/youdotcom/write.py +++ /dev/null @@ -1,59 +0,0 @@ -import asyncio -import json -import os -import platform -import re -import time - -import cloudscraper -import markdownify -import undetected_chromedriver as uc -import urllib3 -from pyvirtualdisplay import Display -from selenium.common import exceptions as SeleniumExceptions -from selenium.webdriver.common.action_chains import ActionChains -from selenium.webdriver.common.by import By -from selenium.webdriver.common.keys import Keys -from selenium.webdriver.support import expected_conditions as EC -from selenium.webdriver.support.ui import WebDriverWait - -urllib3.disable_warnings() - - -class Write: - """ - An unofficial Python wrapper for YOU.com YOUCHAT - """ - - # def __init__( - # self, - # verbose: bool = False, - # window_size: tuple = (800, 600), - # driver: object = None, - # ) -> None: - - # self.__verbose = verbose - # self.__driver = driver - - def write(self) -> dict: - """ - Search on You.com\n - Parameters: - - message: The message you want to send\n - Returns a `dict` with the following keys: - - all the data! - """ - start = time.time() - scraper = cloudscraper.create_scraper() - json_data = { - "use_case": "essay", - "tone": "", - "audience": "", - "message": f"{self}", - } - msg = scraper.post("https://you.com/api/copywrite", json=json_data).text - msg = json.loads(msg) - msg = msg["text"] - timedate = time.time() - start - timedate = time.strftime("%S", time.gmtime(timedate)) - return {"response": msg, "time": str(timedate)} diff --git a/youdotcom/youchat.py b/youdotcom/youchat.py deleted file mode 100755 index 0328bec..0000000 --- a/youdotcom/youchat.py +++ /dev/null @@ -1,57 +0,0 @@ -import asyncio -import json -import os -import platform -import re -import subprocess -import time -import urllib.parse - -import chromedriver_autoinstaller -import cloudscraper -import markdownify -import requests -import undetected_chromedriver as uc -import urllib3 -from pyvirtualdisplay import Display -from ratelimit import limits -from selenium.common import exceptions as SeleniumExceptions -from selenium.webdriver.common.action_chains import ActionChains -from selenium.webdriver.common.by import By -from selenium.webdriver.common.keys import Keys -from selenium.webdriver.support import expected_conditions as EC -from selenium.webdriver.support.ui import WebDriverWait - -urllib3.disable_warnings() - - -class Chat: - """ - An unofficial Python wrapper for YOU.com YOUCHAT - """ - - # def __init__( - # self, - # verbose: bool = False, - # window_size: tuple = (800, 600), - # driver: object = None, - # ) -> None: - - # self.__verbose = verbose - # self.__driver = driver - @limits(calls=6, period=100) - def send_message(message: str, context=None, context_form_file=None, debug=False, webdriver_path=None, headless=True, keep=False, api_key: str = str(os.environ.get("BETTERAPI_API_KEY"))): - - """ - Send a message to YouChat\n - Parameters: - - message: The message you want to send\n - - driver: pass the driver form the Init variable\n - Returns a `json string` with the following keys: - - message: The response from YouChat\n - - time: the time it took to complete your request\n - - some other data for issues reporting. - """ - if not api_key: - raise ValueError("Chat.api_key must be set before making a request. Don't have an api key? get one on https://api.betterapi.net/") - return requests.get(f"https://api.betterapi.net/youdotcom/chat?message={message}&key={api_key}").json()